move ifxmips uboot to package/

SVN-Revision: 11601

81 files changed, 23926 insertions, 0 deletions

diff --git a/package/uboot-ifxmips/Makefile b/package/uboot-ifxmips/Makefile
new file mode 100644
index 0000000..7895502
--- /dev/null
+++ b/package/uboot-ifxmips/Makefile
@@ -0,0 +1,47 @@
+#
+# Copyright (C) 2008 OpenWrt.org
+#
+# This is free software, licensed under the GNU General Public License v2.
+# See /LICENSE for more information.
+#
+
+include $(TOPDIR)/rules.mk
+include $(INCLUDE_DIR)/kernel.mk
+
+PKG_NAME:=u-boot
+PKG_VERSION:=1.1.5
+PKG_RELEASE:=1
+
+PKG_BUILD_DIR:=$(KERNEL_BUILD_DIR)/$(PKG_NAME)-$(PKG_VERSION)
+PKG_SOURCE:=$(PKG_NAME)-$(PKG_VERSION).tar.bz2
+PKG_SOURCE_URL:=ftp://ftp.denx.de/pub/u-boot
+PKG_MD5SUM:=579707c8ecbf1ab4127285d2aac2a9ee
+PKG_CAT:=bzcat
+PKG_TARGETS:=bin
+
+include $(INCLUDE_DIR)/package.mk
+
+define Package/uboot-ifxmips
+  SECTION:=boot
+  CATEGORY:=Boot Loaders
+  DEPENDS:=@TARGET_ifxmips
+  TITLE:=U-Boot for Infineon MIPS boards
+  URL:=http://www.denx.de/wiki/UBoot/WebHome
+endef
+
+define Build/Prepare
+	$(call Build/Prepare/Default)
+	cp -r ./files/* $(PKG_BUILD_DIR)
+	find $(PKG_BUILD_DIR) -name .svn | $(XARGS) rm -rf
+endef
+
+define Build/Compile
+	cd $(PKG_BUILD_DIR);chmod a+x build_danube.sh;./build_danube.sh
+endef
+
+define Package/uboot-ifxmips/install
+	mkdir -p $(1)
+	dd if=$(PKG_BUILD_DIR)/u-boot.ifx of=$(1)/u-boot.ifx bs=64k conv=sync
+endef
+
+$(eval $(call BuildPackage,uboot-ifxmips))
diff --git a/package/uboot-ifxmips/files/board/danube/Makefile b/package/uboot-ifxmips/files/board/danube/Makefile
new file mode 100644
index 0000000..0163fd9
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/Makefile
@@ -0,0 +1,41 @@
+#
+# (C) Copyright 2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= lib$(BOARD).a
+
+OBJS	= $(BOARD).o flash.o
+SOBJS	= lowlevel_init.o pmuenable.o
+
+$(LIB):	.depend $(OBJS) $(SOBJS)
+	$(AR) crv $@ $^
+
+#########################################################################
+
+.depend:	Makefile $(SOBJS:.o=.S) $(OBJS:.o=.c)
+		$(CC) -M $(CFLAGS) $(SOBJS:.o=.S) $(OBJS:.o=.c) > $@
+
+sinclude .depend
+
+#########################################################################
diff --git a/package/uboot-ifxmips/files/board/danube/README b/package/uboot-ifxmips/files/board/danube/README
new file mode 100644
index 0000000..d1c5c1e
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/README
@@ -0,0 +1,55 @@
+/*
+** Copyright (C) 2005 Wu Qi Ming <Qi-Ming.Wu@infineon.com>
+**  
+** This program is free software; you can redistribute it and/or modify
+** it under the terms of the GNU General Public License as published by
+** the Free Software Foundation; either version 2 of the License, or
+** (at your option) any later version.
+** 
+** This program is distributed in the hope that it will be useful,
+** but WITHOUT ANY WARRANTY; without even the implied warranty of
+** MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+** GNU General Public License for more details.
+** 
+** You should have received a copy of the GNU General Public License
+** along with this program; if not, write to the Free Software 
+** Foundation, Inc., 59 Temple Place - Suite 330, Boston, MA 02111-1307, USA.
+*/
+
+To build a u-boot for danube board, user need to do the following things:
+To configure u-boot for a proper board, user need to modify two files accordingly.
+
+To configure u-boot for evaluation board, in danube-uboot/include/configs/danube.h, set
+#define USE_EVALUATION_BOARD
+#undef  USE_REFERENCE_BOARD
+and vice-versa.
+
+To let u-boot boot from ebu(flash,e.g), in danube-uboot/include/configus/danube.h, set 
+#define   DANUBE_BOOT_FROM_EBU
+Otherwise u-boot will be compiled for booting from RAM.
+
+To use DDR RAM running at 111M, in danube-uboot/include/configus/danube.
+h, set
+#define  DANUBE_DDR_RAM_111M
+#undef   DANUBE_DDR_RAM_166M
+and vice-versa.
+
+To define RAM size of RAM, in danube-uboot/include/configus/danube.
+h, set
+#define RAM_SIZE                0x2000000 /*32M ram*/
+This is an example for a 32M RAM.
+
+
+Besides above settings, user need to change danube-uboot/board/danube/config.mk to set the loading address of u-boot.
+If U-Boot is to boot from EBU(flash), user needs to set
+TEXT_BASE=0xB0000000
+If u-boot is to boot from RAM, user needs to set
+TEXT_BASE=0xa0400000
+
+Use the script gct to build a uart downloadable u-boot image:
+./gct danube_ref_ddr166.conf u-boot.srec u-boot.asc
+
+
+
+
+
diff --git a/package/uboot-ifxmips/files/board/danube/config.mk b/package/uboot-ifxmips/files/board/danube/config.mk
new file mode 100644
index 0000000..e6fcbc6
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/config.mk
@@ -0,0 +1,33 @@
+#
+# (C) Copyright 2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+#
+# Danube board with MIPS 24Kec CPU core
+#boot from ebu
+TEXT_BASE = 0xB0000000
+BOOTSTRAP_TEXT_BASE = 0xB0000000
+
+#boot from ram
+#TEXT_BASE = 0xa0400000
+#TEXT_BASE = 0x807c0000
+
diff --git a/package/uboot-ifxmips/files/board/danube/danube.c b/package/uboot-ifxmips/files/board/danube/danube.c
new file mode 100644
index 0000000..b6174ba
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/danube.c
@@ -0,0 +1,208 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <command.h>
+#include <asm/addrspace.h>
+#include <asm/danube.h>
+
+#ifdef DANUBE_USE_DDR_RAM
+long int initdram(int board_type)
+{
+	return (1024*1024*DANUBE_DDR_RAM_SIZE);
+}
+#else
+extern uint danube_get_cpuclk(void);
+
+static ulong max_sdram_size(void)     /* per Chip Select */
+{
+	/* The only supported SDRAM data width is 16bit.
+	 */
+#define CFG_DW	4
+
+	/* The only supported number of SDRAM banks is 4.
+	 */
+#define CFG_NB	4
+
+	ulong cfgpb0 = *DANUBE_SDRAM_MC_CFGPB0;
+	int   cols   = cfgpb0 & 0xF;
+	int   rows   = (cfgpb0 & 0xF0) >> 4;
+	ulong size   = (1 << (rows + cols)) * CFG_DW * CFG_NB;
+
+	return size;
+}
+
+/*
+ * Check memory range for valid RAM. A simple memory test determines
+ * the actually available RAM size between addresses `base' and
+ * `base + maxsize'. 
+ */
+
+static long int dram_size(long int *base, long int maxsize)
+{
+	volatile long int *addr;
+	ulong cnt, val;
+	ulong save[32];			/* to make test non-destructive */
+	unsigned char i = 0;
+
+	for (cnt = (maxsize / sizeof (long)) >> 1; cnt > 0; cnt >>= 1) {
+		addr = base + cnt;		/* pointer arith! */
+
+		save[i++] = *addr;
+		*addr = ~cnt;
+	}
+
+	/* write 0 to base address */
+	addr = base;
+	save[i] = *addr;
+	*addr = 0;
+
+	/* check at base address */
+	if ((val = *addr) != 0) {
+		*addr = save[i];
+		return (0);
+	}
+
+	for (cnt = 1; cnt < maxsize / sizeof (long); cnt <<= 1) {
+		addr = base + cnt;		/* pointer arith! */
+
+		val = *addr;
+		*addr = save[--i];
+
+		if (val != (~cnt)) {
+			return (cnt * sizeof (long));
+		}
+	}
+	return (maxsize);
+}
+
+long int initdram(int board_type)
+{
+	int   rows, cols, best_val = *DANUBE_SDRAM_MC_CFGPB0;
+	ulong size, max_size       = 0;
+	ulong our_address;
+
+	/* load t9 into our_address */	
+	asm volatile ("move %0, $25" : "=r" (our_address) :);
+
+	/* Can't probe for RAM size unless we are running from Flash.
+	 * find out whether running from DRAM or Flash.
+	 */
+	if (PHYSADDR(our_address) < PHYSADDR(PHYS_FLASH_1))
+	{
+		return max_sdram_size();
+	}
+
+	for (cols = 0x8; cols <= 0xC; cols++)
+	{
+		for (rows = 0xB; rows <= 0xD; rows++)
+		{
+			*DANUBE_SDRAM_MC_CFGPB0 = (0x14 << 8) |
+			                           (rows << 4) | cols;
+			size = dram_size((ulong *)CFG_SDRAM_BASE,
+			                                     max_sdram_size());
+
+			if (size > max_size)
+			{
+				best_val = *DANUBE_SDRAM_MC_CFGPB0;
+				max_size = size;
+			}
+		}
+	}
+
+	*DANUBE_SDRAM_MC_CFGPB0 = best_val;
+	return max_size;
+}
+#endif
+
+int checkboard (void)
+{
+	/*    No such register in Amazon */
+#if 0
+	unsigned long chipid = *AMAZON_MCD_CHIPID;
+	int part_num;
+
+	puts ("Board: AMAZON ");
+	part_num = AMAZON_MCD_CHIPID_PART_NUMBER_GET(chipid);
+	switch (part_num) {
+	case AMAZON_CHIPID_STANDARD:
+		printf ("Standard Version, ");
+		break;
+	case AMAZON_CHIPID_YANGTSE:
+		printf ("Yangtse Version, ");
+		break;
+	default:
+		printf ("Unknown Part Number 0x%x ", part_num);
+		break;
+	}
+
+	printf ("Chip V1.%ld, ", AMAZON_MCD_CHIPID_VERSION_GET(chipid));
+     
+
+	printf("CPU Speed %d MHz\n", danube_get_cpuclk()/1000000);
+	
+#endif
+	return 0;
+}
+
+
+/*
+ * Disk On Chip (NAND) Millenium initialization.
+ * The NAND lives in the CS2* space
+ */
+#if (CONFIG_COMMANDS & CFG_CMD_NAND)
+extern void
+nand_probe(ulong physadr);
+
+#define AT91_SMARTMEDIA_BASE 0x40000000  /* physical address to access memory on NCS3 */
+void
+nand_init(void)
+{
+       	int devtype;
+	/* Configure EBU */
+//TODO: should we keep this?
+        //Set GPIO23 to be Flash CS1;
+	*DANUBE_GPIO_P1_ALTSEL0 = *DANUBE_GPIO_P1_ALTSEL0 | (1<<7);
+	*DANUBE_GPIO_P1_ALTSEL1 = *DANUBE_GPIO_P1_ALTSEL1 & ~(1<<7);
+	*DANUBE_GPIO_P1_DIR = *DANUBE_GPIO_P1_DIR | (1<<7) ;
+	*DANUBE_GPIO_P1_OD = *DANUBE_GPIO_P1_OD | (1<<7) ;
+	
+	*EBU_ADDR_SEL_1 = (NAND_BASE_ADDRESS&0x1fffff00)|0x31;
+	/* byte swap;minimum delay*/
+	*EBU_CON_1      = 0x40C155;
+	*EBU_NAND_CON   = 0x000005F3;
+
+	/* Set bus signals to inactive */
+	 NAND_READY_CLEAR;
+
+	 NAND_CE_CLEAR;
+         nand_probe(NAND_BASE_ADDRESS);
+
+
+
+	//nand_probe(AT91_SMARTMEDIA_BASE);
+}
+#endif
+
+
+
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings.h b/package/uboot-ifxmips/files/board/danube/ddr_settings.h
new file mode 100644
index 0000000..3a4b135
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Eval Board DDR 167 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA03
+#define MC_DC21_VALUE	0x1d00
+#define MC_DC22_VALUE	0x1d1d
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x5e   /* was 0x7f */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d89
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_111.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_111.h
new file mode 100644
index 0000000..b655ca2
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_111.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Eval Board DDR 167 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA03  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1800
+#define MC_DC22_VALUE	0x1818
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x5e   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d89
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_166.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_166.h
new file mode 100644
index 0000000..b655ca2
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_166.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Eval Board DDR 167 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA03  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1800
+#define MC_DC22_VALUE	0x1818
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x5e   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d89
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_PROMOSDDR400.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_PROMOSDDR400.h
new file mode 100644
index 0000000..54bb6c9
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_PROMOSDDR400.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Ref Board DDR 166 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xa02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x0
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA04  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1200
+#define MC_DC22_VALUE	0x1212
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x62   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x4e20
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_Samsung_166.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_Samsung_166.h
new file mode 100644
index 0000000..7975c3e
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_Samsung_166.h
@@ -0,0 +1,51 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Samsung DDR K4H561638H Danube Ref Board DDR 166 Mhz - by Ng Aik Ann 27th Nov 2006 */
+
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0x120  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x301
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA04  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1400
+#define MC_DC22_VALUE	0x1414
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x4e   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d93
+#define MC_DC30_VALUE	0x8235
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_e111.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_e111.h
new file mode 100644
index 0000000..b655ca2
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_e111.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Eval Board DDR 167 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA03  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1800
+#define MC_DC22_VALUE	0x1818
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x5e   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d89
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_e166.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_e166.h
new file mode 100644
index 0000000..b655ca2
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_e166.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Eval Board DDR 167 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA03  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1800
+#define MC_DC22_VALUE	0x1818
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x5e   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d89
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_psc_166.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_psc_166.h
new file mode 100644
index 0000000..445b7da
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_psc_166.h
@@ -0,0 +1,51 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for PSC DDR A2S56D40CTP for Danube Ref Board DDR 166 Mhz - by Ng Aik Ann 27th Nov 2006 */
+
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0x120  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x301
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA04  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1700
+#define MC_DC22_VALUE	0x1717
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x52   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x4e20
+#define MC_DC30_VALUE	0x8235
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_r111.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_r111.h
new file mode 100644
index 0000000..fd15597
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_r111.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Ref Board DDR 166 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA04  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0x1200
+#define MC_DC22_VALUE	0x1212
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x5e   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d89
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/ddr_settings_r166.h b/package/uboot-ifxmips/files/board/danube/ddr_settings_r166.h
new file mode 100644
index 0000000..742d34f
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/ddr_settings_r166.h
@@ -0,0 +1,50 @@
+/* Settings for Denali DDR SDRAM controller */
+/* Optimise for Danube Ref Board DDR 166 Mhz - by Ng Aik Ann 29th April */
+#define MC_DC0_VALUE	0x1B1B
+#define MC_DC1_VALUE	0x0
+#define MC_DC2_VALUE	0x0
+#define MC_DC3_VALUE	0x0
+#define MC_DC4_VALUE	0x0
+#define MC_DC5_VALUE	0x200
+#define MC_DC6_VALUE	0x605
+#define MC_DC7_VALUE	0x303
+#define MC_DC8_VALUE	0x102
+#define MC_DC9_VALUE	0x70a
+#define MC_DC10_VALUE	0x203
+#define MC_DC11_VALUE	0xc02
+#define MC_DC12_VALUE	0x1C8
+#define MC_DC13_VALUE	0x1
+#define MC_DC14_VALUE	0x0
+#define MC_DC15_VALUE	0xf3c  /* WDQS tuning for clk_wr*/
+#define MC_DC16_VALUE	0xC800
+#define MC_DC17_VALUE	0xd
+#define MC_DC18_VALUE	0x300
+#define MC_DC19_VALUE	0x200
+#define MC_DC20_VALUE	0xA04  /* A04 for reference board, A03 for Eval board */
+#define MC_DC21_VALUE	0xd00
+#define MC_DC22_VALUE	0xd0d
+#define MC_DC23_VALUE	0x0
+#define MC_DC24_VALUE	0x62   /* WDQS Tuning for DQS */
+#define MC_DC25_VALUE	0x0
+#define MC_DC26_VALUE	0x0
+#define MC_DC27_VALUE	0x0
+#define MC_DC28_VALUE	0x510
+#define MC_DC29_VALUE	0x2d89
+#define MC_DC30_VALUE	0x8300
+#define MC_DC31_VALUE	0x0
+#define MC_DC32_VALUE	0x0
+#define MC_DC33_VALUE	0x0
+#define MC_DC34_VALUE	0x0
+#define MC_DC35_VALUE	0x0
+#define MC_DC36_VALUE	0x0
+#define MC_DC37_VALUE	0x0
+#define MC_DC38_VALUE	0x0
+#define MC_DC39_VALUE	0x0
+#define MC_DC40_VALUE	0x0
+#define MC_DC41_VALUE	0x0
+#define MC_DC42_VALUE	0x0
+#define MC_DC43_VALUE	0x0
+#define MC_DC44_VALUE	0x0
+#define MC_DC45_VALUE	0x500
+//#define MC_DC45_VALUE	0x400
+#define MC_DC46_VALUE	0x0
diff --git a/package/uboot-ifxmips/files/board/danube/flash.c b/package/uboot-ifxmips/files/board/danube/flash.c
new file mode 100644
index 0000000..587c072
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/flash.c
@@ -0,0 +1,892 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+//joelin 10/07/2004 for MXIC MX29LV320ABTC-90
+#include <common.h>
+#include <asm/danube.h>
+
+/*
+#ifdef CONFIG_AMAZON
+	#define FLASH_DELAY 	{int i; \
+				for(i=0;i<800;i++) \
+					*((volatile u32 *)CFG_SDRAM_BASE_UNCACHE); \
+				}
+#else
+	#define FLASH_DELAY
+#endif
+*/	
+
+flash_info_t	flash_info[CFG_MAX_FLASH_BANKS]; /* info for FLASH chips	*/
+
+/* NOTE - CONFIG_FLASH_16BIT means the CPU interface is 16-bit, it
+ *        has nothing to do with the flash chip being 8-bit or 16-bit.
+ */
+#ifdef CONFIG_FLASH_16BIT
+typedef unsigned short FLASH_PORT_WIDTH;
+typedef volatile unsigned short FLASH_PORT_WIDTHV;
+#define	FLASH_ID_MASK	0xFFFF
+#else
+typedef unsigned long FLASH_PORT_WIDTH;
+typedef volatile unsigned long FLASH_PORT_WIDTHV;
+#define	FLASH_ID_MASK	0xFFFFFFFF
+#endif
+
+#define FPW	FLASH_PORT_WIDTH
+#define FPWV	FLASH_PORT_WIDTHV
+
+#define ORMASK(size) ((-size) & OR_AM_MSK)	// 0xffff8000
+
+#if 0
+#define FLASH_CYCLE1	0x0555
+#define FLASH_CYCLE2	0x02aa
+#else
+#define FLASH_CYCLE1	0x0554			//joelin for MX29LV320AT/B  0x0555 
+#define FLASH_CYCLE2	0x02ab			//joelin for MX29LV320AT/B  0x02aa 
+#endif
+
+/*-----------------------------------------------------------------------
+ * Functions
+ */
+static ulong flash_get_size(FPWV *addr, flash_info_t *info);
+static void flash_reset(flash_info_t *info);
+static int write_word_intel(flash_info_t *info, FPWV *dest, FPW data);
+static int write_word_amd(flash_info_t *info, FPWV *dest, FPW data);
+static void flash_get_offsets(ulong base, flash_info_t *info);
+static flash_info_t *flash_get_info(ulong base);
+
+/*-----------------------------------------------------------------------
+ * flash_init()
+ *
+ * sets up flash_info and returns size of FLASH (bytes)
+ */
+unsigned long flash_init (void)
+{
+	unsigned long size = 0;
+	int i;
+
+	/* Init: no FLASHes known */
+	for (i=0; i < CFG_MAX_FLASH_BANKS; ++i) {         // 1 bank 
+		ulong flashbase = (i == 0) ? PHYS_FLASH_1 : PHYS_FLASH_2;      // 0xb0000000,  0xb4000000
+
+       volatile ulong * buscon = (ulong *)
+			((i == 0) ? DANUBE_EBU_BUSCON0 : DANUBE_EBU_BUSCON1);
+
+		/* Disable write protection */
+//		*buscon &= ~AMAZON_EBU_BUSCON0_WRDIS;
+		/* Enable write protection */
+		*buscon |= DANUBE_EBU_BUSCON0_WRDIS;
+
+#if 1
+		memset(&flash_info[i], 0, sizeof(flash_info_t));
+#endif
+
+		flash_info[i].size = 
+			flash_get_size((FPW *)flashbase, &flash_info[i]);
+
+		if (flash_info[i].flash_id == FLASH_UNKNOWN) {
+			printf ("## Unknown FLASH on Bank %d - Size = 0x%08lx\n",
+			i, flash_info[i].size);
+		}
+		
+		size += flash_info[i].size;
+	}
+
+#if CFG_MONITOR_BASE >= CFG_FLASH_BASE    // TEXT_BASE >= 0xB3000000
+	/* monitor protection ON by default */  /* only use software protection, info->protect[i]=0/1 */
+/*	flash_protect(FLAG_PROTECT_SET,
+		      CFG_MONITOR_BASE,
+		      CFG_MONITOR_BASE+CFG_MONITOR_LEN-1,
+		      flash_get_info(CFG_MONITOR_BASE));
+*/
+	flash_protect(FLAG_PROTECT_CLEAR,    // clear protect
+		      CFG_MONITOR_BASE,
+		      CFG_MONITOR_BASE+CFG_MONITOR_LEN-1,
+		      flash_get_info(CFG_MONITOR_BASE));
+
+#endif
+
+#ifdef	CFG_ENV_IS_IN_FLASH     /* 1 */
+	/* ENV protection ON by default */
+/*	flash_protect(FLAG_PROTECT_SET,
+		      CFG_ENV_ADDR,
+		      CFG_ENV_ADDR+CFG_ENV_SIZE-1,
+		      flash_get_info(CFG_ENV_ADDR));
+*/
+	flash_protect(FLAG_PROTECT_CLEAR,
+		      CFG_ENV_ADDR,
+		      CFG_ENV_ADDR+CFG_ENV_SIZE-1,
+		      flash_get_info(CFG_ENV_ADDR));
+
+#endif
+
+
+	return size;
+}
+
+/*-----------------------------------------------------------------------
+ */
+static void flash_reset(flash_info_t *info)
+{
+	FPWV *base = (FPWV *)(info->start[0]);
+
+	(*DANUBE_EBU_BUSCON0)&=(~0x80000000);	// enable writing
+	(*DANUBE_EBU_BUSCON1)&=(~0x80000000);	// enable writing
+	(*EBU_NAND_CON)=0;	
+	/* Put FLASH back in read mode */
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL){
+		*base = (FPW)0x00FF00FF;	/* Intel Read Mode */
+		asm("SYNC");
+	}
+	else if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_AMD){
+		*base = (FPW)0x00F000F0;	/* AMD Read Mode */
+		asm("SYNC");			//joelin
+	}
+	else if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_MX){
+		*base = (FPW)0x00F000F0;	/* MXIC Read Mode */
+		asm("SYNC");			//joelin
+	}		
+
+	(*DANUBE_EBU_BUSCON0)|=0x80000000;	// disable writing
+	(*DANUBE_EBU_BUSCON1)|=0x80000000;	// disable writing
+
+}
+
+/*-----------------------------------------------------------------------
+ */
+static void flash_get_offsets (ulong base, flash_info_t *info)
+{
+	int i;
+
+	/* set up sector start address table */
+	if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL
+	    && (info->flash_id & FLASH_BTYPE)) {
+		int bootsect_size;	/* number of bytes/boot sector	*/
+		int sect_size;		/* number of bytes/regular sector */
+
+		bootsect_size = 0x00002000 * (sizeof(FPW)/2);
+		sect_size =     0x00010000 * (sizeof(FPW)/2);
+
+		/* set sector offsets for bottom boot block type	*/
+		for (i = 0; i < 8; ++i) {
+			info->start[i] = base + (i * bootsect_size);
+		}
+		for (i = 8; i < info->sector_count; i++) {
+			info->start[i] = base + ((i - 7) * sect_size);
+		}
+	}
+	else if ((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_AMD
+		 && (info->flash_id & FLASH_TYPEMASK) == FLASH_AM640U) {
+
+		int sect_size;		/* number of bytes/sector */
+
+		sect_size = 0x00010000 * (sizeof(FPW)/2);
+
+		/* set up sector start address table (uniform sector type) */
+		for( i = 0; i < info->sector_count; i++ )
+			info->start[i] = base + (i * sect_size);
+	}
+	else if(((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL)
+		&& ((info->flash_id & FLASH_TYPEMASK)==FLASH_28F128J3A)){
+		int sect_size;
+		sect_size = 0x20000;
+		for(i=0;i < info->sector_count; i++)
+			info->start[i]= base + (i*sect_size);
+	}
+	else if(((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL)
+		&& ((info->flash_id & FLASH_TYPEMASK)==FLASH_28F320J3A)){
+		int sect_size;
+		sect_size = 0x20000;
+		for(i=0;i < info->sector_count; i++)
+			info->start[i]= base + (i*sect_size);
+	}
+//joelin add for MX29LV320AB-- SA0~SA7:sector size=8K bytes ,SA9~SA70 :sector size=64k bytes	
+	else if(((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_MX)
+		&& ((info->flash_id & FLASH_TYPEMASK)==FLASH_29LV320AB)){
+		int bootsect_size;	/* number of bytes/boot sector	*/
+		int sect_size;		/* number of bytes/regular sector */
+
+		bootsect_size = 0x00002000 * (sizeof(FPW)/2);
+		sect_size =     0x00010000 * (sizeof(FPW)/2);
+
+		/* set sector offsets for bottom boot block type	*/
+		for (i = 0; i < 8; ++i) {
+			info->start[i] = base + (i * bootsect_size);
+		}
+		for (i = 8; i < info->sector_count; i++) {
+			info->start[i] = base + ((i - 7) * sect_size);
+		}
+	}	
+//joelin add for MX29LV160BB-- SA0=16K,SA1,SA2=8K,SA3=32K bytes ,SA4~SA34 :sector size=64k bytes			
+	else if(((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_MX)
+		&& ((info->flash_id & FLASH_TYPEMASK)==FLASH_29LV160BB)){
+		int bootsect_size;	/* number of bytes/boot sector	*/
+		int sect_size;		/* number of bytes/regular sector */
+
+		bootsect_size = 0x00002000 * (sizeof(FPW)/2);
+		sect_size =     0x00010000 * (sizeof(FPW)/2);
+/* set sector offsets for bottom boot block type	*/		
+//MX29LV160BB
+		info->start[0] = base ;				//SA0=16K bytes
+		info->start[1] = info->start[0]  + (1 * 0x00004000 * (sizeof(FPW)/2)); //SA1=8K bytes
+		info->start[2] = info->start[1]  + (1 * 0x00002000 * (sizeof(FPW)/2)); //SA2=8K bytes
+		info->start[3] = info->start[2]  + (1 * 0x00002000 * (sizeof(FPW)/2)); //SA3=32K bytes
+
+		for (i = 4; i < info->sector_count; i++) {
+			info->start[i] = base + ((i - 3) * sect_size);
+		}		
+	}	
+//liupeng add for MX29LV640BB-- SA0~SA7:sector size=8k bytes ,SA8~SA134 :sector size=64k bytes	
+	else if(((info->flash_id & FLASH_VENDMASK) == FLASH_MAN_MX)
+		&& ((info->flash_id & FLASH_TYPEMASK)==FLASH_29LV640BB)){
+		int bootsect_size;	/* number of bytes/boot sector	*/
+		int sect_size;		/* number of bytes/regular sector */
+
+		bootsect_size = 0x00002000 * (sizeof(FPW)/2);
+		sect_size =     0x00010000 * (sizeof(FPW)/2);
+
+		/* set sector offsets for bottom boot block type	*/
+		for (i = 0; i < 8; ++i) {
+			info->start[i] = base + (i * bootsect_size);
+		}
+		for (i = 8; i < info->sector_count; i++) {
+			info->start[i] = base + ((i - 7) * sect_size);
+		}
+	}	
+	else{
+		printf("flash get offsets fail\n");
+	}
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+static flash_info_t *flash_get_info(ulong base)
+{
+	int i;
+	flash_info_t * info;
+	
+	for (i = 0; i < CFG_MAX_FLASH_BANKS; i ++) {
+		info = & flash_info[i];
+		if (info->start[0] <= base && base < info->start[0] + info->size)
+			break;
+	}
+	
+	return i == CFG_MAX_FLASH_BANKS ? 0 : info;
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+void flash_print_info (flash_info_t *info)
+{
+	int i;
+	uchar *boottype;
+	uchar *bootletter;
+	uchar *fmt;
+	uchar botbootletter[] = "B";
+	uchar topbootletter[] = "T";
+	uchar botboottype[] = "bottom boot sector";
+	uchar topboottype[] = "top boot sector";
+
+	if (info->flash_id == FLASH_UNKNOWN) {
+		printf ("missing or unknown FLASH type\n");
+		return;
+	}
+
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_AMD:	printf ("AMD ");		break;
+	case FLASH_MAN_BM:	printf ("BRIGHT MICRO ");	break;
+	case FLASH_MAN_FUJ:	printf ("FUJITSU ");		break;
+	case FLASH_MAN_SST:	printf ("SST ");		break;
+	case FLASH_MAN_STM:	printf ("STM ");		break;
+	case FLASH_MAN_INTEL:	printf ("INTEL ");		break;
+	case FLASH_MAN_MX:	printf ("MXIC  ");		break;	
+	default:		printf ("Unknown Vendor ");	break;
+	}
+
+	/* check for top or bottom boot, if it applies */
+	if (info->flash_id & FLASH_BTYPE) {
+		boottype = botboottype;
+		bootletter = botbootletter;
+	}
+	else {
+		boottype = topboottype;
+		bootletter = topbootletter;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case FLASH_AM640U:
+		fmt = "29LV641D (64 Mbit, uniform sectors)\n";
+		break;
+        case FLASH_28F800C3B:
+        case FLASH_28F800C3T:
+		fmt = "28F800C3%s (8 Mbit, %s)\n";
+		break;
+	case FLASH_INTEL800B:
+	case FLASH_INTEL800T:
+		fmt = "28F800B3%s (8 Mbit, %s)\n";
+		break;
+        case FLASH_28F160C3B:
+        case FLASH_28F160C3T:
+		fmt = "28F160C3%s (16 Mbit, %s)\n";
+		break;
+	case FLASH_INTEL160B:
+	case FLASH_INTEL160T:
+		fmt = "28F160B3%s (16 Mbit, %s)\n";
+		break;
+        case FLASH_28F320C3B:
+        case FLASH_28F320C3T:
+		fmt = "28F320C3%s (32 Mbit, %s)\n";
+		break;
+	case FLASH_INTEL320B:
+	case FLASH_INTEL320T:
+		fmt = "28F320B3%s (32 Mbit, %s)\n";
+		break;
+        case FLASH_28F640C3B:
+        case FLASH_28F640C3T:
+		fmt = "28F640C3%s (64 Mbit, %s)\n";
+		break;
+	case FLASH_INTEL640B:
+	case FLASH_INTEL640T:
+		fmt = "28F640B3%s (64 Mbit, %s)\n";
+		break;
+	case FLASH_28F128J3A:
+		fmt = "28F128J3A (128 Mbit, 128 uniform sectors)\n";
+		break;
+	case FLASH_28F320J3A:
+		fmt = "28F320J3A (32 Mbit, 32 uniform sectors)\n";
+		break;
+	case FLASH_29LV640BB:		//liupeng for MXIC FLASH_29LV640BB
+		fmt = "29LV640BB (64 Mbit, boot sector SA0~SA126 size 64k bytes,other sectors SA127~SA135 size 8k bytes)\n";
+		break;	
+	case FLASH_29LV320AB:		//joelin for MXIC FLASH_29LV320AB
+		fmt = "29LV320AB (32 Mbit, boot sector SA0~SA7 size 8K bytes,other sectors SA8~SA70 size 64K bytes)\n";
+		break;	
+	case FLASH_29LV160BB:		//joelin for MXIC FLASH_29LV160BB
+		fmt = "29LV160BB (16 Mbit, boot sector SA0 size 16K bytes,SA1,SA2 size 8K bytes,SA3 size 32k bytes,other sectors SA4~SA34 size 64K bytes)\n";
+		break;					
+	default:
+		fmt = "Unknown Chip Type\n";
+		break;
+	}
+
+	printf (fmt, bootletter, boottype);
+
+	printf ("  Size: %ld MB in %d Sectors\n",
+		info->size >> 20,
+		info->sector_count);
+
+	printf ("  Sector Start Addresses:");
+
+	for (i=0; i<info->sector_count; ++i) {
+		if ((i % 5) == 0) {
+			printf ("\n   ");
+		}
+
+		printf (" %08lX%s", info->start[i],
+			info->protect[i] ? " (RO)" : "     ");
+	}
+
+	printf ("\n");
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+/*
+ * The following code cannot be run from FLASH!
+ */
+
+ulong flash_get_size (FPWV *addr, flash_info_t *info)
+{
+        (*DANUBE_EBU_BUSCON0)=0x1d7ff;  //value from Aikann, should be used on the real chip
+	(*EBU_ADDR_SEL_0) = 0x10000031; //starting address from 0xb0000000
+	(*EBU_NAND_CON)=0;
+	(*DANUBE_EBU_BUSCON0)&=(~0x80000000);	// enable writing
+	(*DANUBE_EBU_BUSCON1)&=(~0x80000000);	// enable writing
+	/* Write auto select command: read Manufacturer ID */
+
+	/* Write auto select command sequence and test FLASH answer */
+  	addr[FLASH_CYCLE1] = (FPW)0x00AA00AA;	/* for AMD, Intel ignores this */
+  	asm("SYNC");	
+  	addr[FLASH_CYCLE2] = (FPW)0x00550055;	/* for AMD, Intel ignores this */
+  	asm("SYNC");
+  	addr[FLASH_CYCLE1] = (FPW)0x00900090;	/* selects Intel or AMD */
+  	asm("SYNC");
+	
+	/* The manufacturer codes are only 1 byte, so just use 1 byte.
+	 * This works for any bus width and any FLASH device width.
+	 */
+ 
+//	printf("\n type is %08lx", addr[1] & 0xff); 	//joelin 10/06/2004 flash type
+//	printf("\n type is %08lx", addr[0] & 0xff); 	//joelin 10/06/2004 flash type
+//		asm("SYNC");	 
+	switch (addr[1] & 0xff) {
+	case (uchar)AMD_MANUFACT:
+		info->flash_id = FLASH_MAN_AMD;
+		break;
+
+	case (uchar)INTEL_MANUFACT:			// 0x0089
+		info->flash_id = FLASH_MAN_INTEL; //0x00300000
+		break;
+		
+//joelin for MXIC		
+	case (uchar)MX_MANUFACT:		// 0x00c2
+		info->flash_id = FLASH_MAN_MX ;//0x00030000
+		break;
+		
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		break;
+/*	default:
+		info->flash_id = FLASH_MAN_INTEL; //0x00300000
+		break;*/
+	}
+
+	/* Check 16 bits or 32 bits of ID so work on 32 or 16 bit bus. */
+	if (info->flash_id != FLASH_UNKNOWN) switch (addr[0]) {
+	case (FPW)AMD_ID_LV640U:	/* 29LV640 and 29LV641 have same ID */
+		info->flash_id += FLASH_AM640U;
+		info->sector_count = 128;
+		info->size = 0x00800000 * (sizeof(FPW)/2);
+		break;				/* => 8 or 16 MB	*/
+
+	case (FPW)INTEL_ID_28F800C3B:
+		info->flash_id += FLASH_28F800C3B;
+		info->sector_count = 23;
+		info->size = 0x00100000 * (sizeof(FPW)/2);
+		break;				/* => 1 or 2 MB		*/
+
+	case (FPW)INTEL_ID_28F800B3B:
+		info->flash_id += FLASH_INTEL800B;
+		info->sector_count = 23;
+		info->size = 0x00100000 * (sizeof(FPW)/2);
+		break;				/* => 1 or 2 MB		*/
+
+	case (FPW)INTEL_ID_28F160C3B:
+		info->flash_id += FLASH_28F160C3B;
+		info->sector_count = 39;
+		info->size = 0x00200000 * (sizeof(FPW)/2);
+		break;				/* => 2 or 4 MB		*/
+
+	case (FPW)INTEL_ID_28F160B3B:
+		info->flash_id += FLASH_INTEL160B;
+		info->sector_count = 39;
+		info->size = 0x00200000 * (sizeof(FPW)/2);
+		break;				/* => 2 or 4 MB		*/
+
+	case (FPW)INTEL_ID_28F320C3B:
+		info->flash_id += FLASH_28F320C3B;
+		info->sector_count = 71;
+		info->size = 0x00400000 * (sizeof(FPW)/2);
+		break;				/* => 4 or 8 MB		*/
+
+	case (FPW)INTEL_ID_28F320B3B:
+		info->flash_id += FLASH_INTEL320B;
+		info->sector_count = 71;
+		info->size = 0x00400000 * (sizeof(FPW)/2);
+		break;				/* => 4 or 8 MB		*/
+
+	case (FPW)INTEL_ID_28F640C3B:
+		info->flash_id += FLASH_28F640C3B;
+		info->sector_count = 135;
+		info->size = 0x00800000 * (sizeof(FPW)/2);
+		break;				/* => 8 or 16 MB	*/
+
+	case (FPW)INTEL_ID_28F640B3B:
+		info->flash_id += FLASH_INTEL640B;
+		info->sector_count = 135;
+		info->size = 0x00800000 * (sizeof(FPW)/2);
+		break;				/* => 8 or 16 MB	*/
+	
+	case (FPW)INTEL_ID_28F128J3A:
+		info->flash_id +=FLASH_28F128J3A;
+		info->sector_count = 128;
+		info->size = 0x01000000 * (sizeof(FPW)/2);
+		break;				/* => 16 MB */
+	case (FPW)INTEL_ID_28F320J3A:
+		info->flash_id += FLASH_28F320J3A;
+		info->sector_count = 32;
+		info->size = 0x00400000 * (sizeof(FPW)/2);
+		break;	
+//joelin for MXIC
+	case (FPW)MX_ID_29LV320AB:
+		info->flash_id += FLASH_29LV320AB;
+		info->sector_count = 71;
+		info->size = 0x00400000 * (sizeof(FPW)/2);
+		break;				/* => 4 MB		*/		
+					/* => 4 MB */
+//joelin for MXIC
+	case (FPW)MX_ID_29LV160BB:
+		info->flash_id += FLASH_29LV160BB;
+		info->sector_count = 35;
+		info->size = 0x00200000 * (sizeof(FPW)/2);
+		break;				/* => 2 MB		*/		
+					/* => 2 MB */					
+	/* liupeng*/
+	case (FPW)MX_ID_29LV640BB:
+		info->flash_id += FLASH_29LV640BB;
+		info->sector_count = 135;
+		info->size = 0x00800000 * (sizeof(FPW)/2);
+		break;				/* => 2 MB		*/		
+	default:
+		info->flash_id = FLASH_UNKNOWN;
+		info->sector_count = 0;
+		info->size = 0;
+		return (0);			/* => no or unknown flash */
+/*	default:
+		info->flash_id += FLASH_28F320J3A;
+		info->sector_count = 32;
+		info->size = 0x00400000 * (sizeof(FPW)/2);
+		break;*/
+	}
+
+
+	(*DANUBE_EBU_BUSCON0)|=0x80000000;	// disable writing
+	(*DANUBE_EBU_BUSCON1)|=0x80000000;	// disable writing
+	
+	flash_get_offsets((ulong)addr, info);
+
+	/* Put FLASH back in read mode */
+	flash_reset(info);
+	
+	return (info->size);
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+int	flash_erase (flash_info_t *info, int s_first, int s_last)
+{
+	FPWV *addr;
+	int flag, prot, sect;
+	int intel = (info->flash_id & FLASH_VENDMASK) == FLASH_MAN_INTEL;
+	ulong start, now, last;
+	int rcode = 0;
+	if ((s_first < 0) || (s_first > s_last)) {
+		if (info->flash_id == FLASH_UNKNOWN) {
+			printf ("- missing\n");
+		} else {
+			printf ("- no sectors to erase\n");
+		}
+		return 1;
+	}
+
+	switch (info->flash_id & FLASH_TYPEMASK) {
+	case FLASH_INTEL800B:
+	case FLASH_INTEL160B:
+	case FLASH_INTEL320B:
+	case FLASH_INTEL640B:
+	case FLASH_28F800C3B:
+	case FLASH_28F160C3B:
+	case FLASH_28F320C3B:
+	case FLASH_28F640C3B:
+	case FLASH_28F128J3A:
+	case FLASH_28F320J3A:
+	case FLASH_AM640U:
+	case FLASH_29LV640BB:	//liupeng for MXIC MX29LV640BB
+	case FLASH_29LV320AB:	//joelin for MXIC MX29LV320AB
+	case FLASH_29LV160BB:	//joelin for MXIC MX29LV160BB
+		break;
+	case FLASH_UNKNOWN:
+	default:
+		printf ("Can't erase unknown flash type %08lx - aborted\n",
+			info->flash_id);
+		return 1;
+	}
+
+	prot = 0;
+	for (sect=s_first; sect<=s_last; ++sect) {
+		if (info->protect[sect]) {
+			prot++;
+		}
+	}
+
+	if (prot) {
+		printf ("- Warning: %d protected sectors will not be erased!\n",
+			prot);
+	} else {
+		printf ("\n");
+	}
+
+	last  = get_timer(0);
+
+	/* Start erase on unprotected sectors */
+	for (sect = s_first; sect<=s_last && rcode == 0; sect++) {
+
+		if (info->protect[sect] != 0)	/* protected, skip it */
+			continue;
+
+		/* Disable interrupts which might cause a timeout here */
+		flag = disable_interrupts();
+		
+		(*DANUBE_EBU_BUSCON0)&=(~0x80000000);	// enable writing
+		(*DANUBE_EBU_BUSCON1)&=(~0x80000000);	// enable writing
+		(*EBU_NAND_CON)=0;
+		addr = (FPWV *)(info->start[sect]);
+		if (intel) {
+			*addr = (FPW)0x00500050; /* clear status register */
+			*addr = (FPW)0x00200020; /* erase setup */
+			*addr = (FPW)0x00D000D0; /* erase confirm */
+			asm("SYNC");
+		}
+		else {
+			/* must be AMD style if not Intel */
+			FPWV *base;		/* first address in bank */
+
+			base = (FPWV *)(info->start[0]);
+			base[FLASH_CYCLE1] = (FPW)0x00AA00AA;	/* unlock */
+			base[FLASH_CYCLE2] = (FPW)0x00550055;	/* unlock */
+			base[FLASH_CYCLE1] = (FPW)0x00800080;	/* erase mode */
+			base[FLASH_CYCLE1] = (FPW)0x00AA00AA;	/* unlock */
+			base[FLASH_CYCLE2] = (FPW)0x00550055;	/* unlock */
+			*addr = (FPW)0x00300030;	/* erase sector */
+		}
+
+		/* re-enable interrupts if necessary */
+		if (flag)
+			enable_interrupts();
+
+		start = get_timer(0);
+
+		/* wait at least 50us for AMD, 80us for Intel.
+		 * Let's wait 1 ms.
+		 */
+		udelay (1000);
+
+		while ((*addr & (FPW)0x00800080) != (FPW)0x00800080) {
+			if ((now = get_timer(start)) > CFG_FLASH_ERASE_TOUT) {
+				printf ("Erase Timeout\n");
+
+				if (intel) {
+					/* suspend erase	*/
+					*addr = (FPW)0x00B000B0;
+				}
+
+				flash_reset(info);	/* reset to read mode */
+				rcode = 1;		/* failed */
+				break;
+			}
+
+			/* show that we're waiting */
+			if ((get_timer(last)) > CFG_HZ) {/* every second */
+				putc ('.');
+				last = get_timer(0);
+			}
+		}
+		
+			
+//joelin for MXIC 
+	switch (info->flash_id & FLASH_VENDMASK) {
+ 	case FLASH_MAN_MX:		//joelin for MXIC	
+ 		break;
+ 	default:
+		if((*addr & (FPW)0x00200020) != (FPW)0x0)
+			printf("Erase Error\n");
+		break;
+	}			
+			
+			
+
+		/* show that we're waiting */
+		if ((get_timer(last)) > CFG_HZ) {	/* every second */
+			putc ('.');
+			last = get_timer(0);
+		}
+
+		//flash_reset(info);	/* reset to read mode	*/
+	}
+
+	(*DANUBE_EBU_BUSCON0)|=0x80000000;	// disable writing
+	(*DANUBE_EBU_BUSCON1)|=0x80000000;	// disable writing
+ 
+	printf (" done\n");
+	return rcode;
+}
+
+/*-----------------------------------------------------------------------
+ * Copy memory to flash, returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+int write_buff (flash_info_t *info, uchar *src, ulong addr, ulong cnt)
+{
+    FPW data = 0; /* 16 or 32 bit word, matches flash bus width on MPC8XX */
+    int bytes;	  /* number of bytes to program in current word		*/
+    int left;	  /* number of bytes left to program			*/
+    int i, res;
+
+    for (left = cnt, res = 0;
+	 left > 0 && res == 0;
+	 addr += sizeof(data), left -= sizeof(data) - bytes) {
+
+        bytes = addr & (sizeof(data) - 1);
+        addr &= ~(sizeof(data) - 1);
+
+	/* combine source and destination data so can program
+	 * an entire word of 16 or 32 bits
+	 */
+        for (i = 0; i < sizeof(data); i++) {
+            data <<= 8;
+            if (i < bytes || i - bytes >= left )
+		data += *((uchar *)addr + i);
+	    else
+		data += *src++;
+	}
+
+	/* write one word to the flash */
+	switch (info->flash_id & FLASH_VENDMASK) {
+	case FLASH_MAN_AMD:
+	case FLASH_MAN_MX:		//joelin for MXIC	
+		res = write_word_amd(info, (FPWV *)addr, data);
+		break;
+	case FLASH_MAN_INTEL:
+		res = write_word_intel(info, (FPWV *)addr, data);
+		break;
+	default:
+		/* unknown flash type, error! */
+		printf ("missing or unknown FLASH type\n");
+		res = 1;	/* not really a timeout, but gives error */
+		break;
+	}
+    }
+
+    return (res);
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word to Flash for AMD FLASH
+ * A word is 16 or 32 bits, whichever the bus width of the flash bank
+ * (not an individual chip) is.
+ *
+ * returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_word_amd (flash_info_t *info, FPWV *dest, FPW data)
+{
+    ulong start;
+    int flag;
+    int res = 0;	/* result, assume success	*/
+    FPWV *base;		/* first address in flash bank	*/
+
+    /* Check if Flash is (sufficiently) erased */
+    if ((*dest & data) != data) {
+	return (2);
+    }
+
+    base = (FPWV *)(info->start[0]);
+
+    /* Disable interrupts which might cause a timeout here */
+    flag = disable_interrupts();
+  
+    (*DANUBE_EBU_BUSCON0)&=(~0x80000000);	// enable writing
+    (*DANUBE_EBU_BUSCON1)&=(~0x80000000);	// enable writing
+    (*EBU_NAND_CON)=0;
+	
+    base[FLASH_CYCLE1] = (FPW)0x00AA00AA;	/* unlock */
+    base[FLASH_CYCLE2] = (FPW)0x00550055;	/* unlock */
+    base[FLASH_CYCLE1] = (FPW)0x00A000A0;	/* selects program mode */
+
+    *dest = data;		/* start programming the data	*/
+
+    /* re-enable interrupts if necessary */
+    if (flag)
+	enable_interrupts();
+
+    start = get_timer (0);
+
+    /* data polling for D7 */
+    while (res == 0 && (*dest & (FPW)0x00800080) != (data & (FPW)0x00800080)) {
+	if (get_timer(start) > CFG_FLASH_WRITE_TOUT) {
+	    *dest = (FPW)0x00F000F0;	/* reset bank */
+	    res = 1;
+	}
+    }
+ 
+	(*DANUBE_EBU_BUSCON0)|=0x80000000;	// disable writing
+	(*DANUBE_EBU_BUSCON1)|=0x80000000;	// disable writing
+ 
+        return (res);
+}
+
+/*-----------------------------------------------------------------------
+ * Write a word to Flash for Intel FLASH
+ * A word is 16 or 32 bits, whichever the bus width of the flash bank
+ * (not an individual chip) is.
+ *
+ * returns:
+ * 0 - OK
+ * 1 - write timeout
+ * 2 - Flash not erased
+ */
+static int write_word_intel (flash_info_t *info, FPWV *dest, FPW data)
+{
+    ulong start;
+    int flag;
+    int res = 0;	/* result, assume success	*/
+	
+    /* Check if Flash is (sufficiently) erased */
+    if ((*dest & data) != data) {
+	return (2);
+    }
+
+    /* Disable interrupts which might cause a timeout here */
+    flag = disable_interrupts();
+
+    (*DANUBE_EBU_BUSCON0)&=(~0x80000000);	// enable writing
+    (*DANUBE_EBU_BUSCON1)&=(~0x80000000);	// enable writing
+    (*EBU_NAND_CON)=0;
+    *dest = (FPW)0x00500050;	/* clear status register	*/
+    *dest = (FPW)0x00FF00FF;	/* make sure in read mode	*/
+    *dest = (FPW)0x00400040;	/* program setup		*/
+    *dest = data;		/* start programming the data	*/
+    asm("SYNC");
+    
+    /* re-enable interrupts if necessary */
+    if (flag)
+	enable_interrupts();
+
+    start = get_timer (0);
+
+    while (res == 0 && (*dest & (FPW)0x00800080) != (FPW)0x00800080) {
+	if (get_timer(start) > CFG_FLASH_WRITE_TOUT) {
+	    *dest = (FPW)0x00B000B0;	/* Suspend program	*/
+	    res = 1;
+	}
+    }
+
+    if (res == 0 && (*dest & (FPW)0x00100010))
+	res = 1;	/* write failed, time out error is close enough	*/
+
+    *dest = (FPW)0x00500050;	/* clear status register	*/
+    flash_reset(info);
+
+    (*DANUBE_EBU_BUSCON0)|=0x80000000;	// disable writing
+    (*DANUBE_EBU_BUSCON1)|=0x80000000;	// disable writing
+ 
+        return (res);
+}
diff --git a/package/uboot-ifxmips/files/board/danube/lowlevel_init.S b/package/uboot-ifxmips/files/board/danube/lowlevel_init.S
new file mode 100644
index 0000000..f5f24a4
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/lowlevel_init.S
@@ -0,0 +1,582 @@
+
+/*
+ *  Memory sub-system initialization code for INCA-IP2 development board.
+ *  Andre Messerschmidt
+ *  Copyright (c) 2005	Infineon Technologies AG 
+ *
+ *  Based on Inca-IP code 
+ *  Copyright (c) 2003	Wolfgang Denk <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+/* History:
+      peng liu May 25, 2006, for PLL setting after reset, 05252006
+ */
+#include <config.h>
+#include <version.h>
+#include <asm/regdef.h>
+#include <configs/danube.h>
+
+
+#ifdef USE_REFERENCE_BOARD
+#ifdef DANUBE_DDR_RAM_111M
+#include "ddr_settings_r111.h"
+#elif defined(PROMOSDDR400)
+#include "ddr_settings_PROMOSDDR400.h"
+#elif defined(DDR_SAMSUNG_166M)
+#include "ddr_settings_Samsung_166.h"
+#elif defined(DDR_PSC_166M)
+#include "ddr_settings_psc_166.h"
+#else
+#include "ddr_settings_r166.h"
+#endif
+#endif
+
+#ifdef USE_EVALUATION_BOARD
+#ifdef DANUBE_DDR_RAM_111M
+#include "ddr_settings_e111.h"
+#else
+#include "ddr_settings_e166.h"
+#endif
+#endif
+
+
+
+/*TODO: liupeng check !!! */
+#define EBU_MODUL_BASE		0xB4102000
+#define EBU_CLC(value)		0x0000(value)
+#define EBU_CON(value)		0x0010(value)
+#define EBU_ADDSEL0(value)	0x0020(value)
+#define EBU_ADDSEL1(value)	0x0024(value)
+#define EBU_ADDSEL2(value)	0x0028(value)
+#define EBU_ADDSEL3(value)	0x002C(value)
+#define EBU_BUSCON0(value)	0x0060(value)
+#define EBU_BUSCON1(value)	0x0064(value)
+#define EBU_BUSCON2(value)	0x0068(value)
+#define EBU_BUSCON3(value)	0x006C(value)
+
+#define MC_MODUL_BASE		0xBF800000
+#define MC_ERRCAUSE(value)	0x0010(value)
+#define MC_ERRADDR(value)	0x0020(value)
+#define MC_CON(value)		0x0060(value)
+
+#define MC_SRAM_ENABLE		0x00000004
+#define MC_SDRAM_ENABLE		0x00000002
+#define MC_DDRRAM_ENABLE	0x00000001
+
+#define MC_SDR_MODUL_BASE	0xBF800200
+#define MC_IOGP(value)		0x0000(value)
+#define MC_CTRLENA(value)	0x0010(value)
+#define MC_MRSCODE(value)	0x0020(value)
+#define MC_CFGDW(value)		0x0030(value)
+#define MC_CFGPB0(value)	0x0040(value)
+#define MC_LATENCY(value)	0x0080(value)
+#define MC_TREFRESH(value)	0x0090(value)
+#define MC_SELFRFSH(value)	0x00A0(value)
+
+#define MC_DDR_MODUL_BASE	0xBF801000
+#define MC_DC00(value)		0x0000(value)
+#define MC_DC01(value)		0x0010(value)
+#define MC_DC02(value)		0x0020(value)
+#define MC_DC03(value)		0x0030(value)
+#define MC_DC04(value)		0x0040(value)
+#define MC_DC05(value)		0x0050(value)
+#define MC_DC06(value)		0x0060(value)
+#define MC_DC07(value)		0x0070(value)
+#define MC_DC08(value)		0x0080(value)
+#define MC_DC09(value)		0x0090(value)
+#define MC_DC10(value)		0x00A0(value)
+#define MC_DC11(value)		0x00B0(value)
+#define MC_DC12(value)		0x00C0(value)
+#define MC_DC13(value)		0x00D0(value)
+#define MC_DC14(value)		0x00E0(value)
+#define MC_DC15(value)		0x00F0(value)
+#define MC_DC16(value)		0x0100(value)
+#define MC_DC17(value)		0x0110(value)
+#define MC_DC18(value)		0x0120(value)
+#define MC_DC19(value)		0x0130(value)
+#define MC_DC20(value)		0x0140(value)
+#define MC_DC21(value)		0x0150(value)
+#define MC_DC22(value)		0x0160(value)
+#define MC_DC23(value)		0x0170(value)
+#define MC_DC24(value)		0x0180(value)
+#define MC_DC25(value)		0x0190(value)
+#define MC_DC26(value)		0x01A0(value)
+#define MC_DC27(value)		0x01B0(value)
+#define MC_DC28(value)		0x01C0(value)
+#define MC_DC29(value)		0x01D0(value)
+#define MC_DC30(value)		0x01E0(value)
+#define MC_DC31(value)		0x01F0(value)
+#define MC_DC32(value)		0x0200(value)
+#define MC_DC33(value)		0x0210(value)
+#define MC_DC34(value)		0x0220(value)
+#define MC_DC35(value)		0x0230(value)
+#define MC_DC36(value)		0x0240(value)
+#define MC_DC37(value)		0x0250(value)
+#define MC_DC38(value)		0x0260(value)
+#define MC_DC39(value)		0x0270(value)
+#define MC_DC40(value)		0x0280(value)
+#define MC_DC41(value)		0x0290(value)
+#define MC_DC42(value)		0x02A0(value)
+#define MC_DC43(value)		0x02B0(value)
+#define MC_DC44(value)		0x02C0(value)
+#define MC_DC45(value)		0x02D0(value)
+#define MC_DC46(value)		0x02E0(value)
+
+#define RCU_OFFSET  0xBF203000
+#define RCU_RST_REQ      (RCU_OFFSET + 0x0010)
+#define RCU_STS          (RCU_OFFSET + 0x0014)
+
+#define CGU_OFFSET  0xBF103000
+#define  PLL0_CFG     (CGU_OFFSET + 0x0004)
+#define  PLL1_CFG     (CGU_OFFSET + 0x0008)
+#define  PLL2_CFG     (CGU_OFFSET + 0x000C)
+#define  CGU_SYS      (CGU_OFFSET + 0x0010)
+#define  CGU_UPDATE   (CGU_OFFSET + 0x0014)
+#define  IF_CLK       (CGU_OFFSET + 0x0018)
+#define  CGU_SMD      (CGU_OFFSET + 0x0020)
+#define  CGU_CT1SR    (CGU_OFFSET + 0x0028)
+#define  CGU_CT2SR    (CGU_OFFSET + 0x002C)
+#define  CGU_PCMCR    (CGU_OFFSET + 0x0030)
+#define  PCI_CR_PCI   (CGU_OFFSET + 0x0034)
+#define  CGU_OSC_CTRL (CGU_OFFSET + 0x001C)
+#define  CGU_MIPS_PWR_DWN (CGU_OFFSET + 0x0038)
+#define  CLK_MEASURE  (CGU_OFFSET + 0x003C)
+
+//05252006
+#define  pll0_35MHz_CONFIG 0x9D861059
+#define  pll1_35MHz_CONFIG 0x1A260CD9
+#define  pll2_35MHz_CONFIG 0x8000f1e5
+#define  pll0_36MHz_CONFIG 0x1000125D 
+#define  pll1_36MHz_CONFIG 0x1B1E0C99
+#define  pll2_36MHz_CONFIG 0x8002f2a1 
+//05252006
+
+//06063001-joelin disable the PCI CFRAME mask -start
+/*CFRAME is an I/O signal, in the chip, the output CFRAME is selected via GPIO altsel pins, so if you select MII1 RXD1, the CFRAME will not come out.
+But the CFRAME input still take the signal from the pad and not disabled when altsel choose other function. So when MII1_RXD1 is low from other device, the EBU interface will be disabled.
+
+The chip function in such a way that disable the CFRAME mask mean EBU not longer check CFRAME to be the device using the bus.
+The side effect is the entire PCI block will see CFRAME low all the time meaning PCI cannot use the bus at all so no more PCI function.
+*/
+#define PCI_CR_PR_OFFSET  0xBE105400
+#define PCI_CR_PCI_MOD_REG          (PCI_CR_PR_OFFSET + 0x0030)
+#define PCI_CONFIG_SPACE  0xB7000000
+#define CS_CFM		(PCI_CONFIG_SPACE + 0x6C)
+//06063001-joelin disable the PCI CFRAME mask -end
+	.set	noreorder
+
+
+/*
+ * void ebu_init(long)
+ *
+ * a0 has the clock value we are going to run at
+ */
+	.globl	ebu_init
+	.ent	ebu_init
+ebu_init:
+/*TODO:liupeng */
+	j	ra
+	nop
+
+	.end	ebu_init
+
+
+/*
+ * void cgu_init(long)
+ *
+ * a0 has the clock value
+ */
+	.globl	cgu_init
+	.ent	cgu_init
+cgu_init:
+	li  t2, CGU_SYS
+  lw  t2,0(t2)
+  beq t2,a0,freq_up2date
+  nop
+
+	li  t2, RCU_STS
+	lw  t2, 0(t2)
+	and t2,0x00020000
+	beq t2,0x00020000,boot_36MHZ
+  nop
+//05252006
+	li  t1, PLL0_CFG
+	li  t2, pll0_35MHz_CONFIG
+	sw	t2,0(t1)
+	li  t1, PLL1_CFG
+	li  t2, pll1_35MHz_CONFIG
+	sw	t2,0(t1)
+	li  t1, PLL2_CFG
+	li  t2, pll2_35MHz_CONFIG
+	sw	t2,0(t1)
+	li  t1, CGU_SYS
+	sw	a0,0(t1)
+	li  t1, RCU_RST_REQ
+	li  t2, 0x40000008
+	sw	t2,0(t1)
+	b   wait_reset
+	nop
+boot_36MHZ:
+	li  t1, PLL0_CFG
+	li  t2, pll0_36MHz_CONFIG
+	sw	t2,0(t1)
+	li  t1, PLL1_CFG
+	li  t2, pll1_36MHz_CONFIG
+	sw	t2,0(t1)
+	li  t1, PLL2_CFG
+	li  t2, pll2_36MHz_CONFIG
+	sw	t2,0(t1)
+	li  t1, CGU_SYS
+	sw	a0,0(t1)
+	li  t1, RCU_RST_REQ
+	li  t2, 0x40000008
+	sw	t2,0(t1)
+//05252006
+
+wait_reset:
+    b   wait_reset
+    nop
+freq_up2date:
+    j ra 
+    nop
+	.end	cgu_init
+
+
+/*
+ * void sdram_init(long)
+ *
+ * a0 has the clock value
+ */
+	.globl	sdram_init
+	.ent	sdram_init
+sdram_init:
+	
+	/* SDRAM Initialization
+	 */
+	li	t1, MC_MODUL_BASE
+
+	/* Clear Error log registers */
+	sw	zero, MC_ERRCAUSE(t1)
+	sw	zero, MC_ERRADDR(t1)
+	
+	/* Enable SDRAM module in memory controller */
+	li	t3, MC_SDRAM_ENABLE
+	lw	t2, MC_CON(t1)
+	or	t3, t2, t3
+	sw	t3, MC_CON(t1)
+	
+	li	t1, MC_SDR_MODUL_BASE
+	
+	/* disable the controller */
+	li	t2, 0
+	sw	t2, MC_CTRLENA(t1)
+     
+	li	t2, 0x822	
+	sw	t2, MC_IOGP(t1)
+
+	li	t2, 0x2
+	sw	t2, MC_CFGDW(t1)
+	
+	/* Set CAS Latency */
+	li	t2, 0x00000020		
+	sw	t2, MC_MRSCODE(t1)
+	
+	/* Set CS0 to SDRAM parameters */
+	li	t2, 0x000014d8
+	sw	t2, MC_CFGPB0(t1)
+	
+	/* Set SDRAM latency parameters */
+	li  	t2, 0x00036325;   /* BC PC100 */
+	sw	t2, MC_LATENCY(t1)
+	
+	/* Set SDRAM refresh rate */
+	li	t2, 0x00000C30		
+	sw	t2, MC_TREFRESH(t1)
+	
+	/* Clear Power-down registers */
+	sw	zero, MC_SELFRFSH(t1)
+
+	/* Finally enable the controller */
+	li	t2, 1
+	sw	t2, MC_CTRLENA(t1)
+
+	
+	j	ra
+	nop
+
+
+	.end	sdram_init
+
+/*
+ * void ddrram_init(long)
+ *
+ * a0 has the clock value
+ */
+	.globl	ddrram_init
+	.ent	ddrram_init
+ddrram_init:
+	
+	/* DDR-DRAM Initialization
+	 */
+	li	t1, MC_MODUL_BASE
+
+	/* Clear Error log registers */
+	sw	zero, MC_ERRCAUSE(t1)
+	sw	zero, MC_ERRADDR(t1)
+	
+	/* Enable DDR module in memory controller */
+	li	t3, MC_DDRRAM_ENABLE
+	lw	t2, MC_CON(t1)
+	or	t3, t2, t3
+	sw	t3, MC_CON(t1)
+	
+	li	t1, MC_DDR_MODUL_BASE
+	
+    /* Write configuration to DDR controller registers */
+	li	t2, MC_DC0_VALUE
+	sw	t2, MC_DC00(t1)
+     
+	li	t2, MC_DC1_VALUE
+	sw	t2, MC_DC01(t1)
+
+	li	t2, MC_DC2_VALUE
+	sw	t2, MC_DC02(t1)
+
+	li	t2, MC_DC3_VALUE
+	sw	t2, MC_DC03(t1)
+
+	li	t2, MC_DC4_VALUE
+	sw	t2, MC_DC04(t1)
+
+	li	t2, MC_DC5_VALUE
+	sw	t2, MC_DC05(t1)
+
+	li	t2, MC_DC6_VALUE
+	sw	t2, MC_DC06(t1)
+	
+	li	t2, MC_DC7_VALUE
+	sw	t2, MC_DC07(t1)
+	
+	li	t2, MC_DC8_VALUE
+	sw	t2, MC_DC08(t1)
+	
+	li	t2, MC_DC9_VALUE
+	sw	t2, MC_DC09(t1)
+	
+	li	t2, MC_DC10_VALUE
+	sw	t2, MC_DC10(t1)
+
+	li	t2, MC_DC11_VALUE
+	sw	t2, MC_DC11(t1)
+
+	li	t2, MC_DC12_VALUE
+	sw	t2, MC_DC12(t1)
+
+	li	t2, MC_DC13_VALUE
+	sw	t2, MC_DC13(t1)
+
+	li	t2, MC_DC14_VALUE
+	sw	t2, MC_DC14(t1)
+
+	li	t2, MC_DC15_VALUE
+	sw	t2, MC_DC15(t1)
+
+	li	t2, MC_DC16_VALUE
+	sw	t2, MC_DC16(t1)
+
+	li	t2, MC_DC17_VALUE
+	sw	t2, MC_DC17(t1)
+
+	li	t2, MC_DC18_VALUE
+	sw	t2, MC_DC18(t1)
+
+	li	t2, MC_DC19_VALUE
+	sw	t2, MC_DC19(t1)
+
+	li	t2, MC_DC20_VALUE
+	sw	t2, MC_DC20(t1)
+
+	li	t2, MC_DC21_VALUE
+	sw	t2, MC_DC21(t1)
+
+	li	t2, MC_DC22_VALUE
+	sw	t2, MC_DC22(t1)
+
+	li	t2, MC_DC23_VALUE
+	sw	t2, MC_DC23(t1)
+
+	li	t2, MC_DC24_VALUE
+	sw	t2, MC_DC24(t1)
+
+	li	t2, MC_DC25_VALUE
+	sw	t2, MC_DC25(t1)
+
+	li	t2, MC_DC26_VALUE
+	sw	t2, MC_DC26(t1)
+
+	li	t2, MC_DC27_VALUE
+	sw	t2, MC_DC27(t1)
+
+	li	t2, MC_DC28_VALUE
+	sw	t2, MC_DC28(t1)
+
+	li	t2, MC_DC29_VALUE
+	sw	t2, MC_DC29(t1)
+
+	li	t2, MC_DC30_VALUE
+	sw	t2, MC_DC30(t1)
+
+	li	t2, MC_DC31_VALUE
+	sw	t2, MC_DC31(t1)
+
+	li	t2, MC_DC32_VALUE
+	sw	t2, MC_DC32(t1)
+
+	li	t2, MC_DC33_VALUE
+	sw	t2, MC_DC33(t1)
+
+	li	t2, MC_DC34_VALUE
+	sw	t2, MC_DC34(t1)
+
+	li	t2, MC_DC35_VALUE
+	sw	t2, MC_DC35(t1)
+
+	li	t2, MC_DC36_VALUE
+	sw	t2, MC_DC36(t1)
+
+	li	t2, MC_DC37_VALUE
+	sw	t2, MC_DC37(t1)
+
+	li	t2, MC_DC38_VALUE
+	sw	t2, MC_DC38(t1)
+
+	li	t2, MC_DC39_VALUE
+	sw	t2, MC_DC39(t1)
+
+	li	t2, MC_DC40_VALUE
+	sw	t2, MC_DC40(t1)
+
+	li	t2, MC_DC41_VALUE
+	sw	t2, MC_DC41(t1)
+
+	li	t2, MC_DC42_VALUE
+	sw	t2, MC_DC42(t1)
+
+	li	t2, MC_DC43_VALUE
+	sw	t2, MC_DC43(t1)
+
+	li	t2, MC_DC44_VALUE
+	sw	t2, MC_DC44(t1)
+    
+	li	t2, MC_DC45_VALUE
+	sw	t2, MC_DC45(t1)
+
+	li	t2, MC_DC46_VALUE
+	sw	t2, MC_DC46(t1)
+
+	li	t2, 0x00000100
+	sw	t2, MC_DC03(t1)
+
+	j	ra
+	nop
+
+
+	.end	ddrram_init
+
+	.globl	lowlevel_init
+	.ent	lowlevel_init
+lowlevel_init:
+	/* EBU, CGU and SDRAM/DDR-RAM Initialization.
+	 */
+	move	t0, ra
+	/* We rely on the fact that neither cgu_init() nor sdram_init()
+	 * modify t0
+	 */
+#ifdef DANUBE_BOOT_FROM_EBU 
+#ifdef DANUBE_DDR_RAM_166M
+//05252006
+  /* 0xe8 means CPU0/CPU1 333M, DDR 167M, FPI 83M, PPE 240M */
+        li  a0,0xe8
+        bal cgu_init
+        nop
+#endif
+#ifdef PROMOSDDR400
+        li  a0,0xe8
+        bal cgu_init
+        nop
+#endif
+#ifdef DDR_SAMSUNG_166M
+        li  a0,0xe8
+        bal cgu_init
+        nop
+#endif
+#ifdef DDR_PSC_166M
+	li  a0,0xe8
+	bal cgu_init
+	nop
+#endif
+#ifdef  DANUBE_DDR_RAM_133M
+        li  a0,0xe9
+//05252006
+	bal	cgu_init
+	nop
+#endif
+#endif
+/*TODO:liupeng add this define !!!! */
+/*
+  #define DANUBE_BOOT_FROM_EBU
+  #define DANUBE_USE_DDR_RAM
+*/
+
+//06063001-joelin disable the PCI CFRAME mask-start
+#ifdef DISABLE_CFRAME
+	li  t1, PCI_CR_PCI	//mw bf103034 80000000
+	li  t2, 0x80000000
+	sw	t2,0(t1)
+
+	li  t1, PCI_CR_PCI_MOD_REG	//mw be105430 103
+	li  t2, 0x103
+	sw  t2,0(t1)
+	
+	li  t1, CS_CFM			//mw b700006c 0 
+	li  t2, 0x00
+	sw  t2, 0(t1)		
+	
+	li  t1, PCI_CR_PCI_MOD_REG	//mw be105430 103
+	li  t2, 0x1000103
+	sw  t2, 0(t1)	
+#endif 
+//06063001-joelin disable the PCI CFRAME mask-end
+
+#ifdef DANUBE_BOOT_FROM_EBU
+#ifdef DANUBE_USE_DDR_RAM
+	bal	ddrram_init
+	nop
+#else
+	bal	sdram_init
+	nop
+#endif
+#endif
+
+	move	ra, t0
+	j	ra
+	nop
+
+	.end	lowlevel_init
diff --git a/package/uboot-ifxmips/files/board/danube/pmuenable.S b/package/uboot-ifxmips/files/board/danube/pmuenable.S
new file mode 100644
index 0000000..e0d7971
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/pmuenable.S
@@ -0,0 +1,48 @@
+/*
+ *  Power Management unit initialization code for AMAZON development board.
+ *
+ *  Copyright (c) 2003	Ou Ke, Infineon.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <config.h>
+#include <version.h>
+#include <asm/regdef.h>
+
+#define PMU_PWDCR 		0xBF10201C
+#define PMU_SR			0xBF102020
+
+	.globl	pmuenable
+
+pmuenable:
+	li      t0, PMU_PWDCR
+	li      t1, 0x2		/* enable everything */
+	sw      t1, 0(t0)
+#if 0
+1:
+	li	t0, PMU_SR
+	lw      t2, 0(t0)
+	bne     t1, t2, 1b
+	nop
+#endif
+	j	ra
+	nop
+
+
diff --git a/package/uboot-ifxmips/files/board/danube/u-boot-bootstrap.lds b/package/uboot-ifxmips/files/board/danube/u-boot-bootstrap.lds
new file mode 100644
index 0000000..8738ca8
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/u-boot-bootstrap.lds
@@ -0,0 +1,69 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk Engineering, <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/*
+OUTPUT_FORMAT("elf32-bigmips", "elf32-bigmips", "elf32-bigmips")
+*/
+OUTPUT_FORMAT("elf32-tradbigmips", "elf32-tradbigmips", "elf32-tradbigmips")
+OUTPUT_ARCH(mips)
+ENTRY(_start_bootstrap)
+SECTIONS
+{
+        . = 0x00000000;
+
+        . = ALIGN(4);
+	.text       :
+	{
+	  *(.text)
+	}
+
+        . = ALIGN(4);
+        .rodata  : { *(.rodata) }
+
+        . = ALIGN(4);
+        .data  : { *(.data) }
+
+	. = ALIGN(4);
+	.sdata  : { *(.sdata) }
+
+	_gp = ALIGN(16);
+
+	__got_start_bootstrap = .;
+	.got  : { *(.got) }
+	__got_end_bootstrap = .;
+
+	.sdata  : { *(.sdata) }
+
+	. = .;
+	__u_boot_cmd_start_bootstrap = .;
+	.u_boot_cmd : { *(.u_boot_cmd) }
+	__u_boot_cmd_end_bootstrap = .;
+
+	uboot_end_data_bootstrap = .;
+	num_got_entries = (__got_end_bootstrap - __got_start_bootstrap) >> 2;
+
+        . = ALIGN(4);
+	.sbss  : { *(.sbss) }
+        .bss  : { *(.bss) }
+	uboot_end_bootstrap = .;
+}
diff --git a/package/uboot-ifxmips/files/board/danube/u-boot.lds b/package/uboot-ifxmips/files/board/danube/u-boot.lds
new file mode 100644
index 0000000..ad3ec31
--- /dev/null
+++ b/package/uboot-ifxmips/files/board/danube/u-boot.lds
@@ -0,0 +1,69 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk Engineering, <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/*
+OUTPUT_FORMAT("elf32-bigmips", "elf32-bigmips", "elf32-bigmips")
+*/
+OUTPUT_FORMAT("elf32-tradbigmips", "elf32-tradbigmips", "elf32-tradbigmips")
+OUTPUT_ARCH(mips)
+ENTRY(_start)
+SECTIONS
+{
+        . = 0x00000000;
+
+        . = ALIGN(4);
+	.text       :
+	{
+	  *(.text)
+	}
+
+        . = ALIGN(4);
+        .rodata  : { *(.rodata) }
+
+        . = ALIGN(4);
+        .data  : { *(.data) }
+
+	. = ALIGN(4);
+	.sdata  : { *(.sdata) }
+
+	_gp = ALIGN(16);
+
+	__got_start = .;
+	.got  : { *(.got) }
+	__got_end = .;
+
+	.sdata  : { *(.sdata) }
+
+	. = .;
+        __u_boot_cmd_start = .;
+        .u_boot_cmd : { *(.u_boot_cmd) }
+        __u_boot_cmd_end = .;
+
+	uboot_end_data = .;
+	num_got_entries = (__got_end - __got_start) >> 2;
+
+        . = ALIGN(4);
+	.sbss  : { *(.sbss) }
+        .bss  : { *(.bss) }
+	uboot_end = .;
+}
diff --git a/package/uboot-ifxmips/files/common/flash_danube.c b/package/uboot-ifxmips/files/common/flash_danube.c
new file mode 100644
index 0000000..a64bc98
--- /dev/null
+++ b/package/uboot-ifxmips/files/common/flash_danube.c
@@ -0,0 +1,228 @@
+/*
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/* #define DEBUG */
+
+#include <common.h>
+#include <flash.h>
+
+#if !defined(CFG_NO_FLASH)
+
+extern flash_info_t  flash_info[]; /* info for FLASH chips */
+
+/*-----------------------------------------------------------------------
+ * Functions
+ */
+
+/*-----------------------------------------------------------------------
+ * Set protection status for monitor sectors
+ *
+ * The monitor is always located in the _first_ Flash bank.
+ * If necessary you have to map the second bank at lower addresses.
+ */
+void
+flash_protect (int flag, ulong from, ulong to, flash_info_t *info)
+{
+	ulong b_end = info->start[0] + info->size - 1;	/* bank end address */
+	short s_end = info->sector_count - 1;	/* index of last sector */
+	int i;
+
+	debug ("flash_protect %s: from 0x%08lX to 0x%08lX\n",
+		(flag & FLAG_PROTECT_SET) ? "ON" :
+			(flag & FLAG_PROTECT_CLEAR) ? "OFF" : "???",
+		from, to);
+
+	/* Do nothing if input data is bad. */
+	if (info->sector_count == 0 || info->size == 0 || to < from) {
+		return;
+	}
+
+	/* There is nothing to do if we have no data about the flash
+	 * or the protect range and flash range don't overlap.
+	 */
+	if (info->flash_id == FLASH_UNKNOWN ||
+	    to < info->start[0] || from > b_end) {
+		return;
+	}
+
+	for (i=0; i<info->sector_count; ++i) {
+		ulong end;		/* last address in current sect	*/
+
+		end = (i == s_end) ? b_end : info->start[i + 1] - 1;
+
+		/* Update protection if any part of the sector
+		 * is in the specified range.
+		 */
+		if (from <= end && to >= info->start[i]) {
+			if (flag & FLAG_PROTECT_CLEAR) {
+#if defined(CFG_FLASH_PROTECTION)
+				flash_real_protect(info, i, 0);
+#else
+				info->protect[i] = 0;
+#endif	/* CFG_FLASH_PROTECTION */
+				debug ("protect off %d\n", i);
+			}
+			else if (flag & FLAG_PROTECT_SET) {
+#if defined(CFG_FLASH_PROTECTION)
+				flash_real_protect(info, i, 1);
+#else
+				info->protect[i] = 1;
+#endif	/* CFG_FLASH_PROTECTION */
+				debug ("protect on %d\n", i);
+			}
+		}
+	}
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+flash_info_t *
+addr2info (ulong addr)
+{
+#ifndef CONFIG_SPD823TS
+	flash_info_t *info;
+	int i;
+
+	for (i=0, info=&flash_info[0]; i<CFG_MAX_FLASH_BANKS; ++i, ++info) {
+		if (info->flash_id != FLASH_UNKNOWN &&
+		    addr >= info->start[0] &&
+		    /* WARNING - The '- 1' is needed if the flash
+		     * is at the end of the address space, since
+		     * info->start[0] + info->size wraps back to 0.
+		     * Please don't change this unless you understand this.
+		     */
+		    addr <= info->start[0] + info->size - 1) {
+			return (info);
+		}
+	}
+#endif /* CONFIG_SPD823TS */
+
+	return (NULL);
+}
+
+/*-----------------------------------------------------------------------
+ * Copy memory to flash.
+ * Make sure all target addresses are within Flash bounds,
+ * and no protected sectors are hit.
+ * Returns:
+ * ERR_OK          0 - OK
+ * ERR_TIMOUT      1 - write timeout
+ * ERR_NOT_ERASED  2 - Flash not erased
+ * ERR_PROTECTED   4 - target range includes protected sectors
+ * ERR_INVAL       8 - target address not in Flash memory
+ * ERR_ALIGN       16 - target address not aligned on boundary
+ *			(only some targets require alignment)
+ */
+int
+flash_write (char *src, ulong addr, ulong cnt)
+{
+#ifdef CONFIG_SPD823TS
+	return (ERR_TIMOUT);	/* any other error codes are possible as well */
+#else
+	int i;
+	ulong         end        = addr + cnt - 1;
+	flash_info_t *info_first = addr2info (addr);
+	flash_info_t *info_last  = addr2info (end );
+	flash_info_t *info;
+
+	if (cnt == 0) {
+		return (ERR_OK);
+	}
+
+	if (!info_first || !info_last) {
+		return (ERR_INVAL);
+	}
+
+	for (info = info_first; info <= info_last; ++info) {
+		ulong b_end = info->start[0] + info->size;	/* bank end addr */
+		short s_end = info->sector_count - 1;
+		for (i=0; i<info->sector_count; ++i) {
+			ulong e_addr = (i == s_end) ? b_end : info->start[i + 1];
+
+			if ((end >= info->start[i]) && (addr < e_addr) &&
+			    (info->protect[i] != 0) ) {
+				return (ERR_PROTECTED);
+			}
+		}
+	}
+
+	/* finally write data to flash */
+	for (info = info_first; info <= info_last && cnt>0; ++info) {
+		ulong len;
+
+		len = info->start[0] + info->size - addr;
+		if (len > cnt)
+			len = cnt;
+		if ((i = write_buff(info, (uchar *)src, addr, len)) != 0) {
+			return (i);
+		}
+		cnt  -= len;
+		addr += len;
+		src  += len;
+	}
+	return (ERR_OK);
+#endif /* CONFIG_SPD823TS */
+}
+
+/*-----------------------------------------------------------------------
+ */
+
+void flash_perror (int err)
+{
+	switch (err) {
+	case ERR_OK:
+		break;
+	case ERR_TIMOUT:
+		puts ("Timeout writing to Flash\n");
+		break;
+	case ERR_NOT_ERASED:
+		puts ("Flash not Erased\n");
+		break;
+	case ERR_PROTECTED:
+		puts ("Can't write to protected Flash sectors\n");
+		break;
+	case ERR_INVAL:
+		puts ("Outside available Flash\n");
+		break;
+	case ERR_ALIGN:
+		puts ("Start and/or end address not on sector boundary\n");
+		break;
+	case ERR_UNKNOWN_FLASH_VENDOR:
+		puts ("Unknown Vendor of Flash\n");
+		break;
+	case ERR_UNKNOWN_FLASH_TYPE:
+		puts ("Unknown Type of Flash\n");
+		break;
+	case ERR_PROG_ERROR:
+		puts ("General Flash Programming Error\n");
+		break;
+	default:
+		printf ("%s[%d] FIXME: rc=%d\n", __FILE__, __LINE__, err);
+		break;
+	}
+}
+
+/*-----------------------------------------------------------------------
+ */
+#endif /* !CFG_NO_FLASH */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/Makefile b/package/uboot-ifxmips/files/cpu/mips/danube/Makefile
new file mode 100644
index 0000000..da329b3
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/Makefile
@@ -0,0 +1,49 @@
+#
+# (C) Copyright 2003-2006
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= $(obj)lib$(CPU).a
+
+START	= start.o
+COBJS	= asc_serial.o au1x00_serial.o au1x00_eth.o au1x00_usb_ohci.o \
+	  cpu.o interrupts.o incaip_clock.o ifx_asc.o ifx_clock.o
+SOBJS	= incaip_wdt.o cache.o
+
+SRCS	:= $(START:.o=.S) $(SOBJS:.o=.S) $(COBJS:.o=.c)
+OBJS	:= $(addprefix $(obj),$(SOBJS) $(COBJS))
+START	:= $(addprefix $(obj),$(START))
+
+all:	$(obj).depend $(START) $(LIB)
+
+$(LIB):	$(OBJS)
+	$(AR) $(ARFLAGS) $@ $(OBJS)
+
+#########################################################################
+
+# defines $(obj).depend target
+include $(SRCTREE)/rules.mk
+
+sinclude $(obj).depend
+
+#########################################################################
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/asc_serial.c b/package/uboot-ifxmips/files/cpu/mips/danube/asc_serial.c
new file mode 100644
index 0000000..d95ec3f
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/asc_serial.c
@@ -0,0 +1,371 @@
+/*
+ * (INCA) ASC UART support
+ */
+
+#include <config.h>
+
+#if defined(CONFIG_PURPLE) || defined(CONFIG_INCA_IP)
+
+#ifdef CONFIG_PURPLE
+#define	serial_init	asc_serial_init
+#define	serial_putc	asc_serial_putc
+#define	serial_puts	asc_serial_puts
+#define	serial_getc	asc_serial_getc
+#define	serial_tstc	asc_serial_tstc
+#define	serial_setbrg	asc_serial_setbrg
+#endif
+
+#include <common.h>
+#include <asm/inca-ip.h>
+#include "asc_serial.h"
+
+#ifdef CONFIG_PURPLE
+
+#undef ASC_FIFO_PRESENT
+#define TOUT_LOOP	100000
+
+/* Set base address for second FPI interrupt control register bank */
+#define SFPI_INTCON_BASEADDR	0xBF0F0000
+
+/* Register offset from base address */
+#define FBS_ISR		0x00000000	/* Interrupt status register */
+#define FBS_IMR		0x00000008	/* Interrupt mask register */
+#define FBS_IDIS	0x00000010	/* Interrupt disable register */
+
+/* Interrupt status register bits */
+#define FBS_ISR_AT	0x00000040	/* ASC transmit interrupt */
+#define FBS_ISR_AR 	0x00000020	/* ASC receive interrupt */
+#define FBS_ISR_AE	0x00000010	/* ASC error interrupt */
+#define FBS_ISR_AB	0x00000008	/* ASC transmit buffer interrupt */
+#define FBS_ISR_AS      0x00000004 	/* ASC start of autobaud detection interrupt */
+#define FBS_ISR_AF	0x00000002	/* ASC end of autobaud detection interrupt */
+
+#else
+
+#define ASC_FIFO_PRESENT
+
+#endif
+
+
+#define SET_BIT(reg, mask)                  reg |= (mask)
+#define CLEAR_BIT(reg, mask)                reg &= (~mask)
+#define CLEAR_BITS(reg, mask)               CLEAR_BIT(reg, mask)
+#define SET_BITS(reg, mask)                 SET_BIT(reg, mask)
+#define SET_BITFIELD(reg, mask, off, val)   {reg &= (~mask); reg |= (val << off);}
+
+extern uint incaip_get_fpiclk(void);
+
+static int serial_setopt (void);
+
+/* pointer to ASC register base address */
+static volatile incaAsc_t *pAsc = (incaAsc_t *)INCA_IP_ASC;
+
+/******************************************************************************
+*
+* serial_init - initialize a INCAASC channel
+*
+* This routine initializes the number of data bits, parity
+* and set the selected baud rate. Interrupts are disabled.
+* Set the modem control signals if the option is selected.
+*
+* RETURNS: N/A
+*/
+
+int serial_init (void)
+{
+#ifdef CONFIG_INCA_IP
+    /* we have to set PMU.EN13 bit to enable an ASC device*/
+    INCAASC_PMU_ENABLE(13);
+#endif
+
+    /* and we have to set CLC register*/
+    CLEAR_BIT(pAsc->asc_clc, ASCCLC_DISS);
+    SET_BITFIELD(pAsc->asc_clc, ASCCLC_RMCMASK, ASCCLC_RMCOFFSET, 0x0001);
+
+    /* initialy we are in async mode */
+    pAsc->asc_con = ASCCON_M_8ASYNC;
+
+    /* select input port */
+    pAsc->asc_pisel = (CONSOLE_TTY & 0x1);
+
+#ifdef ASC_FIFO_PRESENT
+    /* TXFIFO's filling level */
+    SET_BITFIELD(pAsc->asc_txfcon, ASCTXFCON_TXFITLMASK,
+		    ASCTXFCON_TXFITLOFF, INCAASC_TXFIFO_FL);
+    /* enable TXFIFO */
+    SET_BIT(pAsc->asc_txfcon, ASCTXFCON_TXFEN);
+
+    /* RXFIFO's filling level */
+    SET_BITFIELD(pAsc->asc_txfcon, ASCRXFCON_RXFITLMASK,
+		    ASCRXFCON_RXFITLOFF, INCAASC_RXFIFO_FL);
+    /* enable RXFIFO */
+    SET_BIT(pAsc->asc_rxfcon, ASCRXFCON_RXFEN);
+#endif
+
+    /* enable error signals */
+    SET_BIT(pAsc->asc_con, ASCCON_FEN);
+    SET_BIT(pAsc->asc_con, ASCCON_OEN);
+
+#ifdef CONFIG_INCA_IP
+    /* acknowledge ASC interrupts */
+    ASC_INTERRUPTS_CLEAR(INCAASC_IRQ_LINE_ALL);
+
+    /* disable ASC interrupts */
+    ASC_INTERRUPTS_DISABLE(INCAASC_IRQ_LINE_ALL);
+#endif
+
+#ifdef ASC_FIFO_PRESENT
+    /* set FIFOs into the transparent mode */
+    SET_BIT(pAsc->asc_txfcon, ASCTXFCON_TXTMEN);
+    SET_BIT(pAsc->asc_rxfcon, ASCRXFCON_RXTMEN);
+#endif
+
+    /* set baud rate */
+    serial_setbrg();
+
+    /* set the options */
+    serial_setopt();
+
+    return 0;
+}
+
+void serial_setbrg (void)
+{
+    ulong      uiReloadValue, fdv;
+    ulong      f_ASC;
+
+#ifdef CONFIG_INCA_IP
+    f_ASC = incaip_get_fpiclk();
+#else
+    f_ASC = ASC_CLOCK_RATE;
+#endif
+
+#ifndef INCAASC_USE_FDV
+    fdv = 2;
+    uiReloadValue = (f_ASC / (fdv * 16 * CONFIG_BAUDRATE)) - 1;
+#else
+    fdv = INCAASC_FDV_HIGH_BAUDRATE;
+    uiReloadValue = (f_ASC / (8192 * CONFIG_BAUDRATE / fdv)) - 1;
+#endif /* INCAASC_USE_FDV */
+
+    if ( (uiReloadValue < 0) || (uiReloadValue > 8191) )
+    {
+#ifndef INCAASC_USE_FDV
+	fdv = 3;
+	uiReloadValue = (f_ASC / (fdv * 16 * CONFIG_BAUDRATE)) - 1;
+#else
+	fdv = INCAASC_FDV_LOW_BAUDRATE;
+	uiReloadValue = (f_ASC / (8192 * CONFIG_BAUDRATE / fdv)) - 1;
+#endif /* INCAASC_USE_FDV */
+
+	if ( (uiReloadValue < 0) || (uiReloadValue > 8191) )
+	{
+	    return;    /* can't impossibly generate that baud rate */
+	}
+    }
+
+    /* Disable Baud Rate Generator; BG should only be written when R=0 */
+    CLEAR_BIT(pAsc->asc_con, ASCCON_R);
+
+#ifndef INCAASC_USE_FDV
+    /*
+     * Disable Fractional Divider (FDE)
+     * Divide clock by reload-value + constant (BRS)
+     */
+    /* FDE = 0 */
+    CLEAR_BIT(pAsc->asc_con, ASCCON_FDE);
+
+    if ( fdv == 2 )
+	CLEAR_BIT(pAsc->asc_con, ASCCON_BRS);   /* BRS = 0 */
+    else
+	SET_BIT(pAsc->asc_con, ASCCON_BRS); /* BRS = 1 */
+
+#else /* INCAASC_USE_FDV */
+
+    /* Enable Fractional Divider */
+    SET_BIT(pAsc->asc_con, ASCCON_FDE); /* FDE = 1 */
+
+    /* Set fractional divider value */
+    pAsc->asc_fdv = fdv & ASCFDV_VALUE_MASK;
+
+#endif /* INCAASC_USE_FDV */
+
+    /* Set reload value in BG */
+    pAsc->asc_bg = uiReloadValue;
+
+    /* Enable Baud Rate Generator */
+    SET_BIT(pAsc->asc_con, ASCCON_R);           /* R = 1 */
+}
+
+/*******************************************************************************
+*
+* serial_setopt - set the serial options
+*
+* Set the channel operating mode to that specified. Following options
+* are supported: CREAD, CSIZE, PARENB, and PARODD.
+*
+* Note, this routine disables the transmitter.  The calling routine
+* may have to re-enable it.
+*
+* RETURNS:
+* Returns 0 to indicate success, otherwise -1 is returned
+*/
+
+static int serial_setopt (void)
+{
+    ulong  con;
+
+    switch ( ASC_OPTIONS & ASCOPT_CSIZE )
+    {
+    /* 7-bit-data */
+    case ASCOPT_CS7:
+	con = ASCCON_M_7ASYNCPAR;   /* 7-bit-data and parity bit */
+	break;
+
+    /* 8-bit-data */
+    case ASCOPT_CS8:
+	if ( ASC_OPTIONS & ASCOPT_PARENB )
+	    con = ASCCON_M_8ASYNCPAR;   /* 8-bit-data and parity bit */
+	else
+	    con = ASCCON_M_8ASYNC;      /* 8-bit-data no parity */
+	break;
+
+    /*
+     *  only 7 and 8-bit frames are supported
+     *  if we don't use IOCTL extensions
+     */
+    default:
+	return -1;
+    }
+
+    if ( ASC_OPTIONS & ASCOPT_STOPB )
+	SET_BIT(con, ASCCON_STP);       /* 2 stop bits */
+    else
+	CLEAR_BIT(con, ASCCON_STP);     /* 1 stop bit */
+
+    if ( ASC_OPTIONS & ASCOPT_PARENB )
+	SET_BIT(con, ASCCON_PEN);           /* enable parity checking */
+    else
+	CLEAR_BIT(con, ASCCON_PEN);         /* disable parity checking */
+
+    if ( ASC_OPTIONS & ASCOPT_PARODD )
+	SET_BIT(con, ASCCON_ODD);       /* odd parity */
+    else
+	CLEAR_BIT(con, ASCCON_ODD);     /* even parity */
+
+    if ( ASC_OPTIONS & ASCOPT_CREAD )
+	SET_BIT(pAsc->asc_whbcon, ASCWHBCON_SETREN); /* Receiver enable */
+
+    pAsc->asc_con |= con;
+
+    return 0;
+}
+
+void serial_putc (const char c)
+{
+#ifdef ASC_FIFO_PRESENT
+    uint txFl = 0;
+#else
+    uint timeout = 0;
+#endif
+
+    if (c == '\n') serial_putc ('\r');
+
+#ifdef ASC_FIFO_PRESENT
+    /* check do we have a free space in the TX FIFO */
+    /* get current filling level */
+    do
+    {
+	txFl = ( pAsc->asc_fstat & ASCFSTAT_TXFFLMASK ) >> ASCFSTAT_TXFFLOFF;
+    }
+    while ( txFl == INCAASC_TXFIFO_FULL );
+#else
+
+    while(!(*(volatile unsigned long*)(SFPI_INTCON_BASEADDR + FBS_ISR) &
+			   FBS_ISR_AB))
+    {
+	    if (timeout++ > TOUT_LOOP)
+	    {
+		    break;
+	    }
+    }
+#endif
+
+    pAsc->asc_tbuf = c; /* write char to Transmit Buffer Register */
+
+#ifndef ASC_FIFO_PRESENT
+    *(volatile unsigned long*)(SFPI_INTCON_BASEADDR + FBS_ISR) = FBS_ISR_AB |
+								 FBS_ISR_AT;
+#endif
+
+    /* check for errors */
+    if ( pAsc->asc_con & ASCCON_OE )
+    {
+	SET_BIT(pAsc->asc_whbcon, ASCWHBCON_CLROE);
+	return;
+    }
+}
+
+void serial_puts (const char *s)
+{
+    while (*s)
+    {
+	serial_putc (*s++);
+    }
+}
+
+int serial_getc (void)
+{
+    ulong symbol_mask;
+    char c;
+
+    while (!serial_tstc());
+
+    symbol_mask =
+	((ASC_OPTIONS & ASCOPT_CSIZE) == ASCOPT_CS7) ? (0x7f) : (0xff);
+
+    c = (char)(pAsc->asc_rbuf & symbol_mask);
+
+#ifndef ASC_FIFO_PRESENT
+    *(volatile unsigned long*)(SFPI_INTCON_BASEADDR + FBS_ISR) = FBS_ISR_AR;
+#endif
+
+    return c;
+}
+
+int serial_tstc (void)
+{
+    int res = 1;
+
+#ifdef ASC_FIFO_PRESENT
+    if ( (pAsc->asc_fstat & ASCFSTAT_RXFFLMASK) == 0 )
+    {
+	res = 0;
+    }
+#else
+    if (!(*(volatile unsigned long*)(SFPI_INTCON_BASEADDR + FBS_ISR) &
+								FBS_ISR_AR))
+
+    {
+	res = 0;
+    }
+#endif
+    else if ( pAsc->asc_con & ASCCON_FE )
+    {
+	SET_BIT(pAsc->asc_whbcon, ASCWHBCON_CLRFE);
+	res = 0;
+    }
+    else if ( pAsc->asc_con & ASCCON_PE )
+    {
+	SET_BIT(pAsc->asc_whbcon, ASCWHBCON_CLRPE);
+	res = 0;
+    }
+    else if ( pAsc->asc_con & ASCCON_OE )
+    {
+	SET_BIT(pAsc->asc_whbcon, ASCWHBCON_CLROE);
+	res = 0;
+    }
+
+    return res;
+}
+#endif /* CONFIG_PURPLE || CONFIG_INCA_IP */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/asc_serial.h b/package/uboot-ifxmips/files/cpu/mips/danube/asc_serial.h
new file mode 100644
index 0000000..7ffdcfa
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/asc_serial.h
@@ -0,0 +1,177 @@
+/* incaAscSio.h - (INCA) ASC UART tty driver header */
+
+#ifndef __INCincaAscSioh
+#define __INCincaAscSioh
+
+#include <asm/inca-ip.h>
+
+/* channel operating modes */
+#define	ASCOPT_CSIZE	0x00000003
+#define	ASCOPT_CS7	0x00000001
+#define	ASCOPT_CS8	0x00000002
+#define	ASCOPT_PARENB	0x00000004
+#define	ASCOPT_STOPB	0x00000008
+#define	ASCOPT_PARODD	0x00000010
+#define	ASCOPT_CREAD	0x00000020
+
+#define ASC_OPTIONS		(ASCOPT_CREAD | ASCOPT_CS8)
+
+/* ASC input select (0 or 1) */
+#define CONSOLE_TTY	0
+
+/* use fractional divider for baudrate settings */
+#define INCAASC_USE_FDV
+
+#ifdef INCAASC_USE_FDV
+   #define INCAASC_FDV_LOW_BAUDRATE        71
+   #define INCAASC_FDV_HIGH_BAUDRATE       453
+#endif /*INCAASC_USE_FDV*/
+
+
+#define INCAASC_TXFIFO_FL       1
+#define INCAASC_RXFIFO_FL       1
+#define INCAASC_TXFIFO_FULL     16
+
+/* interrupt lines masks for the ASC device interrupts*/
+/* change these macroses if it's necessary */
+#define INCAASC_IRQ_LINE_ALL        0x000F0000  /* all IRQs */
+
+#define INCAASC_IRQ_LINE_TIR            0x00010000      /* TIR - Tx */
+#define INCAASC_IRQ_LINE_RIR            0x00020000      /* RIR - Rx */
+#define INCAASC_IRQ_LINE_EIR            0x00040000      /* EIR - Err */
+#define INCAASC_IRQ_LINE_TBIR           0x00080000      /* TBIR - Tx Buf*/
+
+/* interrupt controller access macros */
+#define ASC_INTERRUPTS_ENABLE(X)  \
+   *((volatile unsigned int*) INCA_IP_ICU_IM2_IER) |= X;
+#define ASC_INTERRUPTS_DISABLE(X) \
+   *((volatile unsigned int*) INCA_IP_ICU_IM2_IER) &= ~X;
+#define ASC_INTERRUPTS_CLEAR(X)   \
+   *((volatile unsigned int*) INCA_IP_ICU_IM2_ISR) = X;
+
+/* CLC register's bits and bitfields */
+#define ASCCLC_DISR        0x00000001
+#define ASCCLC_DISS        0x00000002
+#define ASCCLC_RMCMASK     0x0000FF00
+#define ASCCLC_RMCOFFSET   8
+
+/* CON register's bits and bitfields */
+#define ASCCON_MODEMASK 0x0007
+    #define ASCCON_M_8SYNC          0x0
+    #define ASCCON_M_8ASYNC         0x1
+    #define ASCCON_M_8IRDAASYNC     0x2
+    #define ASCCON_M_7ASYNCPAR      0x3
+    #define ASCCON_M_9ASYNC         0x4
+    #define ASCCON_M_8WAKEUPASYNC   0x5
+    #define ASCCON_M_8ASYNCPAR      0x7
+#define ASCCON_STP      0x0008
+#define ASCCON_REN      0x0010
+#define ASCCON_PEN      0x0020
+#define ASCCON_FEN      0x0040
+#define ASCCON_OEN      0x0080
+#define ASCCON_PE       0x0100
+#define ASCCON_FE       0x0200
+#define ASCCON_OE       0x0400
+#define ASCCON_FDE      0x0800
+#define ASCCON_ODD      0x1000
+#define ASCCON_BRS      0x2000
+#define ASCCON_LB       0x4000
+#define ASCCON_R        0x8000
+
+/* WHBCON register's bits and bitfields */
+#define ASCWHBCON_CLRREN    0x0010
+#define ASCWHBCON_SETREN    0x0020
+#define ASCWHBCON_CLRPE     0x0100
+#define ASCWHBCON_CLRFE     0x0200
+#define ASCWHBCON_CLROE     0x0400
+#define ASCWHBCON_SETPE     0x0800
+#define ASCWHBCON_SETFE     0x1000
+#define ASCWHBCON_SETOE     0x2000
+
+/* ABCON register's bits and bitfields */
+#define ASCABCON_ABEN       0x0001
+#define ASCABCON_AUREN      0x0002
+#define ASCABCON_ABSTEN     0x0004
+#define ASCABCON_ABDETEN    0x0008
+#define ASCABCON_FCDETEN    0x0010
+#define ASCABCON_EMMASK     0x0300
+    #define ASCABCON_EMOFF          8
+	#define ASCABCON_EM_DISAB       0x0
+	#define ASCABCON_EM_DURAB       0x1
+	#define ASCABCON_EM_ALWAYS      0x2
+#define ASCABCON_TXINV      0x0400
+#define ASCABCON_RXINV      0x0800
+
+/* FDV register mask, offset and bitfields*/
+#define ASCFDV_VALUE_MASK     0x000001FF
+
+/* WHBABCON register's bits and bitfields */
+#define ASCWHBABCON_SETABEN     0x0001
+#define ASCWHBABCON_CLRABEN     0x0002
+
+/* ABSTAT register's bits and bitfields */
+#define ASCABSTAT_FCSDET    0x0001
+#define ASCABSTAT_FCCDET    0x0002
+#define ASCABSTAT_SCSDET    0x0004
+#define ASCABSTAT_SCCDET    0x0008
+#define ASCABSTAT_DETWAIT   0x0010
+
+/* WHBABSTAT register's bits and bitfields */
+#define ASCWHBABSTAT_CLRFCSDET  0x0001
+#define ASCWHBABSTAT_SETFCSDET  0x0002
+#define ASCWHBABSTAT_CLRFCCDET  0x0004
+#define ASCWHBABSTAT_SETFCCDET  0x0008
+#define ASCWHBABSTAT_CLRSCSDET  0x0010
+#define ASCWHBABSTAT_SETSCSDET  0x0020
+#define ASCWHBABSTAT_SETSCCDET  0x0040
+#define ASCWHBABSTAT_CLRSCCDET  0x0080
+#define ASCWHBABSTAT_CLRDETWAIT 0x0100
+#define ASCWHBABSTAT_SETDETWAIT 0x0200
+
+/* TXFCON register's bits and bitfields */
+#define ASCTXFCON_TXFEN         0x0001
+#define ASCTXFCON_TXFFLU        0x0002
+#define ASCTXFCON_TXTMEN        0x0004
+#define ASCTXFCON_TXFITLMASK    0x3F00
+#define ASCTXFCON_TXFITLOFF     8
+
+/* RXFCON register's bits and bitfields */
+#define ASCRXFCON_RXFEN         0x0001
+#define ASCRXFCON_RXFFLU        0x0002
+#define ASCRXFCON_RXTMEN        0x0004
+#define ASCRXFCON_RXFITLMASK    0x3F00
+#define ASCRXFCON_RXFITLOFF     8
+
+/* FSTAT register's bits and bitfields */
+#define ASCFSTAT_RXFFLMASK      0x003F
+#define ASCFSTAT_TXFFLMASK      0x3F00
+#define ASCFSTAT_TXFFLOFF       8
+
+#define INCAASC_PMU_ENABLE(BIT) *((volatile ulong*)0xBF102000) |= (0x1 << BIT);
+
+typedef  struct         /* incaAsc_t */
+{
+    volatile unsigned long  asc_clc;                            /*0x0000*/
+    volatile unsigned long  asc_pisel;                          /*0x0004*/
+    volatile unsigned long  asc_rsvd1[2];   /* for mapping */   /*0x0008*/
+    volatile unsigned long  asc_con;                            /*0x0010*/
+    volatile unsigned long  asc_bg;                             /*0x0014*/
+    volatile unsigned long  asc_fdv;                            /*0x0018*/
+    volatile unsigned long  asc_pmw;        /* not used */      /*0x001C*/
+    volatile unsigned long  asc_tbuf;                           /*0x0020*/
+    volatile unsigned long  asc_rbuf;                           /*0x0024*/
+    volatile unsigned long  asc_rsvd2[2];   /* for mapping */   /*0x0028*/
+    volatile unsigned long  asc_abcon;                          /*0x0030*/
+    volatile unsigned long  asc_abstat;     /* not used */      /*0x0034*/
+    volatile unsigned long  asc_rsvd3[2];   /* for mapping */   /*0x0038*/
+    volatile unsigned long  asc_rxfcon;                         /*0x0040*/
+    volatile unsigned long  asc_txfcon;                         /*0x0044*/
+    volatile unsigned long  asc_fstat;                          /*0x0048*/
+    volatile unsigned long  asc_rsvd4;      /* for mapping */   /*0x004C*/
+    volatile unsigned long  asc_whbcon;                         /*0x0050*/
+    volatile unsigned long  asc_whbabcon;                       /*0x0054*/
+    volatile unsigned long  asc_whbabstat;  /* not used */      /*0x0058*/
+
+} incaAsc_t;
+
+#endif /* __INCincaAscSioh */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_eth.c b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_eth.c
new file mode 100644
index 0000000..078e832
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_eth.c
@@ -0,0 +1,311 @@
+/* Only eth0 supported for now
+ *
+ * (C) Copyright 2003
+ * Thomas.Lange@corelatus.se
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+#include <config.h>
+
+#ifdef CONFIG_AU1X00
+
+#if defined(CFG_DISCOVER_PHY)
+#error "PHY not supported yet"
+/* We just assume that we are running 100FD for now */
+/* We all use switches, right? ;-) */
+#endif
+
+/* I assume ethernet behaves like au1000 */
+
+#ifdef CONFIG_AU1000
+/* Base address differ between cpu:s */
+#define ETH0_BASE AU1000_ETH0_BASE
+#define MAC0_ENABLE AU1000_MAC0_ENABLE
+#else
+#ifdef CONFIG_AU1100
+#define ETH0_BASE AU1100_ETH0_BASE
+#define MAC0_ENABLE AU1100_MAC0_ENABLE
+#else
+#ifdef CONFIG_AU1500
+#define ETH0_BASE AU1500_ETH0_BASE
+#define MAC0_ENABLE AU1500_MAC0_ENABLE
+#else
+#ifdef CONFIG_AU1550
+#define ETH0_BASE AU1550_ETH0_BASE
+#define MAC0_ENABLE AU1550_MAC0_ENABLE
+#else
+#error "No valid cpu set"
+#endif
+#endif
+#endif
+#endif
+
+#include <common.h>
+#include <malloc.h>
+#include <net.h>
+#include <command.h>
+#include <asm/io.h>
+#include <asm/au1x00.h>
+
+#if (CONFIG_COMMANDS & CFG_CMD_MII)
+#include <miiphy.h>
+#endif
+
+/* Ethernet Transmit and Receive Buffers */
+#define DBUF_LENGTH  1520
+#define PKT_MAXBUF_SIZE		1518
+
+static char txbuf[DBUF_LENGTH];
+
+static int next_tx;
+static int next_rx;
+
+/* 4 rx and 4 tx fifos */
+#define NO_OF_FIFOS 4
+
+typedef struct{
+	u32 status;
+	u32 addr;
+	u32 len; /* Only used for tx */
+	u32 not_used;
+} mac_fifo_t;
+
+mac_fifo_t mac_fifo[NO_OF_FIFOS];
+
+#define MAX_WAIT 1000
+
+static int au1x00_send(struct eth_device* dev, volatile void *packet, int length){
+	volatile mac_fifo_t *fifo_tx =
+		(volatile mac_fifo_t*)(MAC0_TX_DMA_ADDR+MAC_TX_BUFF0_STATUS);
+	int i;
+	int res;
+
+	/* tx fifo should always be idle */
+	fifo_tx[next_tx].len = length;
+	fifo_tx[next_tx].addr = (virt_to_phys(packet))|TX_DMA_ENABLE;
+	au_sync();
+
+	udelay(1);
+	i=0;
+	while(!(fifo_tx[next_tx].addr&TX_T_DONE)){
+		if(i>MAX_WAIT){
+			printf("TX timeout\n");
+			break;
+		}
+		udelay(1);
+		i++;
+	}
+
+	/* Clear done bit */
+	fifo_tx[next_tx].addr = 0;
+	fifo_tx[next_tx].len = 0;
+	au_sync();
+
+	res = fifo_tx[next_tx].status;
+
+	next_tx++;
+	if(next_tx>=NO_OF_FIFOS){
+		next_tx=0;
+	}
+	return(res);
+}
+
+static int au1x00_recv(struct eth_device* dev){
+	volatile mac_fifo_t *fifo_rx =
+		(volatile mac_fifo_t*)(MAC0_RX_DMA_ADDR+MAC_RX_BUFF0_STATUS);
+
+	int length;
+	u32 status;
+
+	for(;;){
+		if(!(fifo_rx[next_rx].addr&RX_T_DONE)){
+			/* Nothing has been received */
+			return(-1);
+		}
+
+		status = fifo_rx[next_rx].status;
+
+		length = status&0x3FFF;
+
+		if(status&RX_ERROR){
+			printf("Rx error 0x%x\n", status);
+		}
+		else{
+			/* Pass the packet up to the protocol layers. */
+			NetReceive(NetRxPackets[next_rx], length - 4);
+		}
+
+		fifo_rx[next_rx].addr = (virt_to_phys(NetRxPackets[next_rx]))|RX_DMA_ENABLE;
+
+		next_rx++;
+		if(next_rx>=NO_OF_FIFOS){
+			next_rx=0;
+		}
+	} /* for */
+
+	return(0); /* Does anyone use this? */
+}
+
+static int au1x00_init(struct eth_device* dev, bd_t * bd){
+
+	volatile u32 *macen = (volatile u32*)MAC0_ENABLE;
+	volatile u32 *mac_ctrl = (volatile u32*)(ETH0_BASE+MAC_CONTROL);
+	volatile u32 *mac_addr_high = (volatile u32*)(ETH0_BASE+MAC_ADDRESS_HIGH);
+	volatile u32 *mac_addr_low = (volatile u32*)(ETH0_BASE+MAC_ADDRESS_LOW);
+	volatile u32 *mac_mcast_high = (volatile u32*)(ETH0_BASE+MAC_MCAST_HIGH);
+	volatile u32 *mac_mcast_low = (volatile u32*)(ETH0_BASE+MAC_MCAST_LOW);
+	volatile mac_fifo_t *fifo_tx =
+		(volatile mac_fifo_t*)(MAC0_TX_DMA_ADDR+MAC_TX_BUFF0_STATUS);
+	volatile mac_fifo_t *fifo_rx =
+		(volatile mac_fifo_t*)(MAC0_RX_DMA_ADDR+MAC_RX_BUFF0_STATUS);
+	int i;
+
+	next_tx = TX_GET_DMA_BUFFER(fifo_tx[0].addr);
+	next_rx = RX_GET_DMA_BUFFER(fifo_rx[0].addr);
+
+	/* We have to enable clocks before releasing reset */
+	*macen = MAC_EN_CLOCK_ENABLE;
+	udelay(10);
+
+	/* Enable MAC0 */
+	/* We have to release reset before accessing registers */
+	*macen = MAC_EN_CLOCK_ENABLE|MAC_EN_RESET0|
+		MAC_EN_RESET1|MAC_EN_RESET2;
+	udelay(10);
+
+	for(i=0;i<NO_OF_FIFOS;i++){
+		fifo_tx[i].len = 0;
+		fifo_tx[i].addr = virt_to_phys(&txbuf[0]);
+		fifo_rx[i].addr = (virt_to_phys(NetRxPackets[i]))|RX_DMA_ENABLE;
+	}
+
+	/* Put mac addr in little endian */
+#define ea eth_get_dev()->enetaddr
+	*mac_addr_high	=	(ea[5] <<  8) | (ea[4]	    ) ;
+	*mac_addr_low	=	(ea[3] << 24) | (ea[2] << 16) |
+		(ea[1] <<  8) | (ea[0]	    ) ;
+#undef ea
+	*mac_mcast_low = 0;
+	*mac_mcast_high = 0;
+
+	/* Make sure the MAC buffer is in the correct endian mode */
+#ifdef __LITTLE_ENDIAN
+	*mac_ctrl = MAC_FULL_DUPLEX;
+	udelay(1);
+	*mac_ctrl = MAC_FULL_DUPLEX|MAC_RX_ENABLE|MAC_TX_ENABLE;
+#else
+	*mac_ctrl = MAC_BIG_ENDIAN|MAC_FULL_DUPLEX;
+	udelay(1);
+	*mac_ctrl = MAC_BIG_ENDIAN|MAC_FULL_DUPLEX|MAC_RX_ENABLE|MAC_TX_ENABLE;
+#endif
+
+	return(1);
+}
+
+static void au1x00_halt(struct eth_device* dev){
+}
+
+int au1x00_enet_initialize(bd_t *bis){
+	struct eth_device* dev;
+
+	if ((dev = (struct eth_device*)malloc(sizeof *dev)) == NULL) {
+		puts ("malloc failed\n");
+		return 0;
+	}
+
+	memset(dev, 0, sizeof *dev);
+
+	sprintf(dev->name, "Au1X00 ethernet");
+	dev->iobase = 0;
+	dev->priv   = 0;
+	dev->init   = au1x00_init;
+	dev->halt   = au1x00_halt;
+	dev->send   = au1x00_send;
+	dev->recv   = au1x00_recv;
+
+	eth_register(dev);
+
+#if (CONFIG_COMMANDS & CFG_CMD_MII)
+	miiphy_register(dev->name,
+		au1x00_miiphy_read, au1x00_miiphy_write);
+#endif
+
+	return 1;
+}
+
+#if (CONFIG_COMMANDS & CFG_CMD_MII)
+int  au1x00_miiphy_read(char *devname, unsigned char addr,
+		unsigned char reg, unsigned short * value)
+{
+	volatile u32 *mii_control_reg = (volatile u32*)(ETH0_BASE+MAC_MII_CNTRL);
+	volatile u32 *mii_data_reg = (volatile u32*)(ETH0_BASE+MAC_MII_DATA);
+	u32 mii_control;
+	unsigned int timedout = 20;
+
+	while (*mii_control_reg & MAC_MII_BUSY) {
+		udelay(1000);
+		if (--timedout == 0) {
+			printf("au1x00_eth: miiphy_read busy timeout!!\n");
+			return -1;
+		}
+	}
+
+	mii_control = MAC_SET_MII_SELECT_REG(reg) |
+		MAC_SET_MII_SELECT_PHY(addr) | MAC_MII_READ;
+
+	*mii_control_reg = mii_control;
+
+	timedout = 20;
+	while (*mii_control_reg & MAC_MII_BUSY) {
+		udelay(1000);
+		if (--timedout == 0) {
+			printf("au1x00_eth: miiphy_read busy timeout!!\n");
+			return -1;
+		}
+	}
+	*value = *mii_data_reg;
+	return 0;
+}
+
+int  au1x00_miiphy_write(char *devname, unsigned char addr,
+		unsigned char reg, unsigned short value)
+{
+	volatile u32 *mii_control_reg = (volatile u32*)(ETH0_BASE+MAC_MII_CNTRL);
+	volatile u32 *mii_data_reg = (volatile u32*)(ETH0_BASE+MAC_MII_DATA);
+	u32 mii_control;
+	unsigned int timedout = 20;
+
+	while (*mii_control_reg & MAC_MII_BUSY) {
+		udelay(1000);
+		if (--timedout == 0) {
+			printf("au1x00_eth: miiphy_write busy timeout!!\n");
+			return;
+		}
+	}
+
+	mii_control = MAC_SET_MII_SELECT_REG(reg) |
+		MAC_SET_MII_SELECT_PHY(addr) | MAC_MII_WRITE;
+
+	*mii_data_reg = value;
+	*mii_control_reg = mii_control;
+	return 0;
+}
+#endif	/* CONFIG_COMMANDS & CFG_CMD_MII */
+
+#endif /* CONFIG_AU1X00 */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_serial.c b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_serial.c
new file mode 100644
index 0000000..42c668e
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_serial.c
@@ -0,0 +1,135 @@
+/*
+ * AU1X00 UART support
+ *
+ * Hardcoded to UART 0 for now
+ * Speed and options also hardcoded to 115200 8N1
+ *
+ *  Copyright (c) 2003	Thomas.Lange@corelatus.se
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <config.h>
+
+#ifdef CONFIG_AU1X00
+
+#include <common.h>
+#include <asm/au1x00.h>
+
+/******************************************************************************
+*
+* serial_init - initialize a channel
+*
+* This routine initializes the number of data bits, parity
+* and set the selected baud rate. Interrupts are disabled.
+* Set the modem control signals if the option is selected.
+*
+* RETURNS: N/A
+*/
+
+int serial_init (void)
+{
+	volatile u32 *uart_fifoctl = (volatile u32*)(UART0_ADDR+UART_FCR);
+	volatile u32 *uart_enable = (volatile u32*)(UART0_ADDR+UART_ENABLE);
+
+	/* Enable clocks first */
+	*uart_enable = UART_EN_CE;
+
+	/* Then release reset */
+	/* Must release reset before setting other regs */
+	*uart_enable = UART_EN_CE|UART_EN_E;
+
+	/* Activate fifos, reset tx and rx */
+	/* Set tx trigger level to 12 */
+	*uart_fifoctl = UART_FCR_ENABLE_FIFO|UART_FCR_CLEAR_RCVR|
+		UART_FCR_CLEAR_XMIT|UART_FCR_T_TRIGGER_12;
+
+	serial_setbrg();
+
+	return 0;
+}
+
+
+void serial_setbrg (void)
+{
+	volatile u32 *uart_clk = (volatile u32*)(UART0_ADDR+UART_CLK);
+	volatile u32 *uart_lcr = (volatile u32*)(UART0_ADDR+UART_LCR);
+	volatile u32 *sys_powerctrl = (u32 *)SYS_POWERCTRL;
+	int sd;
+	int divisorx2;
+
+	/* sd is system clock divisor			*/
+	/* see section 10.4.5 in au1550 datasheet	*/
+	sd = (*sys_powerctrl & 0x03) + 2;
+
+	/* calulate 2x baudrate and round */
+	divisorx2 = ((CFG_HZ/(sd * 16 * CONFIG_BAUDRATE)));
+
+	if (divisorx2 & 0x01)
+		divisorx2 = divisorx2 + 1;
+
+	*uart_clk = divisorx2 / 2;
+
+	/* Set parity, stop bits and word length to 8N1 */
+	*uart_lcr = UART_LCR_WLEN8;
+}
+
+void serial_putc (const char c)
+{
+	volatile u32 *uart_lsr = (volatile u32*)(UART0_ADDR+UART_LSR);
+	volatile u32 *uart_tx = (volatile u32*)(UART0_ADDR+UART_TX);
+
+	if (c == '\n') serial_putc ('\r');
+
+	/* Wait for fifo to shift out some bytes */
+	while((*uart_lsr&UART_LSR_THRE)==0);
+
+	*uart_tx = (u32)c;
+}
+
+void serial_puts (const char *s)
+{
+	while (*s)
+	{
+		serial_putc (*s++);
+	}
+}
+
+int serial_getc (void)
+{
+	volatile u32 *uart_rx = (volatile u32*)(UART0_ADDR+UART_RX);
+	char c;
+
+	while (!serial_tstc());
+
+	c = (*uart_rx&0xFF);
+	return c;
+}
+
+int serial_tstc (void)
+{
+	volatile u32 *uart_lsr = (volatile u32*)(UART0_ADDR+UART_LSR);
+
+	if(*uart_lsr&UART_LSR_DR){
+		/* Data in rfifo */
+		return(1);
+	}
+	return 0;
+}
+#endif /* CONFIG_SERIAL_AU1X00 */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_usb_ohci.c b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_usb_ohci.c
new file mode 100644
index 0000000..dbf72dc
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_usb_ohci.c
@@ -0,0 +1,1727 @@
+/*
+ * URB OHCI HCD (Host Controller Driver) for USB on the AU1x00.
+ *
+ * (C) Copyright 2003
+ * Gary Jennejohn, DENX Software Engineering <gj@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ *
+ * Note: Part of this code has been derived from linux
+ *
+ */
+/*
+ * IMPORTANT NOTES
+ * 1 - you MUST define LITTLEENDIAN in the configuration file for the
+ *     board or this driver will NOT work!
+ * 2 - this driver is intended for use with USB Mass Storage Devices
+ *     (BBB) ONLY. There is NO support for Interrupt or Isochronous pipes!
+ */
+
+#include <config.h>
+
+#if defined(CONFIG_AU1X00) && defined(CONFIG_USB_OHCI)
+
+/* #include <pci.h> no PCI on the AU1x00 */
+
+#include <common.h>
+#include <malloc.h>
+#include <asm/io.h>
+#include <asm/au1x00.h>
+#include <usb.h>
+#include "au1x00_usb_ohci.h"
+
+#define OHCI_USE_NPS		/* force NoPowerSwitching mode */
+#define OHCI_VERBOSE_DEBUG	/* not always helpful */
+#define OHCI_FILL_TRACE
+
+#define USBH_ENABLE_BE (1<<0)
+#define USBH_ENABLE_C  (1<<1)
+#define USBH_ENABLE_E  (1<<2)
+#define USBH_ENABLE_CE (1<<3)
+#define USBH_ENABLE_RD (1<<4)
+
+#ifdef LITTLEENDIAN
+#define USBH_ENABLE_INIT (USBH_ENABLE_CE | USBH_ENABLE_E | USBH_ENABLE_C)
+#else
+#define USBH_ENABLE_INIT (USBH_ENABLE_CE | USBH_ENABLE_E | USBH_ENABLE_C | USBH_ENABLE_BE)
+#endif
+
+
+/* For initializing controller (mask in an HCFS mode too) */
+#define OHCI_CONTROL_INIT \
+	(OHCI_CTRL_CBSR & 0x3) | OHCI_CTRL_IE | OHCI_CTRL_PLE
+
+#undef readl
+#undef writel
+
+#define readl(a)     au_readl((long)(a))
+#define writel(v,a)  au_writel((v),(int)(a))
+
+#define min_t(type,x,y) ({ type __x = (x); type __y = (y); __x < __y ? __x: __y; })
+
+#define DEBUG
+#ifdef DEBUG
+#define dbg(format, arg...) printf("DEBUG: " format "\n", ## arg)
+#else
+#define dbg(format, arg...) do {} while(0)
+#endif /* DEBUG */
+#define err(format, arg...) printf("ERROR: " format "\n", ## arg)
+#define SHOW_INFO
+#ifdef SHOW_INFO
+#define info(format, arg...) printf("INFO: " format "\n", ## arg)
+#else
+#define info(format, arg...) do {} while(0)
+#endif
+
+#define m16_swap(x) swap_16(x)
+#define m32_swap(x) swap_32(x)
+
+/* global ohci_t */
+static ohci_t gohci;
+/* this must be aligned to a 256 byte boundary */
+struct ohci_hcca ghcca[1];
+/* a pointer to the aligned storage */
+struct ohci_hcca *phcca;
+/* this allocates EDs for all possible endpoints */
+struct ohci_device ohci_dev;
+/* urb_priv */
+urb_priv_t urb_priv;
+/* RHSC flag */
+int got_rhsc;
+/* device which was disconnected */
+struct usb_device *devgone;
+
+/*-------------------------------------------------------------------------*/
+
+/* AMD-756 (D2 rev) reports corrupt register contents in some cases.
+ * The erratum (#4) description is incorrect.  AMD's workaround waits
+ * till some bits (mostly reserved) are clear; ok for all revs.
+ */
+#define OHCI_QUIRK_AMD756 0xabcd
+#define read_roothub(hc, register, mask) ({ \
+	u32 temp = readl (&hc->regs->roothub.register); \
+	if (hc->flags & OHCI_QUIRK_AMD756) \
+		while (temp & mask) \
+			temp = readl (&hc->regs->roothub.register); \
+	temp; })
+
+static u32 roothub_a (struct ohci *hc)
+	{ return read_roothub (hc, a, 0xfc0fe000); }
+static inline u32 roothub_b (struct ohci *hc)
+	{ return readl (&hc->regs->roothub.b); }
+static inline u32 roothub_status (struct ohci *hc)
+	{ return readl (&hc->regs->roothub.status); }
+static u32 roothub_portstatus (struct ohci *hc, int i)
+	{ return read_roothub (hc, portstatus [i], 0xffe0fce0); }
+
+
+/* forward declaration */
+static int hc_interrupt (void);
+static void
+td_submit_job (struct usb_device * dev, unsigned long pipe, void * buffer,
+	int transfer_len, struct devrequest * setup, urb_priv_t * urb, int interval);
+
+/*-------------------------------------------------------------------------*
+ * URB support functions
+ *-------------------------------------------------------------------------*/
+
+/* free HCD-private data associated with this URB */
+
+static void urb_free_priv (urb_priv_t * urb)
+{
+	int		i;
+	int		last;
+	struct td	* td;
+
+	last = urb->length - 1;
+	if (last >= 0) {
+		for (i = 0; i <= last; i++) {
+			td = urb->td[i];
+			if (td) {
+				td->usb_dev = NULL;
+				urb->td[i] = NULL;
+			}
+		}
+	}
+}
+
+/*-------------------------------------------------------------------------*/
+
+#ifdef DEBUG
+static int sohci_get_current_frame_number (struct usb_device * dev);
+
+/* debug| print the main components of an URB
+ * small: 0) header + data packets 1) just header */
+
+static void pkt_print (struct usb_device * dev, unsigned long pipe, void * buffer,
+	int transfer_len, struct devrequest * setup, char * str, int small)
+{
+	urb_priv_t * purb = &urb_priv;
+
+	dbg("%s URB:[%4x] dev:%2d,ep:%2d-%c,type:%s,len:%d/%d stat:%#lx",
+			str,
+			sohci_get_current_frame_number (dev),
+			usb_pipedevice (pipe),
+			usb_pipeendpoint (pipe),
+			usb_pipeout (pipe)? 'O': 'I',
+			usb_pipetype (pipe) < 2? (usb_pipeint (pipe)? "INTR": "ISOC"):
+				(usb_pipecontrol (pipe)? "CTRL": "BULK"),
+			purb->actual_length,
+			transfer_len, dev->status);
+#ifdef	OHCI_VERBOSE_DEBUG
+	if (!small) {
+		int i, len;
+
+		if (usb_pipecontrol (pipe)) {
+			printf (__FILE__ ": cmd(8):");
+			for (i = 0; i < 8 ; i++)
+				printf (" %02x", ((__u8 *) setup) [i]);
+			printf ("\n");
+		}
+		if (transfer_len > 0 && buffer) {
+			printf (__FILE__ ": data(%d/%d):",
+				purb->actual_length,
+				transfer_len);
+			len = usb_pipeout (pipe)?
+					transfer_len: purb->actual_length;
+			for (i = 0; i < 16 && i < len; i++)
+				printf (" %02x", ((__u8 *) buffer) [i]);
+			printf ("%s\n", i < len? "...": "");
+		}
+	}
+#endif
+}
+
+/* just for debugging; prints non-empty branches of the int ed tree inclusive iso eds*/
+void ep_print_int_eds (ohci_t *ohci, char * str) {
+	int i, j;
+	 __u32 * ed_p;
+	for (i= 0; i < 32; i++) {
+		j = 5;
+		ed_p = &(ohci->hcca->int_table [i]);
+		if (*ed_p == 0)
+		    continue;
+		printf (__FILE__ ": %s branch int %2d(%2x):", str, i, i);
+		while (*ed_p != 0 && j--) {
+			ed_t *ed = (ed_t *)m32_swap(ed_p);
+			printf (" ed: %4x;", ed->hwINFO);
+			ed_p = &ed->hwNextED;
+		}
+		printf ("\n");
+	}
+}
+
+static void ohci_dump_intr_mask (char *label, __u32 mask)
+{
+	dbg ("%s: 0x%08x%s%s%s%s%s%s%s%s%s",
+		label,
+		mask,
+		(mask & OHCI_INTR_MIE) ? " MIE" : "",
+		(mask & OHCI_INTR_OC) ? " OC" : "",
+		(mask & OHCI_INTR_RHSC) ? " RHSC" : "",
+		(mask & OHCI_INTR_FNO) ? " FNO" : "",
+		(mask & OHCI_INTR_UE) ? " UE" : "",
+		(mask & OHCI_INTR_RD) ? " RD" : "",
+		(mask & OHCI_INTR_SF) ? " SF" : "",
+		(mask & OHCI_INTR_WDH) ? " WDH" : "",
+		(mask & OHCI_INTR_SO) ? " SO" : ""
+		);
+}
+
+static void maybe_print_eds (char *label, __u32 value)
+{
+	ed_t *edp = (ed_t *)value;
+
+	if (value) {
+		dbg ("%s %08x", label, value);
+		dbg ("%08x", edp->hwINFO);
+		dbg ("%08x", edp->hwTailP);
+		dbg ("%08x", edp->hwHeadP);
+		dbg ("%08x", edp->hwNextED);
+	}
+}
+
+static char * hcfs2string (int state)
+{
+	switch (state) {
+		case OHCI_USB_RESET:	return "reset";
+		case OHCI_USB_RESUME:	return "resume";
+		case OHCI_USB_OPER:	return "operational";
+		case OHCI_USB_SUSPEND:	return "suspend";
+	}
+	return "?";
+}
+
+/* dump control and status registers */
+static void ohci_dump_status (ohci_t *controller)
+{
+	struct ohci_regs	*regs = controller->regs;
+	__u32			temp;
+
+	temp = readl (&regs->revision) & 0xff;
+	if (temp != 0x10)
+		dbg ("spec %d.%d", (temp >> 4), (temp & 0x0f));
+
+	temp = readl (&regs->control);
+	dbg ("control: 0x%08x%s%s%s HCFS=%s%s%s%s%s CBSR=%d", temp,
+		(temp & OHCI_CTRL_RWE) ? " RWE" : "",
+		(temp & OHCI_CTRL_RWC) ? " RWC" : "",
+		(temp & OHCI_CTRL_IR) ? " IR" : "",
+		hcfs2string (temp & OHCI_CTRL_HCFS),
+		(temp & OHCI_CTRL_BLE) ? " BLE" : "",
+		(temp & OHCI_CTRL_CLE) ? " CLE" : "",
+		(temp & OHCI_CTRL_IE) ? " IE" : "",
+		(temp & OHCI_CTRL_PLE) ? " PLE" : "",
+		temp & OHCI_CTRL_CBSR
+		);
+
+	temp = readl (&regs->cmdstatus);
+	dbg ("cmdstatus: 0x%08x SOC=%d%s%s%s%s", temp,
+		(temp & OHCI_SOC) >> 16,
+		(temp & OHCI_OCR) ? " OCR" : "",
+		(temp & OHCI_BLF) ? " BLF" : "",
+		(temp & OHCI_CLF) ? " CLF" : "",
+		(temp & OHCI_HCR) ? " HCR" : ""
+		);
+
+	ohci_dump_intr_mask ("intrstatus", readl (&regs->intrstatus));
+	ohci_dump_intr_mask ("intrenable", readl (&regs->intrenable));
+
+	maybe_print_eds ("ed_periodcurrent", readl (&regs->ed_periodcurrent));
+
+	maybe_print_eds ("ed_controlhead", readl (&regs->ed_controlhead));
+	maybe_print_eds ("ed_controlcurrent", readl (&regs->ed_controlcurrent));
+
+	maybe_print_eds ("ed_bulkhead", readl (&regs->ed_bulkhead));
+	maybe_print_eds ("ed_bulkcurrent", readl (&regs->ed_bulkcurrent));
+
+	maybe_print_eds ("donehead", readl (&regs->donehead));
+}
+
+static void ohci_dump_roothub (ohci_t *controller, int verbose)
+{
+	__u32			temp, ndp, i;
+
+	temp = roothub_a (controller);
+	ndp = (temp & RH_A_NDP);
+
+	if (verbose) {
+		dbg ("roothub.a: %08x POTPGT=%d%s%s%s%s%s NDP=%d", temp,
+			((temp & RH_A_POTPGT) >> 24) & 0xff,
+			(temp & RH_A_NOCP) ? " NOCP" : "",
+			(temp & RH_A_OCPM) ? " OCPM" : "",
+			(temp & RH_A_DT) ? " DT" : "",
+			(temp & RH_A_NPS) ? " NPS" : "",
+			(temp & RH_A_PSM) ? " PSM" : "",
+			ndp
+			);
+		temp = roothub_b (controller);
+		dbg ("roothub.b: %08x PPCM=%04x DR=%04x",
+			temp,
+			(temp & RH_B_PPCM) >> 16,
+			(temp & RH_B_DR)
+			);
+		temp = roothub_status (controller);
+		dbg ("roothub.status: %08x%s%s%s%s%s%s",
+			temp,
+			(temp & RH_HS_CRWE) ? " CRWE" : "",
+			(temp & RH_HS_OCIC) ? " OCIC" : "",
+			(temp & RH_HS_LPSC) ? " LPSC" : "",
+			(temp & RH_HS_DRWE) ? " DRWE" : "",
+			(temp & RH_HS_OCI) ? " OCI" : "",
+			(temp & RH_HS_LPS) ? " LPS" : ""
+			);
+	}
+
+	for (i = 0; i < ndp; i++) {
+		temp = roothub_portstatus (controller, i);
+		dbg ("roothub.portstatus [%d] = 0x%08x%s%s%s%s%s%s%s%s%s%s%s%s",
+			i,
+			temp,
+			(temp & RH_PS_PRSC) ? " PRSC" : "",
+			(temp & RH_PS_OCIC) ? " OCIC" : "",
+			(temp & RH_PS_PSSC) ? " PSSC" : "",
+			(temp & RH_PS_PESC) ? " PESC" : "",
+			(temp & RH_PS_CSC) ? " CSC" : "",
+
+			(temp & RH_PS_LSDA) ? " LSDA" : "",
+			(temp & RH_PS_PPS) ? " PPS" : "",
+			(temp & RH_PS_PRS) ? " PRS" : "",
+			(temp & RH_PS_POCI) ? " POCI" : "",
+			(temp & RH_PS_PSS) ? " PSS" : "",
+
+			(temp & RH_PS_PES) ? " PES" : "",
+			(temp & RH_PS_CCS) ? " CCS" : ""
+			);
+	}
+}
+
+static void ohci_dump (ohci_t *controller, int verbose)
+{
+	dbg ("OHCI controller usb-%s state", controller->slot_name);
+
+	/* dumps some of the state we know about */
+	ohci_dump_status (controller);
+	if (verbose)
+		ep_print_int_eds (controller, "hcca");
+	dbg ("hcca frame #%04x", controller->hcca->frame_no);
+	ohci_dump_roothub (controller, 1);
+}
+
+
+#endif /* DEBUG */
+
+/*-------------------------------------------------------------------------*
+ * Interface functions (URB)
+ *-------------------------------------------------------------------------*/
+
+/* get a transfer request */
+
+int sohci_submit_job(struct usb_device *dev, unsigned long pipe, void *buffer,
+		int transfer_len, struct devrequest *setup, int interval)
+{
+	ohci_t *ohci;
+	ed_t * ed;
+	urb_priv_t *purb_priv;
+	int i, size = 0;
+
+	ohci = &gohci;
+
+	/* when controller's hung, permit only roothub cleanup attempts
+	 * such as powering down ports */
+	if (ohci->disabled) {
+		err("sohci_submit_job: EPIPE");
+		return -1;
+	}
+
+	/* every endpoint has a ed, locate and fill it */
+	if (!(ed = ep_add_ed (dev, pipe))) {
+		err("sohci_submit_job: ENOMEM");
+		return -1;
+	}
+
+	/* for the private part of the URB we need the number of TDs (size) */
+	switch (usb_pipetype (pipe)) {
+		case PIPE_BULK: /* one TD for every 4096 Byte */
+			size = (transfer_len - 1) / 4096 + 1;
+			break;
+		case PIPE_CONTROL: /* 1 TD for setup, 1 for ACK and 1 for every 4096 B */
+			size = (transfer_len == 0)? 2:
+						(transfer_len - 1) / 4096 + 3;
+			break;
+	}
+
+	if (size >= (N_URB_TD - 1)) {
+		err("need %d TDs, only have %d", size, N_URB_TD);
+		return -1;
+	}
+	purb_priv = &urb_priv;
+	purb_priv->pipe = pipe;
+
+	/* fill the private part of the URB */
+	purb_priv->length = size;
+	purb_priv->ed = ed;
+	purb_priv->actual_length = 0;
+
+	/* allocate the TDs */
+	/* note that td[0] was allocated in ep_add_ed */
+	for (i = 0; i < size; i++) {
+		purb_priv->td[i] = td_alloc (dev);
+		if (!purb_priv->td[i]) {
+			purb_priv->length = i;
+			urb_free_priv (purb_priv);
+			err("sohci_submit_job: ENOMEM");
+			return -1;
+		}
+	}
+
+	if (ed->state == ED_NEW || (ed->state & ED_DEL)) {
+		urb_free_priv (purb_priv);
+		err("sohci_submit_job: EINVAL");
+		return -1;
+	}
+
+	/* link the ed into a chain if is not already */
+	if (ed->state != ED_OPER)
+		ep_link (ohci, ed);
+
+	/* fill the TDs and link it to the ed */
+	td_submit_job(dev, pipe, buffer, transfer_len, setup, purb_priv, interval);
+
+	return 0;
+}
+
+/*-------------------------------------------------------------------------*/
+
+#ifdef DEBUG
+/* tell us the current USB frame number */
+
+static int sohci_get_current_frame_number (struct usb_device *usb_dev)
+{
+	ohci_t *ohci = &gohci;
+
+	return m16_swap (ohci->hcca->frame_no);
+}
+#endif
+
+/*-------------------------------------------------------------------------*
+ * ED handling functions
+ *-------------------------------------------------------------------------*/
+
+/* link an ed into one of the HC chains */
+
+static int ep_link (ohci_t *ohci, ed_t *edi)
+{
+	volatile ed_t *ed = edi;
+
+	ed->state = ED_OPER;
+
+	switch (ed->type) {
+	case PIPE_CONTROL:
+		ed->hwNextED = 0;
+		if (ohci->ed_controltail == NULL) {
+			writel ((long)ed, &ohci->regs->ed_controlhead);
+		} else {
+			ohci->ed_controltail->hwNextED = m32_swap (ed);
+		}
+		ed->ed_prev = ohci->ed_controltail;
+		if (!ohci->ed_controltail && !ohci->ed_rm_list[0] &&
+			!ohci->ed_rm_list[1] && !ohci->sleeping) {
+			ohci->hc_control |= OHCI_CTRL_CLE;
+			writel (ohci->hc_control, &ohci->regs->control);
+		}
+		ohci->ed_controltail = edi;
+		break;
+
+	case PIPE_BULK:
+		ed->hwNextED = 0;
+		if (ohci->ed_bulktail == NULL) {
+			writel ((long)ed, &ohci->regs->ed_bulkhead);
+		} else {
+			ohci->ed_bulktail->hwNextED = m32_swap (ed);
+		}
+		ed->ed_prev = ohci->ed_bulktail;
+		if (!ohci->ed_bulktail && !ohci->ed_rm_list[0] &&
+			!ohci->ed_rm_list[1] && !ohci->sleeping) {
+			ohci->hc_control |= OHCI_CTRL_BLE;
+			writel (ohci->hc_control, &ohci->regs->control);
+		}
+		ohci->ed_bulktail = edi;
+		break;
+	}
+	return 0;
+}
+
+/*-------------------------------------------------------------------------*/
+
+/* unlink an ed from one of the HC chains.
+ * just the link to the ed is unlinked.
+ * the link from the ed still points to another operational ed or 0
+ * so the HC can eventually finish the processing of the unlinked ed */
+
+static int ep_unlink (ohci_t *ohci, ed_t *ed)
+{
+	ed->hwINFO |= m32_swap (OHCI_ED_SKIP);
+
+	switch (ed->type) {
+	case PIPE_CONTROL:
+		if (ed->ed_prev == NULL) {
+			if (!ed->hwNextED) {
+				ohci->hc_control &= ~OHCI_CTRL_CLE;
+				writel (ohci->hc_control, &ohci->regs->control);
+			}
+			writel (m32_swap (*((__u32 *)&ed->hwNextED)), &ohci->regs->ed_controlhead);
+		} else {
+			ed->ed_prev->hwNextED = ed->hwNextED;
+		}
+		if (ohci->ed_controltail == ed) {
+			ohci->ed_controltail = ed->ed_prev;
+		} else {
+			((ed_t *)m32_swap (*((__u32 *)&ed->hwNextED)))->ed_prev = ed->ed_prev;
+		}
+		break;
+
+	case PIPE_BULK:
+		if (ed->ed_prev == NULL) {
+			if (!ed->hwNextED) {
+				ohci->hc_control &= ~OHCI_CTRL_BLE;
+				writel (ohci->hc_control, &ohci->regs->control);
+			}
+			writel (m32_swap (*((__u32 *)&ed->hwNextED)), &ohci->regs->ed_bulkhead);
+		} else {
+			ed->ed_prev->hwNextED = ed->hwNextED;
+		}
+		if (ohci->ed_bulktail == ed) {
+			ohci->ed_bulktail = ed->ed_prev;
+		} else {
+			((ed_t *)m32_swap (*((__u32 *)&ed->hwNextED)))->ed_prev = ed->ed_prev;
+		}
+		break;
+	}
+	ed->state = ED_UNLINK;
+	return 0;
+}
+
+
+/*-------------------------------------------------------------------------*/
+
+/* add/reinit an endpoint; this should be done once at the usb_set_configuration command,
+ * but the USB stack is a little bit stateless	so we do it at every transaction
+ * if the state of the ed is ED_NEW then a dummy td is added and the state is changed to ED_UNLINK
+ * in all other cases the state is left unchanged
+ * the ed info fields are setted anyway even though most of them should not change */
+
+static ed_t * ep_add_ed (struct usb_device *usb_dev, unsigned long pipe)
+{
+	td_t *td;
+	ed_t *ed_ret;
+	volatile ed_t *ed;
+
+	ed = ed_ret = &ohci_dev.ed[(usb_pipeendpoint (pipe) << 1) |
+			(usb_pipecontrol (pipe)? 0: usb_pipeout (pipe))];
+
+	if ((ed->state & ED_DEL) || (ed->state & ED_URB_DEL)) {
+		err("ep_add_ed: pending delete");
+		/* pending delete request */
+		return NULL;
+	}
+
+	if (ed->state == ED_NEW) {
+		ed->hwINFO = m32_swap (OHCI_ED_SKIP); /* skip ed */
+		/* dummy td; end of td list for ed */
+		td = td_alloc (usb_dev);
+		ed->hwTailP = m32_swap (td);
+		ed->hwHeadP = ed->hwTailP;
+		ed->state = ED_UNLINK;
+		ed->type = usb_pipetype (pipe);
+		ohci_dev.ed_cnt++;
+	}
+
+	ed->hwINFO = m32_swap (usb_pipedevice (pipe)
+			| usb_pipeendpoint (pipe) << 7
+			| (usb_pipeisoc (pipe)? 0x8000: 0)
+			| (usb_pipecontrol (pipe)? 0: (usb_pipeout (pipe)? 0x800: 0x1000))
+			| usb_pipeslow (pipe) << 13
+			| usb_maxpacket (usb_dev, pipe) << 16);
+
+	return ed_ret;
+}
+
+/*-------------------------------------------------------------------------*
+ * TD handling functions
+ *-------------------------------------------------------------------------*/
+
+/* enqueue next TD for this URB (OHCI spec 5.2.8.2) */
+
+static void td_fill (ohci_t *ohci, unsigned int info,
+	void *data, int len,
+	struct usb_device *dev, int index, urb_priv_t *urb_priv)
+{
+	volatile td_t  *td, *td_pt;
+#ifdef OHCI_FILL_TRACE
+	int i;
+#endif
+
+	if (index > urb_priv->length) {
+		err("index > length");
+		return;
+	}
+	/* use this td as the next dummy */
+	td_pt = urb_priv->td [index];
+	td_pt->hwNextTD = 0;
+
+	/* fill the old dummy TD */
+	td = urb_priv->td [index] = (td_t *)(m32_swap (urb_priv->ed->hwTailP) & ~0xf);
+
+	td->ed = urb_priv->ed;
+	td->next_dl_td = NULL;
+	td->index = index;
+	td->data = (__u32)data;
+#ifdef OHCI_FILL_TRACE
+	if (1 || ((usb_pipetype(urb_priv->pipe) == PIPE_BULK) && usb_pipeout(urb_priv->pipe))) {
+		for (i = 0; i < len; i++)
+		printf("td->data[%d] %#2x\n",i, ((unsigned char *)(td->data+0x80000000))[i]);
+	}
+#endif
+	if (!len)
+		data = 0;
+
+	td->hwINFO = m32_swap (info);
+	td->hwCBP = m32_swap (data);
+	if (data)
+		td->hwBE = m32_swap (data + len - 1);
+	else
+		td->hwBE = 0;
+	td->hwNextTD = m32_swap (td_pt);
+	td->hwPSW [0] = m16_swap (((__u32)data & 0x0FFF) | 0xE000);
+
+	/* append to queue */
+	td->ed->hwTailP = td->hwNextTD;
+}
+
+/*-------------------------------------------------------------------------*/
+
+/* prepare all TDs of a transfer */
+
+#define kseg_to_phys(x)	  ((void *)((__u32)(x) - 0x80000000))
+
+static void td_submit_job (struct usb_device *dev, unsigned long pipe, void *buffer,
+	int transfer_len, struct devrequest *setup, urb_priv_t *urb, int interval)
+{
+	ohci_t *ohci = &gohci;
+	int data_len = transfer_len;
+	void *data;
+	int cnt = 0;
+	__u32 info = 0;
+	unsigned int toggle = 0;
+
+	/* OHCI handles the DATA-toggles itself, we just use the USB-toggle bits for reseting */
+	if(usb_gettoggle(dev, usb_pipeendpoint(pipe), usb_pipeout(pipe))) {
+		toggle = TD_T_TOGGLE;
+	} else {
+		toggle = TD_T_DATA0;
+		usb_settoggle(dev, usb_pipeendpoint(pipe), usb_pipeout(pipe), 1);
+	}
+	urb->td_cnt = 0;
+	if (data_len)
+		data = kseg_to_phys(buffer);
+	else
+		data = 0;
+
+	switch (usb_pipetype (pipe)) {
+	case PIPE_BULK:
+		info = usb_pipeout (pipe)?
+			TD_CC | TD_DP_OUT : TD_CC | TD_DP_IN ;
+		while(data_len > 4096) {
+			td_fill (ohci, info | (cnt? TD_T_TOGGLE:toggle), data, 4096, dev, cnt, urb);
+			data += 4096; data_len -= 4096; cnt++;
+		}
+		info = usb_pipeout (pipe)?
+			TD_CC | TD_DP_OUT : TD_CC | TD_R | TD_DP_IN ;
+		td_fill (ohci, info | (cnt? TD_T_TOGGLE:toggle), data, data_len, dev, cnt, urb);
+		cnt++;
+
+		if (!ohci->sleeping)
+			writel (OHCI_BLF, &ohci->regs->cmdstatus); /* start bulk list */
+		break;
+
+	case PIPE_CONTROL:
+		info = TD_CC | TD_DP_SETUP | TD_T_DATA0;
+		td_fill (ohci, info, kseg_to_phys(setup), 8, dev, cnt++, urb);
+		if (data_len > 0) {
+			info = usb_pipeout (pipe)?
+				TD_CC | TD_R | TD_DP_OUT | TD_T_DATA1 : TD_CC | TD_R | TD_DP_IN | TD_T_DATA1;
+			/* NOTE:  mishandles transfers >8K, some >4K */
+			td_fill (ohci, info, data, data_len, dev, cnt++, urb);
+		}
+		info = usb_pipeout (pipe)?
+			TD_CC | TD_DP_IN | TD_T_DATA1: TD_CC | TD_DP_OUT | TD_T_DATA1;
+		td_fill (ohci, info, data, 0, dev, cnt++, urb);
+		if (!ohci->sleeping)
+			writel (OHCI_CLF, &ohci->regs->cmdstatus); /* start Control list */
+		break;
+	}
+	if (urb->length != cnt)
+		dbg("TD LENGTH %d != CNT %d", urb->length, cnt);
+}
+
+/*-------------------------------------------------------------------------*
+ * Done List handling functions
+ *-------------------------------------------------------------------------*/
+
+
+/* calculate the transfer length and update the urb */
+
+static void dl_transfer_length(td_t * td)
+{
+	__u32 tdINFO, tdBE, tdCBP;
+	urb_priv_t *lurb_priv = &urb_priv;
+
+	tdINFO = m32_swap (td->hwINFO);
+	tdBE   = m32_swap (td->hwBE);
+	tdCBP  = m32_swap (td->hwCBP);
+
+
+	if (!(usb_pipetype (lurb_priv->pipe) == PIPE_CONTROL &&
+	    ((td->index == 0) || (td->index == lurb_priv->length - 1)))) {
+		if (tdBE != 0) {
+			if (td->hwCBP == 0)
+				lurb_priv->actual_length += tdBE - td->data + 1;
+			else
+				lurb_priv->actual_length += tdCBP - td->data;
+		}
+	}
+}
+
+/*-------------------------------------------------------------------------*/
+
+/* replies to the request have to be on a FIFO basis so
+ * we reverse the reversed done-list */
+
+static td_t * dl_reverse_done_list (ohci_t *ohci)
+{
+	__u32 td_list_hc;
+	td_t *td_rev = NULL;
+	td_t *td_list = NULL;
+	urb_priv_t *lurb_priv = NULL;
+
+	td_list_hc = m32_swap (ohci->hcca->done_head) & 0xfffffff0;
+	ohci->hcca->done_head = 0;
+
+	while (td_list_hc) {
+		td_list = (td_t *)td_list_hc;
+
+		if (TD_CC_GET (m32_swap (td_list->hwINFO))) {
+			lurb_priv = &urb_priv;
+			dbg(" USB-error/status: %x : %p",
+					TD_CC_GET (m32_swap (td_list->hwINFO)), td_list);
+			if (td_list->ed->hwHeadP & m32_swap (0x1)) {
+				if (lurb_priv && ((td_list->index + 1) < lurb_priv->length)) {
+					td_list->ed->hwHeadP =
+						(lurb_priv->td[lurb_priv->length - 1]->hwNextTD & m32_swap (0xfffffff0)) |
+									(td_list->ed->hwHeadP & m32_swap (0x2));
+					lurb_priv->td_cnt += lurb_priv->length - td_list->index - 1;
+				} else
+					td_list->ed->hwHeadP &= m32_swap (0xfffffff2);
+			}
+		}
+
+		td_list->next_dl_td = td_rev;
+		td_rev = td_list;
+		td_list_hc = m32_swap (td_list->hwNextTD) & 0xfffffff0;
+	}
+	return td_list;
+}
+
+/*-------------------------------------------------------------------------*/
+
+/* td done list */
+static int dl_done_list (ohci_t *ohci, td_t *td_list)
+{
+	td_t *td_list_next = NULL;
+	ed_t *ed;
+	int cc = 0;
+	int stat = 0;
+	/* urb_t *urb; */
+	urb_priv_t *lurb_priv;
+	__u32 tdINFO, edHeadP, edTailP;
+
+	while (td_list) {
+		td_list_next = td_list->next_dl_td;
+
+		lurb_priv = &urb_priv;
+		tdINFO = m32_swap (td_list->hwINFO);
+
+		ed = td_list->ed;
+
+		dl_transfer_length(td_list);
+
+		/* error code of transfer */
+		cc = TD_CC_GET (tdINFO);
+		if (cc != 0) {
+			dbg("ConditionCode %#x", cc);
+			stat = cc_to_error[cc];
+		}
+
+		if (ed->state != ED_NEW) {
+			edHeadP = m32_swap (ed->hwHeadP) & 0xfffffff0;
+			edTailP = m32_swap (ed->hwTailP);
+
+			/* unlink eds if they are not busy */
+			if ((edHeadP == edTailP) && (ed->state == ED_OPER))
+				ep_unlink (ohci, ed);
+		}
+
+		td_list = td_list_next;
+	}
+	return stat;
+}
+
+/*-------------------------------------------------------------------------*
+ * Virtual Root Hub
+ *-------------------------------------------------------------------------*/
+
+/* Device descriptor */
+static __u8 root_hub_dev_des[] =
+{
+	0x12,	    /*	__u8  bLength; */
+	0x01,	    /*	__u8  bDescriptorType; Device */
+	0x10,	    /*	__u16 bcdUSB; v1.1 */
+	0x01,
+	0x09,	    /*	__u8  bDeviceClass; HUB_CLASSCODE */
+	0x00,	    /*	__u8  bDeviceSubClass; */
+	0x00,	    /*	__u8  bDeviceProtocol; */
+	0x08,	    /*	__u8  bMaxPacketSize0; 8 Bytes */
+	0x00,	    /*	__u16 idVendor; */
+	0x00,
+	0x00,	    /*	__u16 idProduct; */
+	0x00,
+	0x00,	    /*	__u16 bcdDevice; */
+	0x00,
+	0x00,	    /*	__u8  iManufacturer; */
+	0x01,	    /*	__u8  iProduct; */
+	0x00,	    /*	__u8  iSerialNumber; */
+	0x01	    /*	__u8  bNumConfigurations; */
+};
+
+
+/* Configuration descriptor */
+static __u8 root_hub_config_des[] =
+{
+	0x09,	    /*	__u8  bLength; */
+	0x02,	    /*	__u8  bDescriptorType; Configuration */
+	0x19,	    /*	__u16 wTotalLength; */
+	0x00,
+	0x01,	    /*	__u8  bNumInterfaces; */
+	0x01,	    /*	__u8  bConfigurationValue; */
+	0x00,	    /*	__u8  iConfiguration; */
+	0x40,	    /*	__u8  bmAttributes;
+		 Bit 7: Bus-powered, 6: Self-powered, 5 Remote-wakwup, 4..0: resvd */
+	0x00,	    /*	__u8  MaxPower; */
+
+	/* interface */
+	0x09,	    /*	__u8  if_bLength; */
+	0x04,	    /*	__u8  if_bDescriptorType; Interface */
+	0x00,	    /*	__u8  if_bInterfaceNumber; */
+	0x00,	    /*	__u8  if_bAlternateSetting; */
+	0x01,	    /*	__u8  if_bNumEndpoints; */
+	0x09,	    /*	__u8  if_bInterfaceClass; HUB_CLASSCODE */
+	0x00,	    /*	__u8  if_bInterfaceSubClass; */
+	0x00,	    /*	__u8  if_bInterfaceProtocol; */
+	0x00,	    /*	__u8  if_iInterface; */
+
+	/* endpoint */
+	0x07,	    /*	__u8  ep_bLength; */
+	0x05,	    /*	__u8  ep_bDescriptorType; Endpoint */
+	0x81,	    /*	__u8  ep_bEndpointAddress; IN Endpoint 1 */
+	0x03,	    /*	__u8  ep_bmAttributes; Interrupt */
+	0x02,	    /*	__u16 ep_wMaxPacketSize; ((MAX_ROOT_PORTS + 1) / 8 */
+	0x00,
+	0xff	    /*	__u8  ep_bInterval; 255 ms */
+};
+
+static unsigned char root_hub_str_index0[] =
+{
+	0x04,			/*  __u8  bLength; */
+	0x03,			/*  __u8  bDescriptorType; String-descriptor */
+	0x09,			/*  __u8  lang ID */
+	0x04,			/*  __u8  lang ID */
+};
+
+static unsigned char root_hub_str_index1[] =
+{
+	28,			/*  __u8  bLength; */
+	0x03,			/*  __u8  bDescriptorType; String-descriptor */
+	'O',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'H',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'C',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'I',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	' ',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'R',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'o',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'o',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	't',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	' ',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'H',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'u',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+	'b',			/*  __u8  Unicode */
+	0,				/*  __u8  Unicode */
+};
+
+/* Hub class-specific descriptor is constructed dynamically */
+
+
+/*-------------------------------------------------------------------------*/
+
+#define OK(x)			len = (x); break
+#ifdef DEBUG
+#define WR_RH_STAT(x)		{info("WR:status %#8x", (x));writel((x), &gohci.regs->roothub.status);}
+#define WR_RH_PORTSTAT(x)	{info("WR:portstatus[%d] %#8x", wIndex-1, (x));writel((x), &gohci.regs->roothub.portstatus[wIndex-1]);}
+#else
+#define WR_RH_STAT(x)		writel((x), &gohci.regs->roothub.status)
+#define WR_RH_PORTSTAT(x)	writel((x), &gohci.regs->roothub.portstatus[wIndex-1])
+#endif
+#define RD_RH_STAT		roothub_status(&gohci)
+#define RD_RH_PORTSTAT		roothub_portstatus(&gohci,wIndex-1)
+
+/* request to virtual root hub */
+
+int rh_check_port_status(ohci_t *controller)
+{
+	__u32 temp, ndp, i;
+	int res;
+
+	res = -1;
+	temp = roothub_a (controller);
+	ndp = (temp & RH_A_NDP);
+	for (i = 0; i < ndp; i++) {
+		temp = roothub_portstatus (controller, i);
+		/* check for a device disconnect */
+		if (((temp & (RH_PS_PESC | RH_PS_CSC)) ==
+			(RH_PS_PESC | RH_PS_CSC)) &&
+			((temp & RH_PS_CCS) == 0)) {
+			res = i;
+			break;
+		}
+	}
+	return res;
+}
+
+static int ohci_submit_rh_msg(struct usb_device *dev, unsigned long pipe,
+		void *buffer, int transfer_len, struct devrequest *cmd)
+{
+	void * data = buffer;
+	int leni = transfer_len;
+	int len = 0;
+	int stat = 0;
+	__u32 datab[4];
+	__u8 *data_buf = (__u8 *)datab;
+	__u16 bmRType_bReq;
+	__u16 wValue;
+	__u16 wIndex;
+	__u16 wLength;
+
+#ifdef DEBUG
+urb_priv.actual_length = 0;
+pkt_print(dev, pipe, buffer, transfer_len, cmd, "SUB(rh)", usb_pipein(pipe));
+#else
+	wait_ms(1);
+#endif
+	if ((pipe & PIPE_INTERRUPT) == PIPE_INTERRUPT) {
+		info("Root-Hub submit IRQ: NOT implemented");
+		return 0;
+	}
+
+	bmRType_bReq  = cmd->requesttype | (cmd->request << 8);
+	wValue	      = m16_swap (cmd->value);
+	wIndex	      = m16_swap (cmd->index);
+	wLength	      = m16_swap (cmd->length);
+
+	info("Root-Hub: adr: %2x cmd(%1x): %08x %04x %04x %04x",
+		dev->devnum, 8, bmRType_bReq, wValue, wIndex, wLength);
+
+	switch (bmRType_bReq) {
+	/* Request Destination:
+	   without flags: Device,
+	   RH_INTERFACE: interface,
+	   RH_ENDPOINT: endpoint,
+	   RH_CLASS means HUB here,
+	   RH_OTHER | RH_CLASS	almost ever means HUB_PORT here
+	*/
+
+	case RH_GET_STATUS:
+			*(__u16 *) data_buf = m16_swap (1); OK (2);
+	case RH_GET_STATUS | RH_INTERFACE:
+			*(__u16 *) data_buf = m16_swap (0); OK (2);
+	case RH_GET_STATUS | RH_ENDPOINT:
+			*(__u16 *) data_buf = m16_swap (0); OK (2);
+	case RH_GET_STATUS | RH_CLASS:
+			*(__u32 *) data_buf = m32_swap (
+				RD_RH_STAT & ~(RH_HS_CRWE | RH_HS_DRWE));
+			OK (4);
+	case RH_GET_STATUS | RH_OTHER | RH_CLASS:
+			*(__u32 *) data_buf = m32_swap (RD_RH_PORTSTAT); OK (4);
+
+	case RH_CLEAR_FEATURE | RH_ENDPOINT:
+		switch (wValue) {
+			case (RH_ENDPOINT_STALL): OK (0);
+		}
+		break;
+
+	case RH_CLEAR_FEATURE | RH_CLASS:
+		switch (wValue) {
+			case RH_C_HUB_LOCAL_POWER:
+				OK(0);
+			case (RH_C_HUB_OVER_CURRENT):
+					WR_RH_STAT(RH_HS_OCIC); OK (0);
+		}
+		break;
+
+	case RH_CLEAR_FEATURE | RH_OTHER | RH_CLASS:
+		switch (wValue) {
+			case (RH_PORT_ENABLE):
+					WR_RH_PORTSTAT (RH_PS_CCS ); OK (0);
+			case (RH_PORT_SUSPEND):
+					WR_RH_PORTSTAT (RH_PS_POCI); OK (0);
+			case (RH_PORT_POWER):
+					WR_RH_PORTSTAT (RH_PS_LSDA); OK (0);
+			case (RH_C_PORT_CONNECTION):
+					WR_RH_PORTSTAT (RH_PS_CSC ); OK (0);
+			case (RH_C_PORT_ENABLE):
+					WR_RH_PORTSTAT (RH_PS_PESC); OK (0);
+			case (RH_C_PORT_SUSPEND):
+					WR_RH_PORTSTAT (RH_PS_PSSC); OK (0);
+			case (RH_C_PORT_OVER_CURRENT):
+					WR_RH_PORTSTAT (RH_PS_OCIC); OK (0);
+			case (RH_C_PORT_RESET):
+					WR_RH_PORTSTAT (RH_PS_PRSC); OK (0);
+		}
+		break;
+
+	case RH_SET_FEATURE | RH_OTHER | RH_CLASS:
+		switch (wValue) {
+			case (RH_PORT_SUSPEND):
+					WR_RH_PORTSTAT (RH_PS_PSS ); OK (0);
+			case (RH_PORT_RESET): /* BUG IN HUP CODE *********/
+					if (RD_RH_PORTSTAT & RH_PS_CCS)
+					    WR_RH_PORTSTAT (RH_PS_PRS);
+					OK (0);
+			case (RH_PORT_POWER):
+					WR_RH_PORTSTAT (RH_PS_PPS ); OK (0);
+			case (RH_PORT_ENABLE): /* BUG IN HUP CODE *********/
+					if (RD_RH_PORTSTAT & RH_PS_CCS)
+					    WR_RH_PORTSTAT (RH_PS_PES );
+					OK (0);
+		}
+		break;
+
+	case RH_SET_ADDRESS: gohci.rh.devnum = wValue; OK(0);
+
+	case RH_GET_DESCRIPTOR:
+		switch ((wValue & 0xff00) >> 8) {
+			case (0x01): /* device descriptor */
+				len = min_t(unsigned int,
+					  leni,
+					  min_t(unsigned int,
+					      sizeof (root_hub_dev_des),
+					      wLength));
+				data_buf = root_hub_dev_des; OK(len);
+			case (0x02): /* configuration descriptor */
+				len = min_t(unsigned int,
+					  leni,
+					  min_t(unsigned int,
+					      sizeof (root_hub_config_des),
+					      wLength));
+				data_buf = root_hub_config_des; OK(len);
+			case (0x03): /* string descriptors */
+				if(wValue==0x0300) {
+					len = min_t(unsigned int,
+						  leni,
+						  min_t(unsigned int,
+						      sizeof (root_hub_str_index0),
+						      wLength));
+					data_buf = root_hub_str_index0;
+					OK(len);
+				}
+				if(wValue==0x0301) {
+					len = min_t(unsigned int,
+						  leni,
+						  min_t(unsigned int,
+						      sizeof (root_hub_str_index1),
+						      wLength));
+					data_buf = root_hub_str_index1;
+					OK(len);
+			}
+			default:
+				stat = USB_ST_STALLED;
+		}
+		break;
+
+	case RH_GET_DESCRIPTOR | RH_CLASS:
+	    {
+		    __u32 temp = roothub_a (&gohci);
+
+		    data_buf [0] = 9;		/* min length; */
+		    data_buf [1] = 0x29;
+		    data_buf [2] = temp & RH_A_NDP;
+		    data_buf [3] = 0;
+		    if (temp & RH_A_PSM)	/* per-port power switching? */
+			data_buf [3] |= 0x1;
+		    if (temp & RH_A_NOCP)	/* no overcurrent reporting? */
+			data_buf [3] |= 0x10;
+		    else if (temp & RH_A_OCPM)	/* per-port overcurrent reporting? */
+			data_buf [3] |= 0x8;
+
+		    /* corresponds to data_buf[4-7] */
+		    datab [1] = 0;
+		    data_buf [5] = (temp & RH_A_POTPGT) >> 24;
+		    temp = roothub_b (&gohci);
+		    data_buf [7] = temp & RH_B_DR;
+		    if (data_buf [2] < 7) {
+			data_buf [8] = 0xff;
+		    } else {
+			data_buf [0] += 2;
+			data_buf [8] = (temp & RH_B_DR) >> 8;
+			data_buf [10] = data_buf [9] = 0xff;
+		    }
+
+		    len = min_t(unsigned int, leni,
+			      min_t(unsigned int, data_buf [0], wLength));
+		    OK (len);
+		}
+
+	case RH_GET_CONFIGURATION:	*(__u8 *) data_buf = 0x01; OK (1);
+
+	case RH_SET_CONFIGURATION:	WR_RH_STAT (0x10000); OK (0);
+
+	default:
+		dbg ("unsupported root hub command");
+		stat = USB_ST_STALLED;
+	}
+
+#ifdef	DEBUG
+	ohci_dump_roothub (&gohci, 1);
+#else
+	wait_ms(1);
+#endif
+
+	len = min_t(int, len, leni);
+	if (data != data_buf)
+	    memcpy (data, data_buf, len);
+	dev->act_len = len;
+	dev->status = stat;
+
+#ifdef DEBUG
+	if (transfer_len)
+		urb_priv.actual_length = transfer_len;
+	pkt_print(dev, pipe, buffer, transfer_len, cmd, "RET(rh)", 0/*usb_pipein(pipe)*/);
+#else
+	wait_ms(1);
+#endif
+
+	return stat;
+}
+
+/*-------------------------------------------------------------------------*/
+
+/* common code for handling submit messages - used for all but root hub */
+/* accesses. */
+int submit_common_msg(struct usb_device *dev, unsigned long pipe, void *buffer,
+		int transfer_len, struct devrequest *setup, int interval)
+{
+	int stat = 0;
+	int maxsize = usb_maxpacket(dev, pipe);
+	int timeout;
+
+	/* device pulled? Shortcut the action. */
+	if (devgone == dev) {
+		dev->status = USB_ST_CRC_ERR;
+		return 0;
+	}
+
+#ifdef DEBUG
+	urb_priv.actual_length = 0;
+	pkt_print(dev, pipe, buffer, transfer_len, setup, "SUB", usb_pipein(pipe));
+#else
+	wait_ms(1);
+#endif
+	if (!maxsize) {
+		err("submit_common_message: pipesize for pipe %lx is zero",
+			pipe);
+		return -1;
+	}
+
+	if (sohci_submit_job(dev, pipe, buffer, transfer_len, setup, interval) < 0) {
+		err("sohci_submit_job failed");
+		return -1;
+	}
+
+	wait_ms(10);
+	/* ohci_dump_status(&gohci); */
+
+	/* allow more time for a BULK device to react - some are slow */
+#define BULK_TO	 5000	/* timeout in milliseconds */
+	if (usb_pipetype (pipe) == PIPE_BULK)
+		timeout = BULK_TO;
+	else
+		timeout = 100;
+
+	timeout *= 4;
+	/* wait for it to complete */
+	for (;;) {
+		/* check whether the controller is done */
+		stat = hc_interrupt();
+		if (stat < 0) {
+			stat = USB_ST_CRC_ERR;
+			break;
+		}
+		if (stat >= 0 && stat != 0xff) {
+			/* 0xff is returned for an SF-interrupt */
+			break;
+		}
+		if (--timeout) {
+			udelay(250); /* wait_ms(1); */
+		} else {
+			err("CTL:TIMEOUT ");
+			stat = USB_ST_CRC_ERR;
+			break;
+		}
+	}
+	/* we got an Root Hub Status Change interrupt */
+	if (got_rhsc) {
+#ifdef DEBUG
+		ohci_dump_roothub (&gohci, 1);
+#endif
+		got_rhsc = 0;
+		/* abuse timeout */
+		timeout = rh_check_port_status(&gohci);
+		if (timeout >= 0) {
+#if 0 /* this does nothing useful, but leave it here in case that changes */
+			/* the called routine adds 1 to the passed value */
+			usb_hub_port_connect_change(gohci.rh.dev, timeout - 1);
+#endif
+			/*
+			 * XXX
+			 * This is potentially dangerous because it assumes
+			 * that only one device is ever plugged in!
+			 */
+			devgone = dev;
+		}
+	}
+
+	dev->status = stat;
+	dev->act_len = transfer_len;
+
+#ifdef DEBUG
+	pkt_print(dev, pipe, buffer, transfer_len, setup, "RET(ctlr)", usb_pipein(pipe));
+#else
+	wait_ms(1);
+#endif
+
+	/* free TDs in urb_priv */
+	urb_free_priv (&urb_priv);
+	return 0;
+}
+
+/* submit routines called from usb.c */
+int submit_bulk_msg(struct usb_device *dev, unsigned long pipe, void *buffer,
+		int transfer_len)
+{
+	info("submit_bulk_msg");
+	return submit_common_msg(dev, pipe, buffer, transfer_len, NULL, 0);
+}
+
+int submit_control_msg(struct usb_device *dev, unsigned long pipe, void *buffer,
+		int transfer_len, struct devrequest *setup)
+{
+	int maxsize = usb_maxpacket(dev, pipe);
+
+	info("submit_control_msg");
+#ifdef DEBUG
+	urb_priv.actual_length = 0;
+	pkt_print(dev, pipe, buffer, transfer_len, setup, "SUB", usb_pipein(pipe));
+#else
+	wait_ms(1);
+#endif
+	if (!maxsize) {
+		err("submit_control_message: pipesize for pipe %lx is zero",
+			pipe);
+		return -1;
+	}
+	if (((pipe >> 8) & 0x7f) == gohci.rh.devnum) {
+		gohci.rh.dev = dev;
+		/* root hub - redirect */
+		return ohci_submit_rh_msg(dev, pipe, buffer, transfer_len,
+			setup);
+	}
+
+	return submit_common_msg(dev, pipe, buffer, transfer_len, setup, 0);
+}
+
+int submit_int_msg(struct usb_device *dev, unsigned long pipe, void *buffer,
+		int transfer_len, int interval)
+{
+	info("submit_int_msg");
+	return -1;
+}
+
+/*-------------------------------------------------------------------------*
+ * HC functions
+ *-------------------------------------------------------------------------*/
+
+/* reset the HC and BUS */
+
+static int hc_reset (ohci_t *ohci)
+{
+	int timeout = 30;
+	int smm_timeout = 50; /* 0,5 sec */
+
+	if (readl (&ohci->regs->control) & OHCI_CTRL_IR) { /* SMM owns the HC */
+		writel (OHCI_OCR, &ohci->regs->cmdstatus); /* request ownership */
+		info("USB HC TakeOver from SMM");
+		while (readl (&ohci->regs->control) & OHCI_CTRL_IR) {
+			wait_ms (10);
+			if (--smm_timeout == 0) {
+				err("USB HC TakeOver failed!");
+				return -1;
+			}
+		}
+	}
+
+	/* Disable HC interrupts */
+	writel (OHCI_INTR_MIE, &ohci->regs->intrdisable);
+
+	dbg("USB HC reset_hc usb-%s: ctrl = 0x%X ;",
+		ohci->slot_name,
+		readl (&ohci->regs->control));
+
+	/* Reset USB (needed by some controllers) */
+	writel (0, &ohci->regs->control);
+
+	/* HC Reset requires max 10 us delay */
+	writel (OHCI_HCR,  &ohci->regs->cmdstatus);
+	while ((readl (&ohci->regs->cmdstatus) & OHCI_HCR) != 0) {
+		if (--timeout == 0) {
+			err("USB HC reset timed out!");
+			return -1;
+		}
+		udelay (1);
+	}
+	return 0;
+}
+
+/*-------------------------------------------------------------------------*/
+
+/* Start an OHCI controller, set the BUS operational
+ * enable interrupts
+ * connect the virtual root hub */
+
+static int hc_start (ohci_t * ohci)
+{
+	__u32 mask;
+	unsigned int fminterval;
+
+	ohci->disabled = 1;
+
+	/* Tell the controller where the control and bulk lists are
+	 * The lists are empty now. */
+
+	writel (0, &ohci->regs->ed_controlhead);
+	writel (0, &ohci->regs->ed_bulkhead);
+
+	writel ((__u32)ohci->hcca, &ohci->regs->hcca); /* a reset clears this */
+
+	fminterval = 0x2edf;
+	writel ((fminterval * 9) / 10, &ohci->regs->periodicstart);
+	fminterval |= ((((fminterval - 210) * 6) / 7) << 16);
+	writel (fminterval, &ohci->regs->fminterval);
+	writel (0x628, &ohci->regs->lsthresh);
+
+	/* start controller operations */
+	ohci->hc_control = OHCI_CONTROL_INIT | OHCI_USB_OPER;
+	ohci->disabled = 0;
+	writel (ohci->hc_control, &ohci->regs->control);
+
+	/* disable all interrupts */
+	mask = (OHCI_INTR_SO | OHCI_INTR_WDH | OHCI_INTR_SF | OHCI_INTR_RD |
+			OHCI_INTR_UE | OHCI_INTR_FNO | OHCI_INTR_RHSC |
+			OHCI_INTR_OC | OHCI_INTR_MIE);
+	writel (mask, &ohci->regs->intrdisable);
+	/* clear all interrupts */
+	mask &= ~OHCI_INTR_MIE;
+	writel (mask, &ohci->regs->intrstatus);
+	/* Choose the interrupts we care about now  - but w/o MIE */
+	mask = OHCI_INTR_RHSC | OHCI_INTR_UE | OHCI_INTR_WDH | OHCI_INTR_SO;
+	writel (mask, &ohci->regs->intrenable);
+
+#ifdef	OHCI_USE_NPS
+	/* required for AMD-756 and some Mac platforms */
+	writel ((roothub_a (ohci) | RH_A_NPS) & ~RH_A_PSM,
+		&ohci->regs->roothub.a);
+	writel (RH_HS_LPSC, &ohci->regs->roothub.status);
+#endif	/* OHCI_USE_NPS */
+
+#define mdelay(n) ({unsigned long msec=(n); while (msec--) udelay(1000);})
+	/* POTPGT delay is bits 24-31, in 2 ms units. */
+	mdelay ((roothub_a (ohci) >> 23) & 0x1fe);
+
+	/* connect the virtual root hub */
+	ohci->rh.devnum = 0;
+
+	return 0;
+}
+
+/*-------------------------------------------------------------------------*/
+
+/* an interrupt happens */
+
+static int
+hc_interrupt (void)
+{
+	ohci_t *ohci = &gohci;
+	struct ohci_regs *regs = ohci->regs;
+	int ints;
+	int stat = -1;
+
+	if ((ohci->hcca->done_head != 0) && !(m32_swap (ohci->hcca->done_head) & 0x01)) {
+		ints =	OHCI_INTR_WDH;
+	} else {
+		ints = readl (&regs->intrstatus);
+	}
+
+	/* dbg("Interrupt: %x frame: %x", ints, le16_to_cpu (ohci->hcca->frame_no)); */
+
+	if (ints & OHCI_INTR_RHSC) {
+		got_rhsc = 1;
+	}
+
+	if (ints & OHCI_INTR_UE) {
+		ohci->disabled++;
+		err ("OHCI Unrecoverable Error, controller usb-%s disabled",
+			ohci->slot_name);
+		/* e.g. due to PCI Master/Target Abort */
+
+#ifdef	DEBUG
+		ohci_dump (ohci, 1);
+#else
+	wait_ms(1);
+#endif
+		/* FIXME: be optimistic, hope that bug won't repeat often. */
+		/* Make some non-interrupt context restart the controller. */
+		/* Count and limit the retries though; either hardware or */
+		/* software errors can go forever... */
+		hc_reset (ohci);
+		return -1;
+	}
+
+	if (ints & OHCI_INTR_WDH) {
+		wait_ms(1);
+		writel (OHCI_INTR_WDH, &regs->intrdisable);
+		stat = dl_done_list (&gohci, dl_reverse_done_list (&gohci));
+		writel (OHCI_INTR_WDH, &regs->intrenable);
+	}
+
+	if (ints & OHCI_INTR_SO) {
+		dbg("USB Schedule overrun\n");
+		writel (OHCI_INTR_SO, &regs->intrenable);
+		stat = -1;
+	}
+
+	/* FIXME:  this assumes SOF (1/ms) interrupts don't get lost... */
+	if (ints & OHCI_INTR_SF) {
+		unsigned int frame = m16_swap (ohci->hcca->frame_no) & 1;
+		wait_ms(1);
+		writel (OHCI_INTR_SF, &regs->intrdisable);
+		if (ohci->ed_rm_list[frame] != NULL)
+			writel (OHCI_INTR_SF, &regs->intrenable);
+		stat = 0xff;
+	}
+
+	writel (ints, &regs->intrstatus);
+	return stat;
+}
+
+/*-------------------------------------------------------------------------*/
+
+/*-------------------------------------------------------------------------*/
+
+/* De-allocate all resources.. */
+
+static void hc_release_ohci (ohci_t *ohci)
+{
+	dbg ("USB HC release ohci usb-%s", ohci->slot_name);
+
+	if (!ohci->disabled)
+		hc_reset (ohci);
+}
+
+/*-------------------------------------------------------------------------*/
+
+#define __read_32bit_c0_register(source, sel)				\
+({ int __res;								\
+	if (sel == 0)							\
+		__asm__ __volatile__(					\
+			"mfc0\t%0, " #source "\n\t"			\
+			: "=r" (__res));				\
+	else								\
+		__asm__ __volatile__(					\
+			".set\tmips32\n\t"				\
+			"mfc0\t%0, " #source ", " #sel "\n\t"		\
+			".set\tmips0\n\t"				\
+			: "=r" (__res));				\
+	__res;								\
+})
+
+#define read_c0_prid()		__read_32bit_c0_register($15, 0)
+
+/*
+ * low level initalisation routine, called from usb.c
+ */
+static char ohci_inited = 0;
+
+int usb_lowlevel_init(void)
+{
+	u32 pin_func;
+	u32 sys_freqctrl, sys_clksrc;
+	u32 prid = read_c0_prid();
+
+	dbg("in usb_lowlevel_init\n");
+
+	/* zero and disable FREQ2 */
+	sys_freqctrl = au_readl(SYS_FREQCTRL0);
+	sys_freqctrl &= ~0xFFF00000;
+	au_writel(sys_freqctrl, SYS_FREQCTRL0);
+
+	/* zero and disable USBH/USBD clocks */
+	sys_clksrc = au_readl(SYS_CLKSRC);
+	sys_clksrc &= ~0x00007FE0;
+	au_writel(sys_clksrc, SYS_CLKSRC);
+
+	sys_freqctrl = au_readl(SYS_FREQCTRL0);
+	sys_freqctrl &= ~0xFFF00000;
+
+	sys_clksrc = au_readl(SYS_CLKSRC);
+	sys_clksrc &= ~0x00007FE0;
+
+	switch (prid & 0x000000FF) {
+	case 0x00: /* DA */
+	case 0x01: /* HA */
+	case 0x02: /* HB */
+		/* CPU core freq to 48MHz to slow it way down... */
+		au_writel(4, SYS_CPUPLL);
+
+		/*
+		 * Setup 48MHz FREQ2 from CPUPLL for USB Host
+		 */
+		/* FRDIV2=3 -> div by 8 of 384MHz -> 48MHz */
+		sys_freqctrl |= ((3<<22) | (1<<21) | (0<<20));
+		au_writel(sys_freqctrl, SYS_FREQCTRL0);
+
+		/* CPU core freq to 384MHz */
+		au_writel(0x20, SYS_CPUPLL);
+
+		printf("Au1000: 48MHz OHCI workaround enabled\n");
+		break;
+
+	default:  /* HC and newer */
+		/* FREQ2 = aux/2 = 48 MHz */
+		sys_freqctrl |= ((0<<22) | (1<<21) | (1<<20));
+		au_writel(sys_freqctrl, SYS_FREQCTRL0);
+		break;
+	}
+
+	/*
+	 * Route 48MHz FREQ2 into USB Host and/or Device
+	 */
+	sys_clksrc |= ((4<<12) | (0<<11) | (0<<10));
+	au_writel(sys_clksrc, SYS_CLKSRC);
+
+	/* configure pins GPIO[14:9] as GPIO */
+	pin_func = au_readl(SYS_PINFUNC) & (u32)(~0x8080);
+
+	au_writel(pin_func, SYS_PINFUNC);
+	au_writel(0x2800, SYS_TRIOUTCLR);
+	au_writel(0x0030, SYS_OUTPUTCLR);
+
+	dbg("OHCI board setup complete\n");
+
+	/* enable host controller */
+	au_writel(USBH_ENABLE_CE, USB_HOST_CONFIG);
+	udelay(1000);
+	au_writel(USBH_ENABLE_INIT, USB_HOST_CONFIG);
+	udelay(1000);
+
+	/* wait for reset complete (read register twice; see au1500 errata) */
+	while (au_readl(USB_HOST_CONFIG),
+	       !(au_readl(USB_HOST_CONFIG) & USBH_ENABLE_RD))
+		udelay(1000);
+
+	dbg("OHCI clock running\n");
+
+	memset (&gohci, 0, sizeof (ohci_t));
+	memset (&urb_priv, 0, sizeof (urb_priv_t));
+
+	/* align the storage */
+	if ((__u32)&ghcca[0] & 0xff) {
+		err("HCCA not aligned!!");
+		return -1;
+	}
+	phcca = &ghcca[0];
+	info("aligned ghcca %p", phcca);
+	memset(&ohci_dev, 0, sizeof(struct ohci_device));
+	if ((__u32)&ohci_dev.ed[0] & 0x7) {
+		err("EDs not aligned!!");
+		return -1;
+	}
+	memset(gtd, 0, sizeof(td_t) * (NUM_TD + 1));
+	if ((__u32)gtd & 0x7) {
+		err("TDs not aligned!!");
+		return -1;
+	}
+	ptd = gtd;
+	gohci.hcca = phcca;
+	memset (phcca, 0, sizeof (struct ohci_hcca));
+
+	gohci.disabled = 1;
+	gohci.sleeping = 0;
+	gohci.irq = -1;
+	gohci.regs = (struct ohci_regs *)(USB_OHCI_BASE | 0xA0000000);
+
+	gohci.flags = 0;
+	gohci.slot_name = "au1x00";
+
+	dbg("OHCI revision: 0x%08x\n"
+	       "  RH: a: 0x%08x b: 0x%08x\n",
+	       readl(&gohci.regs->revision),
+	       readl(&gohci.regs->roothub.a), readl(&gohci.regs->roothub.b));
+
+	if (hc_reset (&gohci) < 0)
+		goto errout;
+
+	/* FIXME this is a second HC reset; why?? */
+	writel (gohci.hc_control = OHCI_USB_RESET, &gohci.regs->control);
+	wait_ms (10);
+
+	if (hc_start (&gohci) < 0)
+		goto errout;
+
+#ifdef	DEBUG
+	ohci_dump (&gohci, 1);
+#else
+	wait_ms(1);
+#endif
+	ohci_inited = 1;
+	return 0;
+
+  errout:
+	err("OHCI initialization error\n");
+	hc_release_ohci (&gohci);
+	/* Initialization failed */
+	au_writel(readl(USB_HOST_CONFIG) & ~USBH_ENABLE_CE, USB_HOST_CONFIG);
+	return -1;
+}
+
+int usb_lowlevel_stop(void)
+{
+	/* this gets called really early - before the controller has */
+	/* even been initialized! */
+	if (!ohci_inited)
+		return 0;
+	/* TODO release any interrupts, etc. */
+	/* call hc_release_ohci() here ? */
+	hc_reset (&gohci);
+	/* may not want to do this */
+	/* Disable clock */
+	au_writel(readl(USB_HOST_CONFIG) & ~USBH_ENABLE_CE, USB_HOST_CONFIG);
+	return 0;
+}
+
+#endif /* CONFIG_USB_OHCI */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_usb_ohci.h b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_usb_ohci.h
new file mode 100644
index 0000000..4ef06ff
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/au1x00_usb_ohci.h
@@ -0,0 +1,416 @@
+/*
+ * URB OHCI HCD (Host Controller Driver) for USB.
+ *
+ * (C) Copyright 1999 Roman Weissgaerber <weissg@vienna.at>
+ * (C) Copyright 2000-2001 David Brownell <dbrownell@users.sourceforge.net>
+ *
+ * usb-ohci.h
+ */
+
+
+static int cc_to_error[16] = {
+
+/* mapping of the OHCI CC status to error codes */
+	/* No  Error  */               0,
+	/* CRC Error  */               USB_ST_CRC_ERR,
+	/* Bit Stuff  */               USB_ST_BIT_ERR,
+	/* Data Togg  */               USB_ST_CRC_ERR,
+	/* Stall      */               USB_ST_STALLED,
+	/* DevNotResp */               -1,
+	/* PIDCheck   */               USB_ST_BIT_ERR,
+	/* UnExpPID   */               USB_ST_BIT_ERR,
+	/* DataOver   */               USB_ST_BUF_ERR,
+	/* DataUnder  */               USB_ST_BUF_ERR,
+	/* reservd    */               -1,
+	/* reservd    */               -1,
+	/* BufferOver */               USB_ST_BUF_ERR,
+	/* BuffUnder  */               USB_ST_BUF_ERR,
+	/* Not Access */               -1,
+	/* Not Access */               -1
+};
+
+/* ED States */
+
+#define ED_NEW 		0x00
+#define ED_UNLINK 	0x01
+#define ED_OPER		0x02
+#define ED_DEL		0x04
+#define ED_URB_DEL  	0x08
+
+/* usb_ohci_ed */
+struct ed {
+	__u32 hwINFO;
+	__u32 hwTailP;
+	__u32 hwHeadP;
+	__u32 hwNextED;
+
+	struct ed *ed_prev;
+	__u8 int_period;
+	__u8 int_branch;
+	__u8 int_load;
+	__u8 int_interval;
+	__u8 state;
+	__u8 type;
+	__u16 last_iso;
+	struct ed *ed_rm_list;
+
+	struct usb_device *usb_dev;
+	__u32 unused[3];
+} __attribute((aligned(16)));
+typedef struct ed ed_t;
+
+
+/* TD info field */
+#define TD_CC       0xf0000000
+#define TD_CC_GET(td_p) ((td_p >>28) & 0x0f)
+#define TD_CC_SET(td_p, cc) (td_p) = ((td_p) & 0x0fffffff) | (((cc) & 0x0f) << 28)
+#define TD_EC       0x0C000000
+#define TD_T        0x03000000
+#define TD_T_DATA0  0x02000000
+#define TD_T_DATA1  0x03000000
+#define TD_T_TOGGLE 0x00000000
+#define TD_R        0x00040000
+#define TD_DI       0x00E00000
+#define TD_DI_SET(X) (((X) & 0x07)<< 21)
+#define TD_DP       0x00180000
+#define TD_DP_SETUP 0x00000000
+#define TD_DP_IN    0x00100000
+#define TD_DP_OUT   0x00080000
+
+#define TD_ISO	    0x00010000
+#define TD_DEL      0x00020000
+
+/* CC Codes */
+#define TD_CC_NOERROR      0x00
+#define TD_CC_CRC          0x01
+#define TD_CC_BITSTUFFING  0x02
+#define TD_CC_DATATOGGLEM  0x03
+#define TD_CC_STALL        0x04
+#define TD_DEVNOTRESP      0x05
+#define TD_PIDCHECKFAIL    0x06
+#define TD_UNEXPECTEDPID   0x07
+#define TD_DATAOVERRUN     0x08
+#define TD_DATAUNDERRUN    0x09
+#define TD_BUFFEROVERRUN   0x0C
+#define TD_BUFFERUNDERRUN  0x0D
+#define TD_NOTACCESSED     0x0F
+
+
+#define MAXPSW 1
+
+struct td {
+	__u32 hwINFO;
+  	__u32 hwCBP;		/* Current Buffer Pointer */
+  	__u32 hwNextTD;		/* Next TD Pointer */
+  	__u32 hwBE;		/* Memory Buffer End Pointer */
+
+  	__u16 hwPSW[MAXPSW];
+  	__u8 unused;
+  	__u8 index;
+  	struct ed *ed;
+  	struct td *next_dl_td;
+	struct usb_device *usb_dev;
+	int transfer_len;
+	__u32 data;
+
+	__u32 unused2[2];
+} __attribute((aligned(32)));
+typedef struct td td_t;
+
+#define OHCI_ED_SKIP	(1 << 14)
+
+/*
+ * The HCCA (Host Controller Communications Area) is a 256 byte
+ * structure defined in the OHCI spec. that the host controller is
+ * told the base address of.  It must be 256-byte aligned.
+ */
+
+#define NUM_INTS 32	/* part of the OHCI standard */
+struct ohci_hcca {
+	__u32	int_table[NUM_INTS];	/* Interrupt ED table */
+	__u16	frame_no;		/* current frame number */
+	__u16	pad1;			/* set to 0 on each frame_no change */
+	__u32	done_head;		/* info returned for an interrupt */
+	u8		reserved_for_hc[116];
+} __attribute((aligned(256)));
+
+
+/*
+ * Maximum number of root hub ports.
+ */
+#define MAX_ROOT_PORTS	15	/* maximum OHCI root hub ports */
+
+/*
+ * This is the structure of the OHCI controller's memory mapped I/O
+ * region.  This is Memory Mapped I/O.  You must use the readl() and
+ * writel() macros defined in asm/io.h to access these!!
+ */
+struct ohci_regs {
+	/* control and status registers */
+	__u32	revision;
+	__u32	control;
+	__u32	cmdstatus;
+	__u32	intrstatus;
+	__u32	intrenable;
+	__u32	intrdisable;
+	/* memory pointers */
+	__u32	hcca;
+	__u32	ed_periodcurrent;
+	__u32	ed_controlhead;
+	__u32	ed_controlcurrent;
+	__u32	ed_bulkhead;
+	__u32	ed_bulkcurrent;
+	__u32	donehead;
+	/* frame counters */
+	__u32	fminterval;
+	__u32	fmremaining;
+	__u32	fmnumber;
+	__u32	periodicstart;
+	__u32	lsthresh;
+	/* Root hub ports */
+	struct	ohci_roothub_regs {
+		__u32	a;
+		__u32	b;
+		__u32	status;
+		__u32	portstatus[MAX_ROOT_PORTS];
+	} roothub;
+} __attribute((aligned(32)));
+
+
+/* OHCI CONTROL AND STATUS REGISTER MASKS */
+
+/*
+ * HcControl (control) register masks
+ */
+#define OHCI_CTRL_CBSR	(3 << 0)	/* control/bulk service ratio */
+#define OHCI_CTRL_PLE	(1 << 2)	/* periodic list enable */
+#define OHCI_CTRL_IE	(1 << 3)	/* isochronous enable */
+#define OHCI_CTRL_CLE	(1 << 4)	/* control list enable */
+#define OHCI_CTRL_BLE	(1 << 5)	/* bulk list enable */
+#define OHCI_CTRL_HCFS	(3 << 6)	/* host controller functional state */
+#define OHCI_CTRL_IR	(1 << 8)	/* interrupt routing */
+#define OHCI_CTRL_RWC	(1 << 9)	/* remote wakeup connected */
+#define OHCI_CTRL_RWE	(1 << 10)	/* remote wakeup enable */
+
+/* pre-shifted values for HCFS */
+#	define OHCI_USB_RESET	(0 << 6)
+#	define OHCI_USB_RESUME	(1 << 6)
+#	define OHCI_USB_OPER	(2 << 6)
+#	define OHCI_USB_SUSPEND	(3 << 6)
+
+/*
+ * HcCommandStatus (cmdstatus) register masks
+ */
+#define OHCI_HCR	(1 << 0)	/* host controller reset */
+#define OHCI_CLF  	(1 << 1)	/* control list filled */
+#define OHCI_BLF  	(1 << 2)	/* bulk list filled */
+#define OHCI_OCR  	(1 << 3)	/* ownership change request */
+#define OHCI_SOC  	(3 << 16)	/* scheduling overrun count */
+
+/*
+ * masks used with interrupt registers:
+ * HcInterruptStatus (intrstatus)
+ * HcInterruptEnable (intrenable)
+ * HcInterruptDisable (intrdisable)
+ */
+#define OHCI_INTR_SO	(1 << 0)	/* scheduling overrun */
+#define OHCI_INTR_WDH	(1 << 1)	/* writeback of done_head */
+#define OHCI_INTR_SF	(1 << 2)	/* start frame */
+#define OHCI_INTR_RD	(1 << 3)	/* resume detect */
+#define OHCI_INTR_UE	(1 << 4)	/* unrecoverable error */
+#define OHCI_INTR_FNO	(1 << 5)	/* frame number overflow */
+#define OHCI_INTR_RHSC	(1 << 6)	/* root hub status change */
+#define OHCI_INTR_OC	(1 << 30)	/* ownership change */
+#define OHCI_INTR_MIE	(1 << 31)	/* master interrupt enable */
+
+
+/* Virtual Root HUB */
+struct virt_root_hub {
+	int devnum; /* Address of Root Hub endpoint */
+	void *dev;  /* was urb */
+	void *int_addr;
+	int send;
+	int interval;
+};
+
+/* USB HUB CONSTANTS (not OHCI-specific; see hub.h) */
+
+/* destination of request */
+#define RH_INTERFACE               0x01
+#define RH_ENDPOINT                0x02
+#define RH_OTHER                   0x03
+
+#define RH_CLASS                   0x20
+#define RH_VENDOR                  0x40
+
+/* Requests: bRequest << 8 | bmRequestType */
+#define RH_GET_STATUS           0x0080
+#define RH_CLEAR_FEATURE        0x0100
+#define RH_SET_FEATURE          0x0300
+#define RH_SET_ADDRESS		0x0500
+#define RH_GET_DESCRIPTOR	0x0680
+#define RH_SET_DESCRIPTOR       0x0700
+#define RH_GET_CONFIGURATION	0x0880
+#define RH_SET_CONFIGURATION	0x0900
+#define RH_GET_STATE            0x0280
+#define RH_GET_INTERFACE        0x0A80
+#define RH_SET_INTERFACE        0x0B00
+#define RH_SYNC_FRAME           0x0C80
+/* Our Vendor Specific Request */
+#define RH_SET_EP               0x2000
+
+
+/* Hub port features */
+#define RH_PORT_CONNECTION         0x00
+#define RH_PORT_ENABLE             0x01
+#define RH_PORT_SUSPEND            0x02
+#define RH_PORT_OVER_CURRENT       0x03
+#define RH_PORT_RESET              0x04
+#define RH_PORT_POWER              0x08
+#define RH_PORT_LOW_SPEED          0x09
+
+#define RH_C_PORT_CONNECTION       0x10
+#define RH_C_PORT_ENABLE           0x11
+#define RH_C_PORT_SUSPEND          0x12
+#define RH_C_PORT_OVER_CURRENT     0x13
+#define RH_C_PORT_RESET            0x14
+
+/* Hub features */
+#define RH_C_HUB_LOCAL_POWER       0x00
+#define RH_C_HUB_OVER_CURRENT      0x01
+
+#define RH_DEVICE_REMOTE_WAKEUP    0x00
+#define RH_ENDPOINT_STALL          0x01
+
+#define RH_ACK                     0x01
+#define RH_REQ_ERR                 -1
+#define RH_NACK                    0x00
+
+
+/* OHCI ROOT HUB REGISTER MASKS */
+
+/* roothub.portstatus [i] bits */
+#define RH_PS_CCS            0x00000001   	/* current connect status */
+#define RH_PS_PES            0x00000002   	/* port enable status*/
+#define RH_PS_PSS            0x00000004   	/* port suspend status */
+#define RH_PS_POCI           0x00000008   	/* port over current indicator */
+#define RH_PS_PRS            0x00000010  	/* port reset status */
+#define RH_PS_PPS            0x00000100   	/* port power status */
+#define RH_PS_LSDA           0x00000200    	/* low speed device attached */
+#define RH_PS_CSC            0x00010000 	/* connect status change */
+#define RH_PS_PESC           0x00020000   	/* port enable status change */
+#define RH_PS_PSSC           0x00040000    	/* port suspend status change */
+#define RH_PS_OCIC           0x00080000    	/* over current indicator change */
+#define RH_PS_PRSC           0x00100000   	/* port reset status change */
+
+/* roothub.status bits */
+#define RH_HS_LPS	     0x00000001		/* local power status */
+#define RH_HS_OCI	     0x00000002		/* over current indicator */
+#define RH_HS_DRWE	     0x00008000		/* device remote wakeup enable */
+#define RH_HS_LPSC	     0x00010000		/* local power status change */
+#define RH_HS_OCIC	     0x00020000		/* over current indicator change */
+#define RH_HS_CRWE	     0x80000000		/* clear remote wakeup enable */
+
+/* roothub.b masks */
+#define RH_B_DR		0x0000ffff		/* device removable flags */
+#define RH_B_PPCM	0xffff0000		/* port power control mask */
+
+/* roothub.a masks */
+#define	RH_A_NDP	(0xff << 0)		/* number of downstream ports */
+#define	RH_A_PSM	(1 << 8)		/* power switching mode */
+#define	RH_A_NPS	(1 << 9)		/* no power switching */
+#define	RH_A_DT		(1 << 10)		/* device type (mbz) */
+#define	RH_A_OCPM	(1 << 11)		/* over current protection mode */
+#define	RH_A_NOCP	(1 << 12)		/* no over current protection */
+#define	RH_A_POTPGT	(0xff << 24)		/* power on to power good time */
+
+/* urb */
+#define N_URB_TD 48
+typedef struct
+{
+	ed_t *ed;
+	__u16 length;	/* number of tds associated with this request */
+	__u16 td_cnt;	/* number of tds already serviced */
+	int   state;
+	unsigned long pipe;
+	int actual_length;
+	td_t *td[N_URB_TD];	/* list pointer to all corresponding TDs associated with this request */
+} urb_priv_t;
+#define URB_DEL 1
+
+/*
+ * This is the full ohci controller description
+ *
+ * Note how the "proper" USB information is just
+ * a subset of what the full implementation needs. (Linus)
+ */
+
+
+typedef struct ohci {
+	struct ohci_hcca *hcca;		/* hcca */
+	/*dma_addr_t hcca_dma;*/
+
+	int irq;
+	int disabled;			/* e.g. got a UE, we're hung */
+	int sleeping;
+	unsigned long flags;		/* for HC bugs */
+
+	struct ohci_regs *regs;	/* OHCI controller's memory */
+
+	ed_t *ed_rm_list[2];     /* lists of all endpoints to be removed */
+	ed_t *ed_bulktail;       /* last endpoint of bulk list */
+	ed_t *ed_controltail;    /* last endpoint of control list */
+	int intrstatus;
+	__u32 hc_control;		/* copy of the hc control reg */
+	struct usb_device *dev[32];
+	struct virt_root_hub rh;
+
+	const char	*slot_name;
+} ohci_t;
+
+#define NUM_EDS 8		/* num of preallocated endpoint descriptors */
+
+struct ohci_device {
+	ed_t 	ed[NUM_EDS];
+	int ed_cnt;
+};
+
+/* hcd */
+/* endpoint */
+static int ep_link(ohci_t * ohci, ed_t * ed);
+static int ep_unlink(ohci_t * ohci, ed_t * ed);
+static ed_t * ep_add_ed(struct usb_device * usb_dev, unsigned long pipe);
+
+/*-------------------------------------------------------------------------*/
+
+/* we need more TDs than EDs */
+#define NUM_TD 64
+
+/* +1 so we can align the storage */
+td_t gtd[NUM_TD+1];
+/* pointers to aligned storage */
+td_t *ptd;
+
+/* TDs ... */
+static inline struct td *
+td_alloc (struct usb_device *usb_dev)
+{
+	int i;
+	struct td	*td;
+
+	td = NULL;
+	for (i = 0; i < NUM_TD; i++) {
+		if (ptd[i].usb_dev == NULL) {
+			td = &ptd[i];
+			td->usb_dev = usb_dev;
+			break;
+		}
+	}
+	return td;
+}
+
+static inline void
+ed_free (struct ed *ed)
+{
+	ed->usb_dev = NULL;
+}
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/cache.S b/package/uboot-ifxmips/files/cpu/mips/danube/cache.S
new file mode 100644
index 0000000..9a39784
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/cache.S
@@ -0,0 +1,278 @@
+/*
+ *  Cache-handling routined for MIPS 4K CPUs
+ *
+ *  Copyright (c) 2003	Wolfgang Denk <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+
+#include <config.h>
+#include <version.h>
+#include <asm/regdef.h>
+#include <asm/mipsregs.h>
+#include <asm/addrspace.h>
+#include <asm/cacheops.h>
+#if defined(CONFIG_IFX_MIPS)
+#	include "ifx_cache.S"
+#endif
+
+	/* 16KB is the maximum size of instruction and data caches on
+	 * MIPS 4K.
+	 */
+#define MIPS_MAX_CACHE_SIZE	0x4000
+
+
+/*
+ * cacheop macro to automate cache operations
+ * first some helpers...
+ */
+#define _mincache(size, maxsize) \
+   bltu  size,maxsize,9f ; \
+   move  size,maxsize ;    \
+9:
+
+#define _align(minaddr, maxaddr, linesize) \
+   .set noat ; \
+   subu  AT,linesize,1 ;   \
+   not   AT ;        \
+   and   minaddr,AT ;      \
+   addu  maxaddr,-1 ;      \
+   and   maxaddr,AT ;      \
+   .set at
+
+/* general operations */
+#define doop1(op1) \
+   cache op1,0(a0)
+#define doop2(op1, op2) \
+   cache op1,0(a0) ;    \
+   nop ;          \
+   cache op2,0(a0)
+
+/* specials for cache initialisation */
+#define doop1lw(op1) \
+   lw zero,0(a0)
+#define doop1lw1(op1) \
+   cache op1,0(a0) ;    \
+   lw zero,0(a0) ;      \
+   cache op1,0(a0)
+#define doop121(op1,op2) \
+   cache op1,0(a0) ;    \
+   nop;           \
+   cache op2,0(a0) ;    \
+   nop;           \
+   cache op1,0(a0)
+
+#define _oploopn(minaddr, maxaddr, linesize, tag, ops) \
+   .set  noreorder ;    \
+10:   doop##tag##ops ;  \
+   bne     minaddr,maxaddr,10b ; \
+   add      minaddr,linesize ;   \
+   .set  reorder
+
+/* finally the cache operation macros */
+#define vcacheopn(kva, n, cacheSize, cacheLineSize, tag, ops) \
+   blez  n,11f ;        \
+   addu  n,kva ;        \
+   _align(kva, n, cacheLineSize) ; \
+   _oploopn(kva, n, cacheLineSize, tag, ops) ; \
+11:
+
+#define icacheopn(kva, n, cacheSize, cacheLineSize, tag, ops) \
+   _mincache(n, cacheSize);   \
+   blez  n,11f ;        \
+   addu  n,kva ;        \
+   _align(kva, n, cacheLineSize) ; \
+   _oploopn(kva, n, cacheLineSize, tag, ops) ; \
+11:
+
+#define vcacheop(kva, n, cacheSize, cacheLineSize, op) \
+   vcacheopn(kva, n, cacheSize, cacheLineSize, 1, (op))
+
+#define icacheop(kva, n, cacheSize, cacheLineSize, op) \
+   icacheopn(kva, n, cacheSize, cacheLineSize, 1, (op))
+
+/*******************************************************************************
+*
+* mips_cache_reset - low level initialisation of the primary caches
+*
+* This routine initialises the primary caches to ensure that they
+* have good parity.  It must be called by the ROM before any cached locations
+* are used to prevent the possibility of data with bad parity being written to
+* memory.
+* To initialise the instruction cache it is essential that a source of data
+* with good parity is available. This routine
+* will initialise an area of memory starting at location zero to be used as
+* a source of parity.
+*
+* RETURNS: N/A
+*
+*/
+	.globl	mips_cache_reset
+	.ent	mips_cache_reset
+mips_cache_reset:
+
+	li	t2, CFG_ICACHE_SIZE
+	li	t3, CFG_DCACHE_SIZE
+	li	t4, CFG_CACHELINE_SIZE
+	move	t5, t4
+
+
+	li	v0, MIPS_MAX_CACHE_SIZE
+
+	/* Now clear that much memory starting from zero.
+	 */
+
+	li	a0, KSEG1
+	addu	a1, a0, v0
+
+2:	sw	zero, 0(a0)
+	sw	zero, 4(a0)
+	sw	zero, 8(a0)
+	sw	zero, 12(a0)
+	sw	zero, 16(a0)
+	sw	zero, 20(a0)
+	sw	zero, 24(a0)
+	sw	zero, 28(a0)
+	addu	a0, 32
+	bltu	a0, a1, 2b
+
+	/* Set invalid tag.
+	 */
+
+	mtc0	zero, CP0_TAGLO
+#if defined(CONFIG_IFX_MIPS) && defined(IFX_CACHE_EXTRA_INVALID_TAG)
+	IFX_CACHE_EXTRA_INVALID_TAG
+#endif
+
+   /*
+    * The caches are probably in an indeterminate state,
+    * so we force good parity into them by doing an
+    * invalidate, load/fill, invalidate for each line.
+    */
+
+	/* Assume bottom of RAM will generate good parity for the cache.
+	 */
+
+	li	a0, K0BASE
+	move	a2, t2		# icacheSize
+	move	a3, t4		# icacheLineSize
+	move	a1, a2
+	icacheopn(a0,a1,a2,a3,121,(Index_Store_Tag_I,Fill))
+
+#if defined(CONFIG_IFX_MIPS) && defined(IFX_CACHE_EXTRA_OPERATION)
+	IFX_CACHE_EXTRA_OPERATION
+#else
+	/* To support Orion/R4600, we initialise the data cache in 3 passes.
+	 */
+
+	/* 1: initialise dcache tags.
+	 */
+
+	li	a0, K0BASE
+	move	a2, t3		# dcacheSize
+	move	a3, t5		# dcacheLineSize
+	move	a1, a2
+	icacheop(a0,a1,a2,a3,Index_Store_Tag_D)
+
+	/* 2: fill dcache.
+	 */
+
+	li	a0, K0BASE
+	move	a2, t3		# dcacheSize
+	move	a3, t5		# dcacheLineSize
+	move	a1, a2
+	icacheopn(a0,a1,a2,a3,1lw,(dummy))
+
+	/* 3: clear dcache tags.
+	 */
+
+	li	a0, K0BASE
+	move	a2, t3		# dcacheSize
+	move	a3, t5		# dcacheLineSize
+	move	a1, a2
+	icacheop(a0,a1,a2,a3,Index_Store_Tag_D)
+#endif
+
+	j  ra
+	.end  mips_cache_reset
+
+
+/*******************************************************************************
+*
+* dcache_status - get cache status
+*
+* RETURNS: 0 - cache disabled; 1 - cache enabled
+*
+*/
+	.globl	dcache_status
+	.ent	dcache_status
+dcache_status:
+
+	mfc0	v0, CP0_CONFIG
+	andi	v0, v0, 1
+	j	ra
+
+	.end  dcache_status
+
+/*******************************************************************************
+*
+* dcache_disable - disable cache
+*
+* RETURNS: N/A
+*
+*/
+	.globl	dcache_disable
+	.ent	dcache_disable
+dcache_disable:
+
+	mfc0	t0, CP0_CONFIG
+	li	t1, -8
+	and	t0, t0, t1
+	ori	t0, t0, CONF_CM_UNCACHED
+	mtc0    t0, CP0_CONFIG
+	j	ra
+
+	.end  dcache_disable
+
+
+/*******************************************************************************
+*
+* mips_cache_lock - lock RAM area pointed to by a0 in cache.
+*
+* RETURNS: N/A
+*
+*/
+#if defined(CONFIG_PURPLE)
+# define	CACHE_LOCK_SIZE	(CFG_DCACHE_SIZE/2)
+#else
+# define	CACHE_LOCK_SIZE	(CFG_DCACHE_SIZE)
+#endif
+	.globl	mips_cache_lock
+	.ent	mips_cache_lock
+mips_cache_lock:
+	li	a1, K0BASE - CACHE_LOCK_SIZE
+	addu	a0, a1
+	li	a2, CACHE_LOCK_SIZE
+	li	a3, CFG_CACHELINE_SIZE
+	move	a1, a2
+	icacheop(a0,a1,a2,a3,0x1d)
+
+	j	ra
+	.end	mips_cache_lock
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/config.mk b/package/uboot-ifxmips/files/cpu/mips/danube/config.mk
new file mode 100644
index 0000000..3414ad8
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/config.mk
@@ -0,0 +1,53 @@
+#
+# (C) Copyright 2003
+# Wolfgang Denk, DENX Software Engineering, <wd@denx.de>
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+v=$(shell \
+$(CROSS_COMPILE)as --version|grep "GNU assembler"|awk '{print $$3}'|awk -F . '{print $$2}')
+
+ifndef PLATFORM_CPU
+PLATFORM_CPU = mips32r2
+endif
+
+MIPSFLAGS=$(shell \
+if [ "$v" -lt "14" ]; then \
+	echo "-mcpu=$(PLATFORM_CPU)"; \
+else \
+	echo "-march=$(PLATFORM_CPU) -mtune=$(PLATFORM_CPU)"; \
+fi)
+
+ifeq ($(CROSS_COMPILE_UCLIBC),1)
+ifneq (,$(findstring mipsel,$(CROSS_COMIPLE)))
+ENDIANNESS = -el
+else
+ENDIANNESS = -eb
+endif
+else
+ifneq (,$(findstring 4KCle,$(CROSS_COMPILE)))
+ENDIANNESS = -EL
+else
+ENDIANNESS = -EB
+endif
+endif
+
+MIPSFLAGS += $(ENDIANNESS) -mabicalls
+
+PLATFORM_CPPFLAGS += $(MIPSFLAGS)
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/cpu.c b/package/uboot-ifxmips/files/cpu/mips/danube/cpu.c
new file mode 100644
index 0000000..b9f90ce
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/cpu.c
@@ -0,0 +1,61 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <command.h>
+#if defined(CONFIG_INCA_IP)
+#	include <asm/inca-ip.h>
+#elif defined(CONFIG_IFX_MIPS)
+#	include <asm/danube.h>
+#	include "ifx_cpu.c"
+#endif
+#include <asm/mipsregs.h>
+
+int do_reset(cmd_tbl_t *cmdtp, int flag, int argc, char *argv[])
+{
+#if defined(CONFIG_INCA_IP)
+	*INCA_IP_WDT_RST_REQ = 0x3f;
+#elif defined(CONFIG_PURPLE) || defined(CONFIG_TB0229)
+	void (*f)(void) = (void *) 0xbfc00000;
+
+	f();
+#elif defined(CONFIG_IFX_MIPS)
+	IFX_CPU_RESET;
+#endif
+	fprintf(stderr, "*** reset failed ***\n");
+	return 0;
+}
+
+void flush_cache (ulong start_addr, ulong size)
+{
+
+}
+
+void write_one_tlb( int index, u32 pagemask, u32 hi, u32 low0, u32 low1 ){
+	write_32bit_cp0_register(CP0_ENTRYLO0, low0);
+	write_32bit_cp0_register(CP0_PAGEMASK, pagemask);
+	write_32bit_cp0_register(CP0_ENTRYLO1, low1);
+	write_32bit_cp0_register(CP0_ENTRYHI, hi);
+	write_32bit_cp0_register(CP0_INDEX, index);
+	tlb_write_indexed();
+}
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/ifx_asc.c b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_asc.c
new file mode 100644
index 0000000..52c6cb2
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_asc.c
@@ -0,0 +1,257 @@
+/*****************************************************************************
+ * DANUBE BootROM
+ * Copyright (c) 2005, Infineon Technologies AG, All rights reserved
+ * IFAP DC COM SD
+ *****************************************************************************/
+
+#include <config.h>
+//#include <lib.h>
+#include <asm/danube.h>
+#include <asm/addrspace.h>
+#include <asm/ifx_asc.h>
+
+
+#define ASC_FIFO_PRESENT
+#define SET_BIT(reg, mask)                  reg |= (mask)
+#define CLEAR_BIT(reg, mask)                reg &= (~mask)
+#define CLEAR_BITS(reg, mask)               CLEAR_BIT(reg, mask)
+#define SET_BITS(reg, mask)                 SET_BIT(reg, mask)
+#define SET_BITFIELD(reg, mask, off, val)   {reg &= (~mask); reg |= (val << off);}
+
+
+typedef unsigned char u8;
+typedef unsigned short u16;
+typedef unsigned long u32;
+typedef signed   long s32;
+typedef unsigned int uint;
+typedef unsigned long ulong;
+typedef volatile unsigned short vuint;
+
+
+
+void serial_setbrg (void);
+
+/*TODO: undefine this !!!*/
+#undef DEBUG_ASC_RAW
+#ifdef DEBUG_ASC_RAW
+#define DEBUG_ASC_RAW_RX_BUF		0xA0800000
+#define DEBUG_ASC_RAW_TX_BUF		0xA0900000
+#endif
+
+static volatile DanubeAsc_t *pAsc = (DanubeAsc_t *)DANUBE_ASC1;
+
+typedef struct{
+  u16 fdv; /* 0~511 fractional divider value*/
+  u16 reload; /* 13 bit reload value*/
+} ifx_asc_baud_reg_t;
+
+#ifdef ON_VENUS
+/*9600 @1.25M rel 00.08*/
+//#define FDV 503
+//#define RELOAD 7
+/*9600 @0.625M rel final00.01 & rtl_freeze*/
+#define FDV 503
+#define RELOAD 3
+/* first index is DDR_SEL, second index is FPI_SEL */
+#endif
+static ifx_asc_baud_reg_t g_danube_asc_baud[4][2] = 
+{
+#ifdef ON_VENUS
+     {{503,3},{503,3}},   /* 1152000 @ 166.67M and half*/
+      {{503,3},{503,3}},   /* 1152000 @ 133.3M  and half*/
+      {{503,3},{503,3}},   /* 1152000 @ 111.11M and half*/
+      {{503.3},{503,3}}    /* 1152000 @ 83.33M  and half*/
+#else
+/*  TAPEOUT table */
+     {{436,76},{419,36}},   /* 1152000 @ 166.67M and half*/
+      {{453,63},{453,31}},   /* 1152000 @ 133.3M  and half*/
+      {{501,58},{510,29}},   /* 1152000 @ 111.11M and half*/
+      {{419.36},{453,19}}    /* 1152000 @ 83.33M  and half*/
+#endif
+};
+/******************************************************************************
+*
+* asc_init - initialize a Danube ASC channel
+*
+* This routine initializes the number of data bits, parity
+* and set the selected baud rate. Interrupts are disabled.
+* Set the modem control signals if the option is selected.
+*
+* RETURNS: N/A
+*/
+
+int serial_init (void)
+{
+
+	/* and we have to set CLC register*/
+	CLEAR_BIT(pAsc->asc_clc, ASCCLC_DISS);
+	SET_BITFIELD(pAsc->asc_clc, ASCCLC_RMCMASK, ASCCLC_RMCOFFSET, 0x0001);
+
+	/* initialy we are in async mode */
+	pAsc->asc_con = ASCCON_M_8ASYNC;
+
+	/* select input port */
+	pAsc->asc_pisel = (CONSOLE_TTY & 0x1);
+
+	/* TXFIFO's filling level */
+	SET_BITFIELD(pAsc->asc_txfcon, ASCTXFCON_TXFITLMASK,
+			ASCTXFCON_TXFITLOFF, DANUBEASC_TXFIFO_FL);
+	/* enable TXFIFO */
+	SET_BIT(pAsc->asc_txfcon, ASCTXFCON_TXFEN);
+
+	/* RXFIFO's filling level */
+	SET_BITFIELD(pAsc->asc_txfcon, ASCRXFCON_RXFITLMASK,
+			ASCRXFCON_RXFITLOFF, DANUBEASC_RXFIFO_FL);
+	/* enable RXFIFO */
+	SET_BIT(pAsc->asc_rxfcon, ASCRXFCON_RXFEN);
+
+	/* set baud rate */
+	serial_setbrg();
+
+	/* enable error signals &  Receiver enable  */
+	SET_BIT(pAsc->asc_whbstate, ASCWHBSTATE_SETREN|ASCCON_FEN|ASCCON_TOEN|ASCCON_ROEN);
+
+	return 0;
+}
+
+void serial_setbrg (void)
+{
+	u32 uiReloadValue, fdv;
+
+#if defined(ON_IKOS)
+	/*1200 @77K */
+	fdv=472;
+	uiReloadValue=5;
+#else
+	/*venus & tapeout */
+  u32 ddr_sel,fpi_sel;
+  ddr_sel = (* DANUBE_CGU_SYS) & 0x3;
+  fpi_sel = ((* DANUBE_CGU_SYS) & 0x40)?1:0;
+	fdv= g_danube_asc_baud[ddr_sel][fpi_sel].fdv;
+	uiReloadValue=g_danube_asc_baud[ddr_sel][fpi_sel].reload;
+#endif	//ON_IKOS
+	/* Disable Baud Rate Generator; BG should only be written when R=0 */
+	CLEAR_BIT(pAsc->asc_con, ASCCON_R);
+
+	/* Enable Fractional Divider */
+	SET_BIT(pAsc->asc_con, ASCCON_FDE); /* FDE = 1 */
+
+	/* Set fractional divider value */
+	pAsc->asc_fdv = fdv & ASCFDV_VALUE_MASK;
+
+	/* Set reload value in BG */
+	pAsc->asc_bg = uiReloadValue;
+
+	/* Enable Baud Rate Generator */
+	SET_BIT(pAsc->asc_con, ASCCON_R);           /* R = 1 */
+}
+
+
+void serial_putc (const char c)
+{
+	u32 txFl = 0;
+#ifdef DEBUG_ASC_RAW
+	static u8 * debug = (u8 *) DEBUG_ASC_RAW_TX_BUF;
+	*debug++=c;
+#endif
+	if (c == '\n')
+		serial_putc ('\r');
+	/* check do we have a free space in the TX FIFO */
+	/* get current filling level */
+	do
+	{
+		txFl = ( pAsc->asc_fstat & ASCFSTAT_TXFFLMASK ) >> ASCFSTAT_TXFFLOFF;
+	}
+	while ( txFl == DANUBEASC_TXFIFO_FULL );
+
+	pAsc->asc_tbuf = c; /* write char to Transmit Buffer Register */
+
+	/* check for errors */
+	if ( pAsc->asc_state & ASCSTATE_TOE )
+	{
+		SET_BIT(pAsc->asc_whbstate, ASCWHBSTATE_CLRTOE);
+		return;
+	}
+}
+
+void serial_puts (const char *s)
+{
+	while (*s)
+	{
+		serial_putc (*s++);
+	}
+}
+
+int asc_inb(int timeout)
+{
+	u32 symbol_mask;
+	char c;
+	while ((pAsc->asc_fstat & ASCFSTAT_RXFFLMASK) == 0 ) {
+	}
+	symbol_mask = ((ASC_OPTIONS & ASCOPT_CSIZE) == ASCOPT_CS7) ? (0x7f) : (0xff);
+	c = (char)(pAsc->asc_rbuf & symbol_mask);
+	return (c);
+}
+
+int serial_getc (void)
+{
+	char c;
+	while ((pAsc->asc_fstat & ASCFSTAT_RXFFLMASK) == 0 );
+	c = (char)(pAsc->asc_rbuf & 0xff);
+
+#ifdef 	DEBUG_ASC_RAW
+	static u8* debug=(u8*)(DEBUG_ASC_RAW_RX_BUF);
+	*debug++=c;
+#endif
+	return c;
+}
+
+
+
+int serial_tstc (void)
+{
+         int res = 1;
+
+#ifdef ASC_FIFO_PRESENT
+    if ( (pAsc->asc_fstat & ASCFSTAT_RXFFLMASK) == 0 )
+    {
+        res = 0;
+    }
+#else
+    if (!(*(volatile unsigned long*)(SFPI_INTCON_BASEADDR + FBS_ISR) &
+			    					FBS_ISR_AR))
+    
+    {
+        res = 0;
+    }
+#endif
+#if 0
+    else if ( pAsc->asc_con & ASCCON_FE )
+    {
+        SET_BIT(pAsc->asc_whbcon, ASCWHBCON_CLRFE);
+        res = 0;
+    }
+    else if ( pAsc->asc_con & ASCCON_PE )
+    {
+        SET_BIT(pAsc->asc_whbcon, ASCWHBCON_CLRPE);
+        res = 0;
+    }
+    else if ( pAsc->asc_con & ASCCON_OE )
+    {
+        SET_BIT(pAsc->asc_whbcon, ASCWHBCON_CLROE);
+        res = 0;
+    }
+#endif
+  return res;
+}
+
+
+int serial_start(void)
+{
+   return 1;
+}
+
+int serial_stop(void)
+{
+   return 1;
+}
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cache.S b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cache.S
new file mode 100644
index 0000000..fc482dc
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cache.S
@@ -0,0 +1,60 @@
+
+#define IFX_CACHE_EXTRA_INVALID_TAG						\
+	mtc0	zero, CP0_TAGLO, 1;						\
+	mtc0	zero, CP0_TAGLO, 2;						\
+	mtc0	zero, CP0_TAGLO, 3;						\
+	mtc0	zero, CP0_TAGLO, 4;
+
+#define IFX_CACHE_EXTRA_OPERATION						\
+	/* set WST bit */							\
+	mfc0	a0, CP0_ECC;							\
+	li	a1, ECCF_WST;							\
+	or	a0, a1;								\
+	mtc0	a0, CP0_ECC;							\
+										\
+	li	a0, K0BASE;							\
+	move	a2, t2;		/* icacheSize */				\
+	move	a3, t4;		/* icacheLineSize */				\
+	move	a1, a2;								\
+	icacheop(a0,a1,a2,a3,(Index_Store_Tag_I));				\
+										\
+	/* clear WST bit */							\
+	mfc0	a0, CP0_ECC;							\
+	li	a1, ~ECCF_WST;							\
+	and	a0, a1;								\
+	mtc0	a0, CP0_ECC;							\
+										\
+	/* 1: initialise dcache tags. */					\
+										\
+	/* cache line size */							\
+	li	a2, CFG_CACHELINE_SIZE;						\
+	/* kseg0 mem address */							\
+	li	a1, 0;								\
+	li	a3, CFG_CACHE_SETS * CFG_CACHE_WAYS;				\
+1:										\
+	/* store tag (invalid, not locked) */					\
+	cache 0x8, 0(a1);							\
+	cache 0x9, 0(a1);							\
+										\
+	add	a3, -1;								\
+	bne	a3, zero, 1b;							\
+	add	a1, a2;								\
+										\
+	/* set WST bit */							\
+	mfc0	a0, CP0_ECC;							\
+	li	a1, ECCF_WST;							\
+	or	a0, a1;								\
+	mtc0	a0, CP0_ECC;							\
+										\
+	li	a0, K0BASE;							\
+	move	a2, t3;		/* dcacheSize */				\
+	move	a3, t5;		/* dcacheLineSize */				\
+	move	a1, a2;								\
+	icacheop(a0,a1,a2,a3,(Index_Store_Tag_D));				\
+										\
+	/* clear WST bit */							\
+	mfc0	a0, CP0_ECC;							\
+	li	a1, ~ECCF_WST;							\
+	and	a0, a1;								\
+	mtc0	a0, CP0_ECC;
+
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cgu.c b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cgu.c
new file mode 100644
index 0000000..bfaea37
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cgu.c
@@ -0,0 +1,1086 @@
+/*
+ * ########################################################################
+ *
+ *  This program is free software; you can distribute it and/or modify it
+ *  under the terms of the GNU General Public License (Version 2) as
+ *  published by the Free Software Foundation.
+ *
+ *  This program is distributed in the hope it will be useful, but WITHOUT
+ *  ANY WARRANTY; without even the implied warranty of MERCHANTABILITY or
+ *  FITNESS FOR A PARTICULAR PURPOSE.  See the GNU General Public License
+ *  for more details.
+ *
+ *  You should have received a copy of the GNU General Public License along
+ *  with this program; if not, write to the Free Software Foundation, Inc.,
+ *  59 Temple Place - Suite 330, Boston MA 02111-1307, USA.
+ *
+ * ########################################################################
+ *
+ * danube_cgu.c
+ *
+ *  Description:
+ *    device driver of clock generation unit of Danube chip
+ *  Author:
+ *    Samuels Xu Liang
+ *  Created:
+ *    19 Jul 2005
+ *  History & Modification Tag:
+ *  ___________________________________________________________________________
+ *  |  Tag   |                  Comments                   | Modifier & Time  |
+ *  |--------+---------------------------------------------+------------------|
+ *  |  S0.0  | First version of this driver and the tag is | Samuels Xu Liang |
+ *  |        | implied.                                    |   19 Jul 2005    |
+ *  ---------------------------------------------------------------------------
+ *
+ */
+
+
+/*
+ * ####################################
+ *              Head File
+ * ####################################
+ */
+
+/*
+ *  Common Head File
+ */
+#include <linux/config.h>
+#include <linux/kernel.h>
+#include <linux/module.h>
+#include <linux/version.h>
+#include <linux/types.h>
+#include <linux/fs.h>
+#include <linux/miscdevice.h>
+#include <linux/init.h>
+#include <asm/uaccess.h>
+#include <asm/unistd.h>
+#include <asm/irq.h>
+#include <linux/errno.h>
+
+/*
+ *  Chip Specific Head File
+ */
+#include "ifx_cgu.h"
+
+
+/*
+ * ####################################
+ *              Definition
+ * ####################################
+ */
+
+#define DEBUG_ON_AMAZON                 1
+#define DEBUG_PRINT_INFO                1
+
+/*
+ *  Frequency of Clock Direct Feed from The Analog Line Driver Chip
+ */
+#define BASIC_INPUT_CLOCK_FREQUENCY     35328000
+
+/*
+ *  Bits Operation
+ */
+#define GET_BITS(x, msb, lsb)           (((x) & ((1 << ((msb) + 1)) - 1)) >> (lsb))
+#define SET_BITS(x, msb, lsb, value)    (((x) & ~(((1 << ((msb) + 1)) - 1) ^ ((1 << (lsb)) - 1))) | (((value) & ((1 << (1 + (msb) - (lsb))) - 1)) << (lsb)))
+
+/*
+ *  CGU Register Mapping
+ */
+#define DANUBE_CGU                      (KSEG1 + 0x1F103000)
+#define DANUBE_CGU_DIV                  ((volatile u32*)(DANUBE_CGU + 0x0000))
+#define DANUBE_CGU_PLL_NMK0             ((volatile u32*)(DANUBE_CGU + 0x0004))
+#define DANUBE_CGU_PLL_SR0              ((volatile u32*)(DANUBE_CGU + 0x0008))
+#define DANUBE_CGU_PLL_NMK1             ((volatile u32*)(DANUBE_CGU + 0x000C))
+#define DANUBE_CGU_PLL_SR1              ((volatile u32*)(DANUBE_CGU + 0x0010))
+#define DANUBE_CGU_PLL_SR2              ((volatile u32*)(DANUBE_CGU + 0x0014))
+#define DANUBE_CGU_IF_CLK               ((volatile u32*)(DANUBE_CGU + 0x0018))
+#define DANUBE_CGU_OSC_CTRL             ((volatile u32*)(DANUBE_CGU + 0x001C))
+#define DANUBE_CGU_SMD                  ((volatile u32*)(DANUBE_CGU + 0x0020))
+#define DANUBE_CGU_CRD                  ((volatile u32*)(DANUBE_CGU + 0x0024))
+#define DANUBE_CGU_CT1SR                ((volatile u32*)(DANUBE_CGU + 0x0028))
+#define DANUBE_CGU_CT2SR                ((volatile u32*)(DANUBE_CGU + 0x002C))
+#define DANUBE_CGU_PCMCR                ((volatile u32*)(DANUBE_CGU + 0x0030))
+#define DANUBE_CGU_MUX                  ((volatile u32*)(DANUBE_CGU + 0x0034))
+
+/*
+ *  CGU Divider Register
+ */
+#define CGU_DIV_SFTR                    (*DANUBE_CGU_DIV & (1 << 31))
+#define CGU_DIV_DIVE                    (*DANUBE_CGU_DIV & (1 << 16))
+#define CGU_DIV_IOR                     GET_BITS(*DANUBE_CGU_DIV, 5, 4)
+#define CGU_DIV_FKS                     GET_BITS(*DANUBE_CGU_DIV, 3, 2)
+#define CGU_DIV_FBS                     GET_BITS(*DANUBE_CGU_DIV, 1, 0)
+
+/*
+ *  CGU PLL0 NMK Register
+ */
+#define CGU_PLL_NMK0_PLLN               ((*DANUBE_CGU_PLL_NMK0 & (0xFFFFFFFF ^ ((1 << 24) - 1))) >> 24)
+#define CGU_PLL_NMK0_PLLM               GET_BITS(*DANUBE_CGU_PLL_NMK0, 23, 20)
+#define CGU_PLL_NMK0_PLLK               GET_BITS(*DANUBE_CGU_PLL_NMK0, 19, 0)
+
+/*
+ *  CGU PLL0 Status Register
+ */
+#define CGU_PLL_SR0_PLLDIV              ((*DANUBE_CGU_PLL_SR0 & (0xFFFFFFFF ^ ((1 << 28) - 1))) >> 28)
+#define CGU_PLL_SR0_PLLDEN              (*DANUBE_CGU_PLL_SR0 & (1 << 26))
+#define CGU_PLL_SR0_PLLPSE              GET_BITS(*DANUBE_CGU_PLL_SR0, 5, 4)
+#define CGU_PLL_SR0_PLLB                (*DANUBE_CGU_PLL_SR0 & (1 << 2))
+#define CGU_PLL_SR0_PLLL                (*DANUBE_CGU_PLL_SR0 & (1 << 1))
+#define CGU_PLL_SR0_PLLEN               (*DANUBE_CGU_PLL_SR0 & (1 << 0))
+
+#define CGU_PLL_SR0_DSMSEL              1
+#define CGU_PLL_SR0_PHASE_DIV_EN        1
+
+/*
+ *  CGU PLL1 NMK Register
+ */
+#define CGU_PLL_NMK1_PLLN               ((*DANUBE_CGU_PLL_NMK1 & (0xFFFFFFFF ^ ((1 << 24) - 1))) >> 24)
+#define CGU_PLL_NMK1_PLLM               GET_BITS(*DANUBE_CGU_PLL_NMK1, 23, 20)
+#define CGU_PLL_NMK1_PLLK               GET_BITS(*DANUBE_CGU_PLL_NMK1, 19, 0)
+
+/*
+ *  CGU PLL1 Status Register
+ */
+#define CGU_PLL_SR1_PLLDIV              ((*DANUBE_CGU_PLL_SR1 & (0xFFFFFFFF ^ ((1 << 28) - 1))) >> 28)
+#define CGU_PLL_SR1_PLLDEN              (*DANUBE_CGU_PLL_SR1 & (1 << 26))
+#define CGU_PLL_SR1_PLLPSE              GET_BITS(*DANUBE_CGU_PLL_SR1, 5, 4)
+#define CGU_PLL_SR1_PLLB                (*DANUBE_CGU_PLL_SR1 & (1 << 2))
+#define CGU_PLL_SR1_PLLL                (*DANUBE_CGU_PLL_SR1 & (1 << 1))
+#define CGU_PLL_SR1_PLLEN               (*DANUBE_CGU_PLL_SR1 & (1 << 0))
+
+#define CGU_PLL_SR1_DSMSEL              1
+#define CGU_PLL_SR1_PHASE_DIV_EN        1
+
+/*
+ *  CGU PLL2 Status Register
+ */
+#define CGU_PLL_SR2_PLLDIV              ((*DANUBE_CGU_PLL_SR2 & (0xFFFFFFFF ^ ((1 << 28) - 1))) >> 28)
+#define CGU_PLL_SR2_PLLDEN              (*DANUBE_CGU_PLL_SR2 & (1 << 27))
+#define CGU_PLL_SR2_PLLN                GET_BITS(*DANUBE_CGU_PLL_SR2, 25, 20)
+#define CGU_PLL_SR2_PLLM                GET_BITS(*DANUBE_CGU_PLL_SR2, 19, 16)
+#define CGU_PLL_SR2_PLLPS               (*DANUBE_CGU_PLL_SR2 & (1 << 5))
+#define CGU_PLL_SR2_PLLPE               (*DANUBE_CGU_PLL_SR2 & (1 << 4))
+#define CGU_PLL_SR2_PLLB                (*DANUBE_CGU_PLL_SR2 & (1 << 2))
+#define CGU_PLL_SR2_PLLL                (*DANUBE_CGU_PLL_SR2 & (1 << 1))
+#define CGU_PLL_SR2_PLLEN               (*DANUBE_CGU_PLL_SR2 & (1 << 0))
+
+/*
+ *  CGU Interface Clock Register
+ */
+#define CGU_IF_CLK_CLKOD0               GET_BITS(*DANUBE_CGU_IF_CLK, 27, 26)
+#define CGU_IF_CLK_CLKOD1               GET_BITS(*DANUBE_CGU_IF_CLK, 25, 24)
+#define CGU_IF_CLK_CLKOD2               GET_BITS(*DANUBE_CGU_IF_CLK, 23, 22)
+#define CGU_IF_CLK_CLKOD3               GET_BITS(*DANUBE_CGU_IF_CLK, 21, 20)
+#define CGU_IF_CLK_PDA                  (*DANUBE_CGU_IF_CLK & (1 << 18))
+#define CGU_IF_CLK_PCI_B                (*DANUBE_CGU_IF_CLK & (1 << 17))
+#define CGU_IF_CLK_PCIBM                (*DANUBE_CGU_IF_CLK & (1 << 16))
+#define CGU_IF_CLK_MIICS                (*DANUBE_CGU_IF_CLK & (1 << 3))
+#define CGU_IF_CLK_USBCS                (*DANUBE_CGU_IF_CLK & (1 << 2))
+#define CGU_IF_CLK_PCIF                 (*DANUBE_CGU_IF_CLK & (1 << 1))
+#define CGU_IF_CLK_PCIS                 (*DANUBE_CGU_IF_CLK & (1 << 0))
+
+/*
+ *  CGU Oscillator Control Register
+ */
+#define CGU_OSC_CTRL                    GET_BITS(*DANUBE_CGU_OSC_CTRL, 1, 0)
+
+/*
+ *  CGU SDRAM Memory Delay Register
+ */
+#define CGU_SMD_CLKI                    (*DANUBE_CGU_SMD & (1 << 31))
+#define CGU_SMD_MIDS                    GET_BITS(*DANUBE_CGU_SMD, 17, 12)
+#define CGU_SMD_MODS                    GET_BITS(*DANUBE_CGU_SMD, 11, 6)
+#define CGU_SMD_MDSEL                   GET_BITS(*DANUBE_CGU_SMD, 5, 0)
+
+/*
+ *  CGU CPU Clock Reduction Register
+ */
+#define CGU_CRD_SFTR                    (*DANUBE_CGU_CRD & (1 << 31))
+#define CGU_CRD_DIVE                    (*DANUBE_CGU_CRD & (1 << 16))
+#define CGU_CRD_CRD1                    GET_BITS(*DANUBE_CGU_CRD, 3, 2)
+#define CGU_CRD_CRD                     GET_BITS(*DANUBE_CGU_CRD, 1, 0)
+
+/*
+ *  CGU CT Status Register 1
+ */
+#define CGU_CT1SR_PDOUT                 GET_BITS(*DANUBE_CGU_CT1SR, 13, 0)
+
+/*
+ *  CGU CT Status Register 2
+ */
+#define CGU_CT2SR_PLL1K                 GET_BITS(*DANUBE_CGU_CT2SR, 9, 0)
+
+/*
+ *  CGU PCM Control Register
+ */
+#define CGU_PCMCR_DCL1                  GET_BITS(*DANUBE_CGU_PCMCR, 27, 25)
+#define CGU_PCMCR_MUXDCL                (*DANUBE_CGU_PCMCR & (1 << 22))
+#define CGU_PCMCR_MUXFSC                (*DANUBE_CGU_PCMCR & (1 << 18))
+#define CGU_PCMCR_PCM_SL                (*DANUBE_CGU_PCMCR & (1 << 13))
+#define CGU_PCMCR_DNTR                  (*DANUBE_CGU_PCMCR & (1 << 12))
+
+/*
+ *  CGU Clock Mux Register
+ */
+#define CGU_MUX_MII_CLK                 (*DANUBE_CGU_MUX & (1 << 6))
+#define CGU_MUX_SUB_SYS                 GET_BITS(*DANUBE_CGU_MUX, 5, 3)
+#define CGU_MUX_PP32                    GET_BITS(*DANUBE_CGU_MUX, 1, 0)
+
+
+/*
+ * ####################################
+ * Preparation of Debug on Amazon Chip
+ * ####################################
+ */
+
+/*
+ *  If try module on Amazon chip, prepare some tricks to prevent invalid memory write.
+ */
+#if defined(DEBUG_ON_AMAZON) && DEBUG_ON_AMAZON
+    u32 g_pFakeRegisters[0x0100];
+
+    #undef  DANUBE_CGU
+    #define DANUBE_CGU                  ((u32)g_pFakeRegisters)
+#endif  //  defined(DEBUG_ON_AMAZON) && DEBUG_ON_AMAZON
+
+
+/*
+ * ####################################
+ *              Data Type
+ * ####################################
+ */
+
+
+/*
+ * ####################################
+ *             Declaration
+ * ####################################
+ */
+
+/*
+ *  Pre-declaration of File Operations
+ */
+static ssize_t cgu_read(struct file *, char *, size_t, loff_t *);
+static ssize_t cgu_write(struct file *, const char *, size_t, loff_t *);
+static int cgu_ioctl(struct inode *, struct file *, unsigned int, unsigned long);
+static int cgu_open(struct inode *, struct file *);
+static int cgu_release(struct inode *, struct file *);
+
+/*
+ *  Pre-declaration of 64-bit Unsigned Integer Operation
+ */
+static inline void uint64_multiply(unsigned int, unsigned int, unsigned int *);
+static inline void uint64_divide(unsigned int *, unsigned int, unsigned int *, unsigned int *);
+
+/*
+ *  Calculate PLL Frequency
+ */
+static inline u32 cal_dsm(u32, u32);
+static inline u32 mash_dsm(u32, u32, u32);
+static inline u32 ssff_dsm_1(u32, u32, u32);
+static inline u32 ssff_dsm_2(u32, u32, u32);
+static inline u32 dsm(u32 M, u32, u32, int, int);
+static inline u32 cgu_get_pll0_fosc(void);
+static inline u32 cgu_get_pll0_fps(void);
+static inline u32 cgu_get_pll0_fdiv(void);
+static inline u32 cgu_get_pll1_fosc(void);
+static inline u32 cgu_get_pll1_fps(void);
+static inline u32 cgu_get_pll1_fdiv(void);
+static inline u32 cgu_get_pll2_fosc(void);
+static inline u32 cgu_get_pll2_fps(void);
+
+/*
+ *  Export Functions
+ */
+u32 cgu_get_mips_clock(int);
+u32 cgu_get_cpu_clock(void);
+u32 cgu_get_io_region_clock(void);
+u32 cgu_get_fpi_bus_clock(int);
+u32 cgu_get_pp32_clock(void);
+u32 cgu_get_pci_clock(void);
+u32 cgu_get_ethernet_clock(void);
+u32 cgu_get_usb_clock(void);
+u32 cgu_get_clockout(int);
+
+
+/*
+ * ####################################
+ *            Local Variable
+ * ####################################
+ */
+
+static struct file_operations cgu_fops = {
+    owner:      THIS_MODULE,
+    llseek:     no_llseek,
+    read:       cgu_read,
+    write:      cgu_write,
+    ioctl:      cgu_ioctl,
+    open:       cgu_open,
+    release:    cgu_release
+};
+
+static struct miscdevice cgu_miscdev = {
+    MISC_DYNAMIC_MINOR,
+    "danube_cgu_dev",
+    &cgu_fops
+};
+
+
+/*
+ * ####################################
+ *           Global Variable
+ * ####################################
+ */
+
+
+/*
+ * ####################################
+ *            Local Function
+ * ####################################
+ */
+
+static ssize_t cgu_read(struct file *file, char *buf, size_t count, loff_t *ppos)
+{
+    return -EPERM;
+}
+
+static ssize_t cgu_write(struct file *file, const char *buf, size_t count, loff_t *ppos)
+{
+    return -EPERM;
+}
+
+static int cgu_ioctl(struct inode *inode, struct file *file, unsigned int cmd, unsigned long arg)
+{
+    int ret = 0;
+    struct cgu_clock_rates rates;
+
+    if ( _IOC_TYPE(cmd) != CGU_IOC_MAGIC
+        || _IOC_NR(cmd) >= CGU_IOC_MAXNR )
+        return -ENOTTY;
+
+    if ( _IOC_DIR(cmd) & _IOC_READ )
+        ret = !access_ok(VERIFY_WRITE, arg, _IOC_SIZE(cmd));
+    else if ( _IOC_DIR(cmd) & _IOC_WRITE )
+        ret = !access_ok(VERIFY_READ, arg, _IOC_SIZE(cmd));
+    if ( ret )
+        return -EFAULT;
+
+    switch ( cmd )
+    {
+    case CGU_GET_CLOCK_RATES:
+        /*  Calculate Clock Rates   */
+        rates.mips0     = cgu_get_mips_clock(0);
+        rates.mips1     = cgu_get_mips_clock(1);
+        rates.cpu       = cgu_get_cpu_clock();
+        rates.io_region = cgu_get_io_region_clock();
+        rates.fpi_bus1  = cgu_get_fpi_bus_clock(1);
+        rates.fpi_bus2  = cgu_get_fpi_bus_clock(2);
+        rates.pp32      = cgu_get_pp32_clock();
+        rates.pci       = cgu_get_pci_clock();
+        rates.ethernet  = cgu_get_ethernet_clock();
+        rates.usb       = cgu_get_usb_clock();
+        rates.clockout0 = cgu_get_clockout(0);
+        rates.clockout1 = cgu_get_clockout(1);
+        rates.clockout2 = cgu_get_clockout(2);
+        rates.clockout3 = cgu_get_clockout(3);
+        /*  Copy to User Space      */
+        copy_to_user((char*)arg, (char*)&rates, sizeof(rates));
+
+        ret = 0;
+        break;
+    default:
+        ret = -ENOTTY;
+    }
+
+    return ret;
+}
+
+static int cgu_open(struct inode *inode, struct file *file)
+{
+    return 0;
+}
+
+static int cgu_release(struct inode *inode, struct file *file)
+{
+    return 0;
+}
+
+/*
+ *  Description:
+ *    calculate 64-bit multiplication result of two 32-bit unsigned integer
+ *  Input:
+ *    u32Multiplier1 --- u32 (32-bit), one of the multipliers
+ *    u32Multiplier2 --- u32 (32-bit), the other multiplier
+ *    u32Result      --- u32[2], array to retrieve the multiplication result,
+ *                       index 0 is high word, index 1 is low word
+ *  Output:
+*    none
+ */
+static inline void uint64_multiply(u32 u32Multiplier1, u32 u32Multiplier2, u32 u32Result[2])
+{
+	u32 u32Multiplier1LowWord = u32Multiplier1 & 0xFFFF;
+	u32 u32Multiplier1HighWord = u32Multiplier1 >> 16;
+	u32 u32Multiplier2LowWord = u32Multiplier2 & 0xFFFF;
+	u32 u32Multiplier2HighWord = u32Multiplier2 >> 16;
+	u32 u32Combo1, u32Combo2, u32Combo3, u32Combo4;
+	u32 u32Word1, u32Word2, u32Word3, u32Word4;
+
+	u32Combo1 = u32Multiplier1LowWord * u32Multiplier2LowWord;
+	u32Combo2 = u32Multiplier1HighWord * u32Multiplier2LowWord;
+	u32Combo3 = u32Multiplier1LowWord * u32Multiplier2HighWord;
+	u32Combo4 = u32Multiplier1HighWord * u32Multiplier2HighWord;
+
+	u32Word1 = u32Combo1 & 0xFFFF;
+	u32Word2 = (u32Combo1 >> 16) + (u32Combo2 & 0xFFFF) + (u32Combo3 & 0xFFFF);
+	u32Word3 = (u32Combo2 >> 16) + (u32Combo3 >> 16) + (u32Combo4 & 0xFFFF) + (u32Word2 >> 16);
+	u32Word4 = (u32Combo4 >> 16) + (u32Word3 >> 16);
+
+	u32Result[0] = (u32Word4 << 16) | u32Word3;
+	u32Result[1] = (u32Word2 << 16) | u32Word1;
+}
+
+/*
+ *  Description:
+ *    divide 64-bit unsigned integer with 32-bit unsigned integer
+ *  Input:
+ *    u32Numerator   --- u32[2], index 0 is high word of numerator, while
+ *                       index 1 is low word of numerator
+ *    u32Denominator --- u32 (32-bit), the denominator in division, this
+ *                       parameter can not be zero, or lead to unpredictable
+ *                       result
+ *    pu32Quotient   --- u32 *, the pointer to retrieve 32-bit quotient, null
+ *                       pointer means ignore quotient
+ *    pu32Residue    --- u32 *, the pointer to retrieve 32-bit residue null
+ *                       pointer means ignore residue
+ *  Output:
+ *    none
+ */
+static inline void uint64_divide(u32 u32Numerator[2], u32 u32Denominator, u32 *pu32Quotient, u32 *pu32Residue)
+{
+	u32 u32DWord1, u32DWord2, u32DWord3;
+	u32 u32Quotient;
+	int i;
+
+	u32DWord3 = 0;
+	u32DWord2 = u32Numerator[0];
+	u32DWord1 = u32Numerator[1];
+
+	u32Quotient = 0;
+
+	for ( i = 0; i < 64; i++ )
+	{
+		u32DWord3 = (u32DWord3 << 1) | (u32DWord2 >> 31);
+		u32DWord2 = (u32DWord2 << 1) | (u32DWord1 >> 31);
+		u32DWord1 <<= 1;
+		u32Quotient <<= 1;
+		if ( u32DWord3 >= u32Denominator )
+		{
+			u32DWord3 -= u32Denominator;
+			u32Quotient |= 1;
+		}
+	}
+	if ( pu32Quotient )
+	    *pu32Quotient = u32Quotient;
+	if ( pu32Residue )
+	    *pu32Residue = u32DWord3;
+}
+
+/*
+ *  Description:
+ *    common routine to calculate PLL frequency
+ *  Input:
+ *    num --- u32, numerator
+ *    den --- u32, denominator
+ *  Output:
+ *    u32 --- frequency the PLL output
+ */
+static inline u32 cal_dsm(u32 num, u32 den)
+{
+    u32 ret;
+    u32 temp[2];
+    u32 residue;
+
+    uint64_multiply(num, BASIC_INPUT_CLOCK_FREQUENCY, temp);
+    uint64_divide(temp, den, &ret, &residue);
+    if ( (residue << 1) >= den )
+        ret++;
+
+    return ret;
+}
+
+/*
+ *  Description:
+ *    calculate PLL frequency following MASH-DSM
+ *  Input:
+ *    M   --- u32, denominator coefficient
+ *    N   --- u32, numerator integer coefficient
+ *    K   --- u32, numerator fraction coefficient
+ *  Output:
+ *    u32 --- frequency the PLL output
+ */
+static inline u32 mash_dsm(u32 M, u32 N, u32 K)
+{
+    u32 num = ((N + 1) << 10) + K;
+    u32 den = (M + 1) << 10;
+
+    return cal_dsm(num, den);
+}
+
+/*
+ *  Description:
+ *    calculate PLL frequency following SSFF-DSM (0.25 < fraction < 0.75)
+ *  Input:
+ *    M   --- u32, denominator coefficient
+ *    N   --- u32, numerator integer coefficient
+ *    K   --- u32, numerator fraction coefficient
+ *  Output:
+ *    u32 --- frequency the PLL output
+ */
+static inline u32 ssff_dsm_1(u32 M, u32 N, u32 K)
+{
+    u32 num = ((N + 1) << 11) + K + 512;
+    u32 den = (M + 1) << 11;
+
+    return cal_dsm(num, den);
+}
+
+/*
+ *  Description:
+ *    calculate PLL frequency following SSFF-DSM
+ *    (fraction < 0.125 || fraction > 0.875)
+ *  Input:
+ *    M   --- u32, denominator coefficient
+ *    N   --- u32, numerator integer coefficient
+ *    K   --- u32, numerator fraction coefficient
+ *  Output:
+ *    u32 --- frequency the PLL output
+ */
+static inline u32 ssff_dsm_2(u32 M, u32 N, u32 K)
+{
+    u32 num = K >= 512 ? ((N + 1) << 12) + K - 512 : ((N + 1) << 12) + K + 3584;
+    u32 den = (M + 1) << 12;
+
+    return cal_dsm(num, den);
+}
+
+/*
+ *  Description:
+ *    calculate PLL frequency
+ *  Input:
+ *    M            --- u32, denominator coefficient
+ *    N            --- u32, numerator integer coefficient
+ *    K            --- u32, numerator fraction coefficient
+ *    dsmsel       --- int, 0: MASH-DSM, 1: SSFF-DSM
+ *    phase_div_en --- int, 0: 0.25 < fraction < 0.75
+ *                          1: fraction < 0.125 || fraction > 0.875
+ *  Output:
+ *    u32          --- frequency the PLL output
+ */
+static inline u32 dsm(u32 M, u32 N, u32 K, int dsmsel, int phase_div_en)
+{
+    if ( !dsmsel )
+        return mash_dsm(M, N, K);
+    else
+        if ( !phase_div_en )
+            return ssff_dsm_1(M, N, K);
+        else
+            return ssff_dsm_2(M, N, K);
+}
+
+/*
+ *  Description:
+ *    get oscillate frequency of PLL0
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL0 Fosc
+ */
+static inline u32 cgu_get_pll0_fosc(void)
+{
+    return CGU_PLL_SR0_PLLB ? BASIC_INPUT_CLOCK_FREQUENCY : dsm(CGU_PLL_NMK0_PLLM, CGU_PLL_NMK0_PLLN, CGU_PLL_NMK0_PLLK, CGU_PLL_SR0_DSMSEL, CGU_PLL_SR0_PHASE_DIV_EN);
+}
+
+/*
+ *  Description:
+ *    get output frequency of PLL0 phase shifter
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL0 Fps
+ */
+static inline u32 cgu_get_pll0_fps(void)
+{
+    register u32 fps = cgu_get_pll0_fosc();
+
+    switch ( CGU_PLL_SR0_PLLPSE )
+    {
+    case 1:
+        /*  1.5     */
+        fps = ((fps << 1) + 1) / 3; break;
+    case 2:
+        /*  1.25    */
+        fps = ((fps << 2) + 2) / 5; break;
+    case 3:
+        /*  3.5     */
+        fps = ((fps << 1) + 3) / 7;
+    }
+    return fps;
+}
+
+/*
+ *  Description:
+ *    get output frequency of PLL0 output divider
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL0 Fdiv
+ */
+static inline u32 cgu_get_pll0_fdiv(void)
+{
+    register u32 fdiv = cgu_get_pll0_fosc();
+
+    if ( CGU_PLL_SR0_PLLDEN )
+        fdiv = (fdiv + (CGU_PLL_SR0_PLLDIV + 1) / 2) / (CGU_PLL_SR0_PLLDIV + 1);
+    return fdiv;
+}
+
+/*
+ *  Description:
+ *    get oscillate frequency of PLL1
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL1 Fosc
+ */
+static inline u32 cgu_get_pll1_fosc(void)
+{
+    return CGU_PLL_SR1_PLLB ? BASIC_INPUT_CLOCK_FREQUENCY : dsm(CGU_PLL_NMK1_PLLM, CGU_PLL_NMK1_PLLN, CGU_PLL_NMK1_PLLK, CGU_PLL_SR1_DSMSEL, CGU_PLL_SR1_PHASE_DIV_EN);
+}
+
+/*
+ *  Description:
+ *    get output frequency of PLL1 phase shifter
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL1 Fps
+ */
+static inline u32 cgu_get_pll1_fps(void)
+{
+    register u32 fps = cgu_get_pll1_fosc();
+
+    switch ( CGU_PLL_SR1_PLLPSE )
+    {
+    case 1:
+        /*  1.5     */
+        fps = ((fps << 1) + 1) / 3; break;
+    case 2:
+        /*  1.25    */
+        fps = ((fps << 2) + 2) / 5; break;
+    case 3:
+        /*  3.5     */
+        fps = ((fps << 1) + 3) / 7;
+    }
+    return fps;
+}
+
+/*
+ *  Description:
+ *    get output frequency of PLL1 output divider
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL1 Fdiv
+ */
+static inline u32 cgu_get_pll1_fdiv(void)
+{
+    register u32 fdiv = cgu_get_pll1_fosc();
+
+    if ( CGU_PLL_SR1_PLLDEN )
+        fdiv = (fdiv + (CGU_PLL_SR1_PLLDIV + 1) / 2) / (CGU_PLL_SR1_PLLDIV + 1);
+    return fdiv;
+}
+
+/*
+ *  Description:
+ *    get oscillate frequency of PLL2
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL2 Fosc
+ */
+static inline u32 cgu_get_pll2_fosc(void)
+{
+    u32 ret;
+    u32 temp[2];
+    u32 residue;
+
+    uint64_multiply((CGU_PLL_SR2_PLLN + 1) * 8, cgu_get_pll0_fdiv(), temp);
+    uint64_divide(temp, CGU_PLL_SR2_PLLM + 1, &ret, &residue);
+    if ( (residue << 1) >= CGU_PLL_SR2_PLLM )
+        ret++;
+
+    return ret;
+}
+
+/*
+ *  Description:
+ *    get output frequency of PLL2 phase shifter
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PLL2 Fps
+ */
+static inline u32 cgu_get_pll2_fps(void)
+{
+    register u32 fps = cgu_get_pll2_fosc();
+
+    if ( CGU_PLL_SR2_PLLPE )
+    {
+        if ( CGU_PLL_SR2_PLLPS )
+            /*  1.25    */
+            fps = ((fps << 3) + 4) / 9;
+        else
+            /*  1.125   */
+            fps = ((fps << 2) + 2) / 5;
+    }
+
+    return fps;
+}
+
+
+/*
+ * ####################################
+ *           Global Function
+ * ####################################
+ */
+
+/*
+ *  Description:
+ *    get frequency of MIPS (0: core, 1: DSP)
+ *  Input:
+ *    cpu --- int, 0: core, 1: DSP
+ *  Output:
+ *    u32 --- frequency of MIPS coprocessor (0: core, 1: DSP)
+ */
+u32 cgu_get_mips_clock(int cpu)
+{
+    register u32 ret = cgu_get_pll0_fosc();
+
+    if ( CGU_CRD_CRD )
+        ret = (ret + (CGU_CRD_CRD >> 1)) / (CGU_CRD_CRD + 1);
+    if ( cpu == 0 && CGU_CRD_CRD1 )
+        ret >>= CGU_CRD_CRD1;
+    return ret;
+}
+
+/*
+ *  Description:
+ *    get frequency of MIPS core
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of MIPS core
+ */
+u32 cgu_get_cpu_clock(void)
+{
+    return cgu_get_mips_clock(0);
+}
+
+/*
+ *  Description:
+ *    get frequency of sub-system and memory controller
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of sub-system and memory controller
+ */
+u32 cgu_get_io_region_clock(void)
+{
+    register u32 ret = (CGU_MUX_SUB_SYS > 4) ? cgu_get_pll0_fosc() : cgu_get_mips_clock(1);
+
+    switch ( CGU_MUX_SUB_SYS )
+    {
+    case 0:
+        break;
+    case 1:
+    default:
+        ret = (ret + 1) >> 1; break;
+    case 2:
+        ret = (ret + 1) / 3; break;
+    case 3:
+        ret = (ret + 2) >> 2; break;
+    case 5:
+        ret = ((ret << 1) + 1) / 3; break;
+    case 6:
+        ret = ((ret << 1) + 2) / 5;
+    }
+
+    return ret;
+}
+
+/*
+ *  Description:
+ *    get frequency of FPI bus
+ *  Input:
+ *    fpi --- int, 1: FPI bus 1 (FBS1/Fast FPI Bus), 2: FPI bus 2 (FBS2)
+ *  Output:
+ *    u32 --- frequency of FPI bus
+ */
+u32 cgu_get_fpi_bus_clock(int fpi)
+{
+    register u32 ret = cgu_get_io_region_clock();
+
+    if ( fpi == 2 )
+        ret >>= 1;
+    return ret;
+}
+
+/*
+ *  Description:
+ *    get frequency of PP32 processor
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PP32 processor
+ */
+u32 cgu_get_pp32_clock(void)
+{
+    register u32 ret;
+
+    switch ( CGU_MUX_PP32 )
+    {
+    case 0:
+    default:
+        ret = ((cgu_get_pll2_fosc() << 2) + 2) / 5; break;
+    case 1:
+        ret = ((cgu_get_pll2_fosc() << 3) + 4) / 9; break;
+    case 2:
+        ret = cgu_get_fpi_bus_clock(1); break;
+    case 3:
+        ret = cgu_get_mips_clock(1);
+    }
+
+    return ret;
+}
+
+/*
+ *  Description:
+ *    get frequency of PCI bus
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of PCI bus
+ */
+u32 cgu_get_pci_clock(void)
+{
+    register u32 ret = 0;
+
+    if ( !CGU_IF_CLK_PCIS )
+    {
+        ret = cgu_get_pll2_fosc();
+        if ( CGU_IF_CLK_PCIF )
+            ret = (ret + 2) / 5;
+        else
+            ret = (ret + 4) / 9;
+    }
+
+    return ret;
+}
+
+/*
+ *  Description:
+ *    get frequency of ethernet module (MII)
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of ethernet module
+ */
+u32 cgu_get_ethernet_clock(void)
+{
+    register u32 ret = 0;
+
+    if ( !CGU_IF_CLK_MIICS )
+    {
+        ret = cgu_get_pll2_fosc();
+        if ( CGU_MUX_MII_CLK )
+            ret = (ret + 3) / 6;
+        else
+            ret = (ret + 6) / 12;
+    }
+
+    return ret;
+}
+
+/*
+ *  Description:
+ *    get frequency of USB
+ *  Input:
+ *    none
+ *  Output:
+ *    u32 --- frequency of USB
+ */
+u32 cgu_get_usb_clock(void)
+{
+    return CGU_IF_CLK_USBCS ? 12000000 : (cgu_get_pll2_fosc() + 12) / 25;
+}
+
+/*
+ *  Description:
+ *    get frequency of CLK_OUT pin
+ *  Input:
+ *    clkout --- int, clock out pin number
+ *  Output:
+ *    u32    --- frequency of CLK_OUT pin
+ */
+u32 cgu_get_clockout(int clkout)
+{
+    u32 fosc1 = cgu_get_pll1_fosc();
+    u32 fosc2 = cgu_get_pll2_fosc();
+
+    if ( clkout > 3 || clkout < 0 )
+        return 0;
+
+    switch ( ((u32)clkout << 2) | GET_BITS(*DANUBE_CGU_IF_CLK, 21 + clkout * 2, 20 + clkout * 2) )
+    {
+    case 0: /*  32.768KHz   */
+    case 14:
+        return (fosc1 + 6000) / 12000;
+    case 1: /*  1.536MHz    */
+        return (fosc1 + 128) / 256;
+    case 2: /*  2.5MHz      */
+        return (fosc2 + 60) / 120;
+    case 3: /*  12MHz       */
+    case 5:
+    case 12:
+        return (fosc2 + 12) / 25;
+    case 4: /*  40MHz       */
+        return (fosc2 * 2 + 7) / 15;
+    case 6: /*  24MHz       */
+        return (fosc2 * 2 + 12) / 25;
+    case 7: /*  48MHz       */
+        return (fosc2 * 4 + 12) / 25;
+    case 8: /*  25MHz       */
+    case 15:
+        return (fosc2 + 6) / 12;
+    case 9: /*  50MHz       */
+    case 13:
+        return (fosc2 + 3) / 6;
+    case 10:/*  30MHz       */
+        return (fosc2 + 5) / 10;
+    case 11:/*  60MHz       */
+        return (fosc2 + 2) / 5;
+    }
+
+    return 0;
+}
+
+
+/*
+ * ####################################
+ *           Init/Cleanup API
+ * ####################################
+ */
+
+/*
+ *  Description:
+ *    register device
+ *  Input:
+ *    none
+ *  Output:
+ *    0    --- successful
+ *    else --- failure, usually it is negative value of error code
+ */
+int __init danube_cgu_init(void)
+{
+    int ret;
+
+    ret = misc_register(&cgu_miscdev);
+    if ( ret )
+    {
+        printk(KERN_ERR "cgu: can't misc_register\n");
+        return ret;
+    }
+    else
+        printk(KERN_INFO "cgu: misc_register on minor = %d\n", cgu_miscdev.minor);
+
+    /*
+     *  initialize fake registers to do testing on Amazon
+     */
+#if defined(DEBUG_ON_AMAZON) && DEBUG_ON_AMAZON
+    #ifdef  DEBUG_PRINT_INFO
+    #undef  DEBUG_PRINT_INFO
+    #endif
+    #define DEBUG_PRINT_INFO    1
+
+    *DANUBE_CGU_DIV         = 0x00010019;
+    *DANUBE_CGU_PLL_NMK0    = 0x416002C3;
+    *DANUBE_CGU_PLL_SR0     = 0x74000013;
+    *DANUBE_CGU_PLL_NMK1    = 0x4C60009C;
+    *DANUBE_CGU_PLL_SR1     = 0x54000013;
+    *DANUBE_CGU_PLL_SR2     = 0x58890013;
+    *DANUBE_CGU_IF_CLK      = 0x00000000;
+    *DANUBE_CGU_OSC_CTRL    = 0x00000000;
+    *DANUBE_CGU_SMD         = 0x00000000;
+    *DANUBE_CGU_CRD         = 0x00010000;
+    *DANUBE_CGU_CT1SR       = 0x00000000;
+    *DANUBE_CGU_CT2SR       = CGU_PLL_NMK1_PLLK;
+    *DANUBE_CGU_PCMCR       = 0x00000000;
+    *DANUBE_CGU_MUX         = 0x00000008;
+#endif  //  defined(DEBUG_ON_AMAZON) && DEBUG_ON_AMAZON
+
+    /*
+     *  for testing only
+     */
+#if defined(DEBUG_PRINT_INFO) && DEBUG_PRINT_INFO
+    printk("pll0 N = %d, M = %d, K = %d, DIV = %d\n", CGU_PLL_NMK0_PLLN, CGU_PLL_NMK0_PLLM, CGU_PLL_NMK0_PLLK, CGU_PLL_SR0_PLLDIV);
+    printk("pll1 N = %d, M = %d, K = %d, DIV = %d\n", CGU_PLL_NMK1_PLLN, CGU_PLL_NMK1_PLLM, CGU_PLL_NMK1_PLLK, CGU_PLL_SR1_PLLDIV);
+    printk("pll2 N = %d, M = %d, DIV = %d\n", CGU_PLL_SR2_PLLN, CGU_PLL_SR2_PLLM, CGU_PLL_SR2_PLLDIV);
+    printk("pll0_fosc    = %d\n", cgu_get_pll0_fosc());
+    printk("pll0_fps     = %d\n", cgu_get_pll0_fps());
+    printk("pll0_fdiv    = %d\n", cgu_get_pll0_fdiv());
+    printk("pll1_fosc    = %d\n", cgu_get_pll1_fosc());
+    printk("pll1_fps     = %d\n", cgu_get_pll1_fps());
+    printk("pll1_fdiv    = %d\n", cgu_get_pll1_fdiv());
+    printk("pll2_fosc    = %d\n", cgu_get_pll2_fosc());
+    printk("pll2_fps     = %d\n", cgu_get_pll2_fps());
+    printk("mips0 clock  = %d\n", cgu_get_mips_clock(0));
+    printk("mips1 clock  = %d\n", cgu_get_mips_clock(1));
+    printk("cpu clock    = %d\n", cgu_get_cpu_clock());
+    printk("IO region    = %d\n", cgu_get_io_region_clock());
+    printk("FPI bus 1    = %d\n", cgu_get_fpi_bus_clock(1));
+    printk("FPI bus 2    = %d\n", cgu_get_fpi_bus_clock(2));
+    printk("PP32 clock   = %d\n", cgu_get_pp32_clock());
+    printk("PCI clock    = %d\n", cgu_get_pci_clock());
+    printk("Ethernet     = %d\n", cgu_get_ethernet_clock());
+    printk("USB clock    = %d\n", cgu_get_usb_clock());
+    printk("Clockout0    = %d\n", cgu_get_clockout(0));
+    printk("Clockout1    = %d\n", cgu_get_clockout(1));
+    printk("Clockout2    = %d\n", cgu_get_clockout(2));
+    printk("Clockout3    = %d\n", cgu_get_clockout(3));
+#endif  //  defined(DEBUG_PRINT_INFO) && DEBUG_PRINT_INFO
+
+    return 0;
+}
+
+/*
+ *  Description:
+ *    deregister device
+ *  Input:
+ *    none
+ *  Output:
+ *    none
+ */
+void __exit danube_cgu_exit(void)
+{
+    int ret;
+
+    ret = misc_deregister(&cgu_miscdev);
+    if ( ret )
+        printk(KERN_ERR "cgu: can't misc_deregister, get error number %d\n", -ret);
+    else
+        printk(KERN_INFO "cgu: misc_deregister successfully\n");
+}
+
+module_init(danube_cgu_init);
+module_exit(danube_cgu_exit);
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cgu.h b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cgu.h
new file mode 100644
index 0000000..704793e
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cgu.h
@@ -0,0 +1,91 @@
+#ifndef __DANUBE_CGU_DEV_H__2005_07_20__14_26__
+#define __DANUBE_CGU_DEV_H__2005_07_20__14_26__
+
+
+/******************************************************************************
+       Copyright (c) 2002, Infineon Technologies.  All rights reserved.
+
+                               No Warranty
+   Because the program is licensed free of charge, there is no warranty for
+   the program, to the extent permitted by applicable law.  Except when
+   otherwise stated in writing the copyright holders and/or other parties
+   provide the program "as is" without warranty of any kind, either
+   expressed or implied, including, but not limited to, the implied
+   warranties of merchantability and fitness for a particular purpose. The
+   entire risk as to the quality and performance of the program is with
+   you.  should the program prove defective, you assume the cost of all
+   necessary servicing, repair or correction.
+
+   In no event unless required by applicable law or agreed to in writing
+   will any copyright holder, or any other party who may modify and/or
+   redistribute the program as permitted above, be liable to you for
+   damages, including any general, special, incidental or consequential
+   damages arising out of the use or inability to use the program
+   (including but not limited to loss of data or data being rendered
+   inaccurate or losses sustained by you or third parties or a failure of
+   the program to operate with any other programs), even if such holder or
+   other party has been advised of the possibility of such damages.
+******************************************************************************/
+
+
+/*
+ * ####################################
+ *              Definition
+ * ####################################
+ */
+
+/*
+ *  ioctl Command
+ */
+#define CGU_IOC_MAGIC                   'u'
+#define CGU_GET_CLOCK_RATES             _IOW(CGU_IOC_MAGIC, 0, struct cgu_clock_rates)
+#define CGU_IOC_MAXNR                   1
+
+
+/*
+ * ####################################
+ *              Data Type
+ * ####################################
+ */
+
+/*
+ *  Data Type Used to Call ioctl(GET_CLOCK_RATES)
+ */
+struct cgu_clock_rates {
+    u32     mips0;
+    u32     mips1;
+    u32     cpu;
+    u32     io_region;
+    u32     fpi_bus1;
+    u32     fpi_bus2;
+    u32     pp32;
+    u32     pci;
+    u32     ethernet;
+    u32     usb;
+    u32     clockout0;
+    u32     clockout1;
+    u32     clockout2;
+    u32     clockout3;
+};
+
+
+/*
+ * ####################################
+ *             Declaration
+ * ####################################
+ */
+
+#if defined(__KERNEL__)
+    extern u32 cgu_get_mips_clock(int);
+    extern u32 cgu_get_cpu_clock(void);
+    extern u32 cgu_get_io_region_clock(void);
+    extern u32 cgu_get_fpi_bus_clock(int);
+    extern u32 cgu_get_pp32_clock(void);
+    extern u32 cgu_get_pci_clock(void);
+    extern u32 cgu_get_ethernet_clock(void);
+    extern u32 cgu_get_usb_clock(void);
+    extern u32 cgu_get_clockout(int);
+#endif  //  defined(__KERNEL__)
+
+
+#endif  //  __DANUBE_CGU_DEV_H__2005_07_20__14_26__
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/ifx_clock.c b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_clock.c
new file mode 100644
index 0000000..0a1cdac
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_clock.c
@@ -0,0 +1,91 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <asm-mips/danube.h>
+
+
+
+/*******************************************************************************
+*
+* get_cpuclk - returns the frequency of the CPU. 
+*
+* NOTE:
+*   This functions should be used by the hardware driver to get the correct
+*   frequency of the CPU. 
+*/
+
+unsigned int danube_get_ddr_hz(void)
+{
+        switch((*DANUBE_CGU_SYS) & 0x3){
+                case 0:
+                        return 166666667;
+                case 1:
+                        return 133333333;
+                case 2:
+                        return 111111111;
+                case 3:
+                        return 83333333;
+        }
+}
+
+
+uint danube_get_cpuclk(void)
+{
+#ifdef CONFIG_USE_EMULATOR
+        return EMULATOR_CPU_SPEED;
+#else //NOT CONFIG_USE_EMULATOR
+        unsigned int ddr_clock=danube_get_ddr_hz();
+        switch((*DANUBE_CGU_SYS) & 0xc){
+                case 0:
+                        return 333333333;
+                case 4:
+                        return ddr_clock;
+                case 8:
+                        return ddr_clock << 1;
+                default:
+			break;
+                        /*reserved*/
+        }
+#endif
+
+}
+
+
+uint danube_get_fpiclk(void)
+{
+#ifdef CONFIG_USE_EMULATOR
+        unsigned int  clkCPU;
+        clkCPU = danube_get_cpu_hz();
+        return clkCPU >> 2;
+#else //NOT CONFIG_USE_EMULATOR
+        unsigned int ddr_clock=danube_get_ddr_hz();
+        if ((*DANUBE_CGU_SYS) & 0x40){
+                return ddr_clock >> 1;
+        }
+        return ddr_clock;
+#endif
+
+}
+
+
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cpu.c b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cpu.c
new file mode 100644
index 0000000..49355de
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_cpu.c
@@ -0,0 +1,5 @@
+
+#define IFX_CPU_RESET					\
+{	*DANUBE_RCU_RST_REQ |=1<<30;			\
+}
+
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/ifx_start.S b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_start.S
new file mode 100644
index 0000000..17c0b0a
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/ifx_start.S
@@ -0,0 +1,51 @@
+/*
+ * IFX Platform Dependent CPU Initializations
+ * - for Danube
+ */
+
+#define IFX_EBU_BOOTCFG_DWORD							\
+	.word INFINEON_EBU_BOOTCFG; /* EBU init code, fetched during booting */	\
+	.word 0x00000000;           /* phases of the flash */
+
+#define IFX_MORE_RESERVED_VECTORS						\
+	XVECENT(romExcHandle,0x400);	/* Int, CauseIV=1 */			\
+	RVECENT(romReserved,129);						\
+	RVECENT(romReserved,130);						\
+	RVECENT(romReserved,131);						\
+	RVECENT(romReserved,132);						\
+	RVECENT(romReserved,133);						\
+	RVECENT(romReserved,134);						\
+	RVECENT(romReserved,135);						\
+	RVECENT(romReserved,136);						\
+	RVECENT(romReserved,137);						\
+	RVECENT(romReserved,138);						\
+	RVECENT(romReserved,139);						\
+	RVECENT(romReserved,140);						\
+	RVECENT(romReserved,141);						\
+	RVECENT(romReserved,142);						\
+	RVECENT(romReserved,143);						\
+	RVECENT(romExcHandle,0x480);	/* EJTAG debug exception */
+
+#define IFX_RESET_PRECHECK							\
+	mfc0	k0, CP0_EBASE;							\
+	and	k0, EBASEF_CPUNUM;						\
+	bne	k0, zero, ifx_mips_handler_1;					\
+	nop;
+
+#define IFX_CPU_EXTRA_INIT							\
+	mfc0	k0, CP0_CONFIG, 7;						\
+	li	k1, 0x04;							\
+	or	k0, k1;								\
+	mtc0	k0, CP0_CONFIG, 7;
+
+#define IFX_CACHE_OPER_MODE							\
+	li	t0, CONF_CM_CACHABLE_NO_WA;
+
+/*
+ * Stop VCPU
+ */
+#define IFX_MIPS_HANDLER_1							\
+	wait;									\
+	b ifx_mips_handler_1;							\
+	nop;
+
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/incaip_clock.c b/package/uboot-ifxmips/files/cpu/mips/danube/incaip_clock.c
new file mode 100644
index 0000000..1b0a0fd
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/incaip_clock.c
@@ -0,0 +1,120 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#ifdef CONFIG_INCA_IP
+
+#include <common.h>
+#include <asm/inca-ip.h>
+
+
+/*******************************************************************************
+*
+* get_cpuclk - returns the frequency of the CPU.
+*
+* Gets the value directly from the INCA-IP hardware.
+*
+* RETURNS:
+*          150.000.000 for 150 MHz
+*          133.333.333 for 133 Mhz (= 400MHz/3)
+*          100.000.000 for 100 Mhz (= 400MHz/4)
+* NOTE:
+*   This functions should be used by the hardware driver to get the correct
+*   frequency of the CPU. Don't use the macros, which are set to init the CPU
+*   frequency in the ROM code.
+*/
+uint incaip_get_cpuclk (void)
+{
+	/*-------------------------------------------------------------------------*/
+	/* CPU Clock Input Multiplexer (MUX I)                                     */
+	/* Multiplexer MUX I selects the maximum input clock to the CPU.           */
+	/*-------------------------------------------------------------------------*/
+	if (*((volatile ulong *) INCA_IP_CGU_CGU_MUXCR) &
+	    INCA_IP_CGU_CGU_MUXCR_MUXI) {
+		/* MUX I set to 150 MHz clock */
+		return 150000000;
+	} else {
+		/* MUX I set to 100/133 MHz clock */
+		if (*((volatile ulong *) INCA_IP_CGU_CGU_DIVCR) & 0x40) {
+			/* Division value is 1/3, maximum CPU operating */
+			/* frequency is 133.3 MHz                       */
+			return 133333333;
+		} else {
+			/* Division value is 1/4, maximum CPU operating */
+			/* frequency is 100 MHz                         */
+			return 100000000;
+		}
+	}
+}
+
+/*******************************************************************************
+*
+* get_fpiclk - returns the frequency of the FPI bus.
+*
+* Gets the value directly from the INCA-IP hardware.
+*
+* RETURNS: Frquency in Hz
+*
+* NOTE:
+*   This functions should be used by the hardware driver to get the correct
+*   frequency of the CPU. Don't use the macros, which are set to init the CPU
+*   frequency in the ROM code.
+*   The calculation for the
+*/
+uint incaip_get_fpiclk (void)
+{
+	uint clkCPU;
+
+	clkCPU = incaip_get_cpuclk ();
+
+	switch (*((volatile ulong *) INCA_IP_CGU_CGU_DIVCR) & 0xC) {
+	case 0x4:
+		return clkCPU >> 1;	/* devided by 2 */
+		break;
+	case 0x8:
+		return clkCPU >> 2;	/* devided by 4 */
+		break;
+	default:
+		return clkCPU;
+		break;
+	}
+}
+
+int incaip_set_cpuclk (void)
+{
+	extern void ebu_init(long);
+	extern void cgu_init(long);
+	extern void sdram_init(long);
+	char tmp[64];
+	ulong cpuclk;
+
+	if (getenv_r ("cpuclk", tmp, sizeof (tmp)) > 0) {
+		cpuclk = simple_strtoul (tmp, NULL, 10) * 1000000;
+		cgu_init (cpuclk);
+		ebu_init (cpuclk);
+		sdram_init (cpuclk);
+	}
+
+	return 0;
+}
+
+#endif /* CONFIG_INCA_IP */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/incaip_wdt.S b/package/uboot-ifxmips/files/cpu/mips/danube/incaip_wdt.S
new file mode 100644
index 0000000..0c6b5e2
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/incaip_wdt.S
@@ -0,0 +1,75 @@
+/*
+ *  INCA-IP Watchdog timer management code.
+ *
+ *  Copyright (c) 2003	Wolfgang Denk <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+
+#include <config.h>
+#include <version.h>
+#include <asm/regdef.h>
+
+#ifdef CONFIG_INCA_IP
+
+#define WD_BASE            0xb8000000
+#define WD_CON0(value)     0x0020(value)
+#define WD_CON1(value)     0x0024(value)
+#define WD_DISABLE         0x00000008
+#define WD_ENABLE          0x00000000
+#define WD_WRITE_PW        0xFFFC00F8
+#define WD_WRITE_ENDINIT   0xFFFC00F3
+#define WD_WRITE_INIT      0xFFFC00F2
+
+
+	.globl	disable_incaip_wdt
+disable_incaip_wdt:
+	li	t0, WD_BASE
+
+	/* Calculate password.
+	 */
+	lw	t2, WD_CON1(t0)
+	and	t2, 0xC
+
+	lw	t3, WD_CON0(t0)
+	and	t3, 0xFFFFFF01
+
+	or	t3, t2
+	or 	t3, 0xF0
+
+	sw	t3, WD_CON0(t0)		/* write password */
+
+	/* Clear ENDINIT.
+	 */
+	li	t1, WD_WRITE_INIT
+	sw	t1, WD_CON0(t0)
+
+
+	li	t1, WD_DISABLE
+	sw	t1, WD_CON1(t0)		/* disable watchdog */
+	li	t1, WD_WRITE_PW
+	sw	t1, WD_CON0(t0)		/* write password */
+	li	t1, WD_WRITE_ENDINIT
+	sw	t1, WD_CON0(t0)		/* end command */
+
+	j	ra
+	nop
+
+#endif /* CONFIG_INCA_IP */
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/interrupts.c b/package/uboot-ifxmips/files/cpu/mips/danube/interrupts.c
new file mode 100644
index 0000000..87f7a9f
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/interrupts.c
@@ -0,0 +1,33 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+
+void enable_interrupts(void)
+{
+}
+
+int disable_interrupts(void)
+{
+	return 0;
+}
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/start.S b/package/uboot-ifxmips/files/cpu/mips/danube/start.S
new file mode 100644
index 0000000..b1ee491
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/start.S
@@ -0,0 +1,442 @@
+/*
+ *  Startup Code for MIPS32 CPU-core
+ *
+ *  Copyright (c) 2003	Wolfgang Denk <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+
+#include <config.h>
+#include <version.h>
+#include <asm/regdef.h>
+#include <asm/mipsregs.h>
+#if defined(CONFIG_IFX_MIPS)
+#include "ifx_start.S"
+#endif
+
+#define RVECENT(f,n) \
+   b f; nop
+#define XVECENT(f,bev) \
+   b f     ;           \
+   li k0,bev
+
+	.set noreorder
+
+	.globl _start
+	.text
+_start:
+	RVECENT(reset,0)	/* U-boot entry point */
+	RVECENT(reset,1)	/* software reboot */
+#if defined(CONFIG_INCA_IP)
+	.word INFINEON_EBU_BOOTCFG /* EBU init code, fetched during booting */
+	.word 0x00000000           /* phase of the flash                    */
+#elif defined(CONFIG_IFX_MIPS) && defined(IFX_EBU_BOOTCFG_DWORD)
+	IFX_EBU_BOOTCFG_DWORD
+#elif defined(CONFIG_PURPLE)
+	.word INFINEON_EBU_BOOTCFG /* EBU init code, fetched during booting */
+	.word INFINEON_EBU_BOOTCFG /* EBU init code, fetched during booting */
+#else
+	RVECENT(romReserved,2)
+#endif
+	RVECENT(romReserved,3)
+	RVECENT(romReserved,4)
+	RVECENT(romReserved,5)
+	RVECENT(romReserved,6)
+	RVECENT(romReserved,7)
+	RVECENT(romReserved,8)
+	RVECENT(romReserved,9)
+	RVECENT(romReserved,10)
+	RVECENT(romReserved,11)
+	RVECENT(romReserved,12)
+	RVECENT(romReserved,13)
+	RVECENT(romReserved,14)
+	RVECENT(romReserved,15)
+	RVECENT(romReserved,16)
+	RVECENT(romReserved,17)
+	RVECENT(romReserved,18)
+	RVECENT(romReserved,19)
+	RVECENT(romReserved,20)
+	RVECENT(romReserved,21)
+	RVECENT(romReserved,22)
+	RVECENT(romReserved,23)
+	RVECENT(romReserved,24)
+	RVECENT(romReserved,25)
+	RVECENT(romReserved,26)
+	RVECENT(romReserved,27)
+	RVECENT(romReserved,28)
+	RVECENT(romReserved,29)
+	RVECENT(romReserved,30)
+	RVECENT(romReserved,31)
+	RVECENT(romReserved,32)
+	RVECENT(romReserved,33)
+	RVECENT(romReserved,34)
+	RVECENT(romReserved,35)
+	RVECENT(romReserved,36)
+	RVECENT(romReserved,37)
+	RVECENT(romReserved,38)
+	RVECENT(romReserved,39)
+	RVECENT(romReserved,40)
+	RVECENT(romReserved,41)
+	RVECENT(romReserved,42)
+	RVECENT(romReserved,43)
+	RVECENT(romReserved,44)
+	RVECENT(romReserved,45)
+	RVECENT(romReserved,46)
+	RVECENT(romReserved,47)
+	RVECENT(romReserved,48)
+	RVECENT(romReserved,49)
+	RVECENT(romReserved,50)
+	RVECENT(romReserved,51)
+	RVECENT(romReserved,52)
+	RVECENT(romReserved,53)
+	RVECENT(romReserved,54)
+	RVECENT(romReserved,55)
+	RVECENT(romReserved,56)
+	RVECENT(romReserved,57)
+	RVECENT(romReserved,58)
+	RVECENT(romReserved,59)
+	RVECENT(romReserved,60)
+	RVECENT(romReserved,61)
+	RVECENT(romReserved,62)
+	RVECENT(romReserved,63)
+	XVECENT(romExcHandle,0x200)	/* bfc00200: R4000 tlbmiss vector */
+	RVECENT(romReserved,65)
+	RVECENT(romReserved,66)
+	RVECENT(romReserved,67)
+	RVECENT(romReserved,68)
+	RVECENT(romReserved,69)
+	RVECENT(romReserved,70)
+	RVECENT(romReserved,71)
+	RVECENT(romReserved,72)
+	RVECENT(romReserved,73)
+	RVECENT(romReserved,74)
+	RVECENT(romReserved,75)
+	RVECENT(romReserved,76)
+	RVECENT(romReserved,77)
+	RVECENT(romReserved,78)
+	RVECENT(romReserved,79)
+	XVECENT(romExcHandle,0x280)	/* bfc00280: R4000 xtlbmiss vector */
+	RVECENT(romReserved,81)
+	RVECENT(romReserved,82)
+	RVECENT(romReserved,83)
+	RVECENT(romReserved,84)
+	RVECENT(romReserved,85)
+	RVECENT(romReserved,86)
+	RVECENT(romReserved,87)
+	RVECENT(romReserved,88)
+	RVECENT(romReserved,89)
+	RVECENT(romReserved,90)
+	RVECENT(romReserved,91)
+	RVECENT(romReserved,92)
+	RVECENT(romReserved,93)
+	RVECENT(romReserved,94)
+	RVECENT(romReserved,95)
+	XVECENT(romExcHandle,0x300)	/* bfc00300: R4000 cache vector */
+	RVECENT(romReserved,97)
+	RVECENT(romReserved,98)
+	RVECENT(romReserved,99)
+	RVECENT(romReserved,100)
+	RVECENT(romReserved,101)
+	RVECENT(romReserved,102)
+	RVECENT(romReserved,103)
+	RVECENT(romReserved,104)
+	RVECENT(romReserved,105)
+	RVECENT(romReserved,106)
+	RVECENT(romReserved,107)
+	RVECENT(romReserved,108)
+	RVECENT(romReserved,109)
+	RVECENT(romReserved,110)
+	RVECENT(romReserved,111)
+	XVECENT(romExcHandle,0x380)	/* bfc00380: R4000 general vector */
+	RVECENT(romReserved,113)
+	RVECENT(romReserved,114)
+	RVECENT(romReserved,115)
+	RVECENT(romReserved,116)
+	RVECENT(romReserved,116)
+	RVECENT(romReserved,118)
+	RVECENT(romReserved,119)
+	RVECENT(romReserved,120)
+	RVECENT(romReserved,121)
+	RVECENT(romReserved,122)
+	RVECENT(romReserved,123)
+	RVECENT(romReserved,124)
+	RVECENT(romReserved,125)
+	RVECENT(romReserved,126)
+	RVECENT(romReserved,127)
+
+	/* We hope there are no more reserved vectors!
+	 * 128 * 8 == 1024 == 0x400
+	 * so this is address R_VEC+0x400 == 0xbfc00400
+	 */
+#if defined(CONFIG_IFX_MIPS) && defined(IFX_MORE_RESERVED_VECTORS)
+	IFX_MORE_RESERVED_VECTORS
+#else
+#ifdef CONFIG_PURPLE
+/* 0xbfc00400 */
+	.word	0xdc870000
+	.word	0xfca70000
+	.word	0x20840008
+	.word	0x20a50008
+	.word	0x20c6ffff
+	.word	0x14c0fffa
+	.word	0x00000000
+	.word	0x03e00008
+	.word	0x00000000
+	.word   0x00000000
+/* 0xbfc00428 */
+	.word	0xdc870000
+	.word	0xfca70000
+	.word	0x20840008
+	.word	0x20a50008
+	.word	0x20c6ffff
+	.word	0x14c0fffa
+	.word	0x00000000
+	.word	0x03e00008
+	.word	0x00000000
+	.word   0x00000000
+#endif /* CONFIG_PURPLE */
+#endif /* CONFIG_IFX_MIPS */
+	.align 4
+reset:
+#if defined(CONFIG_IFX_MIPS) && defined(IFX_RESET_PRECHECK)
+	IFX_RESET_PRECHECK
+#endif
+	/* Clear watch registers.
+	 */
+	mtc0	zero, CP0_WATCHLO
+	mtc0	zero, CP0_WATCHHI
+
+	/* STATUS register */
+#ifdef  CONFIG_TB0229
+	li	k0, ST0_CU0
+#else
+	mfc0	k0, CP0_STATUS
+#endif
+	li	k1, ~ST0_IE
+	and	k0, k1
+	mtc0	k0, CP0_STATUS
+
+	/* CAUSE register */
+	mtc0	zero, CP0_CAUSE
+
+#if defined(CONFIG_IFX_MIPS) && defined(IFX_CPU_EXTRA_INIT)
+	IFX_CPU_EXTRA_INIT
+#endif
+
+	/* Init Timer */
+	mtc0	zero, CP0_COUNT
+	mtc0	zero, CP0_COMPARE
+
+	/* CONFIG0 register */
+	li	t0, CONF_CM_UNCACHED
+	mtc0	t0, CP0_CONFIG
+
+	/* Initialize GOT pointer.
+	*/
+	bal     1f
+	nop
+	.word   _GLOBAL_OFFSET_TABLE_
+	1:
+	move    gp, ra
+	lw      t1, 0(ra)
+	move	gp, t1
+
+#ifdef CONFIG_INCA_IP
+	/* Disable INCA-IP Watchdog.
+	 */
+	la      t9, disable_incaip_wdt
+	jalr    t9
+	nop
+#endif
+
+	/* Initialize any external memory.
+	 */
+	la      t9, lowlevel_init
+	jalr    t9
+	nop
+
+	/* Initialize caches...
+	 */
+	la      t9, mips_cache_reset
+	jalr    t9
+	nop
+
+	/* ... and enable them.
+	 */
+#if defined(CONFIG_IFX_MIPS) && defined(IFX_CACHE_OPER_MODE)
+	IFX_CACHE_OPER_MODE
+#else
+	li	t0, CONF_CM_CACHABLE_NONCOHERENT
+#endif
+	mtc0	t0, CP0_CONFIG
+
+
+	/* Set up temporary stack.
+	 */
+	li	a0, CFG_INIT_SP_OFFSET
+	la      t9, mips_cache_lock
+	jalr    t9
+	nop
+
+	li	t0, CFG_SDRAM_BASE + CFG_INIT_SP_OFFSET
+	la	sp, 0(t0)
+
+	la	t9, board_init_f
+	j	t9
+	nop
+
+#ifdef CFG_HEAD_CODE
+/*
+ * void jump_unconditional (addr)
+ * This function simply jumps to the location pointed by a0.
+ * a0 = target_location
+ *
+ */
+	.globl  jump_unconditional
+	.ent    jump_unconditional
+jump_unconditional:
+	move t9, a0
+	j       t9
+	nop
+	.end    jump_unconditional
+
+#endif
+
+/*
+ * void relocate_code (addr_sp, gd, addr_moni)
+ *
+ * This "function" does not return, instead it continues in RAM
+ * after relocating the monitor code.
+ *
+ * a0 = addr_sp
+ * a1 = gd
+ * a2 = destination address
+ */
+	.globl	relocate_code
+	.ent	relocate_code
+relocate_code:
+	move	sp, a0		/* Set new stack pointer		*/
+
+#ifdef CFG_HEAD_CODE
+	li	t0, CFG_HEAD_BASE
+#else
+	li	t0, CFG_MONITOR_BASE
+#endif
+	la	t3, in_ram
+	lw	t2, -12(t3)	/* t2 <-- uboot_end_data	*/
+	move	t1, a2
+
+	/*
+	 * Fix GOT pointer:
+	 *
+	 * New GOT-PTR = (old GOT-PTR - CFG_MONITOR_BASE) + Destination Address
+	 */
+	move	t6, gp
+#ifdef CFG_HEAD_CODE
+	sub	gp, CFG_HEAD_BASE
+#else
+	sub	gp, CFG_MONITOR_BASE
+#endif
+	add	gp, a2			/* gp now adjusted		*/
+	sub	t6, gp, t6		/* t6 <-- relocation offset	*/
+
+	/*
+	 * t0 = source address
+	 * t1 = target address
+	 * t2 = source end address
+	 */
+	/* On the purple board we copy the code earlier in a special way
+	 * in order to solve flash problems
+	 */
+#ifndef CONFIG_PURPLE
+1:
+	lw	t3, 0(t0)
+	sw	t3, 0(t1)
+	addu	t0, 4
+	ble	t0, t2, 1b
+	addu	t1, 4			/* delay slot			*/
+#endif
+
+	/* If caches were enabled, we would have to flush them here.
+	 */
+
+	/* Jump to where we've relocated ourselves.
+	 */
+	addi	t0, a2, in_ram - _start
+	j	t0
+	nop
+
+	.word	uboot_end_data
+	.word	uboot_end
+	.word	num_got_entries
+
+in_ram:
+	/* Now we want to update GOT.
+	 */
+	lw	t3, -4(t0)	/* t3 <-- num_got_entries	*/
+	addi	t4, gp, 8	/* Skipping first two entries.	*/
+	li	t2, 2
+1:
+	lw	t1, 0(t4)
+	beqz	t1, 2f
+	add	t1, t6
+	sw	t1, 0(t4)
+2:
+	addi	t2, 1
+	blt	t2, t3, 1b
+	addi	t4, 4		/* delay slot			*/
+
+	/* Clear BSS.
+	 */
+	lw	t1, -12(t0)	/* t1 <-- uboot_end_data	*/
+	lw	t2, -8(t0)	/* t2 <-- uboot_end		*/
+	add	t1, t6		/* adjust pointers		*/
+	add	t2, t6
+
+	sub	t1, 4
+1:	addi	t1, 4
+	bltl	t1, t2, 1b
+	sw	zero, 0(t1)	/* delay slot			*/
+
+	move	a0, a1
+	la	t9, board_init_r
+	j	t9
+	move	a1, a2		/* delay slot			*/
+
+	.end	relocate_code
+
+
+	/* Exception handlers.
+	 */
+romReserved:
+	b romReserved
+
+romExcHandle:
+	b romExcHandle
+
+	/* Additional handlers.
+	 */
+#if defined(CONFIG_IFX_MIPS)
+#if defined(IFX_MIPS_HANDLER_1)
+ifx_mips_handler_1:
+	IFX_MIPS_HANDLER_1
+#endif
+#endif
+
diff --git a/package/uboot-ifxmips/files/cpu/mips/danube/start_bootstrap.S b/package/uboot-ifxmips/files/cpu/mips/danube/start_bootstrap.S
new file mode 100644
index 0000000..cd7a13f
--- /dev/null
+++ b/package/uboot-ifxmips/files/cpu/mips/danube/start_bootstrap.S
@@ -0,0 +1,428 @@
+/*
+ *  Startup Code for MIPS32 CPU-core
+ *
+ *  Copyright (c) 2003	Wolfgang Denk <wd@denx.de>
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+
+#include <config.h>
+#include <version.h>
+#include <asm/regdef.h>
+#include <asm/mipsregs.h>
+
+
+#define RVECENT(f,n) \
+   b f; nop
+#define XVECENT(f,bev) \
+   b f     ;           \
+   li k0,bev
+
+	.set noreorder
+
+	.globl _start_bootstrap
+	.text
+_start_bootstrap:
+	RVECENT(reset,0)	/* U-boot entry point */
+	RVECENT(reset,1)	/* software reboot */
+#if defined(CONFIG_INCA_IP) || defined(CONFIG_INCA_IP2)
+	.word INFINEON_EBU_BOOTCFG /* EBU init code, fetched during booting */
+	.word 0x00000000           /* phase of the flash                    */
+#elif defined(CONFIG_PURPLE)
+	.word INFINEON_EBU_BOOTCFG /* EBU init code, fetched during booting */
+	.word INFINEON_EBU_BOOTCFG /* EBU init code, fetched during booting */
+#elif defined(CONFIG_DANUBE)
+
+	.org 0x10
+	.word INFINEON_EBU_BOOTCFG /* EBU init code, fetched during booting */
+	.word 0x00000000           /* phase of the flash                    */
+
+	.org 0x18
+	.word 0x312E3000           /* version x.x                           */
+	.word 0x00000000           /* phase of the flash                    */
+#else
+	RVECENT(romReserved,2)
+#endif
+	RVECENT(romReserved,3)
+	RVECENT(romReserved,4)
+	RVECENT(romReserved,5)
+	RVECENT(romReserved,6)
+	RVECENT(romReserved,7)
+	RVECENT(romReserved,8)
+	RVECENT(romReserved,9)
+	RVECENT(romReserved,10)
+	RVECENT(romReserved,11)
+	RVECENT(romReserved,12)
+	RVECENT(romReserved,13)
+	RVECENT(romReserved,14)
+	RVECENT(romReserved,15)
+	RVECENT(romReserved,16)
+	RVECENT(romReserved,17)
+	RVECENT(romReserved,18)
+	RVECENT(romReserved,19)
+	RVECENT(romReserved,20)
+	RVECENT(romReserved,21)
+	RVECENT(romReserved,22)
+	RVECENT(romReserved,23)
+	RVECENT(romReserved,24)
+	RVECENT(romReserved,25)
+	RVECENT(romReserved,26)
+	RVECENT(romReserved,27)
+	RVECENT(romReserved,28)
+	RVECENT(romReserved,29)
+	RVECENT(romReserved,30)
+	RVECENT(romReserved,31)
+	RVECENT(romReserved,32)
+	RVECENT(romReserved,33)
+	RVECENT(romReserved,34)
+	RVECENT(romReserved,35)
+	RVECENT(romReserved,36)
+	RVECENT(romReserved,37)
+	RVECENT(romReserved,38)
+	RVECENT(romReserved,39)
+	RVECENT(romReserved,40)
+	RVECENT(romReserved,41)
+	RVECENT(romReserved,42)
+	RVECENT(romReserved,43)
+	RVECENT(romReserved,44)
+	RVECENT(romReserved,45)
+	RVECENT(romReserved,46)
+	RVECENT(romReserved,47)
+	RVECENT(romReserved,48)
+	RVECENT(romReserved,49)
+	RVECENT(romReserved,50)
+	RVECENT(romReserved,51)
+	RVECENT(romReserved,52)
+	RVECENT(romReserved,53)
+	RVECENT(romReserved,54)
+	RVECENT(romReserved,55)
+	RVECENT(romReserved,56)
+	RVECENT(romReserved,57)
+	RVECENT(romReserved,58)
+	RVECENT(romReserved,59)
+	RVECENT(romReserved,60)
+	RVECENT(romReserved,61)
+	RVECENT(romReserved,62)
+	RVECENT(romReserved,63)
+	XVECENT(romExcHandle,0x200)	/* bfc00200: R4000 tlbmiss vector */
+	RVECENT(romReserved,65)
+	RVECENT(romReserved,66)
+	RVECENT(romReserved,67)
+	RVECENT(romReserved,68)
+	RVECENT(romReserved,69)
+	RVECENT(romReserved,70)
+	RVECENT(romReserved,71)
+	RVECENT(romReserved,72)
+	RVECENT(romReserved,73)
+	RVECENT(romReserved,74)
+	RVECENT(romReserved,75)
+	RVECENT(romReserved,76)
+	RVECENT(romReserved,77)
+	RVECENT(romReserved,78)
+	RVECENT(romReserved,79)
+	XVECENT(romExcHandle,0x280)	/* bfc00280: R4000 xtlbmiss vector */
+	RVECENT(romReserved,81)
+	RVECENT(romReserved,82)
+	RVECENT(romReserved,83)
+	RVECENT(romReserved,84)
+	RVECENT(romReserved,85)
+	RVECENT(romReserved,86)
+	RVECENT(romReserved,87)
+	RVECENT(romReserved,88)
+	RVECENT(romReserved,89)
+	RVECENT(romReserved,90)
+	RVECENT(romReserved,91)
+	RVECENT(romReserved,92)
+	RVECENT(romReserved,93)
+	RVECENT(romReserved,94)
+	RVECENT(romReserved,95)
+	XVECENT(romExcHandle,0x300)	/* bfc00300: R4000 cache vector */
+	RVECENT(romReserved,97)
+	RVECENT(romReserved,98)
+	RVECENT(romReserved,99)
+	RVECENT(romReserved,100)
+	RVECENT(romReserved,101)
+	RVECENT(romReserved,102)
+	RVECENT(romReserved,103)
+	RVECENT(romReserved,104)
+	RVECENT(romReserved,105)
+	RVECENT(romReserved,106)
+	RVECENT(romReserved,107)
+	RVECENT(romReserved,108)
+	RVECENT(romReserved,109)
+	RVECENT(romReserved,110)
+	RVECENT(romReserved,111)
+	XVECENT(romExcHandle,0x380)	/* bfc00380: R4000 general vector */
+	RVECENT(romReserved,113)
+	RVECENT(romReserved,114)
+	RVECENT(romReserved,115)
+	RVECENT(romReserved,116)
+	RVECENT(romReserved,116)
+	RVECENT(romReserved,118)
+	RVECENT(romReserved,119)
+	RVECENT(romReserved,120)
+	RVECENT(romReserved,121)
+	RVECENT(romReserved,122)
+	RVECENT(romReserved,123)
+	RVECENT(romReserved,124)
+	RVECENT(romReserved,125)
+	RVECENT(romReserved,126)
+	RVECENT(romReserved,127)
+
+	/* We hope there are no more reserved vectors!
+	 * 128 * 8 == 1024 == 0x400
+	 * so this is address R_VEC+0x400 == 0xbfc00400
+	 */
+#ifdef CONFIG_PURPLE
+/* 0xbfc00400 */
+	.word	0xdc870000
+	.word	0xfca70000
+	.word	0x20840008
+	.word	0x20a50008
+	.word	0x20c6ffff
+	.word	0x14c0fffa
+	.word	0x00000000
+	.word	0x03e00008
+	.word	0x00000000
+	.word   0x00000000
+/* 0xbfc00428 */
+	.word	0xdc870000
+	.word	0xfca70000
+	.word	0x20840008
+	.word	0x20a50008
+	.word	0x20c6ffff
+	.word	0x14c0fffa
+	.word	0x00000000
+	.word	0x03e00008
+	.word	0x00000000
+	.word   0x00000000
+#endif /* CONFIG_PURPLE */
+	.align 4
+reset:
+#ifdef CONFIG_INCA_IP2
+	/* Check for Host or Voice CPU */
+
+	mfc0    k0, CP0_EBASE 
+	and	k0, EBASEF_CPUNUM
+	srl	k0, EBASEB_CPUNUM
+	subu	k0, EBASE_CPU_HOST
+	bne	k0, zero, voice_reset_handler
+	nop
+	
+#endif
+
+	/* Clear watch registers.
+	 */
+	mtc0	zero, CP0_WATCHLO
+	mtc0	zero, CP0_WATCHHI
+
+	/* STATUS register */
+#ifdef  CONFIG_TB0229
+	li	k0, ST0_CU0
+#else
+	mfc0	k0, CP0_STATUS
+#endif
+	li	k1, ~ST0_IE
+	and	k0, k1
+	mtc0	k0, CP0_STATUS
+
+	/* CAUSE register */
+	mtc0	zero, CP0_CAUSE
+
+#ifdef CONFIG_INCA_IP2
+	/* CONFIG7 register */
+	mfc0	k0, CP0_CONFIG, 7
+	li	k1, 4 /* Disable RPS due to E83 bug of 24KEC */
+	or	k0, k1
+	mtc0	k0, CP0_CONFIG, 7
+#endif	
+	/* Init Timer */
+	mtc0	zero, CP0_COUNT
+	mtc0	zero, CP0_COMPARE
+
+	/* CONFIG0 register */
+	li	t0, CONF_CM_UNCACHED
+	mtc0	t0, CP0_CONFIG
+
+	/* Initialize GOT pointer.
+	*/
+	bal     1f
+	nop
+	.word   _GLOBAL_OFFSET_TABLE_
+	1:
+	move    gp, ra
+	lw      t1, 0(ra)
+	move	gp, t1
+
+#ifdef CONFIG_INCA_IP
+	/* Disable INCA-IP Watchdog.
+	 */
+	la      t9, disable_incaip_wdt
+	jalr    t9
+	nop
+#endif
+
+	/* Initialize any external memory.
+	 */
+	la      t9, lowlevel_init
+	jalr    t9
+	nop
+
+	/* Initialize caches...
+	 */
+	la      t9, mips_cache_reset
+	jalr    t9
+	nop
+
+	/* ... and enable them.
+	 */
+#ifdef CONFIG_MIPS_FORCE_CACHE_WRITE_THROUGH
+    	li  	t0, CONF_CM_CACHABLE_NO_WA
+#else    
+	li	t0, CONF_CM_CACHABLE_NONCOHERENT
+#endif
+	mtc0	t0, CP0_CONFIG
+
+
+	/* Set up temporary stack.
+	 */
+	li	a0, CFG_INIT_SP_OFFSET
+	la      t9, mips_cache_lock
+	jalr    t9
+	nop
+
+	li	t0, CFG_SDRAM_BASE + CFG_INIT_SP_OFFSET
+	la	sp, 0(t0)
+
+	la	t9, bootstrap_board_init_f
+	j	t9
+	nop
+
+
+/*
+ * void bootstrap_relocate_code (addr_sp, gd, addr_moni)
+ *
+ * This "function" does not return, instead it continues in RAM
+ * after relocating the monitor code.
+ *
+ * a0 = addr_sp
+ * a1 = gd
+ * a2 = destination address
+ */
+	.globl	bootstrap_relocate_code
+	.ent	bootstrap_relocate_code
+bootstrap_relocate_code:
+	move	sp, a0		/* Set new stack pointer		*/
+
+	li	t0, BOOTSTRAP_CFG_MONITOR_BASE
+	la	t3, in_ram
+	lw	t2, -12(t3)	/* t2 <-- uboot_end_data_bootsrap	*/
+	move	t1, a2
+
+	/*
+	 * Fix GOT pointer:
+	 *
+	 * New GOT-PTR = (old GOT-PTR - BOOTSTRAP_CFG_MONITOR_BASE) + Destination Address
+	 */
+	move	t6, gp
+	sub	gp, BOOTSTRAP_CFG_MONITOR_BASE
+	add	gp, a2			/* gp now adjusted		*/
+	sub	t6, gp, t6		/* t6 <-- relocation offset	*/
+
+	/*
+	 * t0 = source address
+	 * t1 = target address
+	 * t2 = source end address
+	 */
+	/* On the purple board we copy the code earlier in a special way
+	 * in order to solve flash problems
+	 */
+#ifndef CONFIG_PURPLE
+1:
+	lw	t3, 0(t0)
+	sw	t3, 0(t1)
+	addu	t0, 4
+	ble	t0, t2, 1b
+	addu	t1, 4			/* delay slot			*/
+#endif
+
+	/* If caches were enabled, we would have to flush them here.
+	 */
+
+	/* Jump to where we've relocated ourselves.
+	 */
+	addi	t0, a2, in_ram - _start_bootstrap
+	j	t0
+	nop
+
+	.word	uboot_end_data_bootstrap
+	.word	uboot_end_bootstrap
+	.word	num_got_entries
+
+in_ram:
+	/* Now we want to update GOT.
+	 */
+	lw	t3, -4(t0)	/* t3 <-- num_got_entries	*/
+	addi	t4, gp, 8	/* Skipping first two entries.	*/
+	li	t2, 2
+1:
+	lw	t1, 0(t4)
+	beqz	t1, 2f
+	add	t1, t6
+	sw	t1, 0(t4)
+2:
+	addi	t2, 1
+	blt	t2, t3, 1b
+	addi	t4, 4		/* delay slot			*/
+
+	/* Clear BSS.
+	 */
+	lw	t1, -12(t0)	/* t1 <-- uboot_end_data_bootstrap	*/
+	lw	t2, -8(t0)	/* t2 <-- uboot_end_bootstrap		*/
+	add	t1, t6		/* adjust pointers		*/
+	add	t2, t6
+
+	sub	t1, 4
+1:	addi	t1, 4
+	bltl	t1, t2, 1b
+	sw	zero, 0(t1)	/* delay slot			*/
+
+	move	a0, a1
+	la	t9, bootstrap_board_init_r
+	j	t9
+	move	a1, a2		/* delay slot			*/
+
+	.end	bootstrap_relocate_code
+
+
+	/* Exception handlers.
+	 */
+romReserved:
+	b romReserved
+
+romExcHandle:
+	b romExcHandle
+
+#ifdef CONFIG_INCA_IP2
+voice_reset_handler:
+	wait
+	b voice_reset_handler
+	nop
+#endif
diff --git a/package/uboot-ifxmips/files/drivers/ifx_sw.c b/package/uboot-ifxmips/files/drivers/ifx_sw.c
new file mode 100644
index 0000000..ac8f1c8
--- /dev/null
+++ b/package/uboot-ifxmips/files/drivers/ifx_sw.c
@@ -0,0 +1,423 @@
+/*
+ * DANUBE internal switch ethernet driver.
+ *
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+
+#include <common.h>
+
+#if (CONFIG_COMMANDS & CFG_CMD_NET) && defined(CONFIG_NET_MULTI) \
+    && defined(CONFIG_DANUBE_SWITCH)
+
+#include <malloc.h>
+#include <net.h>
+#include <asm/danube.h>
+#include <asm/addrspace.h>
+#include <asm/pinstrap.h>
+
+#define MII_MODE 1
+#define REV_MII_MODE 2
+
+#define TX_CHAN_NO   7
+#define RX_CHAN_NO   6
+
+#define NUM_RX_DESC	PKTBUFSRX                  
+#define NUM_TX_DESC	8
+#define MAX_PACKET_SIZE 	1536
+#define TOUT_LOOP	100
+#define PHY0_ADDR       1 /*fixme: set the correct value here*/ 
+
+#define DMA_WRITE_REG(reg, value) *((volatile u32 *)reg) = (u32)value
+#define DMA_READ_REG(reg, value)    value = (u32)*((volatile u32*)reg)
+
+#define SW_WRITE_REG(reg, value)  *((volatile u32*)reg) = (u32)value  	
+#define SW_READ_REG(reg, value)   value = (u32)*((volatile u32*)reg)
+
+typedef struct
+{
+	union
+	{
+		struct
+		{
+			volatile u32 OWN                 :1;
+			volatile u32 C	                 :1;
+			volatile u32 Sop                 :1;
+			volatile u32 Eop	         :1;
+			volatile u32 reserved		 :3;
+			volatile u32 Byteoffset		 :2; 
+			volatile u32 reserve             :7;
+			volatile u32 DataLen             :16;
+		}field;
+
+		volatile u32 word;
+	}status;
+	
+	volatile u32 DataPtr;
+} danube_rx_descriptor_t;
+
+typedef struct
+{
+	union
+	{
+		struct
+		{
+			volatile u32 OWN                 :1;
+			volatile u32 C	                 :1;
+			volatile u32 Sop                 :1;
+			volatile u32 Eop	         :1;
+			volatile u32 Byteoffset		 :5; 
+			volatile u32 reserved            :7;
+			volatile u32 DataLen             :16;
+		}field;
+
+		volatile u32 word;
+	}status;
+	
+	volatile u32 DataPtr;
+} danube_tx_descriptor_t;
+
+
+
+
+static danube_rx_descriptor_t rx_des_ring[NUM_RX_DESC] __attribute__ ((aligned(8)));
+static danube_tx_descriptor_t tx_des_ring[NUM_TX_DESC] __attribute__ ((aligned(8)));
+static int tx_num, rx_num;
+
+int danube_switch_init(struct eth_device *dev, bd_t * bis);
+int danube_switch_send(struct eth_device *dev, volatile void *packet,int length);
+int danube_switch_recv(struct eth_device *dev);
+void danube_switch_halt(struct eth_device *dev);
+static void danube_init_switch_chip(int mode);
+static void danube_dma_init(void);
+
+
+
+int danube_switch_initialize(bd_t * bis)
+{
+	struct eth_device *dev;
+      
+#if 0
+	printf("Entered danube_switch_initialize()\n");
+#endif
+
+	if (!(dev = (struct eth_device *) malloc (sizeof *dev)))
+	{
+		printf("Failed to allocate memory\n");
+		return 0;
+	}
+	memset(dev, 0, sizeof(*dev));
+
+	danube_dma_init();
+	danube_init_switch_chip(REV_MII_MODE);
+        
+#ifdef CLK_OUT2_25MHZ
+       *DANUBE_GPIO_P0_DIR=0x0000ae78;
+       *DANUBE_GPIO_P0_ALTSEL0=0x00008078; 
+       //joelin for Mii-1       *DANUBE_GPIO_P0_ALTSEL1=0x80000080;
+       *DANUBE_GPIO_P0_ALTSEL1=0x80000000; //joelin for Mii-1 
+       *DANUBE_CGU_IFCCR=0x00400010;
+       *DANUBE_GPIO_P0_OD=0x0000ae78;
+#endif        
+       
+        /*patch for 6996*/
+	
+	*DANUBE_RCU_RST_REQ |=1;
+        mdelay(200);
+	*DANUBE_RCU_RST_REQ &=(unsigned long)~1; 
+	mdelay(1);
+	/*while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x80123602;
+	*/
+	/*while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x80123602;
+	*/
+	/***************/
+	sprintf(dev->name, "danube Switch");
+	dev->init = danube_switch_init;
+	dev->halt = danube_switch_halt;
+	dev->send = danube_switch_send;
+	dev->recv = danube_switch_recv;
+
+	eth_register(dev);
+
+#if 0
+	printf("Leaving danube_switch_initialize()\n");
+#endif
+	while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x8001840F;
+	while((*DANUBE_PPE_ETOP_MDIO_ACC)&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x8003840F;
+	while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x8005840F;
+	//while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	//*DANUBE_PPE_ETOP_MDIO_ACC =0x8006840F;
+	while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x8007840F;
+	while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x8008840F;
+	while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x8001840F;
+        while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+	*DANUBE_PPE_ETOP_MDIO_ACC =0x80123602; 
+#ifdef CLK_OUT2_25MHZ         
+        while(*DANUBE_PPE_ETOP_MDIO_ACC&0x80000000);
+        *DANUBE_PPE_ETOP_MDIO_ACC =0x80334000;
+#endif
+
+	return 1;
+}
+
+int danube_switch_init(struct eth_device *dev, bd_t * bis)
+{
+	int i;
+
+	tx_num=0;
+	rx_num=0;
+	
+		/* Reset DMA 
+		 */
+//	serial_puts("i \n\0");
+
+       *DANUBE_DMA_CS=RX_CHAN_NO;
+       *DANUBE_DMA_CCTRL=0x2;/*fix me, need to reset this channel first?*/
+       *DANUBE_DMA_CPOLL= 0x80000040;
+       /*set descriptor base*/
+       *DANUBE_DMA_CDBA=(u32)rx_des_ring;
+       *DANUBE_DMA_CDLEN=NUM_RX_DESC;
+       *DANUBE_DMA_CIE = 0;
+       *DANUBE_DMA_CCTRL=0x30000;
+	 	
+       *DANUBE_DMA_CS=TX_CHAN_NO;
+       *DANUBE_DMA_CCTRL=0x2;/*fix me, need to reset this channel first?*/
+       *DANUBE_DMA_CPOLL= 0x80000040;
+       *DANUBE_DMA_CDBA=(u32)tx_des_ring;
+       *DANUBE_DMA_CDLEN=NUM_TX_DESC;  
+       *DANUBE_DMA_CIE = 0;
+       *DANUBE_DMA_CCTRL=0x30100;
+	
+	for(i=0;i < NUM_RX_DESC; i++)
+	{
+		danube_rx_descriptor_t * rx_desc = KSEG1ADDR(&rx_des_ring[i]);
+		rx_desc->status.word=0;	
+		rx_desc->status.field.OWN=1;
+		rx_desc->status.field.DataLen=PKTSIZE_ALIGN;   /* 1536  */	
+		rx_desc->DataPtr=(u32)KSEG1ADDR(NetRxPackets[i]);
+	}
+
+	for(i=0;i < NUM_TX_DESC; i++)
+	{
+		danube_tx_descriptor_t * tx_desc = KSEG1ADDR(&tx_des_ring[i]);
+		memset(tx_desc, 0, sizeof(tx_des_ring[0]));
+	}
+		/* turn on DMA rx & tx channel
+		 */
+	 *DANUBE_DMA_CS=RX_CHAN_NO;
+	 *DANUBE_DMA_CCTRL|=1;/*reset and turn on the channel*/
+	
+	return 0;
+}
+
+void danube_switch_halt(struct eth_device *dev)
+{
+        int i; 
+		for(i=0;i<8;i++)
+	{
+	   *DANUBE_DMA_CS=i;
+	   *DANUBE_DMA_CCTRL&=~1;/*stop the dma channel*/
+	}
+//	udelay(1000000);
+}
+
+int danube_switch_send(struct eth_device *dev, volatile void *packet,int length)
+{
+
+	int                    	i;
+	int 		 	res = -1;
+
+	danube_tx_descriptor_t * tx_desc= KSEG1ADDR(&tx_des_ring[tx_num]);
+	
+	if (length <= 0)
+	{
+		printf ("%s: bad packet size: %d\n", dev->name, length);
+		goto Done;
+	}
+	
+	for(i=0; tx_desc->status.field.OWN==1; i++)
+	{
+		if(i>=TOUT_LOOP)
+		{
+			printf("NO Tx Descriptor...");
+			goto Done;
+		}
+	}
+
+	//serial_putc('s');
+
+	tx_desc->status.field.Sop=1;
+	tx_desc->status.field.Eop=1;
+	tx_desc->status.field.C=0;
+	tx_desc->DataPtr = (u32)KSEG1ADDR(packet);
+	if(length<60)
+		tx_desc->status.field.DataLen = 60;
+	else
+		tx_desc->status.field.DataLen = (u32)length;	
+	
+	asm("SYNC");
+	tx_desc->status.field.OWN=1;
+			 	
+	res=length;
+	tx_num++;
+        if(tx_num==NUM_TX_DESC) tx_num=0;
+	*DANUBE_DMA_CS=TX_CHAN_NO;
+	  
+	if(!(*DANUBE_DMA_CCTRL & 1))
+	*DANUBE_DMA_CCTRL|=1;
+        
+Done:
+	return res;
+}
+
+int danube_switch_recv(struct eth_device *dev)
+{
+
+	int                    length  = 0;
+
+	danube_rx_descriptor_t * rx_desc;
+        int anchor_num=0;
+	int i;
+	for (;;)
+	{
+	        rx_desc = KSEG1ADDR(&rx_des_ring[rx_num]);
+
+	        if ((rx_desc->status.field.C == 0) || (rx_desc->status.field.OWN == 1))
+		{
+		   break;
+		}
+		 
+                
+		length = rx_desc->status.field.DataLen;
+		if (length)
+		{		
+			NetReceive((void*)KSEG1ADDR(NetRxPackets[rx_num]), length - 4);
+		//	serial_putc('*');
+		}
+		else
+		{
+			printf("Zero length!!!\n");
+		}
+
+		rx_desc->status.field.Sop=0;
+		rx_desc->status.field.Eop=0;
+		rx_desc->status.field.C=0;
+		rx_desc->status.field.DataLen=PKTSIZE_ALIGN;
+		rx_desc->status.field.OWN=1;
+		rx_num++;
+		if(rx_num==NUM_RX_DESC) rx_num=0;
+
+	}
+
+	return length;
+}
+
+
+static void danube_init_switch_chip(int mode)
+{
+        int i;
+        /*get and set mac address for MAC*/
+        static unsigned char addr[6];
+        char *tmp,*end; 
+	tmp = getenv ("ethaddr");
+	if (NULL == tmp) {
+		printf("Can't get environment ethaddr!!!\n");
+	//	return NULL;
+	} else {
+		printf("ethaddr=%s\n", tmp);
+	}
+        *DANUBE_PMU_PWDCR = *DANUBE_PMU_PWDCR & 0xFFFFEFDF;
+        *DANUBE_PPE32_ETOP_MDIO_CFG &= ~0x6;
+        *DANUBE_PPE32_ENET_MAC_CFG = 0x187;
+  
+  // turn on port0, set to rmii and turn off port1.
+	if(mode==REV_MII_MODE)
+		{
+		 *DANUBE_PPE32_ETOP_CFG = (*DANUBE_PPE32_ETOP_CFG & 0xfffffffc) | 0x0000000a;
+                } 
+	else if (mode == MII_MODE)
+	        {
+		*DANUBE_PPE32_ETOP_CFG = (*DANUBE_PPE32_ETOP_CFG & 0xfffffffc) | 0x00000008;
+                }	  
+
+	*DANUBE_PPE32_ETOP_IG_PLEN_CTRL = 0x4005ee; // set packetlen.
+        *ENET_MAC_CFG|=1<<11;/*enable the crc*/
+	return;
+}
+
+
+static void danube_dma_init(void)
+{
+        int i;
+//	serial_puts("d \n\0");
+
+        *DANUBE_PMU_PWDCR &=~(1<<DANUBE_PMU_DMA_SHIFT);/*enable DMA from PMU*/
+		/* Reset DMA 
+		 */
+	*DANUBE_DMA_CTRL|=1; 
+        *DANUBE_DMA_IRNEN=0;/*disable all the interrupts first*/
+
+	/* Clear Interrupt Status Register 		 
+	*/
+	*DANUBE_DMA_IRNCR=0xfffff;
+	/*disable all the dma interrupts*/
+	*DANUBE_DMA_IRNEN=0;
+	/*disable channel 0 and channel 1 interrupts*/
+	
+	  *DANUBE_DMA_CS=RX_CHAN_NO;
+	  *DANUBE_DMA_CCTRL=0x2;/*fix me, need to reset this channel first?*/
+          *DANUBE_DMA_CPOLL= 0x80000040;
+          /*set descriptor base*/
+          *DANUBE_DMA_CDBA=(u32)rx_des_ring;
+          *DANUBE_DMA_CDLEN=NUM_RX_DESC;
+          *DANUBE_DMA_CIE = 0;
+          *DANUBE_DMA_CCTRL=0x30000;
+	 	
+	*DANUBE_DMA_CS=TX_CHAN_NO;
+	*DANUBE_DMA_CCTRL=0x2;/*fix me, need to reset this channel first?*/
+        *DANUBE_DMA_CPOLL= 0x80000040;
+	*DANUBE_DMA_CDBA=(u32)tx_des_ring;
+        *DANUBE_DMA_CDLEN=NUM_TX_DESC;  
+	*DANUBE_DMA_CIE = 0;
+	*DANUBE_DMA_CCTRL=0x30100;
+	/*enable the poll function and set the poll counter*/
+	//*DANUBE_DMA_CPOLL=DANUBE_DMA_POLL_EN | (DANUBE_DMA_POLL_COUNT<<4);
+	/*set port properties, enable endian conversion for switch*/
+	*DANUBE_DMA_PS=0;
+	*DANUBE_DMA_PCTRL|=0xf<<8;/*enable 32 bit endian conversion*/
+
+	return;
+}
+
+
+
+
+
+#endif
diff --git a/package/uboot-ifxmips/files/include/LzmaWrapper.h b/package/uboot-ifxmips/files/include/LzmaWrapper.h
new file mode 100644
index 0000000..2f9a3ff
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/LzmaWrapper.h
@@ -0,0 +1,36 @@
+/******************************************************************************
+**
+** FILE NAME    : LzmaWrapper.h
+** PROJECT      : bootloader
+** MODULES      : U-boot
+**
+** DATE         : 2 Nov 2006
+** AUTHOR       : Lin Mars
+** DESCRIPTION  : LZMA decoder support for U-boot 1.1.5
+** COPYRIGHT    :       Copyright (c) 2006
+**                      Infineon Technologies AG
+**                      Am Campeon 1-12, 85579 Neubiberg, Germany
+**
+**    This program is free software; you can redistribute it and/or modify
+**    it under the terms of the GNU General Public License as published by
+**    the Free Software Foundation; either version 2 of the License, or
+**    (at your option) any later version.
+**
+** HISTORY
+** $Date        $Author         $Comment
+** 2 Nov 2006   Lin Mars        init version which derived from LzmaTest.c from
+**                              LZMA v4.43 SDK
+*******************************************************************************/
+#ifndef  __LZMA_WRAPPER_H__
+#define  __LZMA_WRAPPER_H__
+
+#ifndef LZMA_RESULT_OK
+#define LZMA_RESULT_OK 0
+#endif
+#ifndef LZMA_RESULT_DATA_ERROR
+#define LZMA_RESULT_DATA_ERROR 1
+#endif
+
+extern int lzma_inflate(unsigned char *source, int s_len, unsigned char *dest, int *d_len);
+
+#endif /*__LZMA_WRAPPER_H__*/
diff --git a/package/uboot-ifxmips/files/include/asm-mips/danube.h b/package/uboot-ifxmips/files/include/asm-mips/danube.h
new file mode 100644
index 0000000..c0be9fb
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/asm-mips/danube.h
@@ -0,0 +1,2033 @@
+#ifndef DANUBE_H
+#define DANUBE_H
+/******************************************************************************
+       Copyright (c) 2002, Infineon Technologies.  All rights reserved.
+
+                               No Warranty
+   Because the program is licensed free of charge, there is no warranty for 
+   the program, to the extent permitted by applicable law.  Except when     
+   otherwise stated in writing the copyright holders and/or other parties   
+   provide the program "as is" without warranty of any kind, either         
+   expressed or implied, including, but not limited to, the implied         
+   warranties of merchantability and fitness for a particular purpose. The  
+   entire risk as to the quality and performance of the program is with     
+   you.  should the program prove defective, you assume the cost of all     
+   necessary servicing, repair or correction.                               
+                                                                            
+   In no event unless required by applicable law or agreed to in writing    
+   will any copyright holder, or any other party who may modify and/or      
+   redistribute the program as permitted above, be liable to you for        
+   damages, including any general, special, incidental or consequential     
+   damages arising out of the use or inability to use the program           
+   (including but not limited to loss of data or data being rendered        
+   inaccurate or losses sustained by you or third parties or a failure of   
+   the program to operate with any other programs), even if such holder or  
+   other party has been advised of the possibility of such damages. 
+******************************************************************************/
+
+/***********************************************************************/
+/*  Module      :  MEI register address and bits                       */
+/***********************************************************************/
+#define MEI_SPACE_ACCESS	0xB0100C00
+#define MEI_DATA_XFR				(0x0000 + MEI_SPACE_ACCESS)
+#define	MEI_VERSION				(0x0200 + MEI_SPACE_ACCESS)	
+#define	ARC_GP_STAT				(0x0204 + MEI_SPACE_ACCESS)	
+#define	MEI_XFR_ADDR				(0x020C + MEI_SPACE_ACCESS)	
+#define	MEI_TO_ARC_INT				(0x021C + MEI_SPACE_ACCESS)
+#define	ARC_TO_MEI_INT				(0x0220 + MEI_SPACE_ACCESS)	
+#define	ARC_TO_MEI_INT_MASK			(0x0224 + MEI_SPACE_ACCESS)	
+#define	MEI_DEBUG_WAD				(0x0228 + MEI_SPACE_ACCESS)	
+#define MEI_DEBUG_RAD				(0x022C + MEI_SPACE_ACCESS)	
+#define	MEI_DEBUG_DATA				(0x0230 + MEI_SPACE_ACCESS)	
+#define	MEI_DEBUG_DEC				(0x0234 + MEI_SPACE_ACCESS)	
+#define	MEI_CONTROL				(0x0238 + MEI_SPACE_ACCESS)	
+#define	AT_CELLRDY_BC0				(0x023C + MEI_SPACE_ACCESS)
+#define	AT_CELLRDY_BC1				(0x0240 + MEI_SPACE_ACCESS)	
+#define	AR_CELLRDY_BC0				(0x0244 + MEI_SPACE_ACCESS)	
+#define	AR_CELLRDY_BC1				(0x0248 + MEI_SPACE_ACCESS)	
+#define	AAI_ACCESS				(0x024C + MEI_SPACE_ACCESS)	
+#define	AAITXCB0				(0x0300 + MEI_SPACE_ACCESS)	
+#define	AAITXCB1				(0x0304 + MEI_SPACE_ACCESS)	
+#define	AAIRXCB0				(0x0308 + MEI_SPACE_ACCESS)	
+#define	AAIRXCB1				(0x030C + MEI_SPACE_ACCESS)	
+
+
+/***********************************************************************/
+/*  Module      :  WDT register address and bits                       */
+/***********************************************************************/
+#define DANUBE_BIU_WDT_BASE             (0xBf8803F0)
+#define DANUBE_BIU_WDT_CR     		(0x0000 + DANUBE_BIU_WDT_BASE)
+#define DANUBE_BIU_WDT_SR     		(0x0008 + DANUBE_BIU_WDT_BASE)
+
+
+/***********************************************************************/
+/*  Module      :  PMU register address and bits                       */
+/***********************************************************************/
+#define DANUBE_PMU_BASE_ADDR 				(KSEG1+0x1F102000)
+
+/***PM Control Register***/
+#define DANUBE_PMU_CR 					((volatile u32*)(0x001C + DANUBE_PMU_BASE_ADDR))
+#define DANUBE_PMU_PWDCR				DANUBE_PMU_CR
+#define DANUBE_PMU_SR 					((volatile u32*)(0x0020 + DANUBE_PMU_BASE_ADDR))
+
+#define DANUBE_PMU_DMA_SHIFT                    5
+#define DANUBE_PMU_PPE_SHIFT                    13
+#define DANUBE_PMU_ETOP_SHIFT                   22                                             
+#define DANUBE_PMU_ENET0_SHIFT                  24
+#define DANUBE_PMU_ENET1_SHIFT                  25
+
+
+#define DANUBE_PMU 					DANUBE_PMU_BASE_ADDR
+/***PM Global Enable Register***/
+#define DANUBE_PMU_PM_GEN                       ((volatile u32*)(DANUBE_PMU+ 0x0000))
+#define DANUBE_PMU_PM_GEN_EN16                            (1 << 16)
+#define DANUBE_PMU_PM_GEN_EN15                            (1 << 15)
+#define DANUBE_PMU_PM_GEN_EN14                            (1 << 14)
+#define DANUBE_PMU_PM_GEN_EN13                            (1 << 13)
+#define DANUBE_PMU_PM_GEN_EN12                            (1 << 12)
+#define DANUBE_PMU_PM_GEN_EN11                            (1 << 11)
+#define DANUBE_PMU_PM_GEN_EN10                            (1 << 10)
+#define DANUBE_PMU_PM_GEN_EN9                              (1 << 9)
+#define DANUBE_PMU_PM_GEN_EN8                              (1 << 8)
+#define DANUBE_PMU_PM_GEN_EN7                              (1 << 7)
+#define DANUBE_PMU_PM_GEN_EN6                              (1 << 6)
+#define DANUBE_PMU_PM_GEN_EN5                              (1 << 5)
+#define DANUBE_PMU_PM_GEN_EN4                              (1 << 4)
+#define DANUBE_PMU_PM_GEN_EN3                              (1 << 3)
+#define DANUBE_PMU_PM_GEN_EN2                              (1 << 2)
+#define DANUBE_PMU_PM_GEN_EN0                              (1 << 0)
+                                                                                                                                                             
+/***PM Power Down Enable Register***/
+#define DANUBE_PMU_PM_PDEN                      ((volatile u32*)(DANUBE_PMU+ 0x0008))
+#define DANUBE_PMU_PM_PDEN_EN16                            (1 << 16)
+#define DANUBE_PMU_PM_PDEN_EN15                            (1 << 15)
+#define DANUBE_PMU_PM_PDEN_EN14                            (1 << 14)
+#define DANUBE_PMU_PM_PDEN_EN13                            (1 << 13)
+#define DANUBE_PMU_PM_PDEN_EN12                            (1 << 12)
+#define DANUBE_PMU_PM_PDEN_EN11                            (1 << 11)
+#define DANUBE_PMU_PM_PDEN_EN10                            (1 << 10)
+#define DANUBE_PMU_PM_PDEN_EN9                              (1 << 9)
+#define DANUBE_PMU_PM_PDEN_EN8                              (1 << 8)
+#define DANUBE_PMU_PM_PDEN_EN7                              (1 << 7)
+#define DANUBE_PMU_PM_PDEN_EN5                              (1 << 5)
+#define DANUBE_PMU_PM_PDEN_EN4                              (1 << 4)
+#define DANUBE_PMU_PM_PDEN_EN3                              (1 << 3)
+#define DANUBE_PMU_PM_PDEN_EN2                              (1 << 2)
+#define DANUBE_PMU_PM_PDEN_EN0                              (1 << 0)
+                                                                                                                                                             
+/***PM Wake-Up from Power Down Register***/
+#define DANUBE_PMU_PM_WUP                       ((volatile u32*)(DANUBE_PMU+ 0x0010))
+#define DANUBE_PMU_PM_WUP_WUP16                          (1 << 16)
+#define DANUBE_PMU_PM_WUP_WUP15                          (1 << 15)
+#define DANUBE_PMU_PM_WUP_WUP14                          (1 << 14)
+#define DANUBE_PMU_PM_WUP_WUP13                          (1 << 13)
+#define DANUBE_PMU_PM_WUP_WUP12                          (1 << 12)
+#define DANUBE_PMU_PM_WUP_WUP11                          (1 << 11)
+#define DANUBE_PMU_PM_WUP_WUP10                          (1 << 10)
+#define DANUBE_PMU_PM_WUP_WUP9                            (1 << 9)
+#define DANUBE_PMU_PM_WUP_WUP8                            (1 << 8)
+#define DANUBE_PMU_PM_PDEN_EN7                              (1 << 7)
+#define DANUBE_PMU_PM_PDEN_EN5                              (1 << 5)
+#define DANUBE_PMU_PM_PDEN_EN4                              (1 << 4)
+#define DANUBE_PMU_PM_PDEN_EN3                              (1 << 3)
+#define DANUBE_PMU_PM_PDEN_EN2                              (1 << 2)
+#define DANUBE_PMU_PM_PDEN_EN0                              (1 << 0)
+                                                                                                                                                             
+/***PM Wake-Up from Power Down Register***/
+#define DANUBE_PMU_PM_WUP                       ((volatile u32*)(DANUBE_PMU+ 0x0010))
+#define DANUBE_PMU_PM_WUP_WUP16                          (1 << 16)
+#define DANUBE_PMU_PM_WUP_WUP15                          (1 << 15)
+#define DANUBE_PMU_PM_WUP_WUP14                          (1 << 14)
+#define DANUBE_PMU_PM_WUP_WUP13                          (1 << 13)
+#define DANUBE_PMU_PM_WUP_WUP12                          (1 << 12)
+#define DANUBE_PMU_PM_WUP_WUP11                          (1 << 11)
+#define DANUBE_PMU_PM_WUP_WUP10                          (1 << 10)
+#define DANUBE_PMU_PM_WUP_WUP9                            (1 << 9)
+#define DANUBE_PMU_PM_WUP_WUP8                            (1 << 8)
+#define DANUBE_PMU_PM_WUP_WUP7                            (1 << 7)
+#define DANUBE_PMU_PM_WUP_WUP5                            (1 << 5)
+#define DANUBE_PMU_PM_WUP_WUP4                            (1 << 4)
+#define DANUBE_PMU_PM_WUP_WUP3                            (1 << 3)
+#define DANUBE_PMU_PM_WUP_WUP2                            (1 << 2)
+#define DANUBE_PMU_PM_WUP_WUP0                            (1 << 0)
+                                                                                                                                                             
+/***PM Control Register***/
+#define DANUBE_PMU_PM_CR                        ((volatile u32*)(DANUBE_PMU+ 0x0014))
+#define DANUBE_PMU_PM_CR_AWEN                            (1 << 31)
+#define DANUBE_PMU_PM_CR_SWRST                          (1 << 30)
+#define DANUBE_PMU_PM_CR_SWCR                            (1 << 2)
+#define DANUBE_PMU_PM_CR_CRD (value)                (((( 1 << 2) - 1) & (value)) << 0)
+                                                                                                                                                             
+/***********************************************************************/
+/*  Module      :  RCU register address and bits                       */
+/***********************************************************************/
+#define DANUBE_RCU_BASE_ADDR 		(0xBF203000)
+
+#define DANUBE_RCU_REQ 			(0x0010 + DANUBE_RCU_BASE_ADDR)
+#define DANUBE_RCU_RST_REQ                      ((volatile u32*)(DANUBE_RCU_REQ))
+#define DANUBE_RCU_STAT		        (0x0014 + DANUBE_RCU_BASE_ADDR)
+#define DANUBE_RCU_RST_SR	        ( (volatile u32 *)(DANUBE_RCU_STAT))
+#define DANUBE_RCU_PCI_RDY	        ( (volatile u32 *)(DANUBE_RCU_BASE_ADDR+0x28))
+#define DANUBE_RCU_MON                  (0x0030 + DANUBE_RCU_BASE_ADDR)
+
+
+/***********************************************************************/
+/*  Module      :  BCU  register address and bits                       */
+/***********************************************************************/
+#define DANUBE_BCU_BASE_ADDR 	(0xB0100000)
+/***BCU Control Register (0010H)***/
+#define DANUBE_BCU_CON 		(0x0010 + DANUBE_BCU_BASE_ADDR)
+#define DANUBE_BCU_BCU_CON_SPC (value)                (((( 1 << 8) - 1) & (value)) << 24)
+#define DANUBE_BCU_BCU_CON_SPE                              (1 << 19)
+#define DANUBE_BCU_BCU_CON_PSE                              (1 << 18)
+#define DANUBE_BCU_BCU_CON_DBG                              (1 << 16)
+#define DANUBE_BCU_BCU_CON_TOUT (value)               (((( 1 << 16) - 1) & (value)) << 0)
+
+
+/***BCU Error Control Capture Register (0020H)***/
+#define DANUBE_BCU_ECON 	(0x0020 + DANUBE_BCU_BASE_ADDR)
+#define DANUBE_BCU_BCU_ECON_TAG (value)                (((( 1 << 4) - 1) & (value)) << 24)
+#define DANUBE_BCU_BCU_ECON_RDN                              (1 << 23)
+#define DANUBE_BCU_BCU_ECON_WRN                              (1 << 22)
+#define DANUBE_BCU_BCU_ECON_SVM                              (1 << 21)
+#define DANUBE_BCU_BCU_ECON_ACK (value)                (((( 1 << 2) - 1) & (value)) << 19)
+#define DANUBE_BCU_BCU_ECON_ABT                              (1 << 18)
+#define DANUBE_BCU_BCU_ECON_RDY                              (1 << 17)
+#define DANUBE_BCU_BCU_ECON_TOUT                            (1 << 16)
+#define DANUBE_BCU_BCU_ECON_ERRCNT (value)             (((( 1 << 16) - 1) & (value)) << 0)
+#define DANUBE_BCU_BCU_ECON_OPC (value)                (((( 1 << 4) - 1) & (value)) << 28)
+
+/***BCU Error Address Capture Register (0024 H)***/
+#define DANUBE_BCU_EADD 	(0x0024 + DANUBE_BCU_BASE_ADDR)
+
+/***BCU Error Data Capture Register (0028H)***/
+#define DANUBE_BCU_EDAT 	(0x0028 + DANUBE_BCU_BASE_ADDR)
+
+#define DANUBE_BCU_IRNEN 	(0x00F4 + DANUBE_BCU_BASE_ADDR)
+#define DANUBE_BCU_IRNICR 	(0x00F8 + DANUBE_BCU_BASE_ADDR)
+#define DANUBE_BCU_IRNCR 	(0x00FC + DANUBE_BCU_BASE_ADDR)
+
+
+/***********************************************************************/
+/*  Module      :  MBC register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_MBC                          (0xBF103000)
+/***********************************************************************/
+
+
+/***Mailbox CPU Configuration Register***/
+#define DANUBE_MBC_MBC_CFG                      ((volatile u32*)(DANUBE_MBC+ 0x0080))
+#define DANUBE_MBC_MBC_CFG_SWAP (value)               (((( 1 << 2) - 1) & (value)) << 6)
+#define DANUBE_MBC_MBC_CFG_RES                              (1 << 5)
+#define DANUBE_MBC_MBC_CFG_FWID (value)               (((( 1 << 4) - 1) & (value)) << 1)
+#define DANUBE_MBC_MBC_CFG_SIZE                            (1 << 0)
+
+/***Mailbox CPU Interrupt Status Register***/
+#define DANUBE_MBC_MBC_ISR                      ((volatile u32*)(DANUBE_MBC+ 0x0084))
+#define DANUBE_MBC_MBC_ISR_B3DA                            (1 << 31)
+#define DANUBE_MBC_MBC_ISR_B2DA                            (1 << 30)
+#define DANUBE_MBC_MBC_ISR_B1E                              (1 << 29)
+#define DANUBE_MBC_MBC_ISR_B0E                              (1 << 28)
+#define DANUBE_MBC_MBC_ISR_WDT                              (1 << 27)
+#define DANUBE_MBC_MBC_ISR_DS260 (value)             (((( 1 << 27) - 1) & (value)) << 0)
+
+/***Mailbox CPU Mask Register***/
+#define DANUBE_MBC_MBC_MSK                      ((volatile u32*)(DANUBE_MBC+ 0x0088))
+#define DANUBE_MBC_MBC_MSK_B3DA                            (1 << 31)
+#define DANUBE_MBC_MBC_MSK_B2DA                            (1 << 30)
+#define DANUBE_MBC_MBC_MSK_B1E                              (1 << 29)
+#define DANUBE_MBC_MBC_MSK_B0E                              (1 << 28)
+#define DANUBE_MBC_MBC_MSK_WDT                              (1 << 27)
+#define DANUBE_MBC_MBC_MSK_DS260 (value)             (((( 1 << 27) - 1) & (value)) << 0)
+
+/***Mailbox CPU Mask 01 Register***/
+#define DANUBE_MBC_MBC_MSK01                    ((volatile u32*)(DANUBE_MBC+ 0x008C))
+#define DANUBE_MBC_MBC_MSK01_B3DA                            (1 << 31)
+#define DANUBE_MBC_MBC_MSK01_B2DA                            (1 << 30)
+#define DANUBE_MBC_MBC_MSK01_B1E                              (1 << 29)
+#define DANUBE_MBC_MBC_MSK01_B0E                              (1 << 28)
+#define DANUBE_MBC_MBC_MSK01_WDT                              (1 << 27)
+#define DANUBE_MBC_MBC_MSK01_DS260 (value)             (((( 1 << 27) - 1) & (value)) << 0)
+
+/***Mailbox CPU Mask 10 Register***/
+#define DANUBE_MBC_MBC_MSK10                    ((volatile u32*)(DANUBE_MBC+ 0x0090))
+#define DANUBE_MBC_MBC_MSK10_B3DA                            (1 << 31)
+#define DANUBE_MBC_MBC_MSK10_B2DA                            (1 << 30)
+#define DANUBE_MBC_MBC_MSK10_B1E                              (1 << 29)
+#define DANUBE_MBC_MBC_MSK10_B0E                              (1 << 28)
+#define DANUBE_MBC_MBC_MSK10_WDT                              (1 << 27)
+#define DANUBE_MBC_MBC_MSK10_DS260 (value)             (((( 1 << 27) - 1) & (value)) << 0)
+
+/***Mailbox CPU Short Command Register***/
+#define DANUBE_MBC_MBC_CMD                      ((volatile u32*)(DANUBE_MBC+ 0x0094))
+#define DANUBE_MBC_MBC_CMD_CS270 (value)             (((( 1 << 28) - 1) & (value)) << 0)
+
+/***Mailbox CPU Input Data of Buffer 0***/
+#define DANUBE_MBC_MBC_ID0                      ((volatile u32*)(DANUBE_MBC+ 0x0000))
+#define DANUBE_MBC_MBC_ID0_INDATA
+
+/***Mailbox CPU Input Data of Buffer 1***/
+#define DANUBE_MBC_MBC_ID1                      ((volatile u32*)(DANUBE_MBC+ 0x0020))
+#define DANUBE_MBC_MBC_ID1_INDATA
+
+/***Mailbox CPU Output Data of Buffer 2***/
+#define DANUBE_MBC_MBC_OD2                      ((volatile u32*)(DANUBE_MBC+ 0x0040))
+#define DANUBE_MBC_MBC_OD2_OUTDATA
+
+/***Mailbox CPU Output Data of Buffer 3***/
+#define DANUBE_MBC_MBC_OD3                      ((volatile u32*)(DANUBE_MBC+ 0x0060))
+#define DANUBE_MBC_MBC_OD3_OUTDATA
+
+/***Mailbox CPU Control Register of Buffer 0***/
+#define DANUBE_MBC_MBC_CR0                      ((volatile u32*)(DANUBE_MBC+ 0x0004))
+#define DANUBE_MBC_MBC_CR0_RDYABTFLS (value)          (((( 1 << 3) - 1) & (value)) << 0)
+
+/***Mailbox CPU Control Register of Buffer 1***/
+#define DANUBE_MBC_MBC_CR1                      ((volatile u32*)(DANUBE_MBC+ 0x0024))
+#define DANUBE_MBC_MBC_CR1_RDYABTFLS (value)          (((( 1 << 3) - 1) & (value)) << 0)
+
+/***Mailbox CPU Control Register of Buffer 2***/
+#define DANUBE_MBC_MBC_CR2                      ((volatile u32*)(DANUBE_MBC+ 0x0044))
+#define DANUBE_MBC_MBC_CR2_RDYABTFLS (value)          (((( 1 << 3) - 1) & (value)) << 0)
+
+/***Mailbox CPU Control Register of Buffer 3***/
+#define DANUBE_MBC_MBC_CR3                      ((volatile u32*)(DANUBE_MBC+ 0x0064))
+#define DANUBE_MBC_MBC_CR3_RDYABTFLS (value)          (((( 1 << 3) - 1) & (value)) << 0)
+
+/***Mailbox CPU Free Space of Buffer 0***/
+#define DANUBE_MBC_MBC_FS0                      ((volatile u32*)(DANUBE_MBC+ 0x0008))
+#define DANUBE_MBC_MBC_FS0_FS
+
+/***Mailbox CPU Free Space of Buffer 1***/
+#define DANUBE_MBC_MBC_FS1                      ((volatile u32*)(DANUBE_MBC+ 0x0028))
+#define DANUBE_MBC_MBC_FS1_FS
+
+/***Mailbox CPU Free Space of Buffer 2***/
+#define DANUBE_MBC_MBC_FS2                      ((volatile u32*)(DANUBE_MBC+ 0x0048))
+#define DANUBE_MBC_MBC_FS2_FS
+
+/***Mailbox CPU Free Space of Buffer 3***/
+#define DANUBE_MBC_MBC_FS3                      ((volatile u32*)(DANUBE_MBC+ 0x0068))
+#define DANUBE_MBC_MBC_FS3_FS
+
+/***Mailbox CPU Data Available in Buffer 0***/
+#define DANUBE_MBC_MBC_DA0                      ((volatile u32*)(DANUBE_MBC+ 0x000C))
+#define DANUBE_MBC_MBC_DA0_DA
+
+/***Mailbox CPU Data Available in Buffer 1***/
+#define DANUBE_MBC_MBC_DA1                      ((volatile u32*)(DANUBE_MBC+ 0x002C))
+#define DANUBE_MBC_MBC_DA1_DA
+
+/***Mailbox CPU Data Available in Buffer 2***/
+#define DANUBE_MBC_MBC_DA2                      ((volatile u32*)(DANUBE_MBC+ 0x004C))
+#define DANUBE_MBC_MBC_DA2_DA
+
+/***Mailbox CPU Data Available in Buffer 3***/
+#define DANUBE_MBC_MBC_DA3                      ((volatile u32*)(DANUBE_MBC+ 0x006C))
+#define DANUBE_MBC_MBC_DA3_DA
+
+/***Mailbox CPU Input Absolute Pointer of Buffer 0***/
+#define DANUBE_MBC_MBC_IABS0                    ((volatile u32*)(DANUBE_MBC+ 0x0010))
+#define DANUBE_MBC_MBC_IABS0_IABS
+
+/***Mailbox CPU Input Absolute Pointer of Buffer 1***/
+#define DANUBE_MBC_MBC_IABS1                    ((volatile u32*)(DANUBE_MBC+ 0x0030))
+#define DANUBE_MBC_MBC_IABS1_IABS
+
+/***Mailbox CPU Input Absolute Pointer of Buffer 2***/
+#define DANUBE_MBC_MBC_IABS2                    ((volatile u32*)(DANUBE_MBC+ 0x0050))
+#define DANUBE_MBC_MBC_IABS2_IABS
+
+/***Mailbox CPU Input Absolute Pointer of Buffer 3***/
+#define DANUBE_MBC_MBC_IABS3                    ((volatile u32*)(DANUBE_MBC+ 0x0070))
+#define DANUBE_MBC_MBC_IABS3_IABS
+
+/***Mailbox CPU Input Temporary Pointer of Buffer 0***/
+#define DANUBE_MBC_MBC_ITMP0                    ((volatile u32*)(DANUBE_MBC+ 0x0014))
+#define DANUBE_MBC_MBC_ITMP0_ITMP
+
+/***Mailbox CPU Input Temporary Pointer of Buffer 1***/
+#define DANUBE_MBC_MBC_ITMP1                    ((volatile u32*)(DANUBE_MBC+ 0x0034))
+#define DANUBE_MBC_MBC_ITMP1_ITMP
+
+/***Mailbox CPU Input Temporary Pointer of Buffer 2***/
+#define DANUBE_MBC_MBC_ITMP2                    ((volatile u32*)(DANUBE_MBC+ 0x0054))
+#define DANUBE_MBC_MBC_ITMP2_ITMP
+
+/***Mailbox CPU Input Temporary Pointer of Buffer 3***/
+#define DANUBE_MBC_MBC_ITMP3                    ((volatile u32*)(DANUBE_MBC+ 0x0074))
+#define DANUBE_MBC_MBC_ITMP3_ITMP
+
+/***Mailbox CPU Output Absolute Pointer of Buffer 0***/
+#define DANUBE_MBC_MBC_OABS0                    ((volatile u32*)(DANUBE_MBC+ 0x0018))
+#define DANUBE_MBC_MBC_OABS0_OABS
+
+/***Mailbox CPU Output Absolute Pointer of Buffer 1***/
+#define DANUBE_MBC_MBC_OABS1                    ((volatile u32*)(DANUBE_MBC+ 0x0038))
+#define DANUBE_MBC_MBC_OABS1_OABS
+
+/***Mailbox CPU Output Absolute Pointer of Buffer 2***/
+#define DANUBE_MBC_MBC_OABS2                    ((volatile u32*)(DANUBE_MBC+ 0x0058))
+#define DANUBE_MBC_MBC_OABS2_OABS
+
+/***Mailbox CPU Output Absolute Pointer of Buffer 3***/
+#define DANUBE_MBC_MBC_OABS3                    ((volatile u32*)(DANUBE_MBC+ 0x0078))
+#define DANUBE_MBC_MBC_OABS3_OABS
+
+/***Mailbox CPU Output Temporary Pointer of Buffer 0***/
+#define DANUBE_MBC_MBC_OTMP0                    ((volatile u32*)(DANUBE_MBC+ 0x001C))
+#define DANUBE_MBC_MBC_OTMP0_OTMP
+
+/***Mailbox CPU Output Temporary Pointer of Buffer 1***/
+#define DANUBE_MBC_MBC_OTMP1                    ((volatile u32*)(DANUBE_MBC+ 0x003C))
+#define DANUBE_MBC_MBC_OTMP1_OTMP
+
+/***Mailbox CPU Output Temporary Pointer of Buffer 2***/
+#define DANUBE_MBC_MBC_OTMP2                    ((volatile u32*)(DANUBE_MBC+ 0x005C))
+#define DANUBE_MBC_MBC_OTMP2_OTMP
+
+/***Mailbox CPU Output Temporary Pointer of Buffer 3***/
+#define DANUBE_MBC_MBC_OTMP3                    ((volatile u32*)(DANUBE_MBC+ 0x007C))
+#define DANUBE_MBC_MBC_OTMP3_OTMP
+
+/***DSP Control Register***/
+#define DANUBE_MBC_DCTRL                        ((volatile u32*)(DANUBE_MBC+ 0x00A0))
+#define DANUBE_MBC_DCTRL_BA                              (1 << 0)
+#define DANUBE_MBC_DCTRL_BMOD (value)               (((( 1 << 3) - 1) & (value)) << 1)
+#define DANUBE_MBC_DCTRL_IDL                              (1 << 4)
+#define DANUBE_MBC_DCTRL_RES                              (1 << 15)
+
+/***DSP Status Register***/
+#define DANUBE_MBC_DSTA                         ((volatile u32*)(DANUBE_MBC+ 0x00A4))
+#define DANUBE_MBC_DSTA_IDLE                            (1 << 0)
+#define DANUBE_MBC_DSTA_PD                              (1 << 1)
+
+/***DSP Test 1 Register***/
+#define DANUBE_MBC_DTST1                        ((volatile u32*)(DANUBE_MBC+ 0x00A8))
+#define DANUBE_MBC_DTST1_ABORT                          (1 << 0)
+#define DANUBE_MBC_DTST1_HWF32                          (1 << 1)
+#define DANUBE_MBC_DTST1_HWF4M                          (1 << 2)
+#define DANUBE_MBC_DTST1_HWFOP                          (1 << 3)
+
+
+/***********************************************************************/
+/*  Module      :  SSC1 register address and bits                      */
+/***********************************************************************/
+#define DANUBE_SSC1                       	(KSEG1+0x1e100800) 
+/***********************************************************************/
+/***SSC Clock Control Register***/
+#define DANUBE_SSC_CLC                      	(0x0000)
+#define DANUBE_SSC_CLC_RMC(value)               (((( 1 << 8) - 1) & (value)) << 8)
+#define DANUBE_SSC_CLC_DISS                     (1 << 1)
+#define DANUBE_SSC_CLC_DISR                     (1 << 0)
+/***SSC Port Input Selection Register***/
+#define DANUBE_SSC_PISEL                        (0x0004)
+/***SSC Identification Register***/
+#define DANUBE_SSC_ID                           (0x0008)
+/***Control Register (Programming Mode)***/
+#define DANUBE_SSC_CON                  		(0x0010)
+#define DANUBE_SSC_CON_RUEN                            (1 << 12)
+#define DANUBE_SSC_CON_TUEN                              (1 << 11)
+#define DANUBE_SSC_CON_AEN                              (1 << 10)
+#define DANUBE_SSC_CON_REN                              (1 << 9)
+#define DANUBE_SSC_CON_TEN                              (1 << 8)
+#define DANUBE_SSC_CON_LB                              (1 << 7)
+#define DANUBE_SSC_CON_PO                              (1 << 6)
+#define DANUBE_SSC_CON_PH                              (1 << 5)
+#define DANUBE_SSC_CON_HB                              (1 << 4)
+#define DANUBE_SSC_CON_BM(value)                	(((( 1 << 5) - 1) & (value)) << 16)
+#define DANUBE_SSC_CON_RX_OFF                          (1 << 1)
+#define DANUBE_SSC_CON_TX_OFF                          (1 << 0)
+/***SCC Status Register***/
+#define DANUBE_SSC_STATE                  (0x0014)
+#define DANUBE_SSC_STATE_EN                              (1 << 0)
+#define DANUBE_SSC_STATE_MS                              (1 << 1)
+#define DANUBE_SSC_STATE_BSY                              (1 << 13)
+#define DANUBE_SSC_STATE_RUE                              (1 << 12)
+#define DANUBE_SSC_STATE_TUE                              (1 << 11)
+#define DANUBE_SSC_STATE_AE                              (1 << 10)
+#define DANUBE_SSC_STATE_RE                              (1 << 9)
+#define DANUBE_SSC_STATE_TE                              (1 << 8)
+#define DANUBE_SSC_STATE_BC(value)                (((( 1 << 5) - 1) & (value)) << 16)
+/***SSC Write Hardware Modified Control Register***/
+#define DANUBE_SSC_WHBSTATE                   ( 0x0018)
+#define DANUBE_SSC_WHBSTATE_SETBE                          (1 << 15)
+#define DANUBE_SSC_WHBSTATE_SETPE                          (1 << 14)
+#define DANUBE_SSC_WHBSTATE_SETRE                          (1 << 13)
+#define DANUBE_SSC_WHBSTATE_SETTE                          (1 << 12)
+#define DANUBE_SSC_WHBSTATE_CLRBE                          (1 << 11)
+#define DANUBE_SSC_WHBSTATE_CLRPE                          (1 << 10)
+#define DANUBE_SSC_WHBSTATE_CLRRE                          (1 << 9)
+#define DANUBE_SSC_WHBSTATE_CLRTE                          (1 << 8)
+/***SSC Transmitter Buffer Register***/
+#define DANUBE_SSC_TB                       (0x0020)
+#define DANUBE_SSC_TB_TB_VALUE(value)          (((( 1 << 16) - 1) & (value)) << 0)
+/***SSC Receiver Buffer Register***/
+#define DANUBE_SSC_RB                       (0x0024)
+#define DANUBE_SSC_RB_RB_VALUE(value)          (((( 1 << 16) - 1) & (value)) << 0)
+/***SSC Receive FIFO Control Register***/
+#define DANUBE_SSC_RXFCON                   (0x0030)
+#define DANUBE_SSC_RXFCON_RXFITL(value)             (((( 1 << 6) - 1) & (value)) << 8)
+#define DANUBE_SSC_RXFCON_RXTMEN                        (1 << 2)
+#define DANUBE_SSC_RXFCON_RXFLU                          (1 << 1)
+#define DANUBE_SSC_RXFCON_RXFEN                          (1 << 0)
+/***SSC Transmit FIFO Control Register***/
+#define DANUBE_SSC_TXFCON                   ( 0x0034)
+#define DANUBE_SSC_TXFCON_RXFITL(value)             (((( 1 << 6) - 1) & (value)) << 8)
+#define DANUBE_SSC_TXFCON_TXTMEN                        (1 << 2)
+#define DANUBE_SSC_TXFCON_TXFLU                          (1 << 1)
+#define DANUBE_SSC_TXFCON_TXFEN                          (1 << 0)
+/***SSC FIFO Status Register***/
+#define DANUBE_SSC_FSTAT                    (0x0038)
+#define DANUBE_SSC_FSTAT_TXFFL(value)              (((( 1 << 6) - 1) & (value)) << 8)
+#define DANUBE_SSC_FSTAT_RXFFL(value)              (((( 1 << 6) - 1) & (value)) << 0)
+/***SSC Baudrate Timer Reload Register***/
+#define DANUBE_SSC_BR                       (0x0040)
+#define DANUBE_SSC_BR_BR_VALUE(value)          (((( 1 << 16) - 1) & (value)) << 0)
+#define DANUBE_SSC_BRSTAT                       (0x0044)
+#define DANUBE_SSC_SFCON                        (0x0060)
+#define DANUBE_SSC_SFSTAT                       (0x0064)
+#define DANUBE_SSC_GPOCON                       (0x0070)
+#define DANUBE_SSC_GPOSTAT                      (0x0074)
+#define DANUBE_SSC_WHBGPOSTAT                   (0x0078)
+#define DANUBE_SSC_RXREQ                        (0x0080)
+#define DANUBE_SSC_RXCNT                        (0x0084) 
+/*DMA Registers in Bus Clock Domain*/ 
+#define DANUBE_SSC_DMA_CON                      (0x00EC)
+/*interrupt Node Registers in Bus Clock Domain*/
+#define DANUBE_SSC_IRNEN                        (0x00F4)
+#define DANUBE_SSC_IRNCR                        (0x00F8)
+#define DANUBE_SSC_IRNICR                       (0x00FC)
+#define DANUBE_SSC_IRN_FIR			0x8
+#define DANUBE_SSC_IRN_EIR			0x4
+#define DANUBE_SSC_IRN_RIR			0x2
+#define DANUBE_SSC_IRN_TIR			0x1
+
+
+#define	DANUBE_SSC1_CLC			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_CLC))
+#define	DANUBE_SSC1_ID			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_ID))
+#define	DANUBE_SSC1_CON			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_CON))
+#define	DANUBE_SSC1_STATE			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_STATE))
+#define	DANUBE_SSC1_WHBSTATE			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_WHBSTATE))
+#define	DANUBE_SSC1_TB			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_TB))
+#define	DANUBE_SSC1_RB			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_RB))
+#define	DANUBE_SSC1_FSTAT			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_FSTAT))
+#define	DANUBE_SSC1_PISEL			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_PISEL))
+#define	DANUBE_SSC1_RXFCON			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_RXFCON))
+#define	DANUBE_SSC1_TXFCON			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_TXFCON))
+#define	DANUBE_SSC1_BR			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_BR))
+#define	DANUBE_SSC1_BRSTAT			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_BRSTAT))
+#define	DANUBE_SSC1_SFCON			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_SFCON))
+#define	DANUBE_SSC1_SFSTAT			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_SFSTAT))
+#define	DANUBE_SSC1_GPOCON			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_GPOCON))
+#define	DANUBE_SSC1_GPOSTAT			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_GPOSTAT))
+#define	DANUBE_SSC1_WHBGPOSTAT			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_WHBGPOSTAT))
+#define	DANUBE_SSC1_RXREQ			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_RXREQ))
+#define	DANUBE_SSC1_RXCNT			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_RXCNT))
+#define	DANUBE_SSC1_DMA_CON			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_DMA_CON))
+#define	DANUBE_SSC1_IRNEN			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_IRNEN))
+#define	DANUBE_SSC1_IRNICR			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_IRNICR))
+#define	DANUBE_SSC1_IRNCR			((volatile u32*)(DANUBE_SSC1+DANUBE_SSC_IRNCR))
+
+/***********************************************************************/
+/*  Module      :  GPIO register address and bits                       */
+/***********************************************************************/
+#define DANUBE_GPIO                     (0xBE100B00)
+/***Port 0 Data Output Register (0010H)***/
+#define DANUBE_GPIO_P0_OUT              ((volatile u32 *)(DANUBE_GPIO+ 0x0010))
+/***Port 1 Data Output Register (0040H)***/
+#define DANUBE_GPIO_P1_OUT              ((volatile u32 *)(DANUBE_GPIO+ 0x0040))
+/***Port 0 Data Input Register (0014H)***/
+#define DANUBE_GPIO_P0_IN               ((volatile u32 *)(DANUBE_GPIO+ 0x0014))
+/***Port 1 Data Input Register (0044H)***/
+#define DANUBE_GPIO_P1_IN               ((volatile u32 *)(DANUBE_GPIO+ 0x0044))
+/***Port 0 Direction Register (0018H)***/
+#define DANUBE_GPIO_P0_DIR              ((volatile u32 *)(DANUBE_GPIO+ 0x0018))
+/***Port 1 Direction Register (0048H)***/
+#define DANUBE_GPIO_P1_DIR              ((volatile u32 *)(DANUBE_GPIO+ 0x0048))
+/***Port 0 Alternate Function Select Register 0 (001C H) ***/
+#define DANUBE_GPIO_P0_ALTSEL0          ((volatile u32 *)(DANUBE_GPIO+ 0x001C))
+/***Port 1 Alternate Function Select Register 0 (004C H) ***/
+#define DANUBE_GPIO_P1_ALTSEL0          ((volatile u32 *)(DANUBE_GPIO+ 0x004C))
+/***Port 0 Alternate Function Select Register 1 (0020 H) ***/
+#define DANUBE_GPIO_P0_ALTSEL1          ((volatile u32 *)(DANUBE_GPIO+ 0x0020))
+/***Port 1 Alternate Function Select Register 0 (0050 H) ***/
+#define DANUBE_GPIO_P1_ALTSEL1          ((volatile u32 *)(DANUBE_GPIO+ 0x0050))
+/***Port 0 Open Drain Control Register (0024H)***/
+#define DANUBE_GPIO_P0_OD               ((volatile u32 *)(DANUBE_GPIO+ 0x0024))
+/***Port 1 Open Drain Control Register (0054H)***/
+#define DANUBE_GPIO_P1_OD               ((volatile u32 *)(DANUBE_GPIO+ 0x0054))
+/***Port 0 Input Schmitt-Trigger Off Register (0028 H) ***/
+#define DANUBE_GPIO_P0_STOFF            ((volatile u32 *)(DANUBE_GPIO+ 0x0028))
+/***Port 1 Input Schmitt-Trigger Off Register (0058 H) ***/
+#define DANUBE_GPIO_P1_STOFF            ((volatile u32 *)(DANUBE_GPIO+ 0x0058))
+/***Port 0 Pull Up/Pull Down Select Register (002C H)***/
+#define DANUBE_GPIO_P0_PUDSEL           ((volatile u32 *)(DANUBE_GPIO+ 0x002C))
+/***Port 1 Pull Up/Pull Down Select Register (005C H)***/
+#define DANUBE_GPIO_P1_PUDSEL           ((volatile u32 *)(DANUBE_GPIO+ 0x005C))
+/***Port 0 Pull Up Device Enable Register (0030 H)***/
+#define DANUBE_GPIO_P0_PUDEN            ((volatile u32 *)(DANUBE_GPIO+ 0x0030))
+/***Port 1 Pull Up Device Enable Register (0060 H)***/
+#define DANUBE_GPIO_P1_PUDEN            ((volatile u32 *)(DANUBE_GPIO+ 0x0060))
+/***********************************************************************/
+/*  Module      :  CGU register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_CGU                          (0xBF103000)
+/***********************************************************************/
+
+/***CGU Clock PLL0 ***/
+#define DANUBE_CGU_PLL0_CFG                	((volatile u32*)(DANUBE_CGU+ 0x0004))
+/***CGU Clock PLL1 ***/
+#define DANUBE_CGU_PLL1_CFG                	((volatile u32*)(DANUBE_CGU+ 0x0008))
+/***CGU Clock SYS Mux Register***/
+#define DANUBE_CGU_SYS                   	((volatile u32*)(DANUBE_CGU+ 0x0010))
+/***CGU Interface Clock Control Register***/
+#define DANUBE_CGU_IFCCR                        ((volatile u32*)(DANUBE_CGU+ 0x0018))
+/***CGU PCI Clock Control Register**/
+#define DANUBE_CGU_PCICR                          ((volatile u32*)(DANUBE_CGU+ 0x0034))
+
+
+/***********************************************************************/
+/*  Module      :  PCI register address and bits                       */
+/***********************************************************************/
+#define PCI_CR_PR_OFFSET  0xBE105400
+#define PCI_CR_CLK_CTRL_REG         (PCI_CR_PR_OFFSET + 0x0000)
+
+#define PCI_CR_PCI_ID_REG           (PCI_CR_PR_OFFSET + 0x0004)
+#define PCI_CR_SFT_RST_REG          (PCI_CR_PR_OFFSET + 0x0010)
+#define PCI_CR_PCI_FPI_ERR_ADDR_REG (PCI_CR_PR_OFFSET + 0x0014)
+#define PCI_CR_FCI_PCI_ERR_ADDR_REG (PCI_CR_PR_OFFSET + 0x0018)
+#define PCI_CR_FPI_ERR_TAG_REG      (PCI_CR_PR_OFFSET + 0x001C)
+#define PCI_CR_PCI_IRR_REG          (PCI_CR_PR_OFFSET + 0x0020)
+#define PCI_CR_PCI_IRA_REG          (PCI_CR_PR_OFFSET + 0x0024)
+#define PCI_CR_PCI_IRM_REG          (PCI_CR_PR_OFFSET + 0x0028)
+#define PCI_CR_PCI_EOI_REG          (PCI_CR_PR_OFFSET + 0x002C)
+#define PCI_CR_PCI_MOD_REG          (PCI_CR_PR_OFFSET + 0x0030)
+#define PCI_CR_DV_ID_REG            (PCI_CR_PR_OFFSET + 0x0034)
+#define PCI_CR_SUBSYS_ID_REG        (PCI_CR_PR_OFFSET + 0x0038)
+#define PCI_CR_PCI_PM_REG           (PCI_CR_PR_OFFSET + 0x003C)
+#define PCI_CR_CLASS_CODE1_REG      (PCI_CR_PR_OFFSET + 0x0040)
+#define PCI_CR_BAR11MASK_REG        (PCI_CR_PR_OFFSET + 0x0044)
+#define PCI_CR_BAR12MASK_REG        (PCI_CR_PR_OFFSET + 0x0048)
+#define PCI_CR_BAR13MASK_REG        (PCI_CR_PR_OFFSET + 0x004C)
+#define PCI_CR_BAR14MASK_REG        (PCI_CR_PR_OFFSET + 0x0050)
+#define PCI_CR_BAR15MASK_REG        (PCI_CR_PR_OFFSET + 0x0054)
+#define PCI_CR_BAR16MASK_REG        (PCI_CR_PR_OFFSET + 0x0058)
+#define PCI_CR_CIS_PT1_REG          (PCI_CR_PR_OFFSET + 0x005C)
+#define PCI_CR_SUBSYS_ID1_REG       (PCI_CR_PR_OFFSET + 0x0060)
+#define PCI_CR_PCI_ADDR_MAP11_REG   (PCI_CR_PR_OFFSET + 0x0064)
+#define PCI_CR_PCI_ADDR_MAP12_REG   (PCI_CR_PR_OFFSET + 0x0068)
+#define PCI_CR_PCI_ADDR_MAP13_REG   (PCI_CR_PR_OFFSET + 0x006C)
+#define PCI_CR_PCI_ADDR_MAP14_REG   (PCI_CR_PR_OFFSET + 0x0070)
+#define PCI_CR_PCI_ADDR_MAP15_REG   (PCI_CR_PR_OFFSET + 0x0074)
+#define PCI_CR_PCI_ADDR_MAP16_REG   (PCI_CR_PR_OFFSET + 0x0078)
+#define PCI_CR_FPI_SEG_EN_REG       (PCI_CR_PR_OFFSET + 0x007C)
+#define PCI_CR_PC_ARB_REG           (PCI_CR_PR_OFFSET + 0x0080)
+#define PCI_CR_BAR21MASK_REG        (PCI_CR_PR_OFFSET + 0x0084)
+#define PCI_CR_BAR22MASK_REG        (PCI_CR_PR_OFFSET + 0x0088)
+#define PCI_CR_BAR23MASK_REG        (PCI_CR_PR_OFFSET + 0x008C)
+#define PCI_CR_BAR24MASK_REG        (PCI_CR_PR_OFFSET + 0x0090)
+#define PCI_CR_BAR25MASK_REG        (PCI_CR_PR_OFFSET + 0x0094)
+#define PCI_CR_BAR26MASK_REG        (PCI_CR_PR_OFFSET + 0x0098)
+#define PCI_CR_CIS_PT2_REG          (PCI_CR_PR_OFFSET + 0x009C)
+#define PCI_CR_SUBSYS_ID2_REG       (PCI_CR_PR_OFFSET + 0x00A0)
+#define PCI_CR_PCI_ADDR_MAP21_REG   (PCI_CR_PR_OFFSET + 0x00A4)
+#define PCI_CR_PCI_ADDR_MAP22_REG   (PCI_CR_PR_OFFSET + 0x00A8)
+#define PCI_CR_PCI_ADDR_MAP23_REG   (PCI_CR_PR_OFFSET + 0x00AC)
+
+
+/***********************************************************************/
+/*  Module      :  MCD register address and bits                       */
+/***********************************************************************/
+#define DANUBE_MCD                          		(KSEG1+0x1F106000)
+
+/***Manufacturer Identification Register***/ 
+#define DANUBE_MCD_MANID                        	((volatile u32*)(DANUBE_MCD+ 0x0024))
+#define DANUBE_MCD_MANID_MANUF(value)              	(((( 1 << 11) - 1) & (value)) << 5)
+
+/***Chip Identification Register***/ 
+#define DANUBE_MCD_CHIPID                       	((volatile u32*)(DANUBE_MCD+ 0x0028))
+#define DANUBE_MCD_CHIPID_VERSION_GET(value)             (((value) >> 28) & ((1 << 4) - 1))
+#define DANUBE_MCD_CHIPID_VERSION_SET(value)             (((( 1 << 4) - 1) & (value)) << 28)
+#define DANUBE_MCD_CHIPID_PART_NUMBER_GET(value)         (((value) >> 12) & ((1 << 16) - 1))
+#define DANUBE_MCD_CHIPID_PART_NUMBER_SET(value)         (((( 1 << 16) - 1) & (value)) << 12)
+#define DANUBE_MCD_CHIPID_MANID_GET(value)               (((value) >> 1) & ((1 << 11) - 1))
+#define DANUBE_MCD_CHIPID_MANID_SET(value)               (((( 1 << 11) - 1) & (value)) << 1)
+
+#define DANUBE_CHIPID_STANDARD				0x00EB
+#define DANUBE_CHIPID_YANGTSE				0x00ED
+
+/***Redesign Tracing Identification Register***/ 
+#define DANUBE_MCD_RTID                         	((volatile u32*)(DANUBE_MCD+ 0x002C))
+#define DANUBE_MCD_RTID_LC                              (1 << 15)
+#define DANUBE_MCD_RTID_RIX(value)                	(((( 1 << 3) - 1) & (value)) << 0)
+
+	         
+/***********************************************************************/
+/*  Module      :  EBU register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_EBU                          (0xBE105300)
+#define EBU_ADDR_SEL_0     (volatile u32*)(DANUBE_EBU + 0x20)
+#define EBU_ADDR_SEL_1     (volatile u32*)(DANUBE_EBU + 0x24)
+#define EBU_CON_0          (volatile u32*)(DANUBE_EBU + 0x60)
+#define EBU_CON_1          (volatile u32*)(DANUBE_EBU + 0x64)
+#define EBU_NAND_CON       (volatile u32*)(DANUBE_EBU + 0xB0)
+#define EBU_NAND_WAIT      (volatile u32*)(DANUBE_EBU + 0xB4)
+#define EBU_NAND_ECC0      (volatile u32*)(DANUBE_EBU + 0xB8)
+#define EBU_NAND_ECC_AC    (volatile u32*)(DANUBE_EBU + 0xBC)
+
+/***********************************************************************/
+
+
+/***EBU Clock Control Register***/
+#define DANUBE_EBU_CLC                      ((volatile u32*)(DANUBE_EBU+ 0x0000))
+#define DANUBE_EBU_CLC_DISS                            (1 << 1)
+#define DANUBE_EBU_CLC_DISR                            (1 << 0)
+
+/***EBU Global Control Register***/
+#define DANUBE_EBU_CON                      ((volatile u32*)(DANUBE_EBU+ 0x0010))
+#define DANUBE_EBU_CON_DTACS (value)              (((( 1 << 3) - 1) & (value)) << 20)
+#define DANUBE_EBU_CON_DTARW (value)              (((( 1 << 3) - 1) & (value)) << 16)
+#define DANUBE_EBU_CON_TOUTC (value)              (((( 1 << 8) - 1) & (value)) << 8)
+#define DANUBE_EBU_CON_ARBMODE (value)            (((( 1 << 2) - 1) & (value)) << 6)
+#define DANUBE_EBU_CON_ARBSYNC                      (1 << 5)
+#define DANUBE_EBU_CON_1                              (1 << 3)
+
+/***EBU Address Select Register 0***/
+#define DANUBE_EBU_ADDSEL0                  ((volatile u32*)(DANUBE_EBU+ 0x0020))
+#define DANUBE_EBU_ADDSEL0_BASE (value)               (((( 1 << 20) - 1) & (value)) << 12)
+#define DANUBE_EBU_ADDSEL0_MASK (value)               (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_EBU_ADDSEL0_MIRRORE                      (1 << 1)
+#define DANUBE_EBU_ADDSEL0_REGEN                          (1 << 0)
+
+/***EBU Address Select Register 1***/
+#define DANUBE_EBU_ADDSEL1                  ((volatile u32*)(DANUBE_EBU+ 0x0024))
+#define DANUBE_EBU_ADDSEL1_BASE (value)               (((( 1 << 20) - 1) & (value)) << 12)
+#define DANUBE_EBU_ADDSEL1_MASK (value)               (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_EBU_ADDSEL1_MIRRORE                      (1 << 1)
+#define DANUBE_EBU_ADDSEL1_REGEN                          (1 << 0)
+
+/***EBU Address Select Register 2***/
+#define DANUBE_EBU_ADDSEL2                  ((volatile u32*)(DANUBE_EBU+ 0x0028))
+#define DANUBE_EBU_ADDSEL2_BASE (value)               (((( 1 << 20) - 1) & (value)) << 12)
+#define DANUBE_EBU_ADDSEL2_MASK (value)               (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_EBU_ADDSEL2_MIRRORE                      (1 << 1)
+#define DANUBE_EBU_ADDSEL2_REGEN                          (1 << 0)
+
+/***EBU Address Select Register 3***/
+#define DANUBE_EBU_ADDSEL3                  ((volatile u32*)(DANUBE_EBU+ 0x0028))
+#define DANUBE_EBU_ADDSEL3_BASE (value)               (((( 1 << 20) - 1) & (value)) << 12)
+#define DANUBE_EBU_ADDSEL3_MASK (value)               (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_EBU_ADDSEL3_MIRRORE                      (1 << 1)
+#define DANUBE_EBU_ADDSEL3_REGEN                          (1 << 0)
+
+/***EBU Bus Configuration Register 0***/
+#define DANUBE_EBU_BUSCON0                  ((volatile u32*)(DANUBE_EBU+ 0x0060))
+#define DANUBE_EBU_BUSCON0_WRDIS                          (1 << 31)
+#define DANUBE_EBU_BUSCON0_ALEC (value)               (((( 1 << 2) - 1) & (value)) << 29)
+#define DANUBE_EBU_BUSCON0_BCGEN (value)              (((( 1 << 2) - 1) & (value)) << 27)
+#define DANUBE_EBU_BUSCON0_AGEN (value)               (((( 1 << 2) - 1) & (value)) << 24)
+#define DANUBE_EBU_BUSCON0_CMULTR (value)             (((( 1 << 2) - 1) & (value)) << 22)
+#define DANUBE_EBU_BUSCON0_WAIT (value)               (((( 1 << 2) - 1) & (value)) << 20)
+#define DANUBE_EBU_BUSCON0_WAITINV                      (1 << 19)
+#define DANUBE_EBU_BUSCON0_SETUP                          (1 << 18)
+#define DANUBE_EBU_BUSCON0_PORTW (value)              (((( 1 << 2) - 1) & (value)) << 16)
+#define DANUBE_EBU_BUSCON0_WAITRDC (value)            (((( 1 << 7) - 1) & (value)) << 9)
+#define DANUBE_EBU_BUSCON0_WAITWRC (value)            (((( 1 << 3) - 1) & (value)) << 6)
+#define DANUBE_EBU_BUSCON0_HOLDC (value)              (((( 1 << 2) - 1) & (value)) << 4)
+#define DANUBE_EBU_BUSCON0_RECOVC (value)             (((( 1 << 2) - 1) & (value)) << 2)
+#define DANUBE_EBU_BUSCON0_CMULT (value)              (((( 1 << 2) - 1) & (value)) << 0)
+
+/***EBU Bus Configuration Register 1***/
+#define DANUBE_EBU_BUSCON1                  ((volatile u32*)(DANUBE_EBU+ 0x0064))
+#define DANUBE_EBU_BUSCON1_WRDIS                          (1 << 31)
+#define DANUBE_EBU_BUSCON1_ALEC (value)               (((( 1 << 2) - 1) & (value)) << 29)
+#define DANUBE_EBU_BUSCON1_BCGEN (value)              (((( 1 << 2) - 1) & (value)) << 27)
+#define DANUBE_EBU_BUSCON1_AGEN (value)               (((( 1 << 2) - 1) & (value)) << 24)
+#define DANUBE_EBU_BUSCON1_CMULTR (value)             (((( 1 << 2) - 1) & (value)) << 22)
+#define DANUBE_EBU_BUSCON1_WAIT (value)               (((( 1 << 2) - 1) & (value)) << 20)
+#define DANUBE_EBU_BUSCON1_WAITINV                      (1 << 19)
+#define DANUBE_EBU_BUSCON1_SETUP                          (1 << 18)
+#define DANUBE_EBU_BUSCON1_PORTW (value)              (((( 1 << 2) - 1) & (value)) << 16)
+#define DANUBE_EBU_BUSCON1_WAITRDC (value)            (((( 1 << 7) - 1) & (value)) << 9)
+#define DANUBE_EBU_BUSCON1_WAITWRC (value)            (((( 1 << 3) - 1) & (value)) << 6)
+#define DANUBE_EBU_BUSCON1_HOLDC (value)              (((( 1 << 2) - 1) & (value)) << 4)
+#define DANUBE_EBU_BUSCON1_RECOVC (value)             (((( 1 << 2) - 1) & (value)) << 2)
+#define DANUBE_EBU_BUSCON1_CMULT (value)              (((( 1 << 2) - 1) & (value)) << 0)
+
+/***EBU Bus Configuration Register 2***/
+#define DANUBE_EBU_BUSCON2                  ((volatile u32*)(DANUBE_EBU+ 0x0068))
+#define DANUBE_EBU_BUSCON2_WRDIS                          (1 << 31)
+#define DANUBE_EBU_BUSCON2_ALEC (value)               (((( 1 << 2) - 1) & (value)) << 29)
+#define DANUBE_EBU_BUSCON2_BCGEN (value)              (((( 1 << 2) - 1) & (value)) << 27)
+#define DANUBE_EBU_BUSCON2_AGEN (value)               (((( 1 << 2) - 1) & (value)) << 24)
+#define DANUBE_EBU_BUSCON2_CMULTR (value)             (((( 1 << 2) - 1) & (value)) << 22)
+#define DANUBE_EBU_BUSCON2_WAIT (value)               (((( 1 << 2) - 1) & (value)) << 20)
+#define DANUBE_EBU_BUSCON2_WAITINV                      (1 << 19)
+#define DANUBE_EBU_BUSCON2_SETUP                          (1 << 18)
+#define DANUBE_EBU_BUSCON2_PORTW (value)              (((( 1 << 2) - 1) & (value)) << 16)
+#define DANUBE_EBU_BUSCON2_WAITRDC (value)            (((( 1 << 7) - 1) & (value)) << 9)
+#define DANUBE_EBU_BUSCON2_WAITWRC (value)            (((( 1 << 3) - 1) & (value)) << 6)
+#define DANUBE_EBU_BUSCON2_HOLDC (value)              (((( 1 << 2) - 1) & (value)) << 4)
+#define DANUBE_EBU_BUSCON2_RECOVC (value)             (((( 1 << 2) - 1) & (value)) << 2)
+#define DANUBE_EBU_BUSCON2_CMULT (value)              (((( 1 << 2) - 1) & (value)) << 0)
+
+/***********************************************************************/
+/*  Module      :  SDRAM register address and bits                     */
+/***********************************************************************/
+
+#define DANUBE_SDRAM                        (0xBF800000)
+/***********************************************************************/
+
+
+/***MC Access Error Cause Register***/
+#define DANUBE_SDRAM_MC_ERRCAUSE                  ((volatile u32*)(DANUBE_SDRAM+ 0x0100))
+#define DANUBE_SDRAM_MC_ERRCAUSE_ERR                              (1 << 31)
+#define DANUBE_SDRAM_MC_ERRCAUSE_PORT (value)               (((( 1 << 4) - 1) & (value)) << 16)
+#define DANUBE_SDRAM_MC_ERRCAUSE_CAUSE (value)              (((( 1 << 2) - 1) & (value)) << 0)
+#define DANUBE_SDRAM_MC_ERRCAUSE_Res (value)                (((( 1 << NaN) - 1) & (value)) << NaN)
+
+/***MC Access Error Address Register***/
+#define DANUBE_SDRAM_MC_ERRADDR                   ((volatile u32*)(DANUBE_SDRAM+ 0x0108))
+#define DANUBE_SDRAM_MC_ERRADDR_ADDR
+
+/***MC I/O General Purpose Register***/
+#define DANUBE_SDRAM_MC_IOGP                      ((volatile u32*)(DANUBE_SDRAM+ 0x0800))
+#define DANUBE_SDRAM_MC_IOGP_GPR6 (value)               (((( 1 << 4) - 1) & (value)) << 28)
+#define DANUBE_SDRAM_MC_IOGP_GPR5 (value)               (((( 1 << 4) - 1) & (value)) << 24)
+#define DANUBE_SDRAM_MC_IOGP_GPR4 (value)               (((( 1 << 4) - 1) & (value)) << 20)
+#define DANUBE_SDRAM_MC_IOGP_GPR3 (value)               (((( 1 << 4) - 1) & (value)) << 16)
+#define DANUBE_SDRAM_MC_IOGP_GPR2 (value)               (((( 1 << 4) - 1) & (value)) << 12)
+#define DANUBE_SDRAM_MC_IOGP_CPS                              (1 << 11)
+#define DANUBE_SDRAM_MC_IOGP_CLKDELAY (value)          (((( 1 << 3) - 1) & (value)) << 8)
+#define DANUBE_SDRAM_MC_IOGP_CLKRAT (value)             (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_SDRAM_MC_IOGP_RDDEL (value)              (((( 1 << 4) - 1) & (value)) << 0)
+
+/***MC Self Refresh Register***/
+#define DANUBE_SDRAM_MC_SELFRFSH                  ((volatile u32*)(DANUBE_SDRAM+ 0x0A00))
+#define DANUBE_SDRAM_MC_SELFRFSH_PWDS                            (1 << 1)
+#define DANUBE_SDRAM_MC_SELFRFSH_PWD                              (1 << 0)
+#define DANUBE_SDRAM_MC_SELFRFSH_Res (value)                (((( 1 << 30) - 1) & (value)) << 2)
+
+/***MC Enable Register***/
+#define DANUBE_SDRAM_MC_CTRLENA                   ((volatile u32*)(DANUBE_SDRAM+ 0x1000))
+#define DANUBE_SDRAM_MC_CTRLENA_ENA                              (1 << 0)
+#define DANUBE_SDRAM_MC_CTRLENA_Res (value)                (((( 1 << 31) - 1) & (value)) << 1)
+
+/***MC Mode Register Setup Code***/
+#define DANUBE_SDRAM_MC_MRSCODE                   ((volatile u32*)(DANUBE_SDRAM+ 0x1008))
+#define DANUBE_SDRAM_MC_MRSCODE_UMC (value)                (((( 1 << 5) - 1) & (value)) << 7)
+#define DANUBE_SDRAM_MC_MRSCODE_CL (value)                (((( 1 << 3) - 1) & (value)) << 4)
+#define DANUBE_SDRAM_MC_MRSCODE_WT                              (1 << 3)
+#define DANUBE_SDRAM_MC_MRSCODE_BL (value)                (((( 1 << 3) - 1) & (value)) << 0)
+
+/***MC Configuration Data-word Width Register***/
+#define DANUBE_SDRAM_MC_CFGDW                    ((volatile u32*)(DANUBE_SDRAM+ 0x1010))
+#define DANUBE_SDRAM_MC_CFGDW_DW (value)                (((( 1 << 4) - 1) & (value)) << 0)
+#define DANUBE_SDRAM_MC_CFGDW_Res (value)                (((( 1 << 28) - 1) & (value)) << 4)
+
+/***MC Configuration Physical Bank 0 Register***/
+#define DANUBE_SDRAM_MC_CFGPB0                    ((volatile u32*)(DANUBE_SDRAM+ 0x1018))
+#define DANUBE_SDRAM_MC_CFGPB0_MCSEN0 (value)             (((( 1 << 4) - 1) & (value)) << 12)
+#define DANUBE_SDRAM_MC_CFGPB0_BANKN0 (value)             (((( 1 << 4) - 1) & (value)) << 8)
+#define DANUBE_SDRAM_MC_CFGPB0_ROWW0 (value)              (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_SDRAM_MC_CFGPB0_COLW0 (value)              (((( 1 << 4) - 1) & (value)) << 0)
+#define DANUBE_SDRAM_MC_CFGPB0_Res (value)                (((( 1 << 16) - 1) & (value)) << 16)
+
+/***MC Latency Register***/
+#define DANUBE_SDRAM_MC_LATENCY                   ((volatile u32*)(DANUBE_SDRAM+ 0x1038))
+#define DANUBE_SDRAM_MC_LATENCY_TRP (value)                (((( 1 << 4) - 1) & (value)) << 16)
+#define DANUBE_SDRAM_MC_LATENCY_TRAS (value)               (((( 1 << 4) - 1) & (value)) << 12)
+#define DANUBE_SDRAM_MC_LATENCY_TRCD (value)               (((( 1 << 4) - 1) & (value)) << 8)
+#define DANUBE_SDRAM_MC_LATENCY_TDPL (value)               (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_SDRAM_MC_LATENCY_TDAL (value)               (((( 1 << 4) - 1) & (value)) << 0)
+#define DANUBE_SDRAM_MC_LATENCY_Res (value)                (((( 1 << 12) - 1) & (value)) << 20)
+
+/***MC Refresh Cycle Time Register***/
+#define DANUBE_SDRAM_MC_TREFRESH                  ((volatile u32*)(DANUBE_SDRAM+ 0x1040))
+#define DANUBE_SDRAM_MC_TREFRESH_TREF (value)               (((( 1 << 13) - 1) & (value)) << 0)
+#define DANUBE_SDRAM_MC_TREFRESH_Res (value)                (((( 1 << 19) - 1) & (value)) << 13)
+
+
+/***********************************************************************/
+/*  Module      :  GPTU register address and bits                      */
+/***********************************************************************/
+
+#define DANUBE_GPTU                         (0xB8000300)
+/***********************************************************************/
+
+
+/***GPT Clock Control Register***/
+#define DANUBE_GPTU_GPT_CLC                      ((volatile u32*)(DANUBE_GPTU+ 0x0000))
+#define DANUBE_GPTU_GPT_CLC_RMC (value)                (((( 1 << 8) - 1) & (value)) << 8)
+#define DANUBE_GPTU_GPT_CLC_DISS                            (1 << 1)
+#define DANUBE_GPTU_GPT_CLC_DISR                            (1 << 0)
+
+/***GPT Timer 3 Control Register***/
+#define DANUBE_GPTU_GPT_T3CON                    ((volatile u32*)(DANUBE_GPTU+ 0x0014))
+#define DANUBE_GPTU_GPT_T3CON_T3RDIR                        (1 << 15)
+#define DANUBE_GPTU_GPT_T3CON_T3CHDIR                      (1 << 14)
+#define DANUBE_GPTU_GPT_T3CON_T3EDGE                        (1 << 13)
+#define DANUBE_GPTU_GPT_T3CON_BPS1 (value)               (((( 1 << 2) - 1) & (value)) << 11)
+#define DANUBE_GPTU_GPT_T3CON_T3OTL                          (1 << 10)
+#define DANUBE_GPTU_GPT_T3CON_T3UD                            (1 << 7)
+#define DANUBE_GPTU_GPT_T3CON_T3R                              (1 << 6)
+#define DANUBE_GPTU_GPT_T3CON_T3M (value)                (((( 1 << 3) - 1) & (value)) << 3)
+#define DANUBE_GPTU_GPT_T3CON_T3I (value)                (((( 1 << 3) - 1) & (value)) << 0)
+
+/***GPT Write Hardware Modified Timer 3 Control Register
+If set and clear bit are written concurrently with 1, the associated bit is not changed.***/
+#define DANUBE_GPTU_GPT_WHBT3CON                 ((volatile u32*)(DANUBE_GPTU+ 0x004C))
+#define DANUBE_GPTU_GPT_WHBT3CON_SETT3CHDIR                (1 << 15)
+#define DANUBE_GPTU_GPT_WHBT3CON_CLRT3CHDIR                (1 << 14)
+#define DANUBE_GPTU_GPT_WHBT3CON_SETT3EDGE                  (1 << 13)
+#define DANUBE_GPTU_GPT_WHBT3CON_CLRT3EDGE                  (1 << 12)
+#define DANUBE_GPTU_GPT_WHBT3CON_SETT3OTL                  (1 << 11)
+#define DANUBE_GPTU_GPT_WHBT3CON_CLRT3OTL                  (1 << 10)
+
+/***GPT Timer 2 Control Register***/
+#define DANUBE_GPTU_GPT_T2CON                    ((volatile u32*)(DANUBE_GPTU+ 0x0010))
+#define DANUBE_GPTU_GPT_T2CON_TxRDIR                        (1 << 15)
+#define DANUBE_GPTU_GPT_T2CON_TxCHDIR                      (1 << 14)
+#define DANUBE_GPTU_GPT_T2CON_TxEDGE                        (1 << 13)
+#define DANUBE_GPTU_GPT_T2CON_TxIRDIS                      (1 << 12)
+#define DANUBE_GPTU_GPT_T2CON_TxRC                            (1 << 9)
+#define DANUBE_GPTU_GPT_T2CON_TxUD                            (1 << 7)
+#define DANUBE_GPTU_GPT_T2CON_TxR                              (1 << 6)
+#define DANUBE_GPTU_GPT_T2CON_TxM (value)                (((( 1 << 3) - 1) & (value)) << 3)
+#define DANUBE_GPTU_GPT_T2CON_TxI (value)                (((( 1 << 3) - 1) & (value)) << 0)
+
+/***GPT Timer 4 Control Register***/
+#define DANUBE_GPTU_GPT_T4CON                    ((volatile u32*)(DANUBE_GPTU+ 0x0018))
+#define DANUBE_GPTU_GPT_T4CON_TxRDIR                        (1 << 15)
+#define DANUBE_GPTU_GPT_T4CON_TxCHDIR                      (1 << 14)
+#define DANUBE_GPTU_GPT_T4CON_TxEDGE                        (1 << 13)
+#define DANUBE_GPTU_GPT_T4CON_TxIRDIS                      (1 << 12)
+#define DANUBE_GPTU_GPT_T4CON_TxRC                            (1 << 9)
+#define DANUBE_GPTU_GPT_T4CON_TxUD                            (1 << 7)
+#define DANUBE_GPTU_GPT_T4CON_TxR                              (1 << 6)
+#define DANUBE_GPTU_GPT_T4CON_TxM (value)                (((( 1 << 3) - 1) & (value)) << 3)
+#define DANUBE_GPTU_GPT_T4CON_TxI (value)                (((( 1 << 3) - 1) & (value)) << 0)
+
+/***GPT Write HW Modified Timer 2 Control Register If set
+ and clear bit are written concurrently with 1, the associated bit is not changed.***/
+#define DANUBE_GPTU_GPT_WHBT2CON                 ((volatile u32*)(DANUBE_GPTU+ 0x0048))
+#define DANUBE_GPTU_GPT_WHBT2CON_SETTxCHDIR                (1 << 15)
+#define DANUBE_GPTU_GPT_WHBT2CON_CLRTxCHDIR                (1 << 14)
+#define DANUBE_GPTU_GPT_WHBT2CON_SETTxEDGE                  (1 << 13)
+#define DANUBE_GPTU_GPT_WHBT2CON_CLRTxEDGE                  (1 << 12)
+
+/***GPT Write HW Modified Timer 4 Control Register If set
+ and clear bit are written concurrently with 1, the associated bit is not changed.***/
+#define DANUBE_GPTU_GPT_WHBT4CON                 ((volatile u32*)(DANUBE_GPTU+ 0x0050))
+#define DANUBE_GPTU_GPT_WHBT4CON_SETTxCHDIR                (1 << 15)
+#define DANUBE_GPTU_GPT_WHBT4CON_CLRTxCHDIR                (1 << 14)
+#define DANUBE_GPTU_GPT_WHBT4CON_SETTxEDGE                  (1 << 13)
+#define DANUBE_GPTU_GPT_WHBT4CON_CLRTxEDGE                  (1 << 12)
+
+/***GPT Capture Reload Register***/
+#define DANUBE_GPTU_GPT_CAPREL                   ((volatile u32*)(DANUBE_GPTU+ 0x0030))
+#define DANUBE_GPTU_GPT_CAPREL_CAPREL (value)             (((( 1 << 16) - 1) & (value)) << 0)
+
+/***GPT Timer 2 Register***/
+#define DANUBE_GPTU_GPT_T2                       ((volatile u32*)(DANUBE_GPTU+ 0x0034))
+#define DANUBE_GPTU_GPT_T2_TVAL (value)               (((( 1 << 16) - 1) & (value)) << 0)
+
+/***GPT Timer 3 Register***/
+#define DANUBE_GPTU_GPT_T3                       ((volatile u32*)(DANUBE_GPTU+ 0x0038))
+#define DANUBE_GPTU_GPT_T3_TVAL (value)               (((( 1 << 16) - 1) & (value)) << 0)
+
+/***GPT Timer 4 Register***/
+#define DANUBE_GPTU_GPT_T4                       ((volatile u32*)(DANUBE_GPTU+ 0x003C))
+#define DANUBE_GPTU_GPT_T4_TVAL (value)               (((( 1 << 16) - 1) & (value)) << 0)
+
+/***GPT Timer 5 Register***/
+#define DANUBE_GPTU_GPT_T5                       ((volatile u32*)(DANUBE_GPTU+ 0x0040))
+#define DANUBE_GPTU_GPT_T5_TVAL (value)               (((( 1 << 16) - 1) & (value)) << 0)
+
+/***GPT Timer 6 Register***/
+#define DANUBE_GPTU_GPT_T6                       ((volatile u32*)(DANUBE_GPTU+ 0x0044))
+#define DANUBE_GPTU_GPT_T6_TVAL (value)               (((( 1 << 16) - 1) & (value)) << 0)
+
+/***GPT Timer 6 Control Register***/
+#define DANUBE_GPTU_GPT_T6CON                    ((volatile u32*)(DANUBE_GPTU+ 0x0020))
+#define DANUBE_GPTU_GPT_T6CON_T6SR                            (1 << 15)
+#define DANUBE_GPTU_GPT_T6CON_T6CLR                          (1 << 14)
+#define DANUBE_GPTU_GPT_T6CON_BPS2 (value)               (((( 1 << 2) - 1) & (value)) << 11)
+#define DANUBE_GPTU_GPT_T6CON_T6OTL                          (1 << 10)
+#define DANUBE_GPTU_GPT_T6CON_T6UD                            (1 << 7)
+#define DANUBE_GPTU_GPT_T6CON_T6R                              (1 << 6)
+#define DANUBE_GPTU_GPT_T6CON_T6M (value)                (((( 1 << 3) - 1) & (value)) << 3)
+#define DANUBE_GPTU_GPT_T6CON_T6I (value)                (((( 1 << 3) - 1) & (value)) << 0)
+
+/***GPT Write HW Modified Timer 6 Control Register If set
+ and clear bit are written concurrently with 1, the associated bit is not changed.***/
+#define DANUBE_GPTU_GPT_WHBT6CON                 ((volatile u32*)(DANUBE_GPTU+ 0x0054))
+#define DANUBE_GPTU_GPT_WHBT6CON_SETT6OTL                  (1 << 11)
+#define DANUBE_GPTU_GPT_WHBT6CON_CLRT6OTL                  (1 << 10)
+
+/***GPT Timer 5 Control Register***/
+#define DANUBE_GPTU_GPT_T5CON                    ((volatile u32*)(DANUBE_GPTU+ 0x001C))
+#define DANUBE_GPTU_GPT_T5CON_T5SC                            (1 << 15)
+#define DANUBE_GPTU_GPT_T5CON_T5CLR                          (1 << 14)
+#define DANUBE_GPTU_GPT_T5CON_CI (value)                (((( 1 << 2) - 1) & (value)) << 12)
+#define DANUBE_GPTU_GPT_T5CON_T5CC                            (1 << 11)
+#define DANUBE_GPTU_GPT_T5CON_CT3                              (1 << 10)
+#define DANUBE_GPTU_GPT_T5CON_T5RC                            (1 << 9)
+#define DANUBE_GPTU_GPT_T5CON_T5UDE                          (1 << 8)
+#define DANUBE_GPTU_GPT_T5CON_T5UD                            (1 << 7)
+#define DANUBE_GPTU_GPT_T5CON_T5R                              (1 << 6)
+#define DANUBE_GPTU_GPT_T5CON_T5M (value)                (((( 1 << 3) - 1) & (value)) << 3)
+#define DANUBE_GPTU_GPT_T5CON_T5I (value)                (((( 1 << 3) - 1) & (value)) << 0)
+
+
+/***********************************************************************/
+/*  Module      :  IOM register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_IOM                          (0xBF105000)
+/***********************************************************************/
+
+
+/***Receive FIFO***/
+#define DANUBE_IOM_RFIFO                        ((volatile u32*)(DANUBE_IOM+ 0x0000))
+#define DANUBE_IOM_RFIFO_RXD (value)                (((( 1 << 8) - 1) & (value)) << 0)
+
+/***Transmit FIFO***/
+#define DANUBE_IOM_XFIFO                        ((volatile u32*)(DANUBE_IOM+ 0x0000))
+#define DANUBE_IOM_XFIFO_TXD (value)                (((( 1 << 8) - 1) & (value)) << 0)
+
+/***Interrupt Status Register HDLC***/
+#define DANUBE_IOM_ISTAH                        ((volatile u32*)(DANUBE_IOM+ 0x0080))
+#define DANUBE_IOM_ISTAH_RME                              (1 << 7)
+#define DANUBE_IOM_ISTAH_RPF                              (1 << 6)
+#define DANUBE_IOM_ISTAH_RFO                              (1 << 5)
+#define DANUBE_IOM_ISTAH_XPR                              (1 << 4)
+#define DANUBE_IOM_ISTAH_XMR                              (1 << 3)
+#define DANUBE_IOM_ISTAH_XDU                              (1 << 2)
+
+/***Interrupt Mask Register HDLC***/
+#define DANUBE_IOM_MASKH                        ((volatile u32*)(DANUBE_IOM+ 0x0080))
+#define DANUBE_IOM_MASKH_RME                              (1 << 7)
+#define DANUBE_IOM_MASKH_RPF                              (1 << 6)
+#define DANUBE_IOM_MASKH_RFO                              (1 << 5)
+#define DANUBE_IOM_MASKH_XPR                              (1 << 4)
+#define DANUBE_IOM_MASKH_XMR                              (1 << 3)
+#define DANUBE_IOM_MASKH_XDU                              (1 << 2)
+
+/***Status Register***/
+#define DANUBE_IOM_STAR                         ((volatile u32*)(DANUBE_IOM+ 0x0084))
+#define DANUBE_IOM_STAR_XDOV                            (1 << 7)
+#define DANUBE_IOM_STAR_XFW                              (1 << 6)
+#define DANUBE_IOM_STAR_RACI                            (1 << 3)
+#define DANUBE_IOM_STAR_XACI                            (1 << 1)
+
+/***Command Register***/
+#define DANUBE_IOM_CMDR                         ((volatile u32*)(DANUBE_IOM+ 0x0084))
+#define DANUBE_IOM_CMDR_RMC                              (1 << 7)
+#define DANUBE_IOM_CMDR_RRES                            (1 << 6)
+#define DANUBE_IOM_CMDR_XTF                              (1 << 3)
+#define DANUBE_IOM_CMDR_XME                              (1 << 1)
+#define DANUBE_IOM_CMDR_XRES                            (1 << 0)
+
+/***Mode Register***/
+#define DANUBE_IOM_MODEH                        ((volatile u32*)(DANUBE_IOM+ 0x0088))
+#define DANUBE_IOM_MODEH_MDS2                            (1 << 7)
+#define DANUBE_IOM_MODEH_MDS1                            (1 << 6)
+#define DANUBE_IOM_MODEH_MDS0                            (1 << 5)
+#define DANUBE_IOM_MODEH_RAC                              (1 << 3)
+#define DANUBE_IOM_MODEH_DIM2                            (1 << 2)
+#define DANUBE_IOM_MODEH_DIM1                            (1 << 1)
+#define DANUBE_IOM_MODEH_DIM0                            (1 << 0)
+
+/***Extended Mode Register***/
+#define DANUBE_IOM_EXMR                         ((volatile u32*)(DANUBE_IOM+ 0x008C))
+#define DANUBE_IOM_EXMR_XFBS                            (1 << 7)
+#define DANUBE_IOM_EXMR_RFBS (value)               (((( 1 << 2) - 1) & (value)) << 5)
+#define DANUBE_IOM_EXMR_SRA                              (1 << 4)
+#define DANUBE_IOM_EXMR_XCRC                            (1 << 3)
+#define DANUBE_IOM_EXMR_RCRC                            (1 << 2)
+#define DANUBE_IOM_EXMR_ITF                              (1 << 0)
+
+/***SAPI1 Register***/
+#define DANUBE_IOM_SAP1                         ((volatile u32*)(DANUBE_IOM+ 0x0094))
+#define DANUBE_IOM_SAP1_SAPI1 (value)              (((( 1 << 6) - 1) & (value)) << 2)
+#define DANUBE_IOM_SAP1_MHA                              (1 << 0)
+
+/***Receive Frame Byte Count Low***/
+#define DANUBE_IOM_RBCL                         ((volatile u32*)(DANUBE_IOM+ 0x0098))
+#define DANUBE_IOM_RBCL_RBC(value)              (1 << value)
+
+
+/***SAPI2 Register***/
+#define DANUBE_IOM_SAP2                         ((volatile u32*)(DANUBE_IOM+ 0x0098))
+#define DANUBE_IOM_SAP2_SAPI2 (value)              (((( 1 << 6) - 1) & (value)) << 2)
+#define DANUBE_IOM_SAP2_MLA                              (1 << 0)
+
+/***Receive Frame Byte Count High***/
+#define DANUBE_IOM_RBCH                         ((volatile u32*)(DANUBE_IOM+ 0x009C))
+#define DANUBE_IOM_RBCH_OV                              (1 << 4)
+#define DANUBE_IOM_RBCH_RBC11                          (1 << 3)
+#define DANUBE_IOM_RBCH_RBC10                          (1 << 2)
+#define DANUBE_IOM_RBCH_RBC9                            (1 << 1)
+#define DANUBE_IOM_RBCH_RBC8                            (1 << 0)
+
+/***TEI1 Register 1***/
+#define DANUBE_IOM_TEI1                         ((volatile u32*)(DANUBE_IOM+ 0x009C))
+#define DANUBE_IOM_TEI1_TEI1 (value)               (((( 1 << 7) - 1) & (value)) << 1)
+#define DANUBE_IOM_TEI1_EA                              (1 << 0)
+
+/***Receive Status Register***/
+#define DANUBE_IOM_RSTA                         ((volatile u32*)(DANUBE_IOM+ 0x00A0))
+#define DANUBE_IOM_RSTA_VFR                              (1 << 7)
+#define DANUBE_IOM_RSTA_RDO                              (1 << 6)
+#define DANUBE_IOM_RSTA_CRC                              (1 << 5)
+#define DANUBE_IOM_RSTA_RAB                              (1 << 4)
+#define DANUBE_IOM_RSTA_SA1                              (1 << 3)
+#define DANUBE_IOM_RSTA_SA0                              (1 << 2)
+#define DANUBE_IOM_RSTA_TA                              (1 << 0)
+#define DANUBE_IOM_RSTA_CR                              (1 << 1)
+
+/***TEI2 Register***/
+#define DANUBE_IOM_TEI2                         ((volatile u32*)(DANUBE_IOM+ 0x00A0))
+#define DANUBE_IOM_TEI2_TEI2 (value)               (((( 1 << 7) - 1) & (value)) << 1)
+#define DANUBE_IOM_TEI2_EA                              (1 << 0)
+
+/***Test Mode Register HDLC***/
+#define DANUBE_IOM_TMH                          ((volatile u32*)(DANUBE_IOM+ 0x00A4))
+#define DANUBE_IOM_TMH_TLP                              (1 << 0)
+
+/***Command/Indication Receive 0***/
+#define DANUBE_IOM_CIR0                         ((volatile u32*)(DANUBE_IOM+ 0x00B8))
+#define DANUBE_IOM_CIR0_CODR0 (value)              (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_IOM_CIR0_CIC0                            (1 << 3)
+#define DANUBE_IOM_CIR0_CIC1                            (1 << 2)
+#define DANUBE_IOM_CIR0_SG                              (1 << 1)
+#define DANUBE_IOM_CIR0_BAS                              (1 << 0)
+
+/***Command/Indication Transmit 0***/
+#define DANUBE_IOM_CIX0                         ((volatile u32*)(DANUBE_IOM+ 0x00B8))
+#define DANUBE_IOM_CIX0_CODX0 (value)              (((( 1 << 4) - 1) & (value)) << 4)
+#define DANUBE_IOM_CIX0_TBA2                            (1 << 3)
+#define DANUBE_IOM_CIX0_TBA1                            (1 << 2)
+#define DANUBE_IOM_CIX0_TBA0                            (1 << 1)
+#define DANUBE_IOM_CIX0_BAC                              (1 << 0)
+
+/***Command/Indication Receive 1***/
+#define DANUBE_IOM_CIR1                         ((volatile u32*)(DANUBE_IOM+ 0x00BC))
+#define DANUBE_IOM_CIR1_CODR1 (value)              (((( 1 << 6) - 1) & (value)) << 2)
+
+/***Command/Indication Transmit 1***/
+#define DANUBE_IOM_CIX1                         ((volatile u32*)(DANUBE_IOM+ 0x00BC))
+#define DANUBE_IOM_CIX1_CODX1 (value)              (((( 1 << 6) - 1) & (value)) << 2)
+#define DANUBE_IOM_CIX1_CICW                            (1 << 1)
+#define DANUBE_IOM_CIX1_CI1E                            (1 << 0)
+
+/***Controller Data Access Reg. (CH10)***/
+#define DANUBE_IOM_CDA10                        ((volatile u32*)(DANUBE_IOM+ 0x0100))
+#define DANUBE_IOM_CDA10_CDA (value)                (((( 1 << 8) - 1) & (value)) << 0)
+
+/***Controller Data Access Reg. (CH11)***/
+#define DANUBE_IOM_CDA11                        ((volatile u32*)(DANUBE_IOM+ 0x0104))
+#define DANUBE_IOM_CDA11_CDA (value)                (((( 1 << 8) - 1) & (value)) << 0)
+
+/***Controller Data Access Reg. (CH20)***/
+#define DANUBE_IOM_CDA20                        ((volatile u32*)(DANUBE_IOM+ 0x0108))
+#define DANUBE_IOM_CDA20_CDA (value)                (((( 1 << 8) - 1) & (value)) << 0)
+
+/***Controller Data Access Reg. (CH21)***/
+#define DANUBE_IOM_CDA21                        ((volatile u32*)(DANUBE_IOM+ 0x010C))
+#define DANUBE_IOM_CDA21_CDA (value)                (((( 1 << 8) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH10)***/
+#define DANUBE_IOM_CDA_TSDP10                   ((volatile u32*)(DANUBE_IOM+ 0x0110))
+#define DANUBE_IOM_CDA_TSDP10_DPS                              (1 << 7)
+#define DANUBE_IOM_CDA_TSDP10_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH11)***/
+#define DANUBE_IOM_CDA_TSDP11                   ((volatile u32*)(DANUBE_IOM+ 0x0114))
+#define DANUBE_IOM_CDA_TSDP11_DPS                              (1 << 7)
+#define DANUBE_IOM_CDA_TSDP11_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH20)***/
+#define DANUBE_IOM_CDA_TSDP20                   ((volatile u32*)(DANUBE_IOM+ 0x0118))
+#define DANUBE_IOM_CDA_TSDP20_DPS                              (1 << 7)
+#define DANUBE_IOM_CDA_TSDP20_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH21)***/
+#define DANUBE_IOM_CDA_TSDP21                   ((volatile u32*)(DANUBE_IOM+ 0x011C))
+#define DANUBE_IOM_CDA_TSDP21_DPS                              (1 << 7)
+#define DANUBE_IOM_CDA_TSDP21_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH10)***/
+#define DANUBE_IOM_CO_TSDP10                    ((volatile u32*)(DANUBE_IOM+ 0x0120))
+#define DANUBE_IOM_CO_TSDP10_DPS                              (1 << 7)
+#define DANUBE_IOM_CO_TSDP10_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH11)***/
+#define DANUBE_IOM_CO_TSDP11                    ((volatile u32*)(DANUBE_IOM+ 0x0124))
+#define DANUBE_IOM_CO_TSDP11_DPS                              (1 << 7)
+#define DANUBE_IOM_CO_TSDP11_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH20)***/
+#define DANUBE_IOM_CO_TSDP20                    ((volatile u32*)(DANUBE_IOM+ 0x0128))
+#define DANUBE_IOM_CO_TSDP20_DPS                              (1 << 7)
+#define DANUBE_IOM_CO_TSDP20_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Time Slot and Data Port Sel. (CH21)***/
+#define DANUBE_IOM_CO_TSDP21                    ((volatile u32*)(DANUBE_IOM+ 0x012C))
+#define DANUBE_IOM_CO_TSDP21_DPS                              (1 << 7)
+#define DANUBE_IOM_CO_TSDP21_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Ctrl. Reg. Contr. Data Access CH1x***/
+#define DANUBE_IOM_CDA1_CR                      ((volatile u32*)(DANUBE_IOM+ 0x0138))
+#define DANUBE_IOM_CDA1_CR_EN_TBM                        (1 << 5)
+#define DANUBE_IOM_CDA1_CR_EN_I1                          (1 << 4)
+#define DANUBE_IOM_CDA1_CR_EN_I0                          (1 << 3)
+#define DANUBE_IOM_CDA1_CR_EN_O1                          (1 << 2)
+#define DANUBE_IOM_CDA1_CR_EN_O0                          (1 << 1)
+#define DANUBE_IOM_CDA1_CR_SWAP                            (1 << 0)
+
+/***Ctrl. Reg. Contr. Data Access CH1x***/
+#define DANUBE_IOM_CDA2_CR                      ((volatile u32*)(DANUBE_IOM+ 0x013C))
+#define DANUBE_IOM_CDA2_CR_EN_TBM                        (1 << 5)
+#define DANUBE_IOM_CDA2_CR_EN_I1                          (1 << 4)
+#define DANUBE_IOM_CDA2_CR_EN_I0                          (1 << 3)
+#define DANUBE_IOM_CDA2_CR_EN_O1                          (1 << 2)
+#define DANUBE_IOM_CDA2_CR_EN_O0                          (1 << 1)
+#define DANUBE_IOM_CDA2_CR_SWAP                            (1 << 0)
+
+/***Control Register B-Channel Data***/
+#define DANUBE_IOM_BCHA_CR                      ((volatile u32*)(DANUBE_IOM+ 0x0144))
+#define DANUBE_IOM_BCHA_CR_EN_BC2                        (1 << 4)
+#define DANUBE_IOM_BCHA_CR_EN_BC1                        (1 << 3)
+
+/***Control Register B-Channel Data***/
+#define DANUBE_IOM_BCHB_CR                      ((volatile u32*)(DANUBE_IOM+ 0x0148))
+#define DANUBE_IOM_BCHB_CR_EN_BC2                        (1 << 4)
+#define DANUBE_IOM_BCHB_CR_EN_BC1                        (1 << 3)
+
+/***Control Reg. for HDLC and CI1 Data***/
+#define DANUBE_IOM_DCI_CR                       ((volatile u32*)(DANUBE_IOM+ 0x014C))
+#define DANUBE_IOM_DCI_CR_DPS_CI1                      (1 << 7)
+#define DANUBE_IOM_DCI_CR_EN_CI1                        (1 << 6)
+#define DANUBE_IOM_DCI_CR_EN_D                            (1 << 5)
+
+/***Control Reg. for HDLC and CI1 Data***/
+#define DANUBE_IOM_DCIC_CR                      ((volatile u32*)(DANUBE_IOM+ 0x014C))
+#define DANUBE_IOM_DCIC_CR_DPS_CI0                      (1 << 7)
+#define DANUBE_IOM_DCIC_CR_EN_CI0                        (1 << 6)
+#define DANUBE_IOM_DCIC_CR_DPS_D                          (1 << 5)
+
+/***Control Reg. Serial Data Strobe x***/
+#define DANUBE_IOM_SDS_CR                       ((volatile u32*)(DANUBE_IOM+ 0x0154))
+#define DANUBE_IOM_SDS_CR_ENS_TSS                      (1 << 7)
+#define DANUBE_IOM_SDS_CR_ENS_TSS_1                  (1 << 6)
+#define DANUBE_IOM_SDS_CR_ENS_TSS_3                  (1 << 5)
+#define DANUBE_IOM_SDS_CR_TSS (value)                (((( 1 << 4) - 1) & (value)) << 0)
+
+/***Control Register IOM Data***/
+#define DANUBE_IOM_IOM_CR                       ((volatile u32*)(DANUBE_IOM+ 0x015C))
+#define DANUBE_IOM_IOM_CR_SPU                              (1 << 7)
+#define DANUBE_IOM_IOM_CR_CI_CS                          (1 << 5)
+#define DANUBE_IOM_IOM_CR_TIC_DIS                      (1 << 4)
+#define DANUBE_IOM_IOM_CR_EN_BCL                        (1 << 3)
+#define DANUBE_IOM_IOM_CR_CLKM                            (1 << 2)
+#define DANUBE_IOM_IOM_CR_Res                              (1 << 1)
+#define DANUBE_IOM_IOM_CR_DIS_IOM                      (1 << 0)
+
+/***Synchronous Transfer Interrupt***/
+#define DANUBE_IOM_STI                          ((volatile u32*)(DANUBE_IOM+ 0x0160))
+#define DANUBE_IOM_STI_STOV21                        (1 << 7)
+#define DANUBE_IOM_STI_STOV20                        (1 << 6)
+#define DANUBE_IOM_STI_STOV11                        (1 << 5)
+#define DANUBE_IOM_STI_STOV10                        (1 << 4)
+#define DANUBE_IOM_STI_STI21                          (1 << 3)
+#define DANUBE_IOM_STI_STI20                          (1 << 2)
+#define DANUBE_IOM_STI_STI11                          (1 << 1)
+#define DANUBE_IOM_STI_STI10                          (1 << 0)
+
+/***Acknowledge Synchronous Transfer Interrupt***/
+#define DANUBE_IOM_ASTI                         ((volatile u32*)(DANUBE_IOM+ 0x0160))
+#define DANUBE_IOM_ASTI_ACK21                          (1 << 3)
+#define DANUBE_IOM_ASTI_ACK20                          (1 << 2)
+#define DANUBE_IOM_ASTI_ACK11                          (1 << 1)
+#define DANUBE_IOM_ASTI_ACK10                          (1 << 0)
+
+/***Mask Synchronous Transfer Interrupt***/
+#define DANUBE_IOM_MSTI                         ((volatile u32*)(DANUBE_IOM+ 0x0164))
+#define DANUBE_IOM_MSTI_STOV21                        (1 << 7)
+#define DANUBE_IOM_MSTI_STOV20                        (1 << 6)
+#define DANUBE_IOM_MSTI_STOV11                        (1 << 5)
+#define DANUBE_IOM_MSTI_STOV10                        (1 << 4)
+#define DANUBE_IOM_MSTI_STI21                          (1 << 3)
+#define DANUBE_IOM_MSTI_STI20                          (1 << 2)
+#define DANUBE_IOM_MSTI_STI11                          (1 << 1)
+#define DANUBE_IOM_MSTI_STI10                          (1 << 0)
+
+/***Configuration Register for Serial Data Strobes***/
+#define DANUBE_IOM_SDS_CONF                    ((volatile u32*)(DANUBE_IOM+ 0x0168))
+#define DANUBE_IOM_SDS_CONF_SDS_BCL                      (1 << 0)
+
+/***Monitoring CDA Bits***/
+#define DANUBE_IOM_MCDA                         ((volatile u32*)(DANUBE_IOM+ 0x016C))
+#define DANUBE_IOM_MCDA_MCDA21 (value)             (((( 1 << 2) - 1) & (value)) << 6)
+#define DANUBE_IOM_MCDA_MCDA20 (value)             (((( 1 << 2) - 1) & (value)) << 4)
+#define DANUBE_IOM_MCDA_MCDA11 (value)             (((( 1 << 2) - 1) & (value)) << 2)
+#define DANUBE_IOM_MCDA_MCDA10 (value)             (((( 1 << 2) - 1) & (value)) << 0)
+
+/***********************************************************************/
+/*  Module      :  ASC0 register address and bits                      */
+/***********************************************************************/
+#define DANUBE_ASC0                          (KSEG1+0x1E100400)
+/***********************************************************************/
+#define DANUBE_ASC0_TBUF                        ((volatile u32*)(DANUBE_ASC0 + 0x0020))
+#define DANUBE_ASC0_RBUF                        ((volatile u32*)(DANUBE_ASC0 + 0x0024))
+#define DANUBE_ASC0_FSTAT                       ((volatile u32*)(DANUBE_ASC0 + 0x0048))
+#define DANUBE_ASC0_FSTAT_TXFREE_GET(value)     (((value) >> 24) & ((1 << 6) - 1))
+#define DANUBE_ASC0_FSTAT_TXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 24)
+#define DANUBE_ASC0_FSTAT_RXFREE_GET(value)     (((value) >> 16) & ((1 << 6) - 1))
+#define DANUBE_ASC0_FSTAT_RXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 16)
+#define DANUBE_ASC0_FSTAT_TXFFL_GET(value)      (((value) >> 8) & ((1 << 6) - 1))
+#define DANUBE_ASC0_FSTAT_TXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 8)
+#define DANUBE_ASC0_FSTAT_RXFFL_GET(value)      (((value) >> 0) & ((1 << 6) - 1))
+#define DANUBE_ASC0_FSTAT_RXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 0)
+
+
+/***********************************************************************/
+/*  Module      :  ASC1 register address and bits                      */
+/***********************************************************************/
+
+#define DANUBE_ASC1                          (KSEG1+0x1E100C00)
+	/***********************************************************************/
+
+#define DANUBE_ASC1_TBUF                        ((volatile u32*)(DANUBE_ASC1 + 0x0020))
+#define DANUBE_ASC1_RBUF                        ((volatile u32*)(DANUBE_ASC1 + 0x0024))
+#define DANUBE_ASC1_FSTAT                       ((volatile u32*)(DANUBE_ASC1 + 0x0048))
+#define DANUBE_ASC1_FSTAT_TXFREE_GET(value)     (((value) >> 24) & ((1 << 6) - 1))
+#define DANUBE_ASC1_FSTAT_TXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 24)
+#define DANUBE_ASC1_FSTAT_RXFREE_GET(value)     (((value) >> 16) & ((1 << 6) - 1))
+#define DANUBE_ASC1_FSTAT_RXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 16)
+#define DANUBE_ASC1_FSTAT_TXFFL_GET(value)      (((value) >> 8) & ((1 << 6) - 1))
+#define DANUBE_ASC1_FSTAT_TXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 8)
+#define DANUBE_ASC1_FSTAT_RXFFL_GET(value)      (((value) >> 0) & ((1 << 6) - 1))
+#define DANUBE_ASC1_FSTAT_RXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 0)
+
+/***********************************************************************/
+/*  Module      :  DMA register address and bits                       */
+/***********************************************************************/
+/***********************************************************************/
+/*  Module      :  DMA register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_DMA                          (0xBE104100)
+/***********************************************************************/
+
+#define DANUBE_DMA_BASE                 DANUBE_DMA 
+#define DANUBE_DMA_CLC                  (volatile u32*)DANUBE_DMA_BASE
+#define DANUBE_DMA_ID                   (volatile u32*)(DANUBE_DMA_BASE+0x08)       
+#define DANUBE_DMA_CTRL                 (volatile u32*)(DANUBE_DMA_BASE+0x10)
+#define DANUBE_DMA_CPOLL                (volatile u32*)(DANUBE_DMA_BASE+0x14)  
+#define DANUBE_DMA_CS                   (volatile u32*)(DANUBE_DMA_BASE+0x18)
+#define DANUBE_DMA_CCTRL                (volatile u32*)(DANUBE_DMA_BASE+0x1C) 
+#define DANUBE_DMA_CDBA                 (volatile u32*)(DANUBE_DMA_BASE+0x20)
+#define DANUBE_DMA_CDLEN                (volatile u32*)(DANUBE_DMA_BASE+0x24) 
+#define DANUBE_DMA_CIS                  (volatile u32*)(DANUBE_DMA_BASE+0x28) 
+#define DANUBE_DMA_CIE                  (volatile u32*)(DANUBE_DMA_BASE+0x2C) 
+
+#define DANUBE_DMA_PS                   (volatile u32*)(DANUBE_DMA_BASE+0x40)
+#define DANUBE_DMA_PCTRL                (volatile u32*)(DANUBE_DMA_BASE+0x44) 
+
+#define DANUBE_DMA_IRNEN                (volatile u32*)(DANUBE_DMA_BASE+0xf4)  
+#define DANUBE_DMA_IRNCR                (volatile u32*)(DANUBE_DMA_BASE+0xf8) 
+#define DANUBE_DMA_IRNICR               (volatile u32*)(DANUBE_DMA_BASE+0xfc)
+/***********************************************************************/
+/*  Module      :  Debug register address and bits                     */
+/***********************************************************************/
+
+#define DANUBE_Debug                        (0xBF106000)
+/***********************************************************************/
+
+
+/***MCD Break Bus Switch Register***/
+#define DANUBE_Debug_MCD_BBS                      ((volatile u32*)(DANUBE_Debug+ 0x0000))
+#define DANUBE_Debug_MCD_BBS_BTP1                            (1 << 19)
+#define DANUBE_Debug_MCD_BBS_BTP0                            (1 << 18)
+#define DANUBE_Debug_MCD_BBS_BSP1                            (1 << 17)
+#define DANUBE_Debug_MCD_BBS_BSP0                            (1 << 16)
+#define DANUBE_Debug_MCD_BBS_BT5EN                          (1 << 15)
+#define DANUBE_Debug_MCD_BBS_BT4EN                          (1 << 14)
+#define DANUBE_Debug_MCD_BBS_BT5                              (1 << 13)
+#define DANUBE_Debug_MCD_BBS_BT4                              (1 << 12)
+#define DANUBE_Debug_MCD_BBS_BS5EN                          (1 << 7)
+#define DANUBE_Debug_MCD_BBS_BS4EN                          (1 << 6)
+#define DANUBE_Debug_MCD_BBS_BS5                              (1 << 5)
+#define DANUBE_Debug_MCD_BBS_BS4                              (1 << 4)
+
+/***MCD Multiplexer Control Register***/
+#define DANUBE_Debug_MCD_MCR                      ((volatile u32*)(DANUBE_Debug+ 0x0008))
+#define DANUBE_Debug_MCD_MCR_MUX5                            (1 << 4)
+#define DANUBE_Debug_MCD_MCR_MUX4                            (1 << 3)
+#define DANUBE_Debug_MCD_MCR_MUX1                            (1 << 0)
+
+
+/***********************************************************************/
+/*  Module      :  SRAM register address and bits                      */
+/***********************************************************************/
+
+#define DANUBE_SRAM                         (0xBF980000)
+/***********************************************************************/
+
+
+/***SRAM Size Register***/
+#define DANUBE_SRAM_SRAM_SIZE                    ((volatile u32*)(DANUBE_SRAM+ 0x0800))
+#define DANUBE_SRAM_SRAM_SIZE_SIZE (value)               (((( 1 << 23) - 1) & (value)) << 0)
+
+/***********************************************************************/
+/*  Module      :  BIU register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_BIU                          (0xBFA80000)
+/***********************************************************************/
+
+
+/***BIU Identification Register***/
+#define DANUBE_BIU_BIU_ID                       ((volatile u32*)(DANUBE_BIU+ 0x0000))
+#define DANUBE_BIU_BIU_ID_ARCH                            (1 << 16)
+#define DANUBE_BIU_BIU_ID_ID (value)                (((( 1 << 8) - 1) & (value)) << 8)
+#define DANUBE_BIU_BIU_ID_REV (value)                (((( 1 << 8) - 1) & (value)) << 0)
+
+/***BIU Access Error Cause Register***/
+#define DANUBE_BIU_BIU_ERRCAUSE                 ((volatile u32*)(DANUBE_BIU+ 0x0100))
+#define DANUBE_BIU_BIU_ERRCAUSE_ERR                              (1 << 31)
+#define DANUBE_BIU_BIU_ERRCAUSE_PORT (value)               (((( 1 << 4) - 1) & (value)) << 16)
+#define DANUBE_BIU_BIU_ERRCAUSE_CAUSE (value)              (((( 1 << 2) - 1) & (value)) << 0)
+
+/***BIU Access Error Address Register***/
+#define DANUBE_BIU_BIU_ERRADDR                  ((volatile u32*)(DANUBE_BIU+ 0x0108))
+#define DANUBE_BIU_BIU_ERRADDR_ADDR
+
+
+/***********************************************************************/
+/*  Module      :  ICU register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_ICU                          (0xBF880200)
+#define DANUBE_ICU                          (0xBF880200)
+#define DANUBE_ICU_EXI                      (0xBF101000)
+/***********************************************************************/
+
+      
+/***IM0 Interrupt Status Register***/ 
+#define DANUBE_ICU_IM0_ISR                      ((volatile u32*)(DANUBE_ICU+ 0x0000))
+#define DANUBE_ICU_IM0_ISR_IR(value)               (1 << (value))
+                      
+      
+/***IM1 Interrupt Status Register***/ 
+#define DANUBE_ICU_IM1_ISR                      ((volatile u32*)(DANUBE_ICU+ 0x0020))
+#define DANUBE_ICU_IM1_ISR_IR(value)               (1 << (value))
+                      
+      
+/***IM2 Interrupt Status Register***/ 
+#define DANUBE_ICU_IM2_ISR                      ((volatile u32*)(DANUBE_ICU+ 0x0040))
+#define DANUBE_ICU_IM2_ISR_IR(value)               (1 << (value))
+                      
+/***IM3 Interrupt Status Register***/
+#define DANUBE_ICU_IM3_ISR                      ((volatile u32*)(DANUBE_ICU+ 0x0060))
+#define DANUBE_ICU_IM3_ISR_IR(value)               (1 << (value))
+                                                                                       
+/***IM4 Interrupt Status Register***/
+#define DANUBE_ICU_IM4_ISR                      ((volatile u32*)(DANUBE_ICU+ 0x0080))
+#define DANUBE_ICU_IM4_ISR_IR(value)               (1 << (value))
+
+	                
+/***IM0 Interrupt Enable Register***/ 
+#define DANUBE_ICU_IM0_IER                      ((volatile u32*)(DANUBE_ICU+ 0x0008))
+#define DANUBE_ICU_IM0_IER_IR(value)               (1 << (value))
+                      
+      
+/***IM1 Interrupt Enable Register***/ 
+#define DANUBE_ICU_IM1_IER                      ((volatile u32*)(DANUBE_ICU+ 0x0028))
+#define DANUBE_ICU_IM1_IER_IR(value)               (1 << (value))
+                      
+      
+/***IM2 Interrupt Enable Register***/ 
+#define DANUBE_ICU_IM2_IER                      ((volatile u32*)(DANUBE_ICU+ 0x0048))
+#define DANUBE_ICU_IM2_IER_IR(value)               (1 << (value)8
+                      
+/***IM3 Interrupt Enable Register***/
+#define DANUBE_ICU_IM3_IER                      ((volatile u32*)(DANUBE_ICU+ 0x0068))
+#define DANUBE_ICU_IM3_IER_IR(value)               (1 << (value))
+                                                                                       
+/***IM4 Interrupt Enable Register***/
+#define DANUBE_ICU_IM4_IER                      ((volatile u32*)(DANUBE_ICU+ 0x0088))
+#define DANUBE_ICU_IM4_IER_IR(value)               (1 << (value))
+
+            
+/***IM0 Interrupt Output Status Register***/ 
+#define DANUBE_ICU_IM0_IOSR                    ((volatile u32*)(DANUBE_ICU+ 0x0010))
+#define DANUBE_ICU_IM0_IOSR_IR(value)               (1 << (value))
+                      
+      
+/***IM1 Interrupt Output Status Register***/ 
+#define DANUBE_ICU_IM1_IOSR                    ((volatile u32*)(DANUBE_ICU+ 0x0030))
+#define DANUBE_ICU_IM1_IOSR_IR(value)               (1 << (value))
+                      
+      
+/***IM2 Interrupt Output Status Register***/ 
+#define DANUBE_ICU_IM2_IOSR                    ((volatile u32*)(DANUBE_ICU+ 0x0050))
+#define DANUBE_ICU_IM2_IOSR_IR(value)               (1 << (value))
+                      
+/***IM3 Interrupt Output Status Register***/
+#define DANUBE_ICU_IM3_IOSR                    ((volatile u32*)(DANUBE_ICU+ 0x0070))
+#define DANUBE_ICU_IM3_IOSR_IR(value)               (1 << (value))
+                                                                                       
+/***IM4 Interrupt Output Status Register***/
+#define DANUBE_ICU_IM4_IOSR                    ((volatile u32*)(DANUBE_ICU+ 0x0090))
+#define DANUBE_ICU_IM4_IOSR_IR(value)               (1 << (value))
+
+            
+/***IM0 Interrupt Request Set Register***/ 
+#define DANUBE_ICU_IM0_IRSR                    ((volatile u32*)(DANUBE_ICU+ 0x0018))
+#define DANUBE_ICU_IM0_IRSR_IR(value)               (1 << (value))
+                      
+      
+/***IM1 Interrupt Request Set Register***/ 
+#define DANUBE_ICU_IM1_IRSR                    ((volatile u32*)(DANUBE_ICU+ 0x0038))
+#define DANUBE_ICU_IM1_IRSR_IR(value)               (1 << (value))
+                      
+      
+/***IM2 Interrupt Request Set Register***/ 
+#define DANUBE_ICU_IM2_IRSR                    ((volatile u32*)(DANUBE_ICU+ 0x0058))
+#define DANUBE_ICU_IM2_IRSR_IR(value)               (1 << (value))
+                      
+/***IM3 Interrupt Request Set Register***/
+#define DANUBE_ICU_IM3_IRSR                    ((volatile u32*)(DANUBE_ICU+ 0x0078))
+#define DANUBE_ICU_IM3_IRSR_IR(value)               (1 << (value))
+                                                                                       
+/***IM4 Interrupt Request Set Register***/
+#define DANUBE_ICU_IM4_IRSR                    ((volatile u32*)(DANUBE_ICU+ 0x0098))
+#define DANUBE_ICU_IM4_IRSR_IR(value)               (1 << (value))
+
+/***Interrupt Vector Value Register***/
+#define DANUBE_ICU_IM_VEC                      ((volatile u32*)(DANUBE_ICU+ 0x0060))
+
+/***Interrupt Vector Value Mask***/
+#define DANUBE_ICU_IM0_VEC_MASK                0x0000001f
+#define DANUBE_ICU_IM1_VEC_MASK                0x000003e0
+#define DANUBE_ICU_IM2_VEC_MASK                0x00007c00
+#define DANUBE_ICU_IM3_VEC_MASK                0x000f8000
+#define DANUBE_ICU_IM4_VEC_MASK                0x01f00000
+
+/***DMA Interrupt Mask Value***/
+#define DANUBE_DMA_H_MASK			0x00000fff
+                                                                                       
+/***External Interrupt Control Register***/
+#define DANUBE_ICU_EXTINTCR                ((volatile u32*)(DANUBE_ICU_EXI+ 0x0000))                                                                                    
+#define DANUBE_ICU_IRNICR                  ((volatile u32*)(DANUBE_ICU_EXI+ 0x0004))                                                                                       
+#define DANUBE_ICU_IRNCR                   ((volatile u32*)(DANUBE_ICU_EXI+ 0x0008))                                                                                       
+#define DANUBE_ICU_IRNEN                   ((volatile u32*)(DANUBE_ICU_EXI+ 0x000c))
+#define DANUBE_ICU_NMI_CR                   ((volatile u32*)(DANUBE_ICU_EXI+ 0x00f0))
+#define DANUBE_ICU_NMI_SR                   ((volatile u32*)(DANUBE_ICU_EXI+ 0x00f4))
+
+/***********************************************************************/
+/*  Module      :  MPS register address and bits                       */
+/***********************************************************************/
+
+#define DANUBE_MPS                          (KSEG1+0x1F107000)
+/***********************************************************************/
+
+#define DANUBE_MPS_CHIPID                       ((volatile u32*)(DANUBE_MPS + 0x0344))
+#define DANUBE_MPS_CHIPID_VERSION_GET(value)    (((value) >> 28) & ((1 << 4) - 1))
+#define DANUBE_MPS_CHIPID_VERSION_SET(value)    (((( 1 << 4) - 1) & (value)) << 28)
+#define DANUBE_MPS_CHIPID_PARTNUM_GET(value)    (((value) >> 12) & ((1 << 16) - 1))
+#define DANUBE_MPS_CHIPID_PARTNUM_SET(value)    (((( 1 << 16) - 1) & (value)) << 12)
+#define DANUBE_MPS_CHIPID_MANID_GET(value)      (((value) >> 1) & ((1 << 10) - 1))
+#define DANUBE_MPS_CHIPID_MANID_SET(value)      (((( 1 << 10) - 1) & (value)) << 1)
+
+
+/* voice channel 0 ... 3 interrupt enable register */
+#define DANUBE_MPS_VC0ENR ((volatile u32*)(DANUBE_MPS + 0x0000))
+#define DANUBE_MPS_VC1ENR ((volatile u32*)(DANUBE_MPS + 0x0004))
+#define DANUBE_MPS_VC2ENR ((volatile u32*)(DANUBE_MPS + 0x0008))
+#define DANUBE_MPS_VC3ENR ((volatile u32*)(DANUBE_MPS + 0x000C))
+/* voice channel 0 ... 3 interrupt status read register */
+#define DANUBE_MPS_RVC0SR ((volatile u32*)(DANUBE_MPS + 0x0010))
+#define DANUBE_MPS_RVC1SR ((volatile u32*)(DANUBE_MPS + 0x0014))
+#define DANUBE_MPS_RVC2SR ((volatile u32*)(DANUBE_MPS + 0x0018))
+#define DANUBE_MPS_RVC3SR ((volatile u32*)(DANUBE_MPS + 0x001C))
+/* voice channel 0 ... 3 interrupt status set register */
+#define DANUBE_MPS_SVC0SR ((volatile u32*)(DANUBE_MPS + 0x0020))
+#define DANUBE_MPS_SVC1SR ((volatile u32*)(DANUBE_MPS + 0x0024))
+#define DANUBE_MPS_SVC2SR ((volatile u32*)(DANUBE_MPS + 0x0028))
+#define DANUBE_MPS_SVC3SR ((volatile u32*)(DANUBE_MPS + 0x002C))
+/* voice channel 0 ... 3 interrupt status clear register */
+#define DANUBE_MPS_CVC0SR ((volatile u32*)(DANUBE_MPS + 0x0030))
+#define DANUBE_MPS_CVC1SR ((volatile u32*)(DANUBE_MPS + 0x0034))
+#define DANUBE_MPS_CVC2SR ((volatile u32*)(DANUBE_MPS + 0x0038))
+#define DANUBE_MPS_CVC3SR ((volatile u32*)(DANUBE_MPS + 0x003C))
+/* common status 0 and 1 read register */
+#define DANUBE_MPS_RAD0SR ((volatile u32*)(DANUBE_MPS + 0x0040))
+#define DANUBE_MPS_RAD1SR ((volatile u32*)(DANUBE_MPS + 0x0044))
+/* common status 0 and 1 set register */
+#define DANUBE_MPS_SAD0SR ((volatile u32*)(DANUBE_MPS + 0x0048))
+#define DANUBE_MPS_SAD1SR ((volatile u32*)(DANUBE_MPS + 0x004C))
+/* common status 0 and 1 clear register */
+#define DANUBE_MPS_CAD0SR ((volatile u32*)(DANUBE_MPS + 0x0050))
+#define DANUBE_MPS_CAD1SR ((volatile u32*)(DANUBE_MPS + 0x0054))
+/* common status 0 and 1 enable register */
+#define DANUBE_MPS_AD0ENR ((volatile u32*)(DANUBE_MPS + 0x0058))
+#define DANUBE_MPS_AD1ENR ((volatile u32*)(DANUBE_MPS + 0x005C))
+/* notification enable register */
+#define DANUBE_MPS_CPU0_NFER ((volatile u32*)(DANUBE_MPS + 0x0060))
+#define DANUBE_MPS_CPU1_NFER ((volatile u32*)(DANUBE_MPS + 0x0064))
+/* CPU to CPU interrup request register */
+#define DANUBE_MPS_CPU0_2_CPU1_IRR ((volatile u32*)(DANUBE_MPS + 0x0070))
+#define DANUBE_MPS_CPU0_2_CPU1_IER ((volatile u32*)(DANUBE_MPS + 0x0074))
+/* Global interrupt request and request enable register */
+#define DANUBE_MPS_GIRR ((volatile u32*)(DANUBE_MPS + 0x0078))
+#define DANUBE_MPS_GIER ((volatile u32*)(DANUBE_MPS + 0x007C))
+
+
+#define DANUBE_MPS_CPU0_SMP0 ((volatile u32*)(DANUBE_MPS + 0x00100))
+
+#define DANUBE_MPS_CPU1_SMP0 ((volatile u32*)(DANUBE_MPS + 0x00200))
+ 
+/************************************************************************/
+/*   Module       :   DEU register address and bits        		*/
+/************************************************************************/
+#define DANUBE_DEU_BASE_ADDR               (0xBE102000)
+/*   DEU Control Register */
+#define DANUBE_DEU_CLK                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0000))
+#define DANUBE_DEU_ID                      ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0008))
+
+/*   DEU control register */
+#define DANUBE_DEU_CON                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0010))
+#define DANUBE_DEU_IHR                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0014))
+#define DANUBE_DEU_ILR                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0018))
+#define DANUBE_DEU_K1HR                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x001C))
+#define DANUBE_DEU_K1LR                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0020))
+#define DANUBE_DEU_K3HR                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0024))
+#define DANUBE_DEU_K3LR                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0028))
+#define DANUBE_DEU_IVHR                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x002C))
+#define DANUBE_DEU_IVLR                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0030))
+#define DANUBE_DEU_OHR                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0040))
+#define DANUBE_DEU_OLR                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0050))
+
+/* AES DEU register */
+#define DANUBE_AES_CON 			   ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0050))
+#define DANUBE_AES_ID3R                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0054))
+#define DANUBE_AES_ID2R                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0058))
+#define DANUBE_AES_ID1R                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x005C))
+#define DANUBE_AES_ID0R                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0060))
+
+/* AES Key register */
+#define DANUBE_AES_K7R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0064))
+#define DANUBE_AES_K6R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0068))
+#define DANUBE_AES_K5R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x006C))
+#define DANUBE_AES_K4R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0070))
+#define DANUBE_AES_K3R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0074))
+#define DANUBE_AES_K2R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0078))
+#define DANUBE_AES_K1R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x007C))
+#define DANUBE_AES_K0R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0080))
+
+/* AES vector register */
+#define DANUBE_AES_IV3R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0084))
+#define DANUBE_AES_IV2R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0088))
+#define DANUBE_AES_IV1R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x008C))
+#define DANUBE_AES_IV0R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0090))
+#define DANUBE_AES_0D3R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0094))
+#define DANUBE_AES_0D2R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x0098))
+#define DANUBE_AES_OD1R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x009C))
+#define DANUBE_AES_OD0R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00A0))
+
+/* hash control registe */
+#define DANUBE_HASH_CON                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00B0))
+#define DANUBE_HASH_MR                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00B4))
+#define DANUBE_HASH_D1R                    ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00B8 ))
+#define DANUBE_HASH_D2R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00BC ))
+#define DANUBE_HASH_D3R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00C0 ))
+#define DANUBE_HASH_D4R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00C4))
+#define DANUBE_HASH_D5R                     ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00C8))
+
+#define DANUBE_CON                         ((volatile u32 *)(DANUBE_DEU_BASE_ADDR + 0x00EC))
+
+
+
+ 
+/************************************************************************/
+/*   Module       :   PPE register address and bits        		*/
+/************************************************************************/
+#define DANUBE_PPE_BASE_ADDR                (KSEG1 + 0x1E180000)
+#define DANUBE_PPE_PP32_DEBUG_REG_ADDR(x)          ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x0000) << 2)))
+#define DANUBE_PPE_PPM_INT_REG_ADDR(x)             ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x0030) << 2)))
+#define DANUBE_PPE_PP32_INTERNAL_RES_ADDR(x)       ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x0040) << 2)))
+#define DANUBE_PPE_PPE_CLOCK_CONTROL_ADDR(x)       ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x0100) << 2)))
+#define DANUBE_PPE_CDM_CODE_MEMORY_RAM0_ADDR(x)    ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x1000) << 2)))
+#define DANUBE_PPE_CDM_CODE_MEMORY_RAM1_ADDR(x)    ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x2000) << 2)))
+#define DANUBE_PPE_REG_ADDR(x)                 ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x4000) << 2)))
+#define DANUBE_PPE_PP32_DATA_MEMORY_RAM1_ADDR(x)   ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x5000) << 2)))
+#define DANUBE_PPE_PPM_INT_UNIT_ADDR(x)            ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x6000) << 2)))
+#define DANUBE_PPE_PPM_TIMER0_ADDR(x)              ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x6100) << 2)))
+#define DANUBE_PPE_PPM_TASK_IND_REG_ADDR(x)        ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x6200) << 2)))
+#define DANUBE_PPE_PPS_BRK_ADDR(x)                 ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x6300) << 2)))
+#define DANUBE_PPE_PPM_TIMER1_ADDR(x)              ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x6400) << 2)))
+#define DANUBE_PPE_SB_RAM0_ADDR(x)                 ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x8000) << 2)))
+#define DANUBE_PPE_SB_RAM1_ADDR(x)                 ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x8400) << 2)))
+#define DANUBE_PPE_SB_RAM2_ADDR(x)                 ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x8C00) << 2)))
+#define DANUBE_PPE_SB_RAM3_ADDR(x)                 ((volatile u32*)(DANUBE_PPE_BASE_ADDR + (((x) + 0x9600) << 2)))
+
+#define DANUBE_PPE_PP32_SLEEP                      DANUBE_PPE_REG_ADDR(0x0010) /* PP32 Power Saving Register */
+#define DANUBE_PPE_CDM_CFG                         DANUBE_PPE_REG_ADDR(0x0100) /* Code/Data Memory (CDM) Register */
+
+/* Mailbox Registers */
+#define DANUBE_PPE_MBOX_IGU0_ISRS                  DANUBE_PPE_REG_ADDR(0x0200)
+#define DANUBE_PPE_MBOX_IGU0_ISRC                  DANUBE_PPE_REG_ADDR(0x0201)
+#define DANUBE_PPE_MBOX_IGU0_ISR                   DANUBE_PPE_REG_ADDR(0x0202)
+#define DANUBE_PPE_MBOX_IGU0_IER                   DANUBE_PPE_REG_ADDR(0x0203)
+#define DANUBE_PPE_MBOX_IGU1_ISRS0                 DANUBE_PPE_REG_ADDR(0x0204)
+#define DANUBE_PPE_MBOX_IGU1_ISRC0                 DANUBE_PPE_REG_ADDR(0x0205)
+#define DANUBE_PPE_MBOX_IGU1_ISR0                  DANUBE_PPE_REG_ADDR(0x0206)
+#define DANUBE_PPE_MBOX_IGU1_IER0                  DANUBE_PPE_REG_ADDR(0x0207)
+#define DANUBE_PPE_MBOX_IGU1_ISRS1                 DANUBE_PPE_REG_ADDR(0x0208)
+#define DANUBE_PPE_MBOX_IGU1_ISRC1                 DANUBE_PPE_REG_ADDR(0x0209)
+#define DANUBE_PPE_MBOX_IGU1_ISR1                  DANUBE_PPE_REG_ADDR(0x020A)
+#define DANUBE_PPE_MBOX_IGU1_IER1                  DANUBE_PPE_REG_ADDR(0x020B)
+#define DANUBE_PPE_MBOX_IGU1_ISRS2                 DANUBE_PPE_REG_ADDR(0x020C)
+#define DANUBE_PPE_MBOX_IGU1_ISRC2                 DANUBE_PPE_REG_ADDR(0x020D)
+#define DANUBE_PPE_MBOX_IGU1_ISR2                  DANUBE_PPE_REG_ADDR(0x020E)
+#define DANUBE_PPE_MBOX_IGU1_IER2                  DANUBE_PPE_REG_ADDR(0x020F)
+#define DANUBE_PPE_MBOX_IGU2_ISRS                  DANUBE_PPE_REG_ADDR(0x0210)
+#define DANUBE_PPE_MBOX_IGU2_ISRC                  DANUBE_PPE_REG_ADDR(0x0211)
+#define DANUBE_PPE_MBOX_IGU2_ISR                   DANUBE_PPE_REG_ADDR(0x0212)
+#define DANUBE_PPE_MBOX_IGU2_IER                   DANUBE_PPE_REG_ADDR(0x0213)
+#define DANUBE_PPE_MBOX_IGU3_ISRS                  DANUBE_PPE_REG_ADDR(0x0214)
+#define DANUBE_PPE_MBOX_IGU3_ISRC                  DANUBE_PPE_REG_ADDR(0x0215)
+#define DANUBE_PPE_MBOX_IGU3_ISR                   DANUBE_PPE_REG_ADDR(0x0216)
+#define DANUBE_PPE_MBOX_IGU3_IER                   DANUBE_PPE_REG_ADDR(0x0217)
+#define DANUBE_PPE_MBOX_IGU4_ISRS                  DANUBE_PPE_REG_ADDR(0x0218)
+#define DANUBE_PPE_MBOX_IGU4_ISRC                  DANUBE_PPE_REG_ADDR(0x0219)
+#define DANUBE_PPE_MBOX_IGU4_ISR                   DANUBE_PPE_REG_ADDR(0x021A)
+#define DANUBE_PPE_MBOX_IGU4_IER                   DANUBE_PPE_REG_ADDR(0x021B)
+/*
+ *    Shared Buffer (SB) Registers
+ */
+#define DANUBE_PPE_SB_MST_PRI0                     DANUBE_PPE_REG_ADDR(0x0300)
+#define DANUBE_PPE_SB_MST_PRI1                     DANUBE_PPE_REG_ADDR(0x0301)
+#define DANUBE_PPE_SB_MST_PRI2                     DANUBE_PPE_REG_ADDR(0x0302)
+#define DANUBE_PPE_SB_MST_PRI3                     DANUBE_PPE_REG_ADDR(0x0303)
+#define DANUBE_PPE_SB_MST_PRI4                     DANUBE_PPE_REG_ADDR(0x0304)
+#define DANUBE_PPE_SB_MST_SEL                      DANUBE_PPE_REG_ADDR(0x0305)
+/*
+ *    RTHA Registers
+ */
+#define DANUBE_PPE_RFBI_CFG                        DANUBE_PPE_REG_ADDR(0x0400)
+#define DANUBE_PPE_RBA_CFG0                        DANUBE_PPE_REG_ADDR(0x0404)
+#define DANUBE_PPE_RBA_CFG1                        DANUBE_PPE_REG_ADDR(0x0405)
+#define DANUBE_PPE_RCA_CFG0                        DANUBE_PPE_REG_ADDR(0x0408)
+#define DANUBE_PPE_RCA_CFG1                        DANUBE_PPE_REG_ADDR(0x0409)
+#define DANUBE_PPE_RDES_CFG0                       DANUBE_PPE_REG_ADDR(0x040C)
+#define DANUBE_PPE_RDES_CFG1                       DANUBE_PPE_REG_ADDR(0x040D)
+#define DANUBE_PPE_SFSM_STATE0                     DANUBE_PPE_REG_ADDR(0x0410)
+#define DANUBE_PPE_SFSM_STATE1                     DANUBE_PPE_REG_ADDR(0x0411)
+#define DANUBE_PPE_SFSM_DBA0                       DANUBE_PPE_REG_ADDR(0x0412)
+#define DANUBE_PPE_SFSM_DBA1                       DANUBE_PPE_REG_ADDR(0x0413)
+#define DANUBE_PPE_SFSM_CBA0                       DANUBE_PPE_REG_ADDR(0x0414)
+#define DANUBE_PPE_SFSM_CBA1                       DANUBE_PPE_REG_ADDR(0x0415)
+#define DANUBE_PPE_SFSM_CFG0                       DANUBE_PPE_REG_ADDR(0x0416)
+#define DANUBE_PPE_SFSM_CFG1                       DANUBE_PPE_REG_ADDR(0x0417)
+#define DANUBE_PPE_SFSM_PGCNT0                     DANUBE_PPE_REG_ADDR(0x041C)
+#define DANUBE_PPE_SFSM_PGCNT1                     DANUBE_PPE_REG_ADDR(0x041D)
+/*
+ *    TTHA Registers
+ */
+#define DANUBE_PPE_FFSM_DBA0                       DANUBE_PPE_REG_ADDR(0x0508)
+#define DANUBE_PPE_FFSM_DBA1                       DANUBE_PPE_REG_ADDR(0x0509)
+#define DANUBE_PPE_FFSM_CFG0                       DANUBE_PPE_REG_ADDR(0x050A)
+#define DANUBE_PPE_FFSM_CFG1                       DANUBE_PPE_REG_ADDR(0x050B)
+#define DANUBE_PPE_FFSM_IDLE_HEAD_BC0              DANUBE_PPE_REG_ADDR(0x050E)
+#define DANUBE_PPE_FFSM_IDLE_HEAD_BC1              DANUBE_PPE_REG_ADDR(0x050F)
+#define DANUBE_PPE_FFSM_PGCNT0                     DANUBE_PPE_REG_ADDR(0x0514)
+#define DANUBE_PPE_FFSM_PGCNT1                     DANUBE_PPE_REG_ADDR(0x0515)
+/*
+ *    ETOP MDIO Registers
+ */
+#define DANUBE_PPE_ETOP_MDIO_CFG                   DANUBE_PPE_REG_ADDR(0x0600)
+#define DANUBE_PPE_ETOP_MDIO_ACC                   DANUBE_PPE_REG_ADDR(0x0601)
+#define DANUBE_PPE_ETOP_CFG                        DANUBE_PPE_REG_ADDR(0x0602)
+#define DANUBE_PPE_ETOP_IG_VLAN_COS                DANUBE_PPE_REG_ADDR(0x0603)
+#define DANUBE_PPE_ETOP_IG_DSCP_COS3               DANUBE_PPE_REG_ADDR(0x0604)
+#define DANUBE_PPE_ETOP_IG_DSCP_COS2               DANUBE_PPE_REG_ADDR(0x0605)
+#define DANUBE_PPE_ETOP_IG_DSCP_COS1               DANUBE_PPE_REG_ADDR(0x0606)
+#define DANUBE_PPE_ETOP_IG_DSCP_COS0               DANUBE_PPE_REG_ADDR(0x0607)
+#define DANUBE_PPE_ETOP_IG_PLEN_CTRL0              DANUBE_PPE_REG_ADDR(0x0608)
+#define DANUBE_PPE_ETOP_IG_PLEN_CTRL1              DANUBE_PPE_REG_ADDR(0x0609)
+#define DANUBE_PPE_ETOP_ISR                        DANUBE_PPE_REG_ADDR(0x060A)
+#define DANUBE_PPE_ETOP_IER                        DANUBE_PPE_REG_ADDR(0x060B)
+#define DANUBE_PPE_ETOP_VPID                       DANUBE_PPE_REG_ADDR(0x060C)
+#define DANUBE_PPE_ENET_MAC_CFG                    DANUBE_PPE_REG_ADDR(0x0610)
+#define DANUBE_PPE_ENETS_DBA                       DANUBE_PPE_REG_ADDR(0x0612)
+#define DANUBE_PPE_ENETS_CBA                       DANUBE_PPE_REG_ADDR(0x0613)
+#define DANUBE_PPE_ENETS_CFG                       DANUBE_PPE_REG_ADDR(0x0614)
+#define DANUBE_PPE_ENETS_PGCNT                     DANUBE_PPE_REG_ADDR(0x0615)
+#define DANUBE_PPE_ENETS_PGCNT_DSRC_PP32	   (0x00020000)
+#define DANUBE_PPE_ENETS_PGCNT_DVAL_SHIFT	   (9)
+#define DANUBE_PPE_ENETS_PGCNT_DCMD	           (0x00000100) 
+#define DANUBE_PPE_ENETS_PKTCNT                    DANUBE_PPE_REG_ADDR(0x0616)
+#define DANUBE_PPE_ENETS_PKTCNT_DSRC_PP32	   (0x00000200)
+#define DANUBE_PPE_ENETS_PKTCNT_DCMD	           (0x00000100) 
+#define DANUBE_PPE_ENETS_PKTCNT_UPKT	           (0x000000FF) 
+#define DANUBE_PPE_ENETS_BUF_CTRL                  DANUBE_PPE_REG_ADDR(0x0617)
+#define DANUBE_PPE_ENETS_COS_CFG                   DANUBE_PPE_REG_ADDR(0x0618)
+#define DANUBE_PPE_ENETS_IGDROP                    DANUBE_PPE_REG_ADDR(0x0619)
+#define DANUBE_PPE_ENETF_DBA                       DANUBE_PPE_REG_ADDR(0x0630)
+#define DANUBE_PPE_ENETF_CBA                       DANUBE_PPE_REG_ADDR(0x0631)
+#define DANUBE_PPE_ENETF_CFG                       DANUBE_PPE_REG_ADDR(0x0632)
+#define DANUBE_PPE_ENETF_PGCNT                     DANUBE_PPE_REG_ADDR(0x0633)
+#define DANUBE_PPE_ENETF_PGCNT_ISRC_PP32	   (0x00020000)
+#define DANUBE_PPE_ENETF_PGCNT_IVAL_SHIFT	   (9)
+#define DANUBE_PPE_ENETF_PGCNT_ICMD	           (0x00000100) 
+#define DANUBE_PPE_ENETF_PKTCNT                    DANUBE_PPE_REG_ADDR(0x0634)
+#define DANUBE_PPE_ENETF_PKTCNT_ISRC_PP32	   (0x00000200)
+#define DANUBE_PPE_ENETF_PKTCNT_ICMD	           (0x00000100) 
+#define DANUBE_PPE_ENETF_PKTCNT_VPKT	           (0x000000FF) 
+#define DANUBE_PPE_ENETF_HFCTRL                    DANUBE_PPE_REG_ADDR(0x0635)
+#define DANUBE_PPE_ENETF_TXCTRL                    DANUBE_PPE_REG_ADDR(0x0636)
+#define DANUBE_PPE_ENETF_VLCOS0                    DANUBE_PPE_REG_ADDR(0x0638)
+#define DANUBE_PPE_ENETF_VLCOS1                    DANUBE_PPE_REG_ADDR(0x0639)
+#define DANUBE_PPE_ENETF_VLCOS2                    DANUBE_PPE_REG_ADDR(0x063A)
+#define DANUBE_PPE_ENETF_VLCOS3                    DANUBE_PPE_REG_ADDR(0x063B)
+#define DANUBE_PPE_ENETF_EGERR                     DANUBE_PPE_REG_ADDR(0x063C)
+#define DANUBE_PPE_ENETF_EGDROP                    DANUBE_PPE_REG_ADDR(0x063D)
+/*
+ *    DPLUS Registers
+ */
+#define DANUBE_PPE_DPLUS_TXDB                      DANUBE_PPE_REG_ADDR(0x0700)
+#define DANUBE_PPE_DPLUS_TXCB                      DANUBE_PPE_REG_ADDR(0x0701)
+#define DANUBE_PPE_DPLUS_TXCFG                     DANUBE_PPE_REG_ADDR(0x0702)
+#define DANUBE_PPE_DPLUS_TXPGCNT                   DANUBE_PPE_REG_ADDR(0x0703)
+#define DANUBE_PPE_DPLUS_RXDB                      DANUBE_PPE_REG_ADDR(0x0710)
+#define DANUBE_PPE_DPLUS_RXCB                      DANUBE_PPE_REG_ADDR(0x0711)
+#define DANUBE_PPE_DPLUS_RXCFG                     DANUBE_PPE_REG_ADDR(0x0712)
+#define DANUBE_PPE_DPLUS_RXPGCNT                   DANUBE_PPE_REG_ADDR(0x0713)
+/*
+ *    BMC Registers
+ */
+#define DANUBE_PPE_BMC_CMD3                        DANUBE_PPE_REG_ADDR(0x0800)
+#define DANUBE_PPE_BMC_CMD2                        DANUBE_PPE_REG_ADDR(0x0801)
+#define DANUBE_PPE_BMC_CMD1                        DANUBE_PPE_REG_ADDR(0x0802)
+#define DANUBE_PPE_BMC_CMD0                        DANUBE_PPE_REG_ADDR(0x0803)
+#define DANUBE_PPE_BMC_CFG0                        DANUBE_PPE_REG_ADDR(0x0804)
+#define DANUBE_PPE_BMC_CFG1                        DANUBE_PPE_REG_ADDR(0x0805)
+#define DANUBE_PPE_BMC_POLY0                       DANUBE_PPE_REG_ADDR(0x0806)
+#define DANUBE_PPE_BMC_POLY1                       DANUBE_PPE_REG_ADDR(0x0807)
+#define DANUBE_PPE_BMC_CRC0                        DANUBE_PPE_REG_ADDR(0x0808)
+#define DANUBE_PPE_BMC_CRC1                        DANUBE_PPE_REG_ADDR(0x0809)
+/*
+ *    SLL Registers
+ */
+#define DANUBE_PPE_SLL_CMD1                        DANUBE_PPE_REG_ADDR(0x0900)
+#define DANUBE_PPE_SLL_CMD0                        DANUBE_PPE_REG_ADDR(0x0901)
+#define DANUBE_PPE_SLL_KEY0                        DANUBE_PPE_REG_ADDR(0x0910)
+#define DANUBE_PPE_SLL_KEY1                        DANUBE_PPE_REG_ADDR(0x0911)
+#define DANUBE_PPE_SLL_KEY2                        DANUBE_PPE_REG_ADDR(0x0912)
+#define DANUBE_PPE_SLL_KEY3                        DANUBE_PPE_REG_ADDR(0x0913)
+#define DANUBE_PPE_SLL_KEY4                        DANUBE_PPE_REG_ADDR(0x0914)
+#define DANUBE_PPE_SLL_KEY5                        DANUBE_PPE_REG_ADDR(0x0915)
+#define DANUBE_PPE_SLL_RESULT                      DANUBE_PPE_REG_ADDR(0x0920)
+/*
+ *    EMA Registers
+ */
+#define DANUBE_PPE_EMA_CMD2                        DANUBE_PPE_REG_ADDR(0x0A00)
+#define DANUBE_PPE_EMA_CMD1                        DANUBE_PPE_REG_ADDR(0x0A01)
+#define DANUBE_PPE_EMA_CMD0                        DANUBE_PPE_REG_ADDR(0x0A02)
+#define DANUBE_PPE_EMA_ISR                         DANUBE_PPE_REG_ADDR(0x0A04)
+#define DANUBE_PPE_EMA_IER                         DANUBE_PPE_REG_ADDR(0x0A05)
+#define DANUBE_PPE_EMA_CFG                         DANUBE_PPE_REG_ADDR(0x0A06)
+/*
+ *    UTPS Registers
+ */
+#define DANUBE_PPE_UTP_TXCA0                       DANUBE_PPE_REG_ADDR(0x0B00)
+#define DANUBE_PPE_UTP_TXNA0                       DANUBE_PPE_REG_ADDR(0x0B01)
+#define DANUBE_PPE_UTP_TXCA1                       DANUBE_PPE_REG_ADDR(0x0B02)
+#define DANUBE_PPE_UTP_TXNA1                       DANUBE_PPE_REG_ADDR(0x0B03)
+#define DANUBE_PPE_UTP_RXCA0                       DANUBE_PPE_REG_ADDR(0x0B10)
+#define DANUBE_PPE_UTP_RXNA0                       DANUBE_PPE_REG_ADDR(0x0B11)
+#define DANUBE_PPE_UTP_RXCA1                       DANUBE_PPE_REG_ADDR(0x0B12)
+#define DANUBE_PPE_UTP_RXNA1                       DANUBE_PPE_REG_ADDR(0x0B13)
+#define DANUBE_PPE_UTP_CFG                         DANUBE_PPE_REG_ADDR(0x0B20)
+#define DANUBE_PPE_UTP_ISR                         DANUBE_PPE_REG_ADDR(0x0B30)
+#define DANUBE_PPE_UTP_IER                         DANUBE_PPE_REG_ADDR(0x0B31)
+/*
+ *    QSB Registers
+ */
+#define DANUBE_PPE_QSB_RELOG                       DANUBE_PPE_REG_ADDR(0x0C00)
+#define DANUBE_PPE_QSB_EMIT0                       DANUBE_PPE_REG_ADDR(0x0C01)
+#define DANUBE_PPE_QSB_EMIT1                       DANUBE_PPE_REG_ADDR(0x0C02)
+#define DANUBE_PPE_QSB_ICDV                        DANUBE_PPE_REG_ADDR(0x0C07)
+#define DANUBE_PPE_QSB_SBL                         DANUBE_PPE_REG_ADDR(0x0C09)
+#define DANUBE_PPE_QSB_CFG                         DANUBE_PPE_REG_ADDR(0x0C0A)
+#define DANUBE_PPE_QSB_RTM                         DANUBE_PPE_REG_ADDR(0x0C0B)
+#define DANUBE_PPE_QSB_RTD                         DANUBE_PPE_REG_ADDR(0x0C0C)
+#define DANUBE_PPE_QSB_RAMAC                       DANUBE_PPE_REG_ADDR(0x0C0D)
+#define DANUBE_PPE_QSB_ISTAT                       DANUBE_PPE_REG_ADDR(0x0C0E)
+#define DANUBE_PPE_QSB_IMR                         DANUBE_PPE_REG_ADDR(0x0C0F)
+#define DANUBE_PPE_QSB_SRC                         DANUBE_PPE_REG_ADDR(0x0C10)
+/*
+ *    DSP User Registers
+ */
+#define DANUBE_PPE_DREG_A_VERSION                  DANUBE_PPE_REG_ADDR(0x0D00)
+#define DANUBE_PPE_DREG_A_CFG                      DANUBE_PPE_REG_ADDR(0x0D01)
+#define DANUBE_PPE_DREG_AT_CTRL                    DANUBE_PPE_REG_ADDR(0x0D02)
+#define DANUBE_PPE_DREG_AR_CTRL                    DANUBE_PPE_REG_ADDR(0x0D08)
+#define DANUBE_PPE_DREG_A_UTPCFG                   DANUBE_PPE_REG_ADDR(0x0D0E)
+#define DANUBE_PPE_DREG_A_STATUS                   DANUBE_PPE_REG_ADDR(0x0D0F)
+#define DANUBE_PPE_DREG_AT_CFG0                    DANUBE_PPE_REG_ADDR(0x0D20)
+#define DANUBE_PPE_DREG_AT_CFG1                    DANUBE_PPE_REG_ADDR(0x0D21)
+#define DANUBE_PPE_DREG_FB_SIZE0                   DANUBE_PPE_REG_ADDR(0x0D22)
+#define DANUBE_PPE_DREG_FB_SIZE1                   DANUBE_PPE_REG_ADDR(0x0D23)
+#define DANUBE_PPE_DREG_AT_CELL0                   DANUBE_PPE_REG_ADDR(0x0D24)
+#define DANUBE_PPE_DREG_AT_CELL1                   DANUBE_PPE_REG_ADDR(0x0D25)
+#define DANUBE_PPE_DREG_AT_IDLE_CNT0               DANUBE_PPE_REG_ADDR(0x0D26)
+#define DANUBE_PPE_DREG_AT_IDLE_CNT1               DANUBE_PPE_REG_ADDR(0x0D27)
+#define DANUBE_PPE_DREG_AT_IDLE0                   DANUBE_PPE_REG_ADDR(0x0D28)
+#define DANUBE_PPE_DREG_AT_IDLE1                   DANUBE_PPE_REG_ADDR(0x0D29)
+#define DANUBE_PPE_DREG_AR_CFG0                    DANUBE_PPE_REG_ADDR(0x0D60)
+#define DANUBE_PPE_DREG_AR_CFG1                    DANUBE_PPE_REG_ADDR(0x0D61)
+#define DANUBE_PPE_DREG_AR_FB_START0               DANUBE_PPE_REG_ADDR(0x0D62)
+#define DANUBE_PPE_DREG_AR_FB_START1               DANUBE_PPE_REG_ADDR(0x0D63)
+#define DANUBE_PPE_DREG_AR_FB_END0                 DANUBE_PPE_REG_ADDR(0x0D64)
+#define DANUBE_PPE_DREG_AR_FB_END1                 DANUBE_PPE_REG_ADDR(0x0D65)
+#define DANUBE_PPE_DREG_AR_ATM_STAT0               DANUBE_PPE_REG_ADDR(0x0D66)
+#define DANUBE_PPE_DREG_AR_ATM_STAT1               DANUBE_PPE_REG_ADDR(0x0D67)
+#define DANUBE_PPE_DREG_AR_CELL0                   DANUBE_PPE_REG_ADDR(0x0D68)
+#define DANUBE_PPE_DREG_AR_CELL1                   DANUBE_PPE_REG_ADDR(0x0D69)
+#define DANUBE_PPE_DREG_AR_IDLE_CNT0               DANUBE_PPE_REG_ADDR(0x0D6A)
+#define DANUBE_PPE_DREG_AR_IDLE_CNT1               DANUBE_PPE_REG_ADDR(0x0D6B)
+#define DANUBE_PPE_DREG_AR_AIIDLE_CNT0             DANUBE_PPE_REG_ADDR(0x0D6C)
+#define DANUBE_PPE_DREG_AR_AIIDLE_CNT1             DANUBE_PPE_REG_ADDR(0x0D6D)
+#define DANUBE_PPE_DREG_AR_BE_CNT0                 DANUBE_PPE_REG_ADDR(0x0D6E)
+#define DANUBE_PPE_DREG_AR_BE_CNT1                 DANUBE_PPE_REG_ADDR(0x0D6F)
+#define DANUBE_PPE_DREG_AR_HEC_CNT0                DANUBE_PPE_REG_ADDR(0x0D70)
+#define DANUBE_PPE_DREG_AR_HEC_CNT1                DANUBE_PPE_REG_ADDR(0x0D71)
+#define DANUBE_PPE_DREG_AR_CD_CNT0                 DANUBE_PPE_REG_ADDR(0x0D72)
+#define DANUBE_PPE_DREG_AR_CD_CNT1                 DANUBE_PPE_REG_ADDR(0x0D73)
+#define DANUBE_PPE_DREG_AR_IDLE0                   DANUBE_PPE_REG_ADDR(0x0D74)
+#define DANUBE_PPE_DREG_AR_IDLE1                   DANUBE_PPE_REG_ADDR(0x0D75)
+#define DANUBE_PPE_DREG_AR_DELIN0                  DANUBE_PPE_REG_ADDR(0x0D76)
+#define DANUBE_PPE_DREG_AR_DELIN1                  DANUBE_PPE_REG_ADDR(0x0D77)
+#define DANUBE_PPE_DREG_RESV0                      DANUBE_PPE_REG_ADDR(0x0D78)
+#define DANUBE_PPE_DREG_RESV1                      DANUBE_PPE_REG_ADDR(0x0D79)
+#define DANUBE_PPE_DREG_RX_MIB_CMD0                DANUBE_PPE_REG_ADDR(0x0D80)
+#define DANUBE_PPE_DREG_RX_MIB_CMD1                DANUBE_PPE_REG_ADDR(0x0D81)
+#define DANUBE_PPE_DREG_AR_OVDROP_CNT0             DANUBE_PPE_REG_ADDR(0x0D98)
+#define DANUBE_PPE_DREG_AR_OVDROP_CNT1             DANUBE_PPE_REG_ADDR(0x0D99)
+
+
+/************************************************************************/
+/*   Module       :   PPE register address and bits        		*/
+/************************************************************************/
+#define DANUBE_PPE32_BASE  0xBE180000
+#define DANUBE_PPE32_DEBUG_BREAK_TRACE_REG   (DANUBE_PPE32_BASE + (0x0000 * 4))
+#define DANUBE_PPE32_INT_MASK_STATUS_REG     (DANUBE_PPE32_BASE + (0x0030 * 4))
+#define DANUBE_PPE32_INT_RESOURCE_REG        (DANUBE_PPE32_BASE + (0x0040 * 4))
+#define DANUBE_PPE32_CDM_CODE_MEM_B0         (DANUBE_PPE32_BASE + (0x1000 * 4))
+#define DANUBE_PPE32_CDM_CODE_MEM_B1         (DANUBE_PPE32_BASE + (0x2000 * 4))
+#define DANUBE_PPE32_DATA_MEM_MAP_REG_BASE   (DANUBE_PPE32_BASE + (0x4000 * 4))
+
+/************************************************************************/
+/*   Module       :   PPE register address and bits        		*/
+/************************************************************************/
+#define DANUBE_PPE32_BASE  0xBE180000
+#define DANUBE_PPE32_DEBUG_BREAK_TRACE_REG   (DANUBE_PPE32_BASE + (0x0000 * 4))
+#define DANUBE_PPE32_INT_MASK_STATUS_REG     (DANUBE_PPE32_BASE + (0x0030 * 4))
+#define DANUBE_PPE32_INT_RESOURCE_REG        (DANUBE_PPE32_BASE + (0x0040 * 4))
+#define DANUBE_PPE32_CDM_CODE_MEM_B0         (DANUBE_PPE32_BASE + (0x1000 * 4))
+#define DANUBE_PPE32_CDM_CODE_MEM_B1         (DANUBE_PPE32_BASE + (0x2000 * 4))
+#define DANUBE_PPE32_DATA_MEM_MAP_REG_BASE   (DANUBE_PPE32_BASE + (0x4000 * 4))
+
+/*
+ *    ETOP MDIO Registers
+ */
+#define ETOP_MDIO_CFG           ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0600 * 4)))
+#define ETOP_MDIO_ACC           ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0601 * 4)))
+#define ETOP_CFG                ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0602 * 4)))
+#define ETOP_IG_VLAN_COS        ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0603 * 4)))
+#define ETOP_IG_DSCP_COS3       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0604 * 4)))
+#define ETOP_IG_DSCP_COS2       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0605 * 4)))
+#define ETOP_IG_DSCP_COS1       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0606 * 4)))
+#define ETOP_IG_DSCP_COS0       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0607 * 4)))
+#define ETOP_IG_PLEN_CTRL       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0608 * 4)))
+#define ETOP_ISR                ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x060A * 4)))
+#define ETOP_IER                ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x060B * 4)))
+#define ETOP_VPID               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x060C * 4)))
+#define ENET_MAC_CFG            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0610 * 4)))  
+#define ENETS_DBA               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0612 * 4)))       
+#define ENETS_CBA               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0613 * 4)))        
+#define ENETS_CFG               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0614 * 4))) 
+#define ENETS_PGCNT             ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0615 * 4)))
+#define ENETS_PKTCNT            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0616 * 4)))
+#define ENETS_BUF_CTRL          ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0617 * 4)))
+#define ENETS_COS_CFG           ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0618 * 4)))
+#define ENETS_IGDROP            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0619 * 4)))
+#define ENETS_IGERR             ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x061A * 4))) 
+#define ENET_MAC_DA0           ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x061B * 4))) 
+#define ENET_MAC_DA1           ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x061C * 4))) 
+
+#define ENETF_DBA               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0630 * 4)))
+#define ENETF_CBA               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0631 * 4)))
+#define ENETF_CFG               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0632 * 4)))
+#define ENETF_PGCNT             ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0633 * 4)))
+#define ENETF_PKTCNT            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0634 * 4)))
+#define ENETF_HFCTRL            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0635 * 4)))
+#define ENETF_TXCTRL            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0636 * 4)))
+
+#define ENETF_VLCOS0            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0638 * 4)))
+#define ENETF_VLCOS1            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0639 * 4)))
+#define ENETF_VLCOS2            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x063A * 4)))
+#define ENETF_VLCOS3            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x063B * 4)))
+#define ENETF_EGERR             ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x063C * 4)))
+#define ENETF_EGDROP            ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x063D * 4)))
+
+
+/*
+ *    ETOP MDIO Registers
+ */
+#define DANUBE_PPE32_ETOP_MDIO_CFG           ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0600 * 4)))
+#define DANUBE_PPE32_ETOP_MDIO_ACC           ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0601 * 4)))
+#define DANUBE_PPE32_ETOP_CFG                ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0602 * 4)))
+#define DANUBE_PPE32_ETOP_IG_VLAN_COS        ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0603 * 4)))
+#define DANUBE_PPE32_ETOP_IG_DSCP_COS3       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0604 * 4)))
+#define DANUBE_PPE32_ETOP_IG_DSCP_COS2       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0605 * 4)))
+#define DANUBE_PPE32_ETOP_IG_DSCP_COS1       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0606 * 4)))
+#define DANUBE_PPE32_ETOP_IG_DSCP_COS0       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0607 * 4)))
+#define DANUBE_PPE32_ETOP_IG_PLEN_CTRL       ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0608 * 4)))
+#define DANUBE_PPE32_ETOP_ISR                ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x060A * 4)))
+#define DANUBE_PPE32_ETOP_IER                ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x060B * 4)))
+#define DANUBE_PPE32_ETOP_VPID               ((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x060C * 4)))
+
+
+/* ENET Register */
+#define DANUBE_PPE32_ENET_MAC_CFG            	((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0610 * 4)))
+#define DANUBE_PPE32_ENET_IG_PKTDROP          	((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0619 * 4)))
+#define DANUBE_PPE32_ENET_CoS_CFG          	((volatile u32 *)(DANUBE_PPE32_DATA_MEM_MAP_REG_BASE + (0x0618 * 4)))
+
+/*********LED register definition****************/
+
+#define DANUBE_LED                      0xBE100BB0
+#define DANUBE_LED_CON0                 ((volatile u32*)(DANUBE_LED + 0x0000))
+#define DANUBE_LED_CON1                 ((volatile u32*)(DANUBE_LED + 0x0004))
+#define DANUBE_LED_CPU0                 ((volatile u32*)(DANUBE_LED + 0x0008))
+#define DANUBE_LED_CPU1                 ((volatile u32*)(DANUBE_LED + 0x000C))
+#define DANUBE_LED_AR                   ((volatile u32*)(DANUBE_LED + 0x0010))
+
+
+
+
+/***********************************************************************/
+#define DANUBE_REG32(addr)		   *((volatile u32 *)(addr))
+/***********************************************************************/
+#endif //DANUBE_H 
diff --git a/package/uboot-ifxmips/files/include/asm-mips/errno.h b/package/uboot-ifxmips/files/include/asm-mips/errno.h
new file mode 100644
index 0000000..134a8fc
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/asm-mips/errno.h
@@ -0,0 +1,138 @@
+#ifndef _ARM_ERRNO_H
+#define _ARM_ERRNO_H
+
+#define	EPERM		 1	/* Operation not permitted */
+#define	ENOENT		 2	/* No such file or directory */
+#define	ESRCH		 3	/* No such process */
+#define	EINTR		 4	/* Interrupted system call */
+#define	EIO		 5	/* I/O error */
+#define	ENXIO		 6	/* No such device or address */
+#define	E2BIG		 7	/* Arg list too long */
+#define	ENOEXEC		 8	/* Exec format error */
+#define	EBADF		 9	/* Bad file number */
+#define	ECHILD		10	/* No child processes */
+#define	EAGAIN		11	/* Try again */
+#define	ENOMEM		12	/* Out of memory */
+#define	EACCES		13	/* Permission denied */
+#define	EFAULT		14	/* Bad address */
+#define	ENOTBLK		15	/* Block device required */
+#define	EBUSY		16	/* Device or resource busy */
+#define	EEXIST		17	/* File exists */
+#define	EXDEV		18	/* Cross-device link */
+#define	ENODEV		19	/* No such device */
+#define	ENOTDIR		20	/* Not a directory */
+#define	EISDIR		21	/* Is a directory */
+#define	EINVAL		22	/* Invalid argument */
+#define	ENFILE		23	/* File table overflow */
+#define	EMFILE		24	/* Too many open files */
+#define	ENOTTY		25	/* Not a typewriter */
+#define	ETXTBSY		26	/* Text file busy */
+#define	EFBIG		27	/* File too large */
+#define	ENOSPC		28	/* No space left on device */
+#define	ESPIPE		29	/* Illegal seek */
+#define	EROFS		30	/* Read-only file system */
+#define	EMLINK		31	/* Too many links */
+#define	EPIPE		32	/* Broken pipe */
+#define	EDOM		33	/* Math argument out of domain of func */
+#define	ERANGE		34	/* Math result not representable */
+#define	EDEADLK		35	/* Resource deadlock would occur */
+#define	ENAMETOOLONG	36	/* File name too long */
+#define	ENOLCK		37	/* No record locks available */
+#define	ENOSYS		38	/* Function not implemented */
+#define	ENOTEMPTY	39	/* Directory not empty */
+#define	ELOOP		40	/* Too many symbolic links encountered */
+#define	EWOULDBLOCK	EAGAIN	/* Operation would block */
+#define	ENOMSG		42	/* No message of desired type */
+#define	EIDRM		43	/* Identifier removed */
+#define	ECHRNG		44	/* Channel number out of range */
+#define	EL2NSYNC	45	/* Level 2 not synchronized */
+#define	EL3HLT		46	/* Level 3 halted */
+#define	EL3RST		47	/* Level 3 reset */
+#define	ELNRNG		48	/* Link number out of range */
+#define	EUNATCH		49	/* Protocol driver not attached */
+#define	ENOCSI		50	/* No CSI structure available */
+#define	EL2HLT		51	/* Level 2 halted */
+#define	EBADE		52	/* Invalid exchange */
+#define	EBADR		53	/* Invalid request descriptor */
+#define	EXFULL		54	/* Exchange full */
+#define	ENOANO		55	/* No anode */
+#define	EBADRQC		56	/* Invalid request code */
+#define	EBADSLT		57	/* Invalid slot */
+#define	EDEADLOCK	58	/* File locking deadlock error */
+#define	EBFONT		59	/* Bad font file format */
+#define	ENOSTR		60	/* Device not a stream */
+#define	ENODATA		61	/* No data available */
+#define	ETIME		62	/* Timer expired */
+#define	ENOSR		63	/* Out of streams resources */
+#define	ENONET		64	/* Machine is not on the network */
+#define	ENOPKG		65	/* Package not installed */
+#define	EREMOTE		66	/* Object is remote */
+#define	ENOLINK		67	/* Link has been severed */
+#define	EADV		68	/* Advertise error */
+#define	ESRMNT		69	/* Srmount error */
+#define	ECOMM		70	/* Communication error on send */
+#define	EPROTO		71	/* Protocol error */
+#define	EMULTIHOP	72	/* Multihop attempted */
+#define	EDOTDOT		73	/* RFS specific error */
+#define	EBADMSG		74	/* Not a data message */
+#define	EOVERFLOW	75	/* Value too large for defined data type */
+#define	ENOTUNIQ	76	/* Name not unique on network */
+#define	EBADFD		77	/* File descriptor in bad state */
+#define	EREMCHG		78	/* Remote address changed */
+#define	ELIBACC		79	/* Can not access a needed shared library */
+#define	ELIBBAD		80	/* Accessing a corrupted shared library */
+#define	ELIBSCN		81	/* .lib section in a.out corrupted */
+#define	ELIBMAX		82	/* Attempting to link in too many shared libraries */
+#define	ELIBEXEC	83	/* Cannot exec a shared library directly */
+#define	EILSEQ		84	/* Illegal byte sequence */
+#define	ERESTART	85	/* Interrupted system call should be restarted */
+#define	ESTRPIPE	86	/* Streams pipe error */
+#define	EUSERS		87	/* Too many users */
+#define	ENOTSOCK	88	/* Socket operation on non-socket */
+#define	EDESTADDRREQ	89	/* Destination address required */
+#define	EMSGSIZE	90	/* Message too long */
+#define	EPROTOTYPE	91	/* Protocol wrong type for socket */
+#define	ENOPROTOOPT	92	/* Protocol not available */
+#define	EPROTONOSUPPORT	93	/* Protocol not supported */
+#define	ESOCKTNOSUPPORT	94	/* Socket type not supported */
+#define	EOPNOTSUPP	95	/* Operation not supported on transport endpoint */
+#define	EPFNOSUPPORT	96	/* Protocol family not supported */
+#define	EAFNOSUPPORT	97	/* Address family not supported by protocol */
+#define	EADDRINUSE	98	/* Address already in use */
+#define	EADDRNOTAVAIL	99	/* Cannot assign requested address */
+#define	ENETDOWN	100	/* Network is down */
+#define	ENETUNREACH	101	/* Network is unreachable */
+#define	ENETRESET	102	/* Network dropped connection because of reset */
+#define	ECONNABORTED	103	/* Software caused connection abort */
+#define	ECONNRESET	104	/* Connection reset by peer */
+#define	ENOBUFS		105	/* No buffer space available */
+#define	EISCONN		106	/* Transport endpoint is already connected */
+#define	ENOTCONN	107	/* Transport endpoint is not connected */
+#define	ESHUTDOWN	108	/* Cannot send after transport endpoint shutdown */
+#define	ETOOMANYREFS	109	/* Too many references: cannot splice */
+#define	ETIMEDOUT	110	/* Connection timed out */
+#define	ECONNREFUSED	111	/* Connection refused */
+#define	EHOSTDOWN	112	/* Host is down */
+#define	EHOSTUNREACH	113	/* No route to host */
+#define	EALREADY	114	/* Operation already in progress */
+#define	EINPROGRESS	115	/* Operation now in progress */
+#define	ESTALE		116	/* Stale NFS file handle */
+#define	EUCLEAN		117	/* Structure needs cleaning */
+#define	ENOTNAM		118	/* Not a XENIX named type file */
+#define	ENAVAIL		119	/* No XENIX semaphores available */
+#define	EISNAM		120	/* Is a named type file */
+#define	EREMOTEIO	121	/* Remote I/O error */
+#define	EDQUOT		122	/* Quota exceeded */
+
+#define	ENOMEDIUM	123	/* No medium found */
+#define	EMEDIUMTYPE	124	/* Wrong medium type */
+
+/* Should never be seen by user programs */
+#define ERESTARTSYS	512
+#define ERESTARTNOINTR	513
+#define ERESTARTNOHAND	514	/* restart if no handler.. */
+#define ENOIOCTLCMD	515	/* No ioctl command */
+
+#define _LAST_ERRNO	515
+
+#endif
diff --git a/package/uboot-ifxmips/files/include/asm-mips/ifx_asc.h b/package/uboot-ifxmips/files/include/asm-mips/ifx_asc.h
new file mode 100644
index 0000000..51abc95
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/asm-mips/ifx_asc.h
@@ -0,0 +1,220 @@
+/*****************************************************************************
+ * DANUBE BootROM
+ * Copyright (c) 2005, Infineon Technologies AG, All rights reserved
+ * IFAP DC COM SD
+ *****************************************************************************/
+#ifndef __ASC_H
+#define __ASC_H
+
+#define DANUBEASC_TXFIFO_FL       		1
+#define DANUBEASC_RXFIFO_FL       		1
+#define DANUBEASC_TXFIFO_FULL     		16
+
+/* channel operating modes */
+#define	ASCOPT_CSIZE	0x00000003
+#define	ASCOPT_CS7	0x00000001
+#define	ASCOPT_CS8	0x00000002
+#define	ASCOPT_PARENB	0x00000004
+#define	ASCOPT_STOPB	0x00000008
+#define	ASCOPT_PARODD	0x00000010
+#define	ASCOPT_CREAD	0x00000020
+
+#define ASC_OPTIONS		(ASCOPT_CREAD | ASCOPT_CS8)
+
+/* ASC input select (0 or 1) */
+#define CONSOLE_TTY	0
+
+#define DANUBEASC_TXFIFO_FL       1
+#define DANUBEASC_RXFIFO_FL       1
+#define DANUBEASC_TXFIFO_FULL     16
+
+/* interrupt lines masks for the ASC device interrupts*/
+/* change these macroses if it's necessary */
+#define DANUBEASC_IRQ_LINE_ALL        0x0000007f  /* all IRQs */
+
+#define DANUBEASC_IRQ_LINE_TIR            0x00000001      /* Tx Int */
+#define DANUBEASC_IRQ_LINE_TBIR           0x00000002      /* Tx Buffer Int */
+#define DANUBEASC_IRQ_LINE_RIR            0x00000004      /* Rx Int */
+#define DANUBEASC_IRQ_LINE_EIR            0x00000008      /* Error Int */
+#define DANUBEASC_IRQ_LINE_ABSTIR         0x00000010      /* Autobaud Start Int */
+#define DANUBEASC_IRQ_LINE_ABDETIP        0x00000020      /* Autobaud Detection Int */
+#define DANUBEASC_IRQ_LINE_SFCIR          0x00000040      /* Software Flow Control Int */
+
+/* interrupt controller access macros */
+#define ASC_INTERRUPTS_ENABLE(X)  \
+*((volatile unsigned int*) DANUBE_ICU_IM0_IER) |= X;
+#define ASC_INTERRUPTS_DISABLE(X) \
+*((volatile unsigned int*) DANUBE_ICU_IM0_IER) &= ~X;
+#define ASC_INTERRUPTS_CLEAR(X)   \
+*((volatile unsigned int*) DANUBE_ICU_IM0_ISR) = X;
+
+/* CLC register's bits and bitfields */
+#define ASCCLC_DISR        0x00000001
+#define ASCCLC_DISS        0x00000002
+#define ASCCLC_RMCMASK     0x0000FF00
+#define ASCCLC_RMCOFFSET   8
+
+/* CON register's bits and bitfields */
+#define ASCCON_MODEMASK	0x0000000f
+#define ASCCON_M_8ASYNC	0x0
+#define ASCCON_M_8IRDA 	0x1
+#define ASCCON_M_7ASYNC	0x2
+#define ASCCON_M_7IRDA 	0x3
+#define ASCCON_WLSMASK 	0x0000000c
+#define ASCCON_WLSOFFSET	2
+#define ASCCON_WLS_8BIT	0x0
+#define ASCCON_WLS_7BIT	0x1
+#define ASCCON_PEN     	0x00000010
+#define ASCCON_ODD     	0x00000020
+#define ASCCON_SP      	0x00000040
+#define ASCCON_STP     	0x00000080
+#define ASCCON_BRS     	0x00000100
+#define ASCCON_FDE     	0x00000200
+#define ASCCON_ERRCLK  	0x00000400
+#define ASCCON_EMMASK  	0x00001800
+#define ASCCON_EMOFFSET	11
+#define ASCCON_EM_ECHO_OFF	0x0
+#define ASCCON_EM_ECHO_AB	0x1
+#define ASCCON_EM_ECHO_ON	0x2
+#define ASCCON_LB       	0x00002000
+#define ASCCON_ACO      	0x00004000
+#define ASCCON_R        	0x00008000
+#define ASCCON_PAL      	0x00010000
+#define ASCCON_FEN      	0x00020000
+#define ASCCON_RUEN     	0x00040000
+#define ASCCON_ROEN     	0x00080000
+#define ASCCON_TOEN     	0x00100000
+#define ASCCON_BEN      	0x00200000
+#define ASCCON_TXINV    	0x01000000
+#define ASCCON_RXINV    	0x02000000
+#define ASCCON_TXMSB    	0x04000000
+#define ASCCON_RXMSB    	0x08000000
+
+/* STATE register's bits and bitfields */
+#define ASCSTATE_REN     	0x00000001
+#define ASCSTATE_PE      	0x00010000
+#define ASCSTATE_FE      	0x00020000
+#define ASCSTATE_RUE     	0x00040000
+#define ASCSTATE_ROE     	0x00080000
+#define ASCSTATE_TOE     	0x00100000
+#define ASCSTATE_BE      	0x00200000
+#define ASCSTATE_TXBVMASK	0x07000000
+#define ASCSTATE_TXBVOFFSET	24
+#define ASCSTATE_TXEOM     	0x08000000
+#define ASCSTATE_RXBVMASK	0x70000000
+#define ASCSTATE_RXBVOFFSET	28
+#define ASCSTATE_RXEOM     	0x80000000
+
+/* WHBSTATE register's bits and bitfields */
+#define ASCWHBSTATE_CLRREN    0x00000001
+#define ASCWHBSTATE_SETREN    0x00000002
+#define ASCWHBSTATE_CLRPE     0x00000004
+#define ASCWHBSTATE_CLRFE     0x00000008
+#define ASCWHBSTATE_CLRRUE    0x00000010
+#define ASCWHBSTATE_CLRROE    0x00000020
+#define ASCWHBSTATE_CLRTOE    0x00000040
+#define ASCWHBSTATE_CLRBE     0x00000080
+#define ASCWHBSTATE_SETPE     0x00000100
+#define ASCWHBSTATE_SETFE     0x00000200
+#define ASCWHBSTATE_SETRUE    0x00000400
+#define ASCWHBSTATE_SETROE    0x00000800
+#define ASCWHBSTATE_SETTOE    0x00001000
+#define ASCWHBSTATE_SETBE     0x00002000
+
+/* ABCON register's bits and bitfields */
+#define ASCABCON_ABEN       0x0001
+#define ASCABCON_AUREN      0x0002
+#define ASCABCON_ABSTEN     0x0004
+#define ASCABCON_ABDETEN    0x0008
+#define ASCABCON_FCDETEN    0x0010
+
+/* FDV register mask, offset and bitfields*/
+#define ASCFDV_VALUE_MASK     0x000001FF
+
+/* WHBABCON register's bits and bitfields */
+#define ASCWHBABCON_CLRABEN     0x0001
+#define ASCWHBABCON_SETABEN     0x0002
+
+/* ABSTAT register's bits and bitfields */
+#define ASCABSTAT_FCSDET    0x0001
+#define ASCABSTAT_FCCDET    0x0002
+#define ASCABSTAT_SCSDET    0x0004
+#define ASCABSTAT_SCCDET    0x0008
+#define ASCABSTAT_DETWAIT   0x0010
+
+/* WHBABSTAT register's bits and bitfields */
+#define ASCWHBABSTAT_CLRFCSDET  0x0001
+#define ASCWHBABSTAT_SETFCSDET  0x0002
+#define ASCWHBABSTAT_CLRFCCDET  0x0004
+#define ASCWHBABSTAT_SETFCCDET  0x0008
+#define ASCWHBABSTAT_CLRSCSDET  0x0010
+#define ASCWHBABSTAT_SETSCSDET  0x0020
+#define ASCWHBABSTAT_CLRSCCDET  0x0040
+#define ASCWHBABSTAT_SETSCCDET  0x0080
+#define ASCWHBABSTAT_CLRDETWAIT 0x0100
+#define ASCWHBABSTAT_SETDETWAIT 0x0200
+
+/* TXFCON register's bits and bitfields */
+#define ASCTXFCON_TXFIFO1       0x00000400
+#define ASCTXFCON_TXFEN         0x0001
+#define ASCTXFCON_TXFFLU        0x0002
+#define ASCTXFCON_TXFITLMASK    0x3F00
+#define ASCTXFCON_TXFITLOFF     8
+
+/* RXFCON register's bits and bitfields */
+#define ASCRXFCON_RXFIFO1       0x00000400
+#define ASCRXFCON_RXFEN         0x0001
+#define ASCRXFCON_RXFFLU        0x0002
+#define ASCRXFCON_RXFITLMASK    0x3F00
+#define ASCRXFCON_RXFITLOFF     8
+
+/* FSTAT register's bits and bitfields */
+#define ASCFSTAT_RXFFLMASK      0x003F
+#define ASCFSTAT_TXFFLMASK      0x3F00
+#define ASCFSTAT_TXFFLOFF       8
+
+typedef  struct         /* DanubeAsc_t */
+{
+	volatile unsigned long  asc_clc;                            /*0x0000*/
+	volatile unsigned long  asc_pisel;                          /*0x0004*/
+	volatile unsigned long  asc_id;                             /*0x0008*/
+	volatile unsigned long  asc_rsvd1[1];   /* for mapping */   /*0x000C*/
+	volatile unsigned long  asc_con;                           /*0x0010*/
+	volatile unsigned long  asc_state;                          /*0x0014*/
+	volatile unsigned long  asc_whbstate;                       /*0x0018*/
+	volatile unsigned long  asc_rsvd2[1];   /* for mapping */   /*0x001C*/
+	volatile unsigned long  asc_tbuf;                           /*0x0020*/
+	volatile unsigned long  asc_rbuf;                           /*0x0024*/
+	volatile unsigned long  asc_rsvd3[2];   /* for mapping */   /*0x0028*/
+	volatile unsigned long  asc_abcon;                          /*0x0030*/
+	volatile unsigned long  asc_abstat;     /* not used */      /*0x0034*/
+	volatile unsigned long  asc_whbabcon;                       /*0x0038*/
+	volatile unsigned long  asc_whbabstat;  /* not used */      /*0x003C*/
+	volatile unsigned long  asc_rxfcon;                         /*0x0040*/
+	volatile unsigned long  asc_txfcon;                         /*0x0044*/
+	volatile unsigned long  asc_fstat;                          /*0x0048*/
+	volatile unsigned long  asc_rsvd4[1];   /* for mapping */   /*0x004C*/
+	volatile unsigned long  asc_bg;                             /*0x0050*/
+	volatile unsigned long  asc_bg_timer;                       /*0x0054*/
+	volatile unsigned long  asc_fdv;                            /*0x0058*/
+	volatile unsigned long  asc_pmw;                            /*0x005C*/
+	volatile unsigned long  asc_modcon;                         /*0x0060*/
+	volatile unsigned long  asc_modstat;                        /*0x0064*/
+	volatile unsigned long  asc_rsvd5[2];   /* for mapping */   /*0x0068*/
+	volatile unsigned long  asc_sfcc;                           /*0x0070*/
+	volatile unsigned long  asc_rsvd6[3];   /* for mapping */   /*0x0074*/
+	volatile unsigned long  asc_eomcon;                         /*0x0080*/
+	volatile unsigned long  asc_rsvd7[26];   /* for mapping */  /*0x0084*/
+	volatile unsigned long  asc_dmacon;                         /*0x00EC*/
+	volatile unsigned long  asc_rsvd8[1];   /* for mapping */   /*0x00F0*/
+	volatile unsigned long  asc_irnen;                          /*0x00F4*/
+	volatile unsigned long  asc_irnicr;                         /*0x00F8*/
+	volatile unsigned long  asc_irncr;                          /*0x00FC*/
+} DanubeAsc_t;
+
+int asc_init (void);
+void asc_puts (const char *s);
+void asc_putc (const char c);
+int asc_getc (void);
+
+#endif /* __ASC_H */
diff --git a/package/uboot-ifxmips/files/include/asm-mips/inca-ip2.h b/package/uboot-ifxmips/files/include/asm-mips/inca-ip2.h
new file mode 100644
index 0000000..19c8ceb
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/asm-mips/inca-ip2.h
@@ -0,0 +1,634 @@
+/************************************************************************
+ *
+ * Copyright (c) 2005
+ * Infineon Technologies AG
+ * St. Martin Strasse 53; 81669 Muenchen; Germany
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License
+ * as published by the Free Software Foundation; either version
+ * 2 of the License, or (at your option) any later version.
+ *
+ ************************************************************************/
+
+/***********************************************************************/
+/*  Module      :  DMA register address and bits                       */
+/***********************************************************************/
+         
+#define INCA_IP2_DMA				(KSEG1+0x14101000)
+/***********************************************************************/
+#define CONFIGURATION_REGISTERS_CLC (INCA_IP2_DMA + 0x00)
+#define CONFIGURATION_REGISTERS_ID (INCA_IP2_DMA + 0x08)
+#define GENERAL_REGISTERS_DMA_CTRL (INCA_IP2_DMA + 0x10)
+#define CHANNEL_RELATED_REGISTERS_DMA_CS (INCA_IP2_DMA + 0x18)
+#define CHANNEL_RELATED_REGISTERS_DMA_CCTRL (INCA_IP2_DMA + 0x1C)
+#define CHANNEL_RELATED_REGISTERS_DMA_CDBA (INCA_IP2_DMA + 0x20)
+#define CHANNEL_RELATED_REGISTERS_DMA_CDLEN (INCA_IP2_DMA + 0x24)
+#define CHANNEL_RELATED_REGISTERS_DMA_CIE (INCA_IP2_DMA + 0x2C)
+#define CHANNEL_RELATED_REGISTERS_DMA_CIS (INCA_IP2_DMA + 0x28)
+#define CHANNEL_RELATED_REGISTERS_DMA_CPOLL (INCA_IP2_DMA + 0x14)
+	
+#define PORT_RELATED_REGISTERS_DMA_PS (INCA_IP2_DMA + 0x40)
+#define PORT_RELATED_REGISTERS_DMA_PCTRL (INCA_IP2_DMA + 0x44)
+	
+#define INTERRUPT_NODE_REGISTERS_DMA_IRNEN (INCA_IP2_DMA + 0xF4)
+#define INTERRUPT_NODE_REGISTERS_DMA_IRNCR (INCA_IP2_DMA + 0xF8)
+#define INTERRUPT_NODE_REGISTERS_DMA_IRNICR (INCA_IP2_DMA + 0xFC)
+
+#if 0
+/* ISR */
+#define DMA_ISR_RDERR		0x20
+#define DMA_ISR_CMDCPT		0x10
+#define DMA_ISR_CPT			0x8
+#define DMA_ISR_DURR		0x4
+#define DMA_ISR_EOP			0x2
+#endif
+#define DMA_RESET_CHANNEL       0x00000002
+#define DMA_ENABLE_CHANNEL       0x00000001
+#define DMA_DESC_BYTEOFF_SHIFT		22
+
+#define DMA_POLLING_ENABLE		0x80000000
+#define DMA_POLLING_CNT			0x50	/*minimum 0x10, max 0xfff0*/
+
+/***********************************************************************/
+/*  Module      :  ICU register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_ICU                          (KSEG1+0x1F880200)
+/***********************************************************************/
+
+#define INCA_IP2_ICU_IM0_ISR                      ((volatile u32*)(INCA_IP2_ICU + 0x0000))
+#define INCA_IP2_ICU_IM0_IER                      ((volatile u32*)(INCA_IP2_ICU + 0x0008))
+#define INCA_IP2_ICU_IM0_IOSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0010))
+#define INCA_IP2_ICU_IM0_IRSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0018))
+#define INCA_IP2_ICU_IM0_IMR                      ((volatile u32*)(INCA_IP2_ICU + 0x0020))
+#define INCA_IP2_ICU_IM0_IMR_IID                  (1 << 31)
+#define INCA_IP2_ICU_IM0_IMR_IN_GET(value)        (((value) >> 0) & ((1 << 5) - 1))
+#define INCA_IP2_ICU_IM0_IMR_IN_SET(value)        (((( 1 << 5) - 1) & (value)) << 0)
+#define INCA_IP2_ICU_IM0_IR(value)                (1 << (value))
+
+#define INCA_IP2_ICU_IM1_ISR                      ((volatile u32*)(INCA_IP2_ICU + 0x0028))
+#define INCA_IP2_ICU_IM1_IER                      ((volatile u32*)(INCA_IP2_ICU + 0x0030))
+#define INCA_IP2_ICU_IM1_IOSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0038))
+#define INCA_IP2_ICU_IM1_IRSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0040))
+#define INCA_IP2_ICU_IM1_IMR                      ((volatile u32*)(INCA_IP2_ICU + 0x0048))
+#define INCA_IP2_ICU_IM1_IMR_IID                  (1 << 31)
+#define INCA_IP2_ICU_IM1_IMR_IN_GET(value)        (((value) >> 0) & ((1 << 5) - 1))
+#define INCA_IP2_ICU_IM1_IMR_IN_SET(value)        (((( 1 << 5) - 1) & (value)) << 0)
+#define INCA_IP2_ICU_IM1_IR(value)                (1 << (value))
+
+#define INCA_IP2_ICU_IM2_ISR                      ((volatile u32*)(INCA_IP2_ICU + 0x0050))
+#define INCA_IP2_ICU_IM2_IER                      ((volatile u32*)(INCA_IP2_ICU + 0x0058))
+#define INCA_IP2_ICU_IM2_IOSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0060))
+#define INCA_IP2_ICU_IM2_IRSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0068))
+#define INCA_IP2_ICU_IM2_IMR                      ((volatile u32*)(INCA_IP2_ICU + 0x0070))
+#define INCA_IP2_ICU_IM2_IMR_IID                  (1 << 31)
+#define INCA_IP2_ICU_IM2_IMR_IN_GET(value)        (((value) >> 0) & ((1 << 5) - 1))
+#define INCA_IP2_ICU_IM2_IMR_IN_SET(value)        (((( 1 << 5) - 1) & (value)) << 0)
+#define INCA_IP2_ICU_IM2_IR(value)                (1 << (value))
+
+#define INCA_IP2_ICU_IM3_ISR                      ((volatile u32*)(INCA_IP2_ICU + 0x0078))
+#define INCA_IP2_ICU_IM3_IER                      ((volatile u32*)(INCA_IP2_ICU + 0x0080))
+#define INCA_IP2_ICU_IM3_IOSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0088))
+#define INCA_IP2_ICU_IM3_IRSR                     ((volatile u32*)(INCA_IP2_ICU + 0x0090))
+#define INCA_IP2_ICU_IM3_IMR                      ((volatile u32*)(INCA_IP2_ICU + 0x0098))
+#define INCA_IP2_ICU_IM3_IMR_IID                  (1 << 31)
+#define INCA_IP2_ICU_IM3_IMR_IN_GET(value)        (((value) >> 0) & ((1 << 5) - 1))
+#define INCA_IP2_ICU_IM3_IMR_IN_SET(value)        (((( 1 << 5) - 1) & (value)) << 0)
+#define INCA_IP2_ICU_IM3_IR(value)                (1 << (value))
+
+#define INCA_IP2_ICU_IM4_ISR                      ((volatile u32*)(INCA_IP2_ICU + 0x00A0))
+#define INCA_IP2_ICU_IM4_IER                      ((volatile u32*)(INCA_IP2_ICU + 0x00A8))
+#define INCA_IP2_ICU_IM4_IOSR                     ((volatile u32*)(INCA_IP2_ICU + 0x00B0))
+#define INCA_IP2_ICU_IM4_IRSR                     ((volatile u32*)(INCA_IP2_ICU + 0x00B8))
+#define INCA_IP2_ICU_IM4_IMR                      ((volatile u32*)(INCA_IP2_ICU + 0x00C0))
+#define INCA_IP2_ICU_IM4_IMR_IID                  (1 << 31)
+#define INCA_IP2_ICU_IM4_IMR_IN_GET(value)        (((value) >> 0) & ((1 << 5) - 1))
+#define INCA_IP2_ICU_IM4_IMR_IN_SET(value)        (((( 1 << 5) - 1) & (value)) << 0)
+#define INCA_IP2_ICU_IM4_IR(value)                (1 << (value))
+
+#define INCA_IP2_ICU_IM5_ISR                      ((volatile u32*)(INCA_IP2_ICU + 0x00C8))
+#define INCA_IP2_ICU_IM5_IER                      ((volatile u32*)(INCA_IP2_ICU + 0x00D0))
+#define INCA_IP2_ICU_IM5_IOSR                     ((volatile u32*)(INCA_IP2_ICU + 0x00D8))
+#define INCA_IP2_ICU_IM5_IRSR                     ((volatile u32*)(INCA_IP2_ICU + 0x00E0))
+#define INCA_IP2_ICU_IM5_IMR                      ((volatile u32*)(INCA_IP2_ICU + 0x00E8))
+#define INCA_IP2_ICU_IM5_IMR_IID                  (1 << 31)
+#define INCA_IP2_ICU_IM5_IMR_IN_GET(value)        (((value) >> 0) & ((1 << 5) - 1))
+#define INCA_IP2_ICU_IM5_IMR_IN_SET(value)        (((( 1 << 5) - 1) & (value)) << 0)
+#define INCA_IP2_ICU_IM5_IR(value)                (1 << (value))
+
+
+/***********************************************************************/
+/*  Module      :  CGU register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_CGU                          (KSEG1+0x1F100800)
+/***********************************************************************/
+
+#define INCA_IP2_CGU_PLL2CR                       ((volatile u32*)(INCA_IP2_CGU + 0x0008))
+#define INCA_IP2_CGU_FBSCR                        ((volatile u32*)(INCA_IP2_CGU + 0x0018))
+#define INCA_IP2_CGU_FBSCR_LPBSDIV_GET(value)     (((value) >> 6) & ((1 << 2) - 1))
+#define INCA_IP2_CGU_FBSCR_DIV0_GET(value)        (((value) >> 0) & ((1 << 3) - 1))
+#define INCA_IP2_CGU_FBSCR_DIV1_GET(value)        (((value) >> 4) & ((1 << 2) - 1))
+
+/***********************************************************************/
+/*  Module      :  MPS register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_MPS                          (KSEG1+0x1F101400)
+/***********************************************************************/
+
+#define INCA_IP2_MPS_CHIPID                       ((volatile u32*)(INCA_IP2_MPS + 0x0344))
+#define INCA_IP2_MPS_CHIPID_VERSION_GET(value)    (((value) >> 28) & ((1 << 4) - 1))
+#define INCA_IP2_MPS_CHIPID_VERSION_SET(value)    (((( 1 << 4) - 1) & (value)) << 28)
+#define INCA_IP2_MPS_CHIPID_PARTNUM_GET(value)    (((value) >> 12) & ((1 << 16) - 1))
+#define INCA_IP2_MPS_CHIPID_PARTNUM_SET(value)    (((( 1 << 16) - 1) & (value)) << 12)
+#define INCA_IP2_MPS_CHIPID_MANID_GET(value)      (((value) >> 1) & ((1 << 10) - 1))
+#define INCA_IP2_MPS_CHIPID_MANID_SET(value)      (((( 1 << 10) - 1) & (value)) << 1)
+
+
+/* voice channel 0 ... 3 interrupt enable register */
+#define INCA_IP2_MPS_VC0ENR ((volatile u32*)(INCA_IP2_MPS + 0x0000))
+#define INCA_IP2_MPS_VC1ENR ((volatile u32*)(INCA_IP2_MPS + 0x0004))
+#define INCA_IP2_MPS_VC2ENR ((volatile u32*)(INCA_IP2_MPS + 0x0008))
+#define INCA_IP2_MPS_VC3ENR ((volatile u32*)(INCA_IP2_MPS + 0x000C))
+/* voice channel 0 ... 3 interrupt status read register */
+#define INCA_IP2_MPS_RVC0SR ((volatile u32*)(INCA_IP2_MPS + 0x0010))
+#define INCA_IP2_MPS_RVC1SR ((volatile u32*)(INCA_IP2_MPS + 0x0014))
+#define INCA_IP2_MPS_RVC2SR ((volatile u32*)(INCA_IP2_MPS + 0x0018))
+#define INCA_IP2_MPS_RVC3SR ((volatile u32*)(INCA_IP2_MPS + 0x001C))
+/* voice channel 0 ... 3 interrupt status set register */
+#define INCA_IP2_MPS_SVC0SR ((volatile u32*)(INCA_IP2_MPS + 0x0020))
+#define INCA_IP2_MPS_SVC1SR ((volatile u32*)(INCA_IP2_MPS + 0x0024))
+#define INCA_IP2_MPS_SVC2SR ((volatile u32*)(INCA_IP2_MPS + 0x0028))
+#define INCA_IP2_MPS_SVC3SR ((volatile u32*)(INCA_IP2_MPS + 0x002C))
+/* voice channel 0 ... 3 interrupt status clear register */
+#define INCA_IP2_MPS_CVC0SR ((volatile u32*)(INCA_IP2_MPS + 0x0030))
+#define INCA_IP2_MPS_CVC1SR ((volatile u32*)(INCA_IP2_MPS + 0x0034))
+#define INCA_IP2_MPS_CVC2SR ((volatile u32*)(INCA_IP2_MPS + 0x0038))
+#define INCA_IP2_MPS_CVC3SR ((volatile u32*)(INCA_IP2_MPS + 0x003C))
+/* common status 0 and 1 read register */
+#define INCA_IP2_MPS_RAD0SR ((volatile u32*)(INCA_IP2_MPS + 0x0040))
+#define INCA_IP2_MPS_RAD1SR ((volatile u32*)(INCA_IP2_MPS + 0x0044))
+/* common status 0 and 1 set register */
+#define INCA_IP2_MPS_SAD0SR ((volatile u32*)(INCA_IP2_MPS + 0x0048))
+#define INCA_IP2_MPS_SAD1SR ((volatile u32*)(INCA_IP2_MPS + 0x004C))
+/* common status 0 and 1 clear register */
+#define INCA_IP2_MPS_CAD0SR ((volatile u32*)(INCA_IP2_MPS + 0x0050))
+#define INCA_IP2_MPS_CAD1SR ((volatile u32*)(INCA_IP2_MPS + 0x0054))
+/* notification enable register */
+#define INCA_IP2_MPS_CPU0_NFER ((volatile u32*)(INCA_IP2_MPS + 0x0060))
+#define INCA_IP2_MPS_CPU1_NFER ((volatile u32*)(INCA_IP2_MPS + 0x0064))
+/* CPU to CPU interrup request register */
+#define INCA_IP2_MPS_CPU0_2_CPU1_IRR ((volatile u32*)(INCA_IP2_MPS + 0x0070))
+#define INCA_IP2_MPS_CPU0_2_CPU1_IER ((volatile u32*)(INCA_IP2_MPS + 0x0074))
+/* Global interrupt request and request enable register */
+#define INCA_IP2_MPS_GIRR ((volatile u32*)(INCA_IP2_MPS + 0x0078))
+#define INCA_IP2_MPS_GIER ((volatile u32*)(INCA_IP2_MPS + 0x007C))
+
+/* Addresses of enable registers not yet defined 
+#define INCA_IP2_MPS_AD0ENR ((volatile u32*)(INCA_IP2_MPS + 0x????))
+#define INCA_IP2_MPS_AD1ENR ((volatile u32*)(INCA_IP2_MPS + 0x????))
+*/
+
+
+/***********************************************************************/
+/*  Module      :  ASC0 register address and bits                      */
+/***********************************************************************/
+
+#define INCA_IP2_ASC0                          (KSEG1+0x1E000400)
+/***********************************************************************/
+
+#define INCA_IP2_ASC0_TBUF                        ((volatile u32*)(INCA_IP2_ASC0 + 0x0020))
+#define INCA_IP2_ASC0_RBUF                        ((volatile u32*)(INCA_IP2_ASC0 + 0x0024))
+#define INCA_IP2_ASC0_FSTAT                       ((volatile u32*)(INCA_IP2_ASC0 + 0x0048))
+#define INCA_IP2_ASC0_FSTAT_TXFREE_GET(value)     (((value) >> 24) & ((1 << 6) - 1))
+#define INCA_IP2_ASC0_FSTAT_TXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 24)
+#define INCA_IP2_ASC0_FSTAT_RXFREE_GET(value)     (((value) >> 16) & ((1 << 6) - 1))
+#define INCA_IP2_ASC0_FSTAT_RXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 16)
+#define INCA_IP2_ASC0_FSTAT_TXFFL_GET(value)      (((value) >> 8) & ((1 << 6) - 1))
+#define INCA_IP2_ASC0_FSTAT_TXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 8)
+#define INCA_IP2_ASC0_FSTAT_RXFFL_GET(value)      (((value) >> 0) & ((1 << 6) - 1))
+#define INCA_IP2_ASC0_FSTAT_RXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 0)
+
+
+/***********************************************************************/
+/*  Module      :  ASC1 register address and bits                      */
+/***********************************************************************/
+
+#define INCA_IP2_ASC1                          (KSEG1+0x1E000800)
+/***********************************************************************/
+
+#define INCA_IP2_ASC1_TBUF                        ((volatile u32*)(INCA_IP2_ASC1 + 0x0020))
+#define INCA_IP2_ASC1_RBUF                        ((volatile u32*)(INCA_IP2_ASC1 + 0x0024))
+#define INCA_IP2_ASC1_FSTAT                       ((volatile u32*)(INCA_IP2_ASC1 + 0x0048))
+#define INCA_IP2_ASC1_FSTAT_TXFREE_GET(value)     (((value) >> 24) & ((1 << 6) - 1))
+#define INCA_IP2_ASC1_FSTAT_TXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 24)
+#define INCA_IP2_ASC1_FSTAT_RXFREE_GET(value)     (((value) >> 16) & ((1 << 6) - 1))
+#define INCA_IP2_ASC1_FSTAT_RXFREE_SET(value)     (((( 1 << 6) - 1) & (value)) << 16)
+#define INCA_IP2_ASC1_FSTAT_TXFFL_GET(value)      (((value) >> 8) & ((1 << 6) - 1))
+#define INCA_IP2_ASC1_FSTAT_TXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 8)
+#define INCA_IP2_ASC1_FSTAT_RXFFL_GET(value)      (((value) >> 0) & ((1 << 6) - 1))
+#define INCA_IP2_ASC1_FSTAT_RXFFL_SET(value)      (((( 1 << 6) - 1) & (value)) << 0)
+
+
+/***********************************************************************/
+/*  Module      :  RCU register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_RCU                          (KSEG1+0x1E001C00)
+/***********************************************************************/
+
+/***Reset Request Register***/ 
+#define INCA_IP2_RCU_RST_REQ                      ((volatile u32*)(INCA_IP2_RCU + 0x0000))
+#define INCA_IP2_RCU_RST_REQ_CPU0                 (1 << 31)
+#define INCA_IP2_RCU_RST_REQ_CPU1                 (1 << 30)
+#define INCA_IP2_RCU_RST_REQ_CPUSUB               (1 << 29)
+#define INCA_IP2_RCU_RST_REQ_HRST                 (1 << 28)
+#define INCA_IP2_RCU_RST_REQ_WDT0                 (1 << 27)
+#define INCA_IP2_RCU_RST_REQ_WDT1                 (1 << 26)
+#define INCA_IP2_RCU_RST_REQ_CFG_GET(value)       (((value) >> 23) & ((1 << 3) - 1))
+#define INCA_IP2_RCU_RST_REQ_CFG_SET(value)       (((( 1 << 3) - 1) & (value)) << 23)
+#define INCA_IP2_RCU_RST_REQ_SWTBOOT              (1 << 22)
+#define INCA_IP2_RCU_RST_REQ_DMA                  (1 << 21)
+#define INCA_IP2_RCU_RST_REQ_ETHPHY1              (1 << 20)
+#define INCA_IP2_RCU_RST_REQ_ETHPHY0              (1 << 19)
+#define INCA_IP2_RCU_RST_REQ_CPU0_BR              (1 << 18)
+
+/* CPU0, CPU1, CPUSUB, HRST, WDT0, WDT1, DMA, ETHPHY1, ETHPHY0 */
+#define INCA_IP2_RCU_RST_REQ_ALL                  0xFC380000 
+
+/***NMI Status Register***/ 
+#define INCA_IP2_RCU_NMISR                        ((volatile u32*)(INCA_IP2_RCU + 0x00F4))
+#define INCA_IP2_RCU_NMISR_NMIEXT                 (1 << 2)
+#define INCA_IP2_RCU_NMISR_NMIPLL2                (1 << 1)
+#define INCA_IP2_RCU_NMISR_NMIPLL1                (1 << 0)
+
+
+/***********************************************************************/
+/*  Module      :  WDT register address and bits                       */
+/***********************************************************************/
+         
+#define INCA_IP2_WDT                           (KSEG1+0x1F880000)
+/***********************************************************************/
+
+/***Watchdog Timer Control Register ***/ 
+#define INCA_IP2_WDT_BIU_WDT_CR                   ((volatile u32*)(INCA_IP2_WDT + 0x03F0))
+#define INCA_IP2_WDT_BIU_WDT_CR_GEN               (1 << 31)
+#define INCA_IP2_WDT_BIU_WDT_CR_DSEN              (1 << 30)
+#define INCA_IP2_WDT_BIU_WDT_CR_LPEN              (1 << 29)
+#define INCA_IP2_WDT_BIU_WDT_CR_PWL_GET(value)    (((value) >> 26) & ((1 << 2) - 1))
+#define INCA_IP2_WDT_BIU_WDT_CR_PWL_SET(value)    (((( 1 << 2) - 1) & (value)) << 26)
+#define INCA_IP2_WDT_BIU_WDT_CR_CLKDIV_GET(value) (((value) >> 24) & ((1 << 2) - 1))
+#define INCA_IP2_WDT_BIU_WDT_CR_CLKDIV_SET(value) (((( 1 << 2) - 1) & (value)) << 24)
+#define INCA_IP2_WDT_BIU_WDT_CR_PW_GET(value)     (((value) >> 16) & ((1 << 8) - 1))
+#define INCA_IP2_WDT_BIU_WDT_CR_PW_SET(value)     (((( 1 << 8) - 1) & (value)) << 16)
+#define INCA_IP2_WDT_BIU_WDT_CR_RELOAD_GET(value) (((value) >> 0) & ((1 << 16) - 1))
+#define INCA_IP2_WDT_BIU_WDT_CR_RELOAD_SET(value) (((( 1 << 16) - 1) & (value)) << 0)
+
+/***Watchdog Timer Status Register***/ 
+#define INCA_IP2_WDT_BIU_WDT_SR                   ((volatile u32*)(INCA_IP2_WDT + 0x03F8))
+#define INCA_IP2_WDT_BIU_WDT_SR_EN                (1 << 31)
+#define INCA_IP2_WDT_BIU_WDT_SR_AE                (1 << 30)
+#define INCA_IP2_WDT_BIU_WDT_SR_PRW               (1 << 29)
+#define INCA_IP2_WDT_BIU_WDT_SR_EXP               (1 << 28)
+#define INCA_IP2_WDT_BIU_WDT_SR_PWD               (1 << 27)
+#define INCA_IP2_WDT_BIU_WDT_SR_DS                (1 << 26)
+#define INCA_IP2_WDT_BIU_WDT_SR_VALUE_GET(value)  (((value) >> 0) & ((1 << 16) - 1))
+#define INCA_IP2_WDT_BIU_WDT_SR_VALUE_SET(value)  (((( 1 << 16) - 1) & (value)) << 0)
+
+
+/***********************************************************************/
+/*  Module      :  BCU0 register address and bits                      */
+/***********************************************************************/
+
+#define INCA_IP2_BCU0                           (KSEG1+0x14100000)
+/***********************************************************************/
+
+#define INCA_IP2_BCU0_CON                         ((volatile u32*)(INCA_IP2_BCU0 + 0x0010))
+#define INCA_IP2_BCU0_ECON                        ((volatile u32*)(INCA_IP2_BCU0 + 0x0020))
+#define INCA_IP2_BCU0_EADD                        ((volatile u32*)(INCA_IP2_BCU0 + 0x0024))
+#define INCA_IP2_BCU0_EDAT                        ((volatile u32*)(INCA_IP2_BCU0 + 0x0028))
+#define INCA_IP2_BCU0_IRNCR1                      ((volatile u32*)(INCA_IP2_BCU0 + 0x00F8))
+#define INCA_IP2_BCU0_IRNCR0                      ((volatile u32*)(INCA_IP2_BCU0 + 0x00FC))
+
+
+/***********************************************************************/
+/*  Module      :  BCU1 register address and bits                      */
+/***********************************************************************/
+
+#define INCA_IP2_BCU1                           (KSEG1+0x1E000000)
+/***********************************************************************/
+
+#define INCA_IP2_BCU1_CON                         ((volatile u32*)(INCA_IP2_BCU1 + 0x0010))
+#define INCA_IP2_BCU1_ECON                        ((volatile u32*)(INCA_IP2_BCU1 + 0x0020))
+#define INCA_IP2_BCU1_EADD                        ((volatile u32*)(INCA_IP2_BCU1 + 0x0024))
+#define INCA_IP2_BCU1_EDAT                        ((volatile u32*)(INCA_IP2_BCU1 + 0x0028))
+#define INCA_IP2_BCU1_IRNCR1                      ((volatile u32*)(INCA_IP2_BCU1 + 0x00F8))
+#define INCA_IP2_BCU1_IRNCR0                      ((volatile u32*)(INCA_IP2_BCU1 + 0x00FC))
+
+
+/***********************************************************************/
+/*  Module      :  MC register address and bits                        */
+/***********************************************************************/
+
+#define INCA_IP2_MC                             (KSEG1+0x1F800000)
+/***********************************************************************/
+
+#define INCA_IP2_MC_ERRCAUSE                      ((volatile u32*)(INCA_IP2_MC + 0x0010))
+#define INCA_IP2_MC_ERRADDR                       ((volatile u32*)(INCA_IP2_MC + 0x0020))
+#define INCA_IP2_MC_CON                           ((volatile u32*)(INCA_IP2_MC + 0x0060))
+
+/***********************************************************************/
+/*  Module      :  MC SDRAM register address and bits                        */
+/***********************************************************************/
+#define INCA_IP2_SDRAM                          (KSEG1+0x1F800200)
+/***********************************************************************/
+#define INCA_IP2_SDRAM_MC_CFGPB0                  ((volatile u32*)(INCA_IP2_SDRAM + 0x0040))
+
+/***********************************************************************/
+/*  Module      :  MC DDR register address and bits                        */
+/***********************************************************************/
+#define INCA_IP2_DDR                            (KSEG1+0x1F801000)
+/***********************************************************************/
+#define INCA_IP2_DDR_MC_DC19                      ((volatile u32*)(INCA_IP2_DDR + 0x0130))
+#define INCA_IP2_DDR_MC_DC20                      ((volatile u32*)(INCA_IP2_DDR + 0x0140))
+
+
+/***********************************************************************/
+/*  Module      :  PMS register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_PMS     (KSEG1 + 0x1F100C00)
+
+#define INCA_IP2_PMS_PMS_SR				((volatile u32*) (INCA_IP2_PMS + 0x0000))
+#define INCA_IP2_PMS_PMS_SR_ASC1			(1 << 14)
+#define INCA_IP2_PMS_PMS_SR_ASC0			(1 << 13)
+#define INCA_IP2_PMS_PMS_GEN				((volatile u32*) (INCA_IP2_PMS + 0x0004))
+#define INCA_IP2_PMS_PMS_GEN_DMA			(1 << 16)
+#define INCA_IP2_PMS_PMS_GEN_ASC1			(1 << 14)
+#define INCA_IP2_PMS_PMS_GEN_ASC0			(1 << 13)
+#define INCA_IP2_PMS_PMS_GEN_SPI0			(1 << 11)
+#define INCA_IP2_PMS_PMS_GEN_SPI1			(1 << 12)
+#define INCA_IP2_PMS_PMS_CFG				((volatile u32*) (INCA_IP2_PMS + 0x0008))
+
+
+/***********************************************************************/
+/*  Module      :  GPIO register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_GPIO     (KSEG1 + 0x1F102600)
+
+#define INCA_IP2_GPIO_OUT		((volatile u32*) (INCA_IP2_GPIO + 0x0000))
+#define INCA_IP2_GPIO_IN			((volatile u32*) (INCA_IP2_GPIO + 0x0004))
+#define INCA_IP2_GPIO_DIR		((volatile u32*) (INCA_IP2_GPIO + 0x0008))
+#define INCA_IP2_GPIO_ALTSEL1		((volatile u32*) (INCA_IP2_GPIO + 0x000C))
+#define INCA_IP2_GPIO_ALTSEL2		((volatile u32*) (INCA_IP2_GPIO + 0x0010))
+#define INCA_IP2_GPIO_STOFF		((volatile u32*) (INCA_IP2_GPIO + 0x0014))
+#define INCA_IP2_GPIO_OD			((volatile u32*) (INCA_IP2_GPIO + 0x0018))
+#define INCA_IP2_GPIO_PUDEB		((volatile u32*) (INCA_IP2_GPIO + 0x001C))
+
+/***********************************************************************/
+/*  Module      :  RCU register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_RCU                          (KSEG1+0x1E001C00)
+/***********************************************************************/
+
+/***Reset Request Register***/ 
+#define INCA_IP2_RCU_RST_REQ                      ((volatile u32*)(INCA_IP2_RCU + 0x0000))
+#define INCA_IP2_RCU_RST_REQ_CPU0                 (1 << 31)
+#define INCA_IP2_RCU_RST_REQ_CPU1                 (1 << 30)
+#define INCA_IP2_RCU_RST_REQ_CPUSUB               (1 << 29)
+#define INCA_IP2_RCU_RST_REQ_HRST                 (1 << 28)
+#define INCA_IP2_RCU_RST_REQ_WDT0                 (1 << 27)
+#define INCA_IP2_RCU_RST_REQ_WDT1                 (1 << 26)
+#define INCA_IP2_RCU_RST_REQ_CFG_GET(value)       (((value) >> 23) & ((1 << 3) - 1))
+#define INCA_IP2_RCU_RST_REQ_CFG_SET(value)       (((( 1 << 3) - 1) & (value)) << 23)
+#define INCA_IP2_RCU_RST_REQ_SWTBOOT              (1 << 22)
+#define INCA_IP2_RCU_RST_REQ_DMA                  (1 << 21)
+#define INCA_IP2_RCU_RST_REQ_ETHPHY1              (1 << 20)
+#define INCA_IP2_RCU_RST_REQ_ETHPHY0              (1 << 19)
+#define INCA_IP2_RCU_RST_REQ_CPU0_BR              (1 << 18)
+
+/* CPU0, CPU1, CPUSUB, HRST, WDT0, WDT1, DMA, ETHPHY1, ETHPHY0 */
+#define INCA_IP2_RCU_RST_REQ_ALL                  0xFC380000 
+
+/***Reset Status Register***/ 
+#define INCA_IP2_RCU_SR                           ((volatile u32*)(INCA_IP2_RCU + 0x0008))
+
+/***NMI Status Register***/ 
+#define INCA_IP2_RCU_NMISR                        ((volatile u32*)(INCA_IP2_RCU + 0x00F4))
+#define INCA_IP2_RCU_NMISR_NMIEXT                 (1 << 2)
+#define INCA_IP2_RCU_NMISR_NMIPLL2                (1 << 1)
+#define INCA_IP2_RCU_NMISR_NMIPLL1                (1 << 0)
+
+/***********************************************************************/
+/*  Module      :  EBU register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_EBU                          (KSEG1+0x14102000)
+/***********************************************************************/
+
+#define INCA_IP2_EBU_ADDSEL0                      ((volatile u32*)(INCA_IP2_EBU + 0x0020))
+#define INCA_IP2_EBU_ADDSEL1                      ((volatile u32*)(INCA_IP2_EBU + 0x0024))
+#define INCA_IP2_EBU_ADDSEL2                      ((volatile u32*)(INCA_IP2_EBU + 0x0028))
+#define INCA_IP2_EBU_ADDSEL3                      ((volatile u32*)(INCA_IP2_EBU + 0x002C))
+#define INCA_IP2_EBU_CON0                      ((volatile u32*)(INCA_IP2_EBU + 0x0060))
+#define INCA_IP2_EBU_CON1                      ((volatile u32*)(INCA_IP2_EBU + 0x0064))
+#define INCA_IP2_EBU_CON2                      ((volatile u32*)(INCA_IP2_EBU + 0x0068))
+#define INCA_IP2_EBU_CON3                      ((volatile u32*)(INCA_IP2_EBU + 0x006C))
+#define INCA_IP2_EBU_CON_WRDIS                     (1 << 31)
+
+
+
+
+/***********************************************************************/
+/*  Module      :  SWITCH register address and bits                       */
+/***********************************************************************/
+
+#define INCA_IP2_SWITCH				(KSEG1+0x18000000)
+/***********************************************************************/
+
+/* PR Base address */
+#define PR_BASE		(INCA_IP2_SWITCH + 0x00008000)
+
+/* SE Base Address */
+#define SE_BASE		(INCA_IP2_SWITCH + 0x00009000)
+
+#define PR_CTRL_REG				(PR_BASE + 0x0000)	
+#define MA_LEARN_REG			(PR_BASE + 0x0004)
+#define DST_LOOKUP_REG			(PR_BASE + 0x0008)
+
+#define COS_SEL_REG				(PR_BASE + 0x000c)
+#define PRI2_COS_REG			(PR_BASE + 0x0010)		
+#define UNKNOWN_DEST_REG		(PR_BASE + 0x0014)
+	
+#define CPU_ACS_CTRL_REG		(PR_BASE + 0x0018)
+#define CPU_ACS_DATA_REG		(PR_BASE + 0x001c)
+
+#define MA_READ_REG				(PR_BASE + 0x0020)
+#define TB_CTRL_REG				(PR_BASE + 0x0024)
+#define RATE_REG				(PR_BASE + 0x0028)
+#define BURST_REG				(PR_BASE + 0x0048)
+#define EBURST_REG				(PR_BASE + 0x0068)
+
+#define RULE_SEL_REG			(PR_BASE + 0x0088)
+
+#define GEN_SFT_AGE_STB         (PR_BASE + 0x008C)
+#define PR_ISR_REG				(PR_BASE + 0x0090)
+#define PR_IMR_REG				(PR_BASE + 0x0094)
+#define PR_IPR_REG				(PR_BASE + 0x0098)
+#define BPDU_REG				(PR_BASE + 0x00A4)
+
+/*	Switching Engine Register Description	*/
+#define QLL_CMD_REG				(SE_BASE)
+#define QLL_DATA_REG0			(SE_BASE + 0x0004)
+#define QLL_DATA_REG1			(SE_BASE + 0x0008)
+
+#define VLAN_MIBS_CMD_REG		(SE_BASE + 0x000c)
+#define VLAN_MIBS_DATA_REG		(SE_BASE + 0x0010)
+
+#define SD_CMD_REG				(SE_BASE + 0x0014)
+#define SD_DATA_REGS0			(SE_BASE + 0x0018)
+#define SD_DATA_REGS1			(SE_BASE + 0x001C)
+#define SD_DATA_REGS2			(SE_BASE + 0x0020)
+
+#define VLAN_TBL_CMD_REG		(SE_BASE + 0x0024)
+#define VLAN_TBL_DATA_REG		(SE_BASE + 0x0028)
+
+#define FD_TBL_CMD_REG			(SE_BASE + 0x002c)
+#define FD_TBL_DATA_REG			(SE_BASE + 0x0030)
+
+#define SYMM_VLAN_REG			(SE_BASE + 0x0038)
+#define PORT_AUTH				(SE_BASE + 0x0048)
+#define CPU_LINK_OK_REG     	(SE_BASE + 0x0050)
+/* #define TRUNK_CTRL_REGS			(SE_BASE + 0x0054)  */
+#define MIRROR_PORT_REG			(SE_BASE + 0x0064)
+
+#define ST_PT_REG				(SE_BASE + 0x0068)
+#define JUMBO_ENABLE_REG		(SE_BASE + 0x006C)
+#define STACK_PORT_REG			(SE_BASE + 0x0074)
+#define EG_MON_REG              (SE_BASE + 0x007C)
+#define VR_MIB_REG		        (SE_BASE + 0x0080)
+#define QUEUE_CMD_REGS			(SE_BASE + 0x0090)
+
+#define GLOBAL_RX_WM_REG		(SE_BASE + 0x0200)
+#define PORT0_RX_WM_REG0		(SE_BASE + 0x0204)
+#define PORT1_RX_WM_REG0		(SE_BASE + 0x0208)
+#define PORT2_RX_WM_REG0		(SE_BASE + 0x020C)
+
+#define PORT_RX_WM_REGS			(SE_BASE + 0x0200)
+#define PORT_TX_WM_REGS			(SE_BASE + 0x0300)
+#define PORT0_TX_WM_REG0		(SE_BASE + 0x0330)
+#define PORT1_TX_WM_REG0		(SE_BASE + 0x0338)
+#define PORT2_TX_WM_REG0		(SE_BASE + 0x0340)
+#define PORT0_TX_WM_REG1		(SE_BASE + 0x0334)
+#define PORT1_TX_WM_REG1		(SE_BASE + 0x033C)
+#define PORT2_TX_WM_REG1		(SE_BASE + 0x0344)
+
+
+#define QUEUE_STATUS_REGS		(SE_BASE + 0x0400)
+
+#define SE_INT_STS_REG			(SE_BASE + 0x08e0)
+#define SE_INT_MSK_REG_RD	    (SE_BASE + 0x08e4)
+#define SE_INT_MSK_REG_WR		(SE_BASE + 0x08e8)
+#define SE_INT_PRI_REG_RD		(SE_BASE + 0x08ec)
+#define SE_INT_PRI_REG_WR		(SE_BASE + 0x08f0)  /* address too be defined*/
+
+/***********************************************************************/
+/*  Module      :  Ethernet Switch port related addresses and bits     */
+/***********************************************************************/
+#define GPORT0_BASE				(KSEG1+0x18006000)
+#define GPORT1_BASE				(KSEG1+0x18007000)
+#define GPORT2_BASE				(KSEG1+0x1800C000)
+
+#define PORTREG_BASE GPORT0_BASE
+
+#define SWITCH_P0_GMAC_REG (GPORT0_BASE + 0x0004)
+#define SWITCH_P0_GMAC_CTRL (GPORT0_BASE + 0x000C)
+#define SWITCH_P0_RTX_INT_STATUS (GPORT0_BASE + 0x0010)
+#define SWITCH_P0_RTX_INT_MASK (GPORT0_BASE + 0x0014)
+#define SWITCH_P0_INT_PRIORITY (GPORT0_BASE + 0x0018)
+#define SWITCH_P0_RX_CONF (GPORT0_BASE + 0x0400)
+#define SWITCH_P0_OFFSET0_REG (GPORT0_BASE + 0x0404)
+#define SWITCH_P0_OFFSET1_REG (GPORT0_BASE + 0x0408)
+#define SWITCH_P0_PORT_MASK0_REG (GPORT0_BASE + 0x0420)
+#define SWITCH_P0_PORT_MASK1_REG (GPORT0_BASE + 0x0424)
+#define SWITCH_P0_PORT_MASK2_REG (GPORT0_BASE + 0x0428)
+#define SWITCH_P0_PORT_MASK3_REG (GPORT0_BASE + 0x042C)
+#define SWITCH_P0_PORT_RULE0_REG (GPORT0_BASE + 0x0430)
+#define SWITCH_P0_PORT_RULE1_REG (GPORT0_BASE + 0x0434)
+#define SWITCH_P0_PORT_RULE2_REG (GPORT0_BASE + 0x0438)
+#define SWITCH_P0_PORT_RULE3_REG (GPORT0_BASE + 0x043C)
+#define SWITCH_P0_PORT_IKEY_SEL (GPORT0_BASE + 0x0440)
+#define SWITCH_P0_PORT_RX_VLAN_ID (GPORT0_BASE + 0x0450)
+#define SWITCH_P0_TX_CONF (GPORT0_BASE + 0x0800)
+#define SWITCH_P0_PORT_TX_VLAN_ID (GPORT0_BASE + 0x0804)
+#define SWITCH_P0_PORT_MIB_REG_0 (GPORT0_BASE + 0x0C00)
+#define SWITCH_P0_GMAC_MIB_REG_0 (GPORT0_BASE + 0x0C54)
+
+#define SWITCH_P1_GMAC_REG (GPORT1_BASE + 0x0004)
+#define SWITCH_P1_GMAC_CTRL (GPORT1_BASE + 0x000C)
+#define SWITCH_P1_RTX_INT_STATUS (GPORT1_BASE + 0x0010)
+#define SWITCH_P1_RTX_INT_MASK (GPORT1_BASE + 0x0014)
+#define SWITCH_P1_INT_PRIORITY (GPORT1_BASE + 0x0018)
+#define SWITCH_P1_RX_CONF (GPORT1_BASE + 0x0400)
+#define SWITCH_P1_OFFSET0_REG (GPORT1_BASE + 0x0404)
+#define SWITCH_P1_OFFSET1_REG (GPORT1_BASE + 0x0408)
+#define SWITCH_P1_PORT_MASK0_REG (GPORT1_BASE + 0x0420)
+#define SWITCH_P1_PORT_MASK1_REG (GPORT1_BASE + 0x0424)
+#define SWITCH_P1_PORT_MASK2_REG (GPORT1_BASE + 0x0428)
+#define SWITCH_P1_PORT_MASK3_REG (GPORT1_BASE + 0x042C)
+#define SWITCH_P1_PORT_RULE0_REG (GPORT1_BASE + 0x0430)
+#define SWITCH_P1_PORT_RULE1_REG (GPORT1_BASE + 0x0434)
+#define SWITCH_P1_PORT_RULE2_REG (GPORT1_BASE + 0x0438)
+#define SWITCH_P1_PORT_RULE3_REG (GPORT1_BASE + 0x043C)
+#define SWITCH_P1_PORT_IKEY_SEL (GPORT1_BASE + 0x0440)
+#define SWITCH_P1_PORT_RX_VLAN_ID (GPORT1_BASE + 0x0450)
+#define SWITCH_P1_TX_CONF (GPORT1_BASE + 0x0800)
+#define SWITCH_P1_PORT_TX_VLAN_ID (GPORT1_BASE + 0x0804)
+#define SWITCH_P1_PORT_MIB_REG_0 (GPORT1_BASE + 0x0C00)
+#define SWITCH_P1_GMAC_MIB_REG_0 (GPORT1_BASE + 0x0C54)
+
+#define SWITCH_P2_GMAC_REG (GPORT2_BASE + 0x0004)
+#define SWITCH_P2_GMAC_CTRL (GPORT2_BASE + 0x000C)
+#define SWITCH_P2_RTX_INT_STATUS (GPORT2_BASE + 0x0010)
+#define SWITCH_P2_RTX_INT_MASK (GPORT2_BASE + 0x0014)
+#define SWITCH_P2_INT_PRIORITY (GPORT2_BASE + 0x0018)
+#define SWITCH_P2_MDIO_ID_1 (GPORT2_BASE + 0x00A8)
+#define SWITCH_P2_PAUSE_CTL_1 (GPORT2_BASE + 0x00B0)
+#define SWITCH_P2_MDIO_MOD_SEL (GPORT2_BASE + 0x00B4)
+#define SWITCH_P2_MDIO_ACC_0 (GPORT2_BASE + 0x00B8)
+#define SWITCH_P2_RX_CONF (GPORT2_BASE + 0x0400)
+#define SWITCH_P2_OFFSET0_REG (GPORT2_BASE + 0x0404)
+#define SWITCH_P2_OFFSET1_REG (GPORT2_BASE + 0x0408)
+#define SWITCH_P2_PORT_MASK0_REG (GPORT2_BASE + 0x0420)
+#define SWITCH_P2_PORT_MASK1_REG (GPORT2_BASE + 0x0424)
+#define SWITCH_P2_PORT_MASK2_REG (GPORT2_BASE + 0x0428)
+#define SWITCH_P2_PORT_MASK3_REG (GPORT2_BASE + 0x042C)
+#define SWITCH_P2_PORT_RULE0_REG (GPORT2_BASE + 0x0430)
+#define SWITCH_P2_PORT_RULE1_REG (GPORT2_BASE + 0x0434)
+#define SWITCH_P2_PORT_RULE2_REG (GPORT2_BASE + 0x0438)
+#define SWITCH_P2_PORT_RULE3_REG (GPORT2_BASE + 0x043C)
+#define SWITCH_P2_PORT_IKEY_SEL (GPORT2_BASE + 0x0440)
+#define SWITCH_P2_PORT_RX_VLAN_ID (GPORT2_BASE + 0x0450)
+#define SWITCH_P2_TX_CONF (GPORT2_BASE + 0x0800)
+#define SWITCH_P2_PORT_TX_VLAN_ID (GPORT2_BASE + 0x0804)
+#define SWITCH_P2_PORT_MIB_REG_0 (GPORT2_BASE + 0x0C00)
+#define SWITCH_P2_GMAC_MIB_REG_0 (GPORT2_BASE + 0x0C54)
+
+#define MDIO_MOD_SEL SWITCH_P2_MDIO_MOD_SEL
+#define SWITCH_MDIO_ACC SWITCH_P2_MDIO_ACC_0
+#define SWITCH_MDIO_ID SWITCH_P2_MDIO_ID_1
+/* #define TX_CONFIG_REG SWITCH_P0_TX_CONF  */
+
+#define SWITCH_PMAC_HD_CTL (GPORT2_BASE + 0x0070)
+#define SWITCH_PMAC_SA1 (GPORT2_BASE + 0x0074)
+#define SWITCH_PMAC_SA2 (GPORT2_BASE + 0x0078)
+#define SWITCH_PMAC_DA1 (GPORT2_BASE + 0x007C)
+#define SWITCH_PMAC_DA2 (GPORT2_BASE + 0x0080)
+#define SWITCH_PMAC_VLAN (GPORT2_BASE + 0x0084)
+#define SWITCH_PMAC_TX_IPG (GPORT2_BASE + 0x0088)
+#define SWITCH_PMAC_RX_IPG (GPORT2_BASE + 0x008C)
+
diff --git a/package/uboot-ifxmips/files/include/asm-mips/pinstrap.h b/package/uboot-ifxmips/files/include/asm-mips/pinstrap.h
new file mode 100644
index 0000000..1a446fa
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/asm-mips/pinstrap.h
@@ -0,0 +1,12 @@
+#define FLASH_STRAP		0x1		
+#define MII_0_STRAP		0x2
+#define MII_1_STRAP		0x3
+#define ASC_STRAP		0x4
+#define SFLASH_STRAP		0x5
+#define RESERVE_STRAP		0x6
+#define PRODUCT_TEST_STRAP	0x7
+#define PIN_STRAP_MASK		0x001C0000
+#define PIN_STRAP_SHIFT		18
+#define PIN_STRAP		0xB0100914
+#define SDRAM_WIDTH_MASK	0x400000
+#define SDRAM_WIDTH_SHIFT	22
diff --git a/package/uboot-ifxmips/files/include/asm-mips/romconfig.h b/package/uboot-ifxmips/files/include/asm-mips/romconfig.h
new file mode 100644
index 0000000..8951b3a
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/asm-mips/romconfig.h
@@ -0,0 +1,66 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/*
+ * This file contains the configuration parameters for the DANUBE board.
+ */
+
+#ifndef __CONFIG_H
+#define __CONFIG_H
+
+
+#define EXCEPTION_BASE	0x200
+
+/*****************************************************************************
+ * DANUBE
+ *****************************************************************************/
+/* lock cache for C program stack */
+/* points to ROM */
+/* stack size is 16K */
+#define LOCK_DCACHE_ADDR       	0x9FC00000
+#define LOCK_DCACHE_SIZE       	0x1000
+#define CFG_EBU_BOOTWORD	      0x688c688c
+                                                                                                                                                             
+#define CFG_HZ       (danube_get_cpuclk() / 2)
+
+                                                                                                                                                             
+/*
+ * Memory layout
+ */
+//#define CFG_SDRAM_BASE       0x80080000
+#define CFG_CACHE_LOCK_SIZE  LOCK_DCACHE_SIZE
+#define CFG_INIT_SP_OFFSET   CFG_CACHE_LOCK_SIZE
+
+/*
+ * Cache settings
+ */
+#define CFG_CACHE_SIZE   16384
+#define CFG_CACHE_LINES  32
+#define CFG_CACHE_WAYS   4
+#define CFG_CACHE_SETS   128
+
+#define CFG_ICACHE_SIZE   CFG_CACHE_SIZE
+#define CFG_DCACHE_SIZE   CFG_CACHE_SIZE
+#define CFG_CACHELINE_SIZE  CFG_CACHE_LINES
+
+#endif	/* __CONFIG_H */
diff --git a/package/uboot-ifxmips/files/include/boot.h b/package/uboot-ifxmips/files/include/boot.h
new file mode 100644
index 0000000..8f70ebb
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/boot.h
@@ -0,0 +1,86 @@
+#ifndef _BOOT_H
+#define _BOOT_H
+
+/* All this should be defined somewhere in danube.h later... */
+
+#define MPS_SRAM_BASE_ADDRESS   0xBF200000
+#define MPS_SRAM_BOOT_OFFSET    0x1C0
+
+/* Offset for CPU1 (both CPUs have same register set) */
+#define BOOT_BASE_ADDRESS   (MPS_SRAM_BASE_ADDRESS + MPS_SRAM_BOOT_OFFSET)
+#define BOOT_CPU_OFFSET     0x20
+
+
+#ifdef __ASSEMBLY__
+#define BOOT_RVEC		      (BOOT_BASE_ADDRESS + 0x00)
+#define BOOT_NVEC		      (BOOT_BASE_ADDRESS + 0x04)
+#define BOOT_EVEC		      (BOOT_BASE_ADDRESS + 0x08)
+#define BOOT_CP0_CAUSE     (BOOT_BASE_ADDRESS + 0x0C)
+#define BOOT_CP0_EPC	      (BOOT_BASE_ADDRESS + 0x10)
+#define BOOT_CP0_EEPC	   (BOOT_BASE_ADDRESS + 0x14)
+#define BOOT_SIZE        (BOOT_BASE_ADDRESS + 0x18)   /* for CPU1 */
+#define BOOT_RCU_SR        (BOOT_BASE_ADDRESS + 0x18) /* for CPU0 */
+#define BOOT_CFG_STAT	   (BOOT_BASE_ADDRESS + 0x1C)
+#else
+#define BOOT_RVEC(cpu)		(volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x00)
+#define BOOT_NVEC(cpu)		(volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x04)
+#define BOOT_EVEC(cpu)		(volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x08)
+#define BOOT_CP0_STATUS(cpu)	(volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x0C)
+#define BOOT_CP0_EPC(cpu)	(volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x10)
+#define BOOT_CP0_EEPC(cpu)	(volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x14)
+#define BOOT_SIZE(cpu)       (volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x18)    /* for CPU1 */
+#define BOOT_RCU_SR(cpu)       (volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x18)  /* for CPU0 */
+#define BOOT_CFG_STAT(cpu)	(volatile u32*)(BOOT_BASE_ADDRESS + (cpu * BOOT_CPU_OFFSET) + 0x1C)
+#endif
+
+#define BOOT_CFG_NOR   		0x01
+#define BOOT_CFG_MII   		0x02
+#define BOOT_CFG_PCI  		0x03
+#define BOOT_CFG_ASC   		0x04
+#define BOOT_CFG_SFLASH		0x05
+#define BOOT_CFG_NAND  		0x06
+#define BOOT_CFG_RMII   	0x07
+#define BOOT_CFG_TEST   	0x00
+
+#define BOOT_NUM_RETRY  3
+
+#define BOOT_STAT_MASK_ALL     0x0000FFFF
+#define BOOT_STAT_MASK_STAT    0x0000F000
+#define BOOT_STAT_MASK_BERR    0x00000F00
+#define BOOT_STAT_MASK_BSTRAP  0x000000F0
+#define BOOT_STAT_MASK_BMODULE 0x0000000F
+
+#define BOOT_STAT_INIT         0x00000000
+#define BOOT_STAT_BSTRAP       0x00001000
+#define BOOT_STAT_RETRY        0x00002000
+#define BOOT_STAT_START        0x00003000
+#define BOOT_STAT_HALT         0x0000F000
+
+#define BOOT_ERR_NO_RVEC       0x00000100
+#define BOOT_ERR_NO_NVEC       0x00000200
+#define BOOT_ERR_NO_EVEC       0x00000300
+#define BOOT_ERR_BSTRAP        0x00000400
+#define BOOT_ERR_EXC           0x00000800
+
+#ifndef __ASSEMBLY__
+void boot_set_status( u32 status, u32 mask);
+void boot_set_config( u32 config);
+void boot_set_rvec( u32 vector);
+void boot_set_size( u32 size);
+void boot_sdbg( u8* string, u32 value);
+void boot_error( u32 berr);
+int boot_from_ebu(void);
+void _boot_rvec(void);
+typedef struct
+{
+	u32   cpu;              /** CPU number */
+	u32   config;           /** Boot configuration */
+   u32   endian;           /** CPU endianess */
+   u32   debug;            /** Debug mode */
+	u32	(*exit)(void);	   /** application vector */
+} boot_data;
+
+extern boot_data bootrom;
+#endif
+
+#endif /* #ifdef _BOOT_H */
diff --git a/package/uboot-ifxmips/files/include/configs/danube.h b/package/uboot-ifxmips/files/include/configs/danube.h
new file mode 100644
index 0000000..12cca11
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/configs/danube.h
@@ -0,0 +1,262 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/*
+ * This file contains the configuration parameters for the danube board.
+ */
+
+#ifndef __CONFIG_H
+#define __CONFIG_H
+
+#include <configs/ifx_cfg.h>
+
+#define  USE_REFERENCE_BOARD
+//#define   USE_EVALUATION_BOARD
+
+#define   DANUBE_BOOT_FROM_EBU
+#define   DANUBE_USE_DDR_RAM
+
+#ifdef DANUBE_USE_DDR_RAM
+//#define  DANUBE_DDR_RAM_111M
+#define DANUBE_DDR_RAM_166M
+//#define PROMOSDDR400
+//#define DDR_SAMSUNG_166M
+//#define DDR_PSC_166M
+//#define DANUBE_DDR_RAM_133M
+#define DANUBE_DDR_RAM_SIZE	32	/* 32M DDR-DRAM for reference board */
+#endif
+#define CLK_OUT2_25MHZ
+#define CONFIG_MIPS32		1	/* MIPS 4Kc CPU core	*/
+#define CONFIG_DANUBE		1	/* on a danube Board	*/
+#define RAM_SIZE                0x2000000 /*32M ram*/
+
+#define CPU_CLOCK_RATE		235000000   /* 235 MHz clock for the MIPS core */
+
+#define INFINEON_EBU_BOOTCFG	0x688C688C	/* CMULT = 8 for 150 MHz */
+
+#define CONFIG_BOOTDELAY	3	/* autoboot after 3 seconds	*/
+
+#define CONFIG_BAUDRATE		115200
+
+#define DEBUG_PARSER		2
+
+/* valid baudrates */
+#define CFG_BAUDRATE_TABLE	{ 300, 9600, 19200, 38400, 57600, 115200 }
+
+#ifndef CFG_HEAD_CODE
+#define	CONFIG_TIMESTAMP		/* Print image info with timestamp */
+#endif
+
+#define CONFIG_PREBOOT	"echo;"	\
+	"echo Type \"run flash_nfs\" to mount root filesystem over NFS;" \
+	"echo"
+
+#undef	CONFIG_BOOTARGS
+/* by MarsLin 2005/05/10, to support different hardware configuations */
+//#define CONFIG_EXTRA_ENV_SETTINGS	<configs/ifx_extra_env.h>
+#define CONFIG_EXTRA_ENV_SETTINGS \
+	"ethaddr=11:22:33:44:55:66\0" \
+	"serverip=192.168.45.100\0" \
+	"ipaddr=192.168.45.108\0"  \
+	"update_uboot=tftp 0x80500000 u-boot.ifx;era 1:0-10; cp.b 0x80500000 0xb0000000 0x10000\0" \
+	"update_openwrt=tftp 0x80500000 openwrt-ifxmips-squashfs.image; era 1:10-120; cp.b 0x80500000 0xb0030000 0x300000\0" \
+	"bootargs=console=ttyS1,115200 rootfstype=squashfs,jffs2 init=/etc/preinit\0"
+
+#define CONFIG_BOOTCOMMAND	"bootm 0xb0030000"
+
+#define CONFIG_COMMANDS_YES	(CONFIG_CMD_DFL	| \
+				 CFG_CMD_ASKENV		| \
+				 CFG_CMD_DHRYSTONE	| \
+				 CFG_CMD_NET	)
+
+#define CONFIG_COMMANDS_NO	(CFG_CMD_NFS		| \
+				 CFG_CMD_FPGA		| \
+				 CFG_CMD_IMLS		| \
+				 CFG_CMD_ITEST		| \
+				 CFG_CMD_XING		| \
+				 CFG_CMD_IMI		| \
+				 CFG_CMD_BMP		| \
+				 CFG_CMD_BOOTD		| \
+				 CFG_CMD_CONSOLE	| \
+				 CFG_CMD_LOADS		| \
+				 CFG_CMD_LOADB		)
+
+#define CONFIG_COMMANDS		(CONFIG_COMMANDS_YES & ~CONFIG_COMMANDS_NO)
+
+#if 0
+				 CFG_CMD_DHCP
+				 CFG_CMD_ELF
+				 CFG_CMD_NAND
+#endif
+
+#include <cmd_confdefs.h>
+
+/*
+ * Miscellaneous configurable options
+ */
+#define	CFG_LONGHELP				/* undef to save memory      */
+#define	CFG_PROMPT		"DANUBE # "	/* Monitor Command Prompt    */
+#define	CFG_CBSIZE		256		/* Console I/O Buffer Size   */
+#define	CFG_PBSIZE (CFG_CBSIZE+sizeof(CFG_PROMPT)+16)  /* Print Buffer Size */
+#define	CFG_MAXARGS		16		/* max number of command args*/
+
+#define CFG_MALLOC_LEN		128*1024
+
+#define CFG_BOOTPARAMS_LEN	128*1024
+
+#define CFG_HZ       (CPU_CLOCK_RATE / 2)
+
+#define	CFG_LOAD_ADDR		0x80100000	/* default load address	*/
+
+#define CFG_MEMTEST_START	0x80100000
+#define CFG_MEMTEST_END		0x80400000
+
+/*-----------------------------------------------------------------------
+ * FLASH and environment organization
+ */
+#define CFG_MAX_FLASH_BANKS	1	/* max number of memory banks */
+#define CFG_MAX_FLASH_SECT	(135)	/* max number of sectors on one chip */
+
+#define PHYS_FLASH_1		0xB0000000 /* Flash Bank #1 */
+#define PHYS_FLASH_2		0xB4000000 /* Flash Bank #2 */
+
+#define BOOTSTRAP_TEXT_BASE 0xb0000000 	
+
+/* The following #defines are needed to get flash environment right */
+#define	CFG_MONITOR_BASE	UBOOT_RAM_TEXT_BASE 	/* board/danube/config.mk. = 0xA0800000 */
+#define	BOOTSTRAP_CFG_MONITOR_BASE	BOOTSTRAP_TEXT_BASE 	/* board/danube/config.mk. = 0xA0800000 */
+#define	CFG_MONITOR_LEN		(256 << 10)
+
+#define CFG_INIT_SP_OFFSET	0x400000
+
+#define CFG_FLASH_BASE		PHYS_FLASH_1
+
+/* timeout values are in ticks */
+#define CFG_FLASH_ERASE_TOUT	(20 * CFG_HZ) /* Timeout for Flash Erase */
+#define CFG_FLASH_WRITE_TOUT	(20 * CFG_HZ) /* Timeout for Flash Write */
+
+#define	CFG_ENV_IS_IN_FLASH	1
+//#define CFG_ENV_IS_NOWHERE	1
+//#define CFG_ENV_IS_IN_NVRAM	1
+/* Address and size of Primary Environment Sector	*/
+#define CFG_ENV_ADDR		IFX_CFG_FLASH_UBOOT_CFG_START_ADDR
+#define CFG_ENV_SIZE		IFX_CFG_FLASH_UBOOT_CFG_SIZE
+
+#define CONFIG_FLASH_16BIT
+
+#define CONFIG_NR_DRAM_BANKS	1
+
+#define CONFIG_DANUBE_SWITCH
+#define CONFIG_NET_MULTI
+#define CONFIG_ENV_OVERWRITE
+
+#define EXCEPTION_BASE	0x200
+
+/**
+ *\brief definition for nand
+ *
+ */
+#define CFG_MAX_NAND_DEVICE	1	/* Max number of NAND devices		*/
+#define NAND_ChipID_UNKNOWN 	0x00
+#define SECTORSIZE 512
+#define NAND_MAX_FLOORS 1
+#define NAND_MAX_CHIPS 1
+
+
+#define ADDR_COLUMN 1
+#define ADDR_PAGE 2
+#define ADDR_COLUMN_PAGE 3
+
+
+#define AT91_SMART_MEDIA_ALE (1 << 22)  /* our ALE is AD22 */
+#define AT91_SMART_MEDIA_CLE (1 << 21)  /* our CLE is AD21 */
+
+#define NAND_DISABLE_CE(nand) 
+#define NAND_ENABLE_CE(nand)
+#define NAND_WAIT_READY(nand)
+#define WRITE_NAND_COMMAND(d, adr) 
+#define WRITE_NAND_ADDRESS(d, adr) 
+#define WRITE_NAND(d, adr) 
+#define READ_NAND(adr) 
+/* the following are NOP's in our implementation */
+#define NAND_CTL_CLRALE(nandptr)
+#define NAND_CTL_SETALE(nandptr)
+#define NAND_CTL_CLRCLE(nandptr)
+#define NAND_CTL_SETCLE(nandptr)
+
+
+
+#define NAND_BASE_ADDRESS  0xB4000000
+
+#define NAND_WRITE(addr, val)     *((u8*)(NAND_BASE_ADDRESS | (addr))) = val;while((*EBU_NAND_WAIT & 0x08) == 0);
+#define NAND_READ(addr, val)      val = *((u8*)(NAND_BASE_ADDRESS | (addr)))
+#define NAND_CE_SET 
+#define NAND_CE_CLEAR
+#define NAND_READY       ( ((*EBU_NAND_WAIT)&0x07) == 7)
+#define NAND_READY_CLEAR  *EBU_NAND_WAIT = 0;
+#define WRITE_CMD    0x18
+#define WRITE_ADDR   0x14
+#define WRITE_LADDR  0x10
+#define WRITE_DATA  0x10
+#define READ_DATA    0x10
+#define READ_LDATA   0x00
+#define ACCESS_WAIT
+#define IFX_ATC_NAND 0xc176
+#define IFX_BTC_NAND 0xc166
+#define ST_512WB2_NAND 0x2076
+
+#define NAND_OK              0x00000000    /* Bootstrap succesful, start address in BOOT_RVEC */
+#define NAND_ERR             0x80000000
+#define NAND_ACC_TIMEOUT     (NAND_ERR | 0x00000001)
+#define NAND_ACC_ERR         (NAND_ERR | 0x00000002)
+
+
+/*****************************************************************************
+ * DANUBE
+ *****************************************************************************/
+/* lock cache for C program stack */
+/* points to ROM */
+/* stack size is 16K */
+#define LOCK_DCACHE_ADDR       	0x9FC00000
+#define LOCK_DCACHE_SIZE       	0x1000
+
+/*
+ * Memory layout
+ */
+#define CFG_SDRAM_BASE		0x80000000
+#define CFG_SDRAM_BASE_UNCACHE	0xA0000000
+#define CFG_CACHE_LOCK_SIZE  LOCK_DCACHE_SIZE
+
+/*
+ * Cache settings
+ */
+#define CFG_CACHE_SIZE   16384
+#define CFG_CACHE_LINES  32
+#define CFG_CACHE_WAYS   4
+#define CFG_CACHE_SETS   128
+
+#define CFG_ICACHE_SIZE   CFG_CACHE_SIZE
+#define CFG_DCACHE_SIZE   CFG_CACHE_SIZE
+#define CFG_CACHELINE_SIZE  CFG_CACHE_LINES
+
+#endif	/* __CONFIG_H */
diff --git a/package/uboot-ifxmips/files/include/configs/ifx_cfg.h b/package/uboot-ifxmips/files/include/configs/ifx_cfg.h
new file mode 100644
index 0000000..101f2ac
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/configs/ifx_cfg.h
@@ -0,0 +1,249 @@
+/* ============================================================================
+ * Copyright (C) 2003[- 2004] ? Infineon Technologies AG.
+ *
+ * All rights reserved.
+ * ============================================================================
+ *
+ * ============================================================================
+ *
+ * This document contains proprietary information belonging to Infineon 
+ * Technologies AG. Passing on and copying of this document, and communication
+ * of its contents is not permitted without prior written authorisation.
+ * 
+ * ============================================================================
+ *
+ * File Name: ifx_cfg.h
+ * Author : Mars Lin (mars.lin@infineon.com)
+ * Date: 
+ *
+ * ===========================================================================
+ *
+ * Project:
+ * Block:
+ *
+ * ===========================================================================
+ * Contents:  This file contains the data structures and definitions used 
+ * 	      by the core iptables and the sip alg modules. 
+ * ===========================================================================
+ * References:
+ */
+
+/*
+ * This file contains the configuration parameters for the IFX board.
+ */
+#ifndef _DANUBE_CFG_H_
+#define _DANUBE_CFG_H_
+
+/*-----------------------------------------------------------------------
+ * U-Boot/Kernel configurations
+ */
+#define IFX_CFG_UBOOT_DEFAULT_CFG_IPADDR		"172.20.80.100"
+#define IFX_CFG_UBOOT_DEFAULT_CFG_SERVERIP		"172.20.80.2"
+#define IFX_CFG_UBOOT_DEFAULT_CFG_ETHADDR		"00:E0:92:00:01:40"
+#define IFX_CFG_UBOOT_DEFAULT_CFG_NETDEV		"eth1"
+#define IFX_CFG_UBOOT_DEFAULT_CFG_BAUDRATE		"115200"
+#define IFX_CFG_UBOOT_LOAD_ADDRESS                      "0x80800000"
+
+/* End of U-Boot/Kernel configurations
+ *-----------------------------------------------------------------------
+ */
+
+/*-----------------------------------------------------------------------
+ * Board specific configurations
+ */
+#ifdef IFX_CONFIG_MEMORY_SIZE
+	#define IFX_CFG_MEM_SIZE	31
+#else
+	#error "ERROR!! Define memory size first!"
+#endif
+
+//2MB flash partition
+#if (IFX_CONFIG_FLASH_SIZE == 2)
+#define IFX_CFG_FLASH_PARTITIONS_INFO                                   \
+        "part0_begin=0xB0000000\0"                                      \
+        "part1_begin=0xB0010000\0"                                      \
+        "part2_begin=0xB0050000\0"                                      \
+        "total_part=3\0"
+
+#define IFX_CFG_FLASH_DATA_BLOCKS_INFO					\
+	"data_block0=" IFX_CFG_FLASH_UBOOT_IMAGE_BLOCK_NAME "\0"	\
+	"data_block1=" IFX_CFG_FLASH_FIRMWARE_IMAGE_BLOCK_NAME "\0"	\
+	"data_block2=" IFX_CFG_FLASH_ROOTFS_IMAGE_BLOCK_NAME "\0"	\
+	"data_block3=" IFX_CFG_FLASH_KERNEL_IMAGE_BLOCK_NAME "\0"	\
+	"data_block4=" IFX_CFG_FLASH_SYSTEM_CFG_BLOCK_NAME "\0"		\
+	"data_block5=" IFX_CFG_FLASH_UBOOT_CFG_BLOCK_NAME "\0"		\
+	"data_block6=" IFX_CFG_FLASH_FIRMWARE_DIAG_BLOCK_NAME "\0"	\
+	"data_block7=" IFX_CFG_FLASH_CALIBRATION_CFG_BLOCK_NAME "\0"	\
+	"total_db=8\0"
+
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_BLOCK_NAME		"uboot"
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_START_ADDR		0xB0000000
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_SIZE			0
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_MTDBLOCK_NAME		"/dev/mtdblock0"
+
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_BLOCK_NAME		"firmware"
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_START_ADDR         0xB0010000
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_SIZE		0
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_MTDBLOCK_NAME	"/dev/mtdblock1"
+
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_BLOCK_NAME		"rootfs"
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_START_ADDR           0xB0050000
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_SIZE			0
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_MTDBLOCK_NAME	"/dev/mtdblock2"
+
+	#define IFX_CFG_FLASH_KERNEL_IMAGE_BLOCK_NAME		"kernel"
+	#define IFX_CFG_FLASH_KERNEL_IMAGE_START_ADDR		0xB01FCFFF
+	#define IFX_CFG_FLASH_KERNEL_IMAGE_SIZE			0
+
+	#define IFX_CFG_FLASH_SYSTEM_CFG_BLOCK_NAME		"sysconfig"
+	#define IFX_CFG_FLASH_SYSTEM_CFG_START_ADDR		0xB01FD000
+	#define IFX_CFG_FLASH_SYSTEM_CFG_SIZE			0
+	#define IFX_CFG_FLASH_SYSTEM_CFG_END_ADDR		0xB01FEFFF
+
+	#define IFX_CFG_FLASH_UBOOT_CFG_BLOCK_NAME		"ubootconfig"
+	#define IFX_CFG_FLASH_UBOOT_CFG_START_ADDR		0xB01FF000
+	#define IFX_CFG_FLASH_UBOOT_CFG_SIZE                    0x0C00
+	#define IFX_CFG_FLASH_UBOOT_CFG_END_ADDR		0xB01FFBFF
+
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_BLOCK_NAME		"fwdiag"
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_START_ADDR		0xB31FFC00
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_SIZE		0x0200
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_END_ADDR		0xB01FFDFF
+
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_BLOCK_NAME	"calibration"
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_START_ADDR	0xB01FFE00
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_SIZE		0x0200
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_END_ADDR		0xB01FFFFF
+
+	#define IFX_CFG_FLASH_END_ADDR				0xB01FFFFF
+
+//4MB flash partition
+#elif (IFX_CONFIG_FLASH_SIZE == 4)
+#define IFX_CFG_FLASH_PARTITIONS_INFO                                   \
+        "part0_begin=0xB0000000\0"                                      \
+        "part1_begin=0xB0020000\0"                                      \
+        "part2_begin=0xB0060000\0"                                      \
+        "total_part=3\0"
+
+#define IFX_CFG_FLASH_DATA_BLOCKS_INFO                                  \
+        "data_block0=" IFX_CFG_FLASH_UBOOT_IMAGE_BLOCK_NAME "\0"        \
+        "data_block1=" IFX_CFG_FLASH_FIRMWARE_IMAGE_BLOCK_NAME "\0"     \
+        "data_block2=" IFX_CFG_FLASH_ROOTFS_IMAGE_BLOCK_NAME "\0"       \
+        "data_block3=" IFX_CFG_FLASH_KERNEL_IMAGE_BLOCK_NAME "\0"       \
+        "data_block4=" IFX_CFG_FLASH_SYSTEM_CFG_BLOCK_NAME "\0"         \
+	"data_block5=" IFX_CFG_FLASH_UBOOT_CFG_BLOCK_NAME "\0"          \
+        "data_block6=" IFX_CFG_FLASH_VOIP_CFG_BLOCK_NAME "\0"           \
+        "data_block7=" IFX_CFG_FLASH_FIRMWARE_DIAG_BLOCK_NAME "\0"	\
+	"data_block8=" IFX_CFG_FLASH_CALIBRATION_CFG_BLOCK_NAME "\0"	\
+	"total_db=9\0"
+
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_BLOCK_NAME		"uboot"
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_START_ADDR		0xB0000000
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_SIZE			0
+	#define IFX_CFG_FLASH_UBOOT_IMAGE_MTDBLOCK_NAME		"/dev/mtdblock0"
+
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_BLOCK_NAME		"firmware"
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_START_ADDR         0xB0020000
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_SIZE		0
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_MTDBLOCK_NAME	"/dev/mtdblock1"
+
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_BLOCK_NAME		"rootfs"
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_START_ADDR           0xB0060000
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_SIZE			0
+	#define IFX_CFG_FLASH_ROOTFS_IMAGE_MTDBLOCK_NAME	"/dev/mtdblock2"
+
+	#define IFX_CFG_FLASH_KERNEL_IMAGE_BLOCK_NAME		"kernel"
+	#define IFX_CFG_FLASH_KERNEL_IMAGE_START_ADDR		0xB03F4FFF
+	#define IFX_CFG_FLASH_KERNEL_IMAGE_SIZE			0
+
+	#define IFX_CFG_FLASH_SYSTEM_CFG_BLOCK_NAME		"sysconfig"
+	#define IFX_CFG_FLASH_SYSTEM_CFG_START_ADDR		0xB03F5000
+	#define IFX_CFG_FLASH_SYSTEM_CFG_SIZE			0x2000
+	#define IFX_CFG_FLASH_SYSTEM_CFG_END_ADDR		0xB03F6FFF
+
+	#define IFX_CFG_FLASH_UBOOT_CFG_BLOCK_NAME		"ubootconfig"
+	#define IFX_CFG_FLASH_UBOOT_CFG_START_ADDR		0xB03F7000
+	#define IFX_CFG_FLASH_UBOOT_CFG_SIZE			0x0C00
+	#define IFX_CFG_FLASH_UBOOT_CFG_END_ADDR		0xB03F7BFF
+
+	#define IFX_CFG_FLASH_VOIP_CFG_BLOCK_NAME	        "voip"
+	#define IFX_CFG_FLASH_VOIP_CFG_START_ADDR	        0xB03F7C00
+	#define IFX_CFG_FLASH_VOIP_CFG_SIZE		        0x8000
+	#define IFX_CFG_FLASH_VOIP_CFG_END_ADDR		        0xB03FFBFF
+
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_BLOCK_NAME		"fwdiag"
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_START_ADDR		0xB03FFC00
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_SIZE		0x0200
+	#define IFX_CFG_FLASH_FIRMWARE_DIAG_END_ADDR		0xB03FFDFF
+
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_BLOCK_NAME	"calibration"
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_START_ADDR	0xB03FFE00
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_SIZE		0x0200
+	#define IFX_CFG_FLASH_CALIBRATION_CFG_END_ADDR		0xB03FFFFF
+
+	#define IFX_CFG_FLASH_END_ADDR				0xB03FFFFF
+//8MB flash definition
+#elif (IFX_CONFIG_FLASH_SIZE == 8)
+#define IFX_CFG_FLASH_PARTITIONS_INFO                                   \
+        "part0_begin=0xB0000000\0"                                      \
+        "part1_begin=0xB0080000\0"                                      \
+        "part2_begin=0xB0280000\0"                                      \
+        "part3_begin=0xB0790000\0"                                      \
+        "part4_begin=0xB07A0000\0"                                      \
+        "part5_begin=0xB07E0000\0"                                      \
+        "total_part=6\0"
+
+#define IFX_CFG_FLASH_DATA_BLOCKS_INFO                                  \
+        "data_block0=" IFX_CFG_FLASH_UBOOT_IMAGE_BLOCK_NAME "\0"        \
+        "data_block1=" IFX_CFG_FLASH_KERNEL_IMAGE_BLOCK_NAME "\0"       \
+        "data_block2=" IFX_CFG_FLASH_ROOTFS_IMAGE_BLOCK_NAME "\0"       \
+        "data_block3=" IFX_CFG_FLASH_SYSTEM_CFG_BLOCK_NAME "\0"         \
+        "data_block4=" IFX_CFG_FLASH_FIRMWARE_IMAGE_BLOCK_NAME "\0"     \
+	"data_block5=" IFX_CFG_FLASH_UBOOT_CFG_BLOCK_NAME "\0"		\
+        "total_db=6\0"
+
+        #define IFX_CFG_FLASH_UBOOT_IMAGE_BLOCK_NAME            "uboot"
+        #define IFX_CFG_FLASH_UBOOT_IMAGE_START_ADDR            0xB0000000
+        #define IFX_CFG_FLASH_UBOOT_IMAGE_END_ADDR              0xB007FFFF
+        #define IFX_CFG_FLASH_UBOOT_IMAGE_SIZE                  0x00080000
+        #define IFX_CFG_FLASH_UBOOT_IMAGE_MTDBLOCK_NAME         "/dev/mtdblock0"
+
+        #define IFX_CFG_FLASH_KERNEL_IMAGE_BLOCK_NAME           "kernel"
+        #define IFX_CFG_FLASH_KERNEL_IMAGE_START_ADDR           0xB0080000
+        #define IFX_CFG_FLASH_KERNEL_IMAGE_SIZE                 0x200000
+        #define IFX_CFG_FLASH_KERNEL_IMAGE_END_ADDR             0xB017FFFF
+        #define IFX_CFG_FLASH_KERNEL_IMAGE_MTDBLOCK_NAME        "/dev/mtdblock1"
+
+        #define IFX_CFG_FLASH_ROOTFS_IMAGE_BLOCK_NAME           "rootfs"
+        #define IFX_CFG_FLASH_ROOTFS_IMAGE_START_ADDR           0xB0280000
+        #define IFX_CFG_FLASH_ROOTFS_IMAGE_SIZE                 0x00510000
+        #define IFX_CFG_FLASH_ROOTFS_IMAGE_END_ADDR             0xB078FFFF
+        #define IFX_CFG_FLASH_ROOTFS_IMAGE_MTDBLOCK_NAME        "/dev/mtdblock2"
+
+	#define IFX_CFG_FLASH_SYSTEM_CFG_BLOCK_NAME		"sysconfig"
+	#define IFX_CFG_FLASH_SYSTEM_CFG_START_ADDR		0xB0790000
+	#define IFX_CFG_FLASH_SYSTEM_CFG_SIZE			0x10000
+	#define IFX_CFG_FLASH_SYSTEM_CFG_END_ADDR		0xB079FFFF
+	#define IFX_CFG_FLASH_SYSTEM_CFG_MTDBLOCK_NAME		"/dev/mtdblock3"
+
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_BLOCK_NAME		"firmware"
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_START_ADDR         0xB07A0000
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_SIZE		0x40000
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_END_ADDR		0xB07DFFFF
+	#define IFX_CFG_FLASH_FIRMWARE_IMAGE_MTDBLOCK_NAME	"/dev/mtdblock4"
+
+        #define IFX_CFG_FLASH_UBOOT_CFG_BLOCK_NAME              "ubootconfig"
+        #define IFX_CFG_FLASH_UBOOT_CFG_START_ADDR              0xB0020000
+        #define IFX_CFG_FLASH_UBOOT_CFG_END_ADDR                0xB002FFFF
+        #define IFX_CFG_FLASH_UBOOT_CFG_SIZE                    0x10000
+        #define IFX_CFG_FLASH_UBOOT_CFG_MTDBLOCK_NAME           "/dev/mtdblock5"
+
+        #define IFX_CFG_FLASH_END_ADDR                          0xB07FFFFF
+#else
+	#error "ERROR!! Define flash size first!"
+#endif
+/* End of Board specific configurations
+ *-----------------------------------------------------------------------
+ */
+
+#endif
diff --git a/package/uboot-ifxmips/files/include/configs/ifx_extra_env.h b/package/uboot-ifxmips/files/include/configs/ifx_extra_env.h
new file mode 100644
index 0000000..a03d836
--- /dev/null
+++ b/package/uboot-ifxmips/files/include/configs/ifx_extra_env.h
@@ -0,0 +1,94 @@
+/* ============================================================================
+ * Copyright (C) 2003[- 2004] ? Infineon Technologies AG.
+ *
+ * All rights reserved.
+ * ============================================================================
+ *
+ * ============================================================================
+ *
+ * This document contains proprietary information belonging to Infineon 
+ * Technologies AG. Passing on and copying of this document, and communication
+ * of its contents is not permitted without prior written authorisation.
+ * 
+ * ============================================================================
+ *
+ * File Name: ifx_extra_env.h
+ * Author : Mars Lin (mars.lin@infineon.com)
+ * Date: 
+ *
+ * ===========================================================================
+ *
+ * Project:
+ * Block:
+ *
+ * ===========================================================================
+ * Contents:  This file contains the data structures and definitions used 
+ * 	      by the core iptables and the sip alg modules.
+ * ===========================================================================
+ * References:
+ */
+	"mem=" MK_STR(IFX_CONFIG_MEMORY_SIZE) "M\0"
+   	"ipaddr=" IFX_CFG_UBOOT_DEFAULT_CFG_IPADDR "\0"
+	"serverip=" IFX_CFG_UBOOT_DEFAULT_CFG_SERVERIP "\0"
+	"ethaddr=" IFX_CFG_UBOOT_DEFAULT_CFG_ETHADDR "\0"
+	"netdev=eth0\0"
+	"baudrate=" IFX_CFG_UBOOT_DEFAULT_CFG_BAUDRATE "\0"
+	"loadaddr=" IFX_CFG_UBOOT_LOAD_ADDRESS "\0"
+	"rootpath=/tftpboot/nfsrootfs\0"
+	"nfsargs=setenv bootargs root=/dev/nfs rw nfsroot=$(serverip):$(rootpath)\0"
+	"ramargs=setenv bootargs root=/dev/ram rw\0"
+	"addip=setenv bootargs $(bootargs) ip=$(ipaddr):$(serverip):$(gatewayip):$(netmask):$(hostname):$(netdev):on\0"
+	"addmisc=setenv bootargs $(bootargs) console=ttyS1,$(baudrate) ethaddr=$(ethaddr) mem=$(mem) panic=1\0"
+	"flash_nfs=run nfsargs addip addmisc;bootm $(kernel_addr)\0"
+	"ramdisk_addr=B0100000\0"
+	"flash_self=run ramargs addip addmisc;bootm $(kernel_addr) $(ramdisk_addr)\0"
+	"bootfile=uImage\0"
+	"net_nfs=tftp $(loadaddr) $(bootfile);run nfsargs addip addmisc;bootm\0"
+	"net_flash=tftp $(loadaddr) $(bootfile); run flashargs addip addmisc; bootm\0"
+	"u-boot=u-boot.ifx\0"
+	"jffs2fs=jffs2.img\0"
+        "rootfs=rootfs.img\0"
+	"firmware=firmware.img\0"
+	"load=tftp $(loadaddr) $(u-boot)\0"
+	"update=protect off 1:0-2;era 1:0-2;cp.b $(loadaddr) B0000000 $(filesize)\0"
+	"flashargs=setenv bootargs root=/dev/mtdblock2 ro rootfstype=squashfs\0"
+	"mtdargs=setenv bootargs root=/dev/mtdblock2 rw rootfstype=jffs2\0"
+	"flash_flash=run flashargs addip addmisc; bootm $(f_kernel_addr)\0"
+	"net_mtd=tftp $(loadaddr) $(bootfile); run mtdargs addip addmisc; bootm\0"
+	"flash_mtd=run mtdargs addip addmisc; bootm $(f_kernel_addr)\0"
+	"update_uboot=tftpboot $(loadaddr) $(u-boot);upgrade uboot $(loadaddr) $(filesize) 0\0"
+	"update_kernel=tftpboot $(loadaddr) $(bootfile);upgrade kernel $(loadaddr) $(filesize) 0\0"
+	"update_rootfs=tftpboot $(loadaddr) $(rootfs); upgrade rootfs $(loadaddr) $(filesize) 0\0"
+	"update_rootfs_1=tftpboot $(loadaddr) $(rootfs); erase 1:47-132; cp.b $(loadaddr) $(f_rootfs_addr) $(filesize)\0"
+	"update_jffs2=tftpboot $(loadaddr) $(rootfs); upgrade rootfs $(loadaddr) $(filesize) 0\0"
+	"update_jffs2_1=tftpboot $(loadaddr) $(jffs2fs); erase 1:47-132; cp.b $(loadaddr) $(f_rootfs_addr) $(filesize)\0"
+	"update_firmware=tftpboot $(loadaddr) $(firmware);upgrade firmware $(loadaddr) $(filesize) 0\0"
+	"reset_uboot_config=erase " MK_STR(IFX_CFG_FLASH_UBOOT_CFG_START_ADDR) " " MK_STR(IFX_CFG_FLASH_UBOOT_CFG_END_ADDR) "\0" 
+	IFX_CFG_FLASH_PARTITIONS_INFO
+	"flash_end=" MK_STR(IFX_CFG_FLASH_END_ADDR) "\0"
+	IFX_CFG_FLASH_DATA_BLOCKS_INFO
+	"f_uboot_addr=" MK_STR(IFX_CFG_FLASH_UBOOT_IMAGE_START_ADDR) "\0"
+	"f_uboot_size=" MK_STR(IFX_CFG_FLASH_UBOOT_IMAGE_SIZE) "\0"
+	"f_ubootconfig_addr=" MK_STR(IFX_CFG_FLASH_UBOOT_CFG_START_ADDR) "\0"
+	"f_ubootconfig_size=" MK_STR(IFX_CFG_FLASH_UBOOT_CFG_SIZE) "\0"
+	"f_ubootconfig_end=" MK_STR(IFX_CFG_FLASH_UBOOT_CFG_END_ADDR) "\0"
+	"f_kernel_addr=" MK_STR(IFX_CFG_FLASH_KERNEL_IMAGE_START_ADDR) "\0"
+	"f_kernel_size=" MK_STR(IFX_CFG_FLASH_KERNEL_IMAGE_SIZE) "\0"
+	"f_kernel_end=" MK_STR(IFX_CFG_FLASH_KERNEL_IMAGE_END_ADDR) "\0"
+	"f_rootfs_addr=" MK_STR(IFX_CFG_FLASH_ROOTFS_IMAGE_START_ADDR) "\0"
+	"f_rootfs_size=" MK_STR(IFX_CFG_FLASH_ROOTFS_IMAGE_SIZE) "\0"
+	"f_rootfs_end=" MK_STR(IFX_CFG_FLASH_ROOTFS_IMAGE_END_ADDR) "\0" 
+	"f_firmware_addr=" MK_STR(IFX_CFG_FLASH_FIRMWARE_IMAGE_START_ADDR) "\0"
+	"f_firmware_size=" MK_STR(IFX_CFG_FLASH_FIRMWARE_IMAGE_SIZE) "\0"
+	"f_sysconfig_addr=" MK_STR(IFX_CFG_FLASH_SYSTEM_CFG_START_ADDR) "\0"
+	"f_sysconfig_size=" MK_STR(IFX_CFG_FLASH_SYSTEM_CFG_SIZE) "\0"
+	/*
+	"f_fwdiag_addr=" MK_STR(IFX_CFG_FLASH_FIRMWARE_DIAG_START_ADDR) "\0"
+	"f_fwdiag_size=" MK_STR(IFX_CFG_FLASH_FIRMWARE_DIAG_SIZE) "\0"
+	"f_calibration_addr=" MK_STR(IFX_CFG_FLASH_CALIBRATION_CFG_START_ADDR) "\0"
+	"f_calibration_size=" MK_STR(IFX_CFG_FLASH_CALIBRATION_CFG_SIZE) "\0"
+#if (IFX_CONFIG_FLASH_SIZE == 4) || (IFX_CONFIG_FLASH_SIZE == 8) 
+	"f_voip_addr=" MK_STR(IFX_CFG_FLASH_VOIP_CFG_START_ADDR) "\0" 
+	"f_voip_size=" MK_STR(IFX_CFG_FLASH_VOIP_CFG_SIZE) "\0" 
+#endif
+	*/
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/LzmaDecode.c b/package/uboot-ifxmips/files/lib_bootstrap/LzmaDecode.c
new file mode 100644
index 0000000..28263e6
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/LzmaDecode.c
@@ -0,0 +1,622 @@
+/*
+  LzmaDecode.c
+  LZMA Decoder (optimized for Speed version)
+  
+  LZMA SDK 4.40 Copyright (c) 1999-2006 Igor Pavlov (2006-05-01)
+  http://www.7-zip.org/
+
+  LZMA SDK is licensed under two licenses:
+  1) GNU Lesser General Public License (GNU LGPL)
+  2) Common Public License (CPL)
+  It means that you can select one of these two licenses and 
+  follow rules of that license.
+
+  SPECIAL EXCEPTION:
+  Igor Pavlov, as the author of this Code, expressly permits you to 
+  statically or dynamically link your Code (or bind by name) to the 
+  interfaces of this file without subjecting your linked Code to the 
+  terms of the CPL or GNU LGPL. Any modifications or additions 
+  to this file, however, are subject to the LGPL or CPL terms.
+*/
+
+#ifdef CONFIG_LZMA
+
+#include "LzmaDecode.h"
+
+#define kNumTopBits 24
+#define kTopValue ((UInt32)1 << kNumTopBits)
+
+#define kNumBitModelTotalBits 11
+#define kBitModelTotal (1 << kNumBitModelTotalBits)
+#define kNumMoveBits 5
+
+#define RC_READ_BYTE (*Buffer++)
+
+#define RC_INIT2 Code = 0; Range = 0xFFFFFFFF; \
+  { int i; for(i = 0; i < 5; i++) { RC_TEST; Code = (Code << 8) | RC_READ_BYTE; }}
+
+#ifdef _LZMA_IN_CB
+
+
+#if 0
+#define RC_TEST { if (Buffer == BufferLim) \
+  { SizeT size; int result = InCallback->Read(InCallback, &Buffer, &size); if (result != LZMA_RESULT_OK) { printf("ERROR, %s, %d\n", __FILE__, __LINE__); return result; } \
+  BufferLim = Buffer + size; if (size == 0) { printf("ERROR, %s, %d\n", __FILE__, __LINE__); return LZMA_RESULT_DATA_ERROR; } }}
+#else
+
+#define RC_TEST { if (Buffer == BufferLim) \
+  { SizeT size; int result = InCallback->Read(InCallback, &Buffer, &size); if (result != LZMA_RESULT_OK) { return result; } \
+  BufferLim = Buffer + size; if (size == 0) { return LZMA_RESULT_DATA_ERROR; } }}
+#endif
+
+#define RC_INIT Buffer = BufferLim = 0; RC_INIT2
+
+#else
+
+#if 0
+#define RC_TEST { if (Buffer == BufferLim) { printf("ERROR, %s, %d\n", __FILE__, __LINE__); return LZMA_RESULT_DATA_ERROR; } }
+#else
+#define RC_TEST { if (Buffer == BufferLim) { return LZMA_RESULT_DATA_ERROR; } }
+#endif
+
+#define RC_INIT(buffer, bufferSize) Buffer = buffer; BufferLim = buffer + bufferSize; RC_INIT2
+ 
+#endif
+
+#define RC_NORMALIZE if (Range < kTopValue) { RC_TEST; Range <<= 8; Code = (Code << 8) | RC_READ_BYTE; }
+
+#define IfBit0(p) RC_NORMALIZE; bound = (Range >> kNumBitModelTotalBits) * *(p); if (Code < bound)
+#define UpdateBit0(p) Range = bound; *(p) += (kBitModelTotal - *(p)) >> kNumMoveBits;
+#define UpdateBit1(p) Range -= bound; Code -= bound; *(p) -= (*(p)) >> kNumMoveBits;
+
+#define RC_GET_BIT2(p, mi, A0, A1) IfBit0(p) \
+  { UpdateBit0(p); mi <<= 1; A0; } else \
+  { UpdateBit1(p); mi = (mi + mi) + 1; A1; } 
+  
+#define RC_GET_BIT(p, mi) RC_GET_BIT2(p, mi, ; , ;)               
+
+#define RangeDecoderBitTreeDecode(probs, numLevels, res) \
+  { int i = numLevels; res = 1; \
+  do { CProb *p = probs + res; RC_GET_BIT(p, res) } while(--i != 0); \
+  res -= (1 << numLevels); }
+
+
+#define kNumPosBitsMax 4
+#define kNumPosStatesMax (1 << kNumPosBitsMax)
+
+#define kLenNumLowBits 3
+#define kLenNumLowSymbols (1 << kLenNumLowBits)
+#define kLenNumMidBits 3
+#define kLenNumMidSymbols (1 << kLenNumMidBits)
+#define kLenNumHighBits 8
+#define kLenNumHighSymbols (1 << kLenNumHighBits)
+
+#define LenChoice 0
+#define LenChoice2 (LenChoice + 1)
+#define LenLow (LenChoice2 + 1)
+#define LenMid (LenLow + (kNumPosStatesMax << kLenNumLowBits))
+#define LenHigh (LenMid + (kNumPosStatesMax << kLenNumMidBits))
+#define kNumLenProbs (LenHigh + kLenNumHighSymbols) 
+
+
+#define kNumStates 12
+#define kNumLitStates 7
+
+#define kStartPosModelIndex 4
+#define kEndPosModelIndex 14
+#define kNumFullDistances (1 << (kEndPosModelIndex >> 1))
+
+#define kNumPosSlotBits 6
+#define kNumLenToPosStates 4
+
+#define kNumAlignBits 4
+#define kAlignTableSize (1 << kNumAlignBits)
+
+#define kMatchMinLen 2
+
+#define IsMatch 0
+#define IsRep (IsMatch + (kNumStates << kNumPosBitsMax))
+#define IsRepG0 (IsRep + kNumStates)
+#define IsRepG1 (IsRepG0 + kNumStates)
+#define IsRepG2 (IsRepG1 + kNumStates)
+#define IsRep0Long (IsRepG2 + kNumStates)
+#define PosSlot (IsRep0Long + (kNumStates << kNumPosBitsMax))
+#define SpecPos (PosSlot + (kNumLenToPosStates << kNumPosSlotBits))
+#define Align (SpecPos + kNumFullDistances - kEndPosModelIndex)
+#define LenCoder (Align + kAlignTableSize)
+#define RepLenCoder (LenCoder + kNumLenProbs)
+#define Literal (RepLenCoder + kNumLenProbs)
+
+#if Literal != LZMA_BASE_SIZE
+StopCompilingDueBUG
+#endif
+
+int LzmaDecodeProperties(CLzmaProperties *propsRes, const unsigned char *propsData, int size)
+{
+  unsigned char prop0;
+  if (size < LZMA_PROPERTIES_SIZE)
+  {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+    printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+#endif
+    return LZMA_RESULT_DATA_ERROR;
+  }
+  prop0 = propsData[0];
+  if (prop0 >= (9 * 5 * 5))
+  {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+    printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+#endif
+    return LZMA_RESULT_DATA_ERROR;
+  }
+  {
+    for (propsRes->pb = 0; prop0 >= (9 * 5); propsRes->pb++, prop0 -= (9 * 5));
+    for (propsRes->lp = 0; prop0 >= 9; propsRes->lp++, prop0 -= 9);
+    propsRes->lc = prop0;
+    /*
+    unsigned char remainder = (unsigned char)(prop0 / 9);
+    propsRes->lc = prop0 % 9;
+    propsRes->pb = remainder / 5;
+    propsRes->lp = remainder % 5;
+    */
+  }
+
+  #ifdef _LZMA_OUT_READ
+  {
+    int i;
+    propsRes->DictionarySize = 0;
+    for (i = 0; i < 4; i++)
+      propsRes->DictionarySize += (UInt32)(propsData[1 + i]) << (i * 8);
+    if (propsRes->DictionarySize == 0)
+      propsRes->DictionarySize = 1;
+  }
+  #endif
+  return LZMA_RESULT_OK;
+}
+
+#define kLzmaStreamWasFinishedId (-1)
+
+int LzmaDecode(CLzmaDecoderState *vs,
+    #ifdef _LZMA_IN_CB
+    ILzmaInCallback *InCallback,
+    #else
+    const unsigned char *inStream, SizeT inSize, SizeT *inSizeProcessed,
+    #endif
+    unsigned char *outStream, SizeT outSize, SizeT *outSizeProcessed)
+{
+  CProb *p = vs->Probs;
+  SizeT nowPos = 0;
+  Byte previousByte = 0;
+  UInt32 posStateMask = (1 << (vs->Properties.pb)) - 1;
+  UInt32 literalPosMask = (1 << (vs->Properties.lp)) - 1;
+  int lc = vs->Properties.lc;
+
+  #ifdef _LZMA_OUT_READ
+  
+  UInt32 Range = vs->Range;
+  UInt32 Code = vs->Code;
+  #ifdef _LZMA_IN_CB
+  const Byte *Buffer = vs->Buffer;
+  const Byte *BufferLim = vs->BufferLim;
+  #else
+  const Byte *Buffer = inStream;
+  const Byte *BufferLim = inStream + inSize;
+  #endif
+  int state = vs->State;
+  UInt32 rep0 = vs->Reps[0], rep1 = vs->Reps[1], rep2 = vs->Reps[2], rep3 = vs->Reps[3];
+  int len = vs->RemainLen;
+  UInt32 globalPos = vs->GlobalPos;
+  UInt32 distanceLimit = vs->DistanceLimit;
+
+  Byte *dictionary = vs->Dictionary;
+  UInt32 dictionarySize = vs->Properties.DictionarySize;
+  UInt32 dictionaryPos = vs->DictionaryPos;
+
+  Byte tempDictionary[4];
+
+  #ifndef _LZMA_IN_CB
+  *inSizeProcessed = 0;
+  #endif
+  *outSizeProcessed = 0;
+  if (len == kLzmaStreamWasFinishedId)
+    return LZMA_RESULT_OK;
+
+  if (dictionarySize == 0)
+  {
+    dictionary = tempDictionary;
+    dictionarySize = 1;
+    tempDictionary[0] = vs->TempDictionary[0];
+  }
+
+  if (len == kLzmaNeedInitId)
+  {
+    {
+      UInt32 numProbs = Literal + ((UInt32)LZMA_LIT_SIZE << (lc + vs->Properties.lp));
+      UInt32 i;
+      for (i = 0; i < numProbs; i++)
+        p[i] = kBitModelTotal >> 1; 
+      rep0 = rep1 = rep2 = rep3 = 1;
+      state = 0;
+      globalPos = 0;
+      distanceLimit = 0;
+      dictionaryPos = 0;
+      dictionary[dictionarySize - 1] = 0;
+      #ifdef _LZMA_IN_CB
+      RC_INIT;
+      #else
+      RC_INIT(inStream, inSize);
+      #endif
+    }
+    len = 0;
+  }
+  while(len != 0 && nowPos < outSize)
+  {
+    UInt32 pos = dictionaryPos - rep0;
+    if (pos >= dictionarySize)
+      pos += dictionarySize;
+    outStream[nowPos++] = dictionary[dictionaryPos] = dictionary[pos];
+    if (++dictionaryPos == dictionarySize)
+      dictionaryPos = 0;
+    len--;
+  }
+  if (dictionaryPos == 0)
+    previousByte = dictionary[dictionarySize - 1];
+  else
+    previousByte = dictionary[dictionaryPos - 1];
+
+  #else /* if !_LZMA_OUT_READ */
+
+  int state = 0;
+  UInt32 rep0 = 1, rep1 = 1, rep2 = 1, rep3 = 1;
+  int len = 0;
+  const Byte *Buffer;
+  const Byte *BufferLim;
+  UInt32 Range;
+  UInt32 Code;
+
+  #ifndef _LZMA_IN_CB
+  *inSizeProcessed = 0;
+  #endif
+  *outSizeProcessed = 0;
+
+  {
+    UInt32 i;
+    UInt32 numProbs = Literal + ((UInt32)LZMA_LIT_SIZE << (lc + vs->Properties.lp));
+    for (i = 0; i < numProbs; i++)
+      p[i] = kBitModelTotal >> 1;
+  }
+  
+  #ifdef _LZMA_IN_CB
+  RC_INIT;
+  #else
+  RC_INIT(inStream, inSize);
+  #endif
+
+  #endif /* _LZMA_OUT_READ */
+
+  while(nowPos < outSize)
+  {
+    CProb *prob;
+    UInt32 bound;
+    int posState = (int)(
+        (nowPos 
+        #ifdef _LZMA_OUT_READ
+        + globalPos
+        #endif
+        )
+        & posStateMask);
+
+    prob = p + IsMatch + (state << kNumPosBitsMax) + posState;
+    IfBit0(prob)
+    {
+      int symbol = 1;
+      UpdateBit0(prob)
+      prob = p + Literal + (LZMA_LIT_SIZE * 
+        (((
+        (nowPos 
+        #ifdef _LZMA_OUT_READ
+        + globalPos
+        #endif
+        )
+        & literalPosMask) << lc) + (previousByte >> (8 - lc))));
+
+      if (state >= kNumLitStates)
+      {
+        int matchByte;
+        #ifdef _LZMA_OUT_READ
+        UInt32 pos = dictionaryPos - rep0;
+        if (pos >= dictionarySize)
+          pos += dictionarySize;
+        matchByte = dictionary[pos];
+        #else
+        matchByte = outStream[nowPos - rep0];
+        #endif
+        do
+        {
+          int bit;
+          CProb *probLit;
+          matchByte <<= 1;
+          bit = (matchByte & 0x100);
+          probLit = prob + 0x100 + bit + symbol;
+          RC_GET_BIT2(probLit, symbol, if (bit != 0) break, if (bit == 0) break)
+        }
+        while (symbol < 0x100);
+      }
+      while (symbol < 0x100)
+      {
+        CProb *probLit = prob + symbol;
+        RC_GET_BIT(probLit, symbol)
+      }
+      previousByte = (Byte)symbol;
+
+      outStream[nowPos++] = previousByte;
+      #ifdef _LZMA_OUT_READ
+      if (distanceLimit < dictionarySize)
+        distanceLimit++;
+
+      dictionary[dictionaryPos] = previousByte;
+      if (++dictionaryPos == dictionarySize)
+        dictionaryPos = 0;
+      #endif
+      if (state < 4) state = 0;
+      else if (state < 10) state -= 3;
+      else state -= 6;
+    }
+    else             
+    {
+      UpdateBit1(prob);
+      prob = p + IsRep + state;
+      IfBit0(prob)
+      {
+        UpdateBit0(prob);
+        rep3 = rep2;
+        rep2 = rep1;
+        rep1 = rep0;
+        state = state < kNumLitStates ? 0 : 3;
+        prob = p + LenCoder;
+      }
+      else
+      {
+        UpdateBit1(prob);
+        prob = p + IsRepG0 + state;
+        IfBit0(prob)
+        {
+          UpdateBit0(prob);
+          prob = p + IsRep0Long + (state << kNumPosBitsMax) + posState;
+          IfBit0(prob)
+          {
+            #ifdef _LZMA_OUT_READ
+            UInt32 pos;
+            #endif
+            UpdateBit0(prob);
+            
+            #ifdef _LZMA_OUT_READ
+            if (distanceLimit == 0)
+            #else
+            if (nowPos == 0)
+            #endif
+            {
+			  
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+              printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+#endif
+              return LZMA_RESULT_DATA_ERROR;
+            }
+            
+            state = state < kNumLitStates ? 9 : 11;
+            #ifdef _LZMA_OUT_READ
+            pos = dictionaryPos - rep0;
+            if (pos >= dictionarySize)
+              pos += dictionarySize;
+            previousByte = dictionary[pos];
+            dictionary[dictionaryPos] = previousByte;
+            if (++dictionaryPos == dictionarySize)
+              dictionaryPos = 0;
+            #else
+            previousByte = outStream[nowPos - rep0];
+            #endif
+            outStream[nowPos++] = previousByte;
+            #ifdef _LZMA_OUT_READ
+            if (distanceLimit < dictionarySize)
+              distanceLimit++;
+            #endif
+
+            continue;
+          }
+          else
+          {
+            UpdateBit1(prob);
+          }
+        }
+        else
+        {
+          UInt32 distance;
+          UpdateBit1(prob);
+          prob = p + IsRepG1 + state;
+          IfBit0(prob)
+          {
+            UpdateBit0(prob);
+            distance = rep1;
+          }
+          else 
+          {
+            UpdateBit1(prob);
+            prob = p + IsRepG2 + state;
+            IfBit0(prob)
+            {
+              UpdateBit0(prob);
+              distance = rep2;
+            }
+            else
+            {
+              UpdateBit1(prob);
+              distance = rep3;
+              rep3 = rep2;
+            }
+            rep2 = rep1;
+          }
+          rep1 = rep0;
+          rep0 = distance;
+        }
+        state = state < kNumLitStates ? 8 : 11;
+        prob = p + RepLenCoder;
+      }
+      {
+        int numBits, offset;
+        CProb *probLen = prob + LenChoice;
+        IfBit0(probLen)
+        {
+          UpdateBit0(probLen);
+          probLen = prob + LenLow + (posState << kLenNumLowBits);
+          offset = 0;
+          numBits = kLenNumLowBits;
+        }
+        else
+        {
+          UpdateBit1(probLen);
+          probLen = prob + LenChoice2;
+          IfBit0(probLen)
+          {
+            UpdateBit0(probLen);
+            probLen = prob + LenMid + (posState << kLenNumMidBits);
+            offset = kLenNumLowSymbols;
+            numBits = kLenNumMidBits;
+          }
+          else
+          {
+            UpdateBit1(probLen);
+            probLen = prob + LenHigh;
+            offset = kLenNumLowSymbols + kLenNumMidSymbols;
+            numBits = kLenNumHighBits;
+          }
+        }
+        RangeDecoderBitTreeDecode(probLen, numBits, len);
+        len += offset;
+      }
+
+      if (state < 4)
+      {
+        int posSlot;
+        state += kNumLitStates;
+        prob = p + PosSlot +
+            ((len < kNumLenToPosStates ? len : kNumLenToPosStates - 1) << 
+            kNumPosSlotBits);
+        RangeDecoderBitTreeDecode(prob, kNumPosSlotBits, posSlot);
+        if (posSlot >= kStartPosModelIndex)
+        {
+          int numDirectBits = ((posSlot >> 1) - 1);
+          rep0 = (2 | ((UInt32)posSlot & 1));
+          if (posSlot < kEndPosModelIndex)
+          {
+            rep0 <<= numDirectBits;
+            prob = p + SpecPos + rep0 - posSlot - 1;
+          }
+          else
+          {
+            numDirectBits -= kNumAlignBits;
+            do
+            {
+              RC_NORMALIZE
+              Range >>= 1;
+              rep0 <<= 1;
+              if (Code >= Range)
+              {
+                Code -= Range;
+                rep0 |= 1;
+              }
+            }
+            while (--numDirectBits != 0);
+            prob = p + Align;
+            rep0 <<= kNumAlignBits;
+            numDirectBits = kNumAlignBits;
+          }
+          {
+            int i = 1;
+            int mi = 1;
+            do
+            {
+              CProb *prob3 = prob + mi;
+              RC_GET_BIT2(prob3, mi, ; , rep0 |= i);
+              i <<= 1;
+            }
+            while(--numDirectBits != 0);
+          }
+        }
+        else
+          rep0 = posSlot;
+        if (++rep0 == (UInt32)(0))
+        {
+          /* it's for stream version */
+          len = kLzmaStreamWasFinishedId;
+          break;
+        }
+      }
+
+      len += kMatchMinLen;
+      #ifdef _LZMA_OUT_READ
+      if (rep0 > distanceLimit) 
+      #else
+      if (rep0 > nowPos)
+      #endif
+      {
+		
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+        printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+#endif
+        return LZMA_RESULT_DATA_ERROR;
+      }
+
+      #ifdef _LZMA_OUT_READ
+      if (dictionarySize - distanceLimit > (UInt32)len)
+        distanceLimit += len;
+      else
+        distanceLimit = dictionarySize;
+      #endif
+
+      do
+      {
+        #ifdef _LZMA_OUT_READ
+        UInt32 pos = dictionaryPos - rep0;
+        if (pos >= dictionarySize)
+          pos += dictionarySize;
+        previousByte = dictionary[pos];
+        dictionary[dictionaryPos] = previousByte;
+        if (++dictionaryPos == dictionarySize)
+          dictionaryPos = 0;
+        #else
+        previousByte = outStream[nowPos - rep0];
+        #endif
+        len--;
+        outStream[nowPos++] = previousByte;
+      }
+      while(len != 0 && nowPos < outSize);
+    }
+  }
+  RC_NORMALIZE;
+
+  #ifdef _LZMA_OUT_READ
+  vs->Range = Range;
+  vs->Code = Code;
+  vs->DictionaryPos = dictionaryPos;
+  vs->GlobalPos = globalPos + (UInt32)nowPos;
+  vs->DistanceLimit = distanceLimit;
+  vs->Reps[0] = rep0;
+  vs->Reps[1] = rep1;
+  vs->Reps[2] = rep2;
+  vs->Reps[3] = rep3;
+  vs->State = state;
+  vs->RemainLen = len;
+  vs->TempDictionary[0] = tempDictionary[0];
+  #endif
+
+  #ifdef _LZMA_IN_CB
+  vs->Buffer = Buffer;
+  vs->BufferLim = BufferLim;
+  #else
+  *inSizeProcessed = (SizeT)(Buffer - inStream);
+  #endif
+  *outSizeProcessed = nowPos;
+  return LZMA_RESULT_OK;
+}
+
+#endif /* CONFIG_LZMA */
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/LzmaDecode.h b/package/uboot-ifxmips/files/lib_bootstrap/LzmaDecode.h
new file mode 100644
index 0000000..2870eeb
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/LzmaDecode.h
@@ -0,0 +1,113 @@
+/* 
+  LzmaDecode.h
+  LZMA Decoder interface
+
+  LZMA SDK 4.40 Copyright (c) 1999-2006 Igor Pavlov (2006-05-01)
+  http://www.7-zip.org/
+
+  LZMA SDK is licensed under two licenses:
+  1) GNU Lesser General Public License (GNU LGPL)
+  2) Common Public License (CPL)
+  It means that you can select one of these two licenses and 
+  follow rules of that license.
+
+  SPECIAL EXCEPTION:
+  Igor Pavlov, as the author of this code, expressly permits you to 
+  statically or dynamically link your code (or bind by name) to the 
+  interfaces of this file without subjecting your linked code to the 
+  terms of the CPL or GNU LGPL. Any modifications or additions 
+  to this file, however, are subject to the LGPL or CPL terms.
+*/
+
+#ifndef __LZMADECODE_H
+#define __LZMADECODE_H
+
+#include "LzmaTypes.h"
+
+/* #define _LZMA_IN_CB */
+/* Use callback for input data */
+
+/* #define _LZMA_OUT_READ */
+/* Use read function for output data */
+
+/* #define _LZMA_PROB32 */
+/* It can increase speed on some 32-bit CPUs, 
+   but memory usage will be doubled in that case */
+
+/* #define _LZMA_LOC_OPT */
+/* Enable local speed optimizations inside code */
+
+#ifdef _LZMA_PROB32
+#define CProb UInt32
+#else
+#define CProb UInt16
+#endif
+
+#define LZMA_RESULT_OK 0
+#define LZMA_RESULT_DATA_ERROR 1
+
+#ifdef _LZMA_IN_CB
+typedef struct _ILzmaInCallback
+{
+  int (*Read)(void *object, const unsigned char **buffer, SizeT *bufferSize);
+} ILzmaInCallback;
+#endif
+
+#define LZMA_BASE_SIZE 1846
+#define LZMA_LIT_SIZE 768
+
+#define LZMA_PROPERTIES_SIZE 5
+
+typedef struct _CLzmaProperties
+{
+  int lc;
+  int lp;
+  int pb;
+  #ifdef _LZMA_OUT_READ
+  UInt32 DictionarySize;
+  #endif
+}CLzmaProperties;
+
+int LzmaDecodeProperties(CLzmaProperties *propsRes, const unsigned char *propsData, int size);
+
+#define LzmaGetNumProbs(Properties) (LZMA_BASE_SIZE + (LZMA_LIT_SIZE << ((Properties)->lc + (Properties)->lp)))
+
+#define kLzmaNeedInitId (-2)
+
+typedef struct _CLzmaDecoderState
+{
+  CLzmaProperties Properties;
+  CProb *Probs;
+
+  #ifdef _LZMA_IN_CB
+  const unsigned char *Buffer;
+  const unsigned char *BufferLim;
+  #endif
+
+  #ifdef _LZMA_OUT_READ
+  unsigned char *Dictionary;
+  UInt32 Range;
+  UInt32 Code;
+  UInt32 DictionaryPos;
+  UInt32 GlobalPos;
+  UInt32 DistanceLimit;
+  UInt32 Reps[4];
+  int State;
+  int RemainLen;
+  unsigned char TempDictionary[4];
+  #endif
+} CLzmaDecoderState;
+
+#ifdef _LZMA_OUT_READ
+#define LzmaDecoderInit(vs) { (vs)->RemainLen = kLzmaNeedInitId; }
+#endif
+
+int LzmaDecode(CLzmaDecoderState *vs,
+    #ifdef _LZMA_IN_CB
+    ILzmaInCallback *inCallback,
+    #else
+    const unsigned char *inStream, SizeT inSize, SizeT *inSizeProcessed,
+    #endif
+    unsigned char *outStream, SizeT outSize, SizeT *outSizeProcessed);
+
+#endif
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/LzmaTypes.h b/package/uboot-ifxmips/files/lib_bootstrap/LzmaTypes.h
new file mode 100644
index 0000000..288c5e4
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/LzmaTypes.h
@@ -0,0 +1,45 @@
+/* 
+LzmaTypes.h 
+
+Types for LZMA Decoder
+
+This file written and distributed to public domain by Igor Pavlov.
+This file is part of LZMA SDK 4.40 (2006-05-01)
+*/
+
+#ifndef __LZMATYPES_H
+#define __LZMATYPES_H
+
+#ifndef _7ZIP_BYTE_DEFINED
+#define _7ZIP_BYTE_DEFINED
+typedef unsigned char Byte;
+#endif 
+
+#ifndef _7ZIP_UINT16_DEFINED
+#define _7ZIP_UINT16_DEFINED
+typedef unsigned short UInt16;
+#endif 
+
+#ifndef _7ZIP_UINT32_DEFINED
+#define _7ZIP_UINT32_DEFINED
+#ifdef _LZMA_UINT32_IS_ULONG
+typedef unsigned long UInt32;
+#else
+typedef unsigned int UInt32;
+#endif
+#endif 
+
+/* #define _LZMA_SYSTEM_SIZE_T */
+/* Use system's size_t. You can use it to enable 64-bit sizes supporting */
+
+#ifndef _7ZIP_SIZET_DEFINED
+#define _7ZIP_SIZET_DEFINED
+#ifdef _LZMA_SYSTEM_SIZE_T
+#include <stddef.h>
+typedef size_t SizeT;
+#else
+typedef UInt32 SizeT;
+#endif
+#endif
+
+#endif
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/LzmaWrapper.c b/package/uboot-ifxmips/files/lib_bootstrap/LzmaWrapper.c
new file mode 100644
index 0000000..955b911
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/LzmaWrapper.c
@@ -0,0 +1,223 @@
+/******************************************************************************
+**
+** FILE NAME    : LzmaWrapper.c
+** PROJECT      : bootloader
+** MODULES      : U-boot
+**
+** DATE         : 2 Nov 2006
+** AUTHOR       : Lin Mars
+** DESCRIPTION  : LZMA decoder support for U-boot 1.1.5
+** COPYRIGHT    :       Copyright (c) 2006
+**                      Infineon Technologies AG
+**                      Am Campeon 1-12, 85579 Neubiberg, Germany
+**
+**    This program is free software; you can redistribute it and/or modify
+**    it under the terms of the GNU General Public License as published by
+**    the Free Software Foundation; either version 2 of the License, or
+**    (at your option) any later version.
+**
+** HISTORY
+** $Date        $Author         $Comment
+** 2 Nov 2006   Lin Mars        init version which derived from LzmaTest.c from
+**                              LZMA v4.43 SDK
+*******************************************************************************/
+#define LZMA_NO_STDIO
+#ifndef LZMA_NO_STDIO
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#endif
+
+#include <config.h>
+#include <common.h>
+#include <linux/types.h>
+#include <linux/string.h>
+#include <linux/ctype.h>
+#include <malloc.h>
+
+#ifdef CONFIG_LZMA
+
+#include "LzmaDecode.h"
+#include "LzmaWrapper.h"
+
+static const char *kCantReadMessage = "Can not read from source buffer";
+static const char *kCantAllocateMessage = "Not enough buffer for decompression";
+
+static size_t rpos=0, dpos=0;
+
+static int MyReadFileAndCheck(unsigned char *src, void *dest, size_t size)
+{
+  if (size == 0)
+    return 0;
+  memcpy(dest, src + rpos, size);
+  rpos += size;
+  return 1;
+}
+
+int lzma_inflate(unsigned char *source, int s_len, unsigned char *dest, int *d_len)
+{
+  /* We use two 32-bit integers to construct 64-bit integer for file size.
+     You can remove outSizeHigh, if you don't need >= 4GB supporting,
+     or you can use UInt64 outSize, if your compiler supports 64-bit integers*/
+  UInt32 outSize = 0;
+  UInt32 outSizeHigh = 0;
+  SizeT outSizeFull;
+  unsigned char *outStream;
+  
+  int waitEOS = 1; 
+  /* waitEOS = 1, if there is no uncompressed size in headers, 
+   so decoder will wait EOS (End of Stream Marker) in compressed stream */
+
+  SizeT compressedSize;
+  unsigned char *inStream;
+
+  CLzmaDecoderState state;  /* it's about 24-80 bytes structure, if int is 32-bit */
+  unsigned char properties[LZMA_PROPERTIES_SIZE];
+
+  int res;
+
+  if (sizeof(UInt32) < 4)
+  {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+    printf("LZMA decoder needs correct UInt32\n");
+#endif
+    return LZMA_RESULT_DATA_ERROR;
+  }
+
+  {
+    long length=s_len;
+    if ((long)(SizeT)length != length)
+    {
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+      printf("Too big compressed stream\n");
+#endif
+      return LZMA_RESULT_DATA_ERROR;
+    }
+    compressedSize = (SizeT)(length - (LZMA_PROPERTIES_SIZE + 8));
+  }
+
+  /* Read LZMA properties for compressed stream */
+
+  if (!MyReadFileAndCheck(source, properties, sizeof(properties)))
+  {
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+    printf("%s\n", kCantReadMessage);
+#endif
+    return LZMA_RESULT_DATA_ERROR;
+  }
+
+  /* Read uncompressed size */
+  {
+    int i;
+    for (i = 0; i < 8; i++)
+    {
+      unsigned char b;
+      if (!MyReadFileAndCheck(source, &b, 1))
+      {
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+        printf("%s\n", kCantReadMessage);
+#endif
+        return LZMA_RESULT_DATA_ERROR;
+      }
+      if (b != 0xFF)
+        waitEOS = 0;
+      if (i < 4)
+        outSize += (UInt32)(b) << (i * 8);
+      else
+        outSizeHigh += (UInt32)(b) << ((i - 4) * 8);
+    }
+    
+    if (waitEOS)
+    {
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+      printf("Stream with EOS marker is not supported");
+#endif
+      return LZMA_RESULT_DATA_ERROR;
+    }
+    outSizeFull = (SizeT)outSize;
+    if (sizeof(SizeT) >= 8)
+      outSizeFull |= (((SizeT)outSizeHigh << 16) << 16);
+    else if (outSizeHigh != 0 || (UInt32)(SizeT)outSize != outSize)
+    {
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+      printf("Too big uncompressed stream");
+#endif
+      return LZMA_RESULT_DATA_ERROR;
+    }
+  }
+
+  /* Decode LZMA properties and allocate memory */
+  if (LzmaDecodeProperties(&state.Properties, properties, LZMA_PROPERTIES_SIZE) != LZMA_RESULT_OK)
+  {
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+    printf("Incorrect stream properties");
+#endif
+    return LZMA_RESULT_DATA_ERROR;
+  }
+  state.Probs = (CProb *)malloc(LzmaGetNumProbs(&state.Properties) * sizeof(CProb));
+
+  if (outSizeFull == 0)
+    outStream = 0;
+  else
+  {
+    if (outSizeFull > d_len)
+      outStream = 0;
+    else
+      outStream = dest;
+  }
+
+  if (compressedSize == 0)
+    inStream = 0;
+  else
+  {
+    if ((compressedSize+rpos) > s_len )
+      inStream = 0;
+    else
+      inStream = source + rpos;
+  }
+
+  if (state.Probs == 0 
+    || (outStream == 0 && outSizeFull != 0)
+    || (inStream == 0 && compressedSize != 0)
+    )
+  {
+    free(state.Probs);
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+    printf("%s\n", kCantAllocateMessage);
+#endif
+    return LZMA_RESULT_DATA_ERROR;
+  }
+
+  /* Decompress */
+  {
+    SizeT inProcessed;
+    SizeT outProcessed;
+    res = LzmaDecode(&state,
+      inStream, compressedSize, &inProcessed,
+      outStream, outSizeFull, &outProcessed);
+    if (res != 0)
+    {
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+      printf("\nDecoding error = %d\n", res);
+#endif
+      res = 1;
+    }
+    else
+    {
+      *d_len = outProcessed;
+    }
+  }
+
+  free(state.Probs);
+  return res;
+}
+
+#endif /* CONFIG_LZMA */
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/Makefile b/package/uboot-ifxmips/files/lib_bootstrap/Makefile
new file mode 100644
index 0000000..e650be0
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/Makefile
@@ -0,0 +1,52 @@
+#
+# (C) Copyright 2003
+# Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+#
+# See file CREDITS for list of people who contributed to this
+# project.
+#
+# This program is free software; you can redistribute it and/or
+# modify it under the terms of the GNU General Public License as
+# published by the Free Software Foundation; either version 2 of
+# the License, or (at your option) any later version.
+#
+# This program is distributed in the hope that it will be useful,
+# but WITHOUT ANY WARRANTY; without even the implied warranty of
+# MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+# GNU General Public License for more details.
+#
+# You should have received a copy of the GNU General Public License
+# along with this program; if not, write to the Free Software
+# Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+# MA 02111-1307 USA
+#
+
+include $(TOPDIR)/config.mk
+
+LIB	= libbootstrap.a
+
+#OBJS_PRINTF_ENABLED	= bootstrap_board.o time.o console.o LzmaWrapper.o LzmaDecode.o crc32.o ctype.o display_options.o string.o vsprintf.o lists.o devices.o
+#OBJS_PRINTF_DISBALED	= bootstrap_board.o LzmaDecode.o string.o crc32.o LzmaWrapper.o 
+
+OBJS	= bootstrap_board_$(BOARDDIR).o LzmaDecode.o string.o crc32.o LzmaWrapper.o 
+
+ifeq ($(BOOTSTRAP_PRINTF_STATUS), BOOTSTRAP_PRINTF_ENABLED)
+#overwrite objs
+OBJS	= bootstrap_board_$(BOARDDIR).o time.o console.o LzmaWrapper.o LzmaDecode.o crc32.o ctype.o display_options.o string.o vsprintf.o lists.o devices.o
+CFLAGS += -DDEBUG_ENABLE_BOOTSTRAP_PRINTF
+endif
+
+all:	.depend $(LIB)
+
+$(LIB):	$(OBJS)
+	$(AR) crv $@ $(OBJS)
+
+#########################################################################
+
+.depend:	Makefile $(OBJS:.o=.c)
+		echo "make libbootstrap.a with HEAD_SIZE $(HEAD_SIZE)"
+		$(CC) -M $(CFLAGS) $(OBJS:.o=.c) > $@
+
+sinclude .depend
+
+#########################################################################
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/bootstrap_board_danube.c b/package/uboot-ifxmips/files/lib_bootstrap/bootstrap_board_danube.c
new file mode 100644
index 0000000..22f0a5a
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/bootstrap_board_danube.c
@@ -0,0 +1,501 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <command.h>
+#include <malloc.h>
+#include <devices.h>
+#include <version.h>
+#include <net.h>
+#include <environment.h>
+#ifdef CONFIG_DANUBE
+#include <asm-mips/danube.h>
+#include <configs/danube.h>
+#endif
+#include "LzmaWrapper.h"
+
+//#define DEBUG_ENABLE_BOOTSTRAP_PRINTF
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#if ( ((CFG_ENV_ADDR+CFG_ENV_SIZE) < BOOTSTRAP_CFG_MONITOR_BASE) || \
+      (CFG_ENV_ADDR >= (BOOTSTRAP_CFG_MONITOR_BASE + CFG_MONITOR_LEN)) ) || \
+    defined(CFG_ENV_IS_IN_NVRAM)
+#define	TOTAL_MALLOC_LEN	(CFG_MALLOC_LEN + CFG_ENV_SIZE)
+#else
+#define	TOTAL_MALLOC_LEN	CFG_MALLOC_LEN
+#endif
+
+#undef DEBUG
+
+#if (CONFIG_COMMANDS & CFG_CMD_NAND)
+extern unsigned long nand_init(void);
+#endif
+
+#ifdef CONFIG_SERIAL_FLASH
+extern int serial_flash_init (void);
+#endif
+
+extern int timer_init(void);
+
+extern int incaip_set_cpuclk(void);
+
+extern ulong uboot_end_data_bootstrap;
+extern ulong uboot_end_bootstrap;
+
+ulong monitor_flash_len;
+
+const char version_string[] =
+	U_BOOT_VERSION" (" __DATE__ " - " __TIME__ ")";
+
+static char *failed = "*** failed ***\n";
+
+/*
+ * Begin and End of memory area for malloc(), and current "brk"
+ */
+static ulong mem_malloc_start;
+static ulong mem_malloc_end;
+static ulong mem_malloc_brk;
+
+
+/*
+ * The Malloc area is immediately below the monitor copy in DRAM
+ */
+static void mem_malloc_init (ulong dest_addr)
+{
+//	ulong dest_addr = BOOTSTRAP_CFG_MONITOR_BASE + gd->reloc_off;
+
+	mem_malloc_end = dest_addr;
+	mem_malloc_start = dest_addr - TOTAL_MALLOC_LEN;
+	mem_malloc_brk = mem_malloc_start;
+
+	memset ((void *) mem_malloc_start,
+		0,
+		mem_malloc_end - mem_malloc_start);
+}
+
+void *malloc(unsigned int size)
+{
+	if(size < (mem_malloc_end - mem_malloc_start))
+	{
+		mem_malloc_start += size;
+		return (void *)(mem_malloc_start - size);
+	}
+	return NULL;
+}
+
+void *realloc(void *src,unsigned int size)
+{
+	return NULL;
+}
+
+void free(void *src)
+{
+	return;
+}
+
+
+void *sbrk (ptrdiff_t increment)
+{
+	ulong old = mem_malloc_brk;
+	ulong new = old + increment;
+
+	if ((new < mem_malloc_start) || (new > mem_malloc_end)) {
+		return (NULL);
+	}
+	mem_malloc_brk = new;
+	return ((void *) old);
+}
+
+
+static int init_func_ram (void)
+{
+#ifdef	CONFIG_BOARD_TYPES
+	int board_type = gd->board_type;
+#else
+	int board_type = 0;	/* use dummy arg */
+#endif
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	puts ("DRAM:  ");
+#endif
+
+	if ((gd->ram_size = initdram (board_type)) > 0) {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+		print_size (gd->ram_size, "\n");
+#endif
+		return (0);
+	}
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	puts (failed);
+#endif
+	return (1);
+}
+
+static int display_banner(void)
+{
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	printf ("\n\n%s\n\n", version_string);
+#endif
+	return (0);
+}
+
+static int init_baudrate (void)
+{
+#if 0
+	char tmp[64];	/* long enough for environment variables */
+	int i = getenv_r ("baudrate", tmp, sizeof (tmp));
+
+	gd->baudrate = (i > 0)
+			? (int) simple_strtoul (tmp, NULL, 10)
+			: CONFIG_BAUDRATE;
+#endif
+
+	gd->baudrate = CONFIG_BAUDRATE;
+
+	return (0);
+}
+#ifdef CONFIG_DANUBE
+static void init_led(void)
+{
+
+  *(unsigned long *)0xBE100B18 |=  0x70;
+  *(unsigned long *)0xBE100B1C |=  0x70;
+  *(unsigned long *)0xBE100B20 &= ~0x70;
+  *(unsigned long *)0xBE100B24 |=  0x70;
+#ifdef USE_REFERENCE_BOARD
+
+  *DANUBE_LED_CON1 = 0x00000003;
+  *DANUBE_LED_CPU0 = 0x0000010;
+  *DANUBE_LED_CPU1 = 0x00000000;
+  *DANUBE_LED_AR   = 0x00000000;
+  *DANUBE_LED_CON0 = 0x84000000;
+
+#else
+
+  *DANUBE_LED_CON1 = 0x00000007;
+  *DANUBE_LED_CPU0 = 0x00001000;
+  *DANUBE_LED_CPU1 = 0x00000000;
+  *DANUBE_LED_AR   = 0x00000000;
+  *DANUBE_LED_CON0 = 0x84000000;
+
+#endif
+
+}
+#endif
+/*
+ * Breath some life into the board...
+ *
+ * The first part of initialization is running from Flash memory;
+ * its main purpose is to initialize the RAM so that we
+ * can relocate the monitor code to RAM.
+ */
+
+/*
+ * All attempts to come up with a "common" initialization sequence
+ * that works for all boards and architectures failed: some of the
+ * requirements are just _too_ different. To get rid of the resulting
+ * mess of board dependend #ifdef'ed code we now make the whole
+ * initialization sequence configurable to the user.
+ *
+ * The requirements for any new initalization function is simple: it
+ * receives a pointer to the "global data" structure as it's only
+ * argument, and returns an integer return code, where 0 means
+ * "continue" and != 0 means "fatal error, hang the system".
+ */
+typedef int (init_fnc_t) (void);
+
+init_fnc_t *init_sequence[] = {
+	//timer_init,
+	//env_init,		/* initialize environment */
+#ifdef CONFIG_INCA_IP
+	incaip_set_cpuclk,	/* set cpu clock according to environment variable */
+#endif
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	init_baudrate,		/* initialze baudrate settings */
+	serial_init,		/* serial communications setup */
+	console_init_f,
+	display_banner,		/* say that we are here */
+#endif
+	init_func_ram,
+	//checkboard,
+	NULL,
+};
+
+
+void bootstrap_board_init_f(ulong bootflag)
+{
+	gd_t gd_data, *id;
+	bd_t *bd;
+	init_fnc_t **init_fnc_ptr;
+	ulong addr, addr_sp, len = (ulong)&uboot_end_bootstrap - BOOTSTRAP_CFG_MONITOR_BASE;
+	ulong *s;
+	ulong lzmaImageaddr  = 0;
+#ifdef CONFIG_PURPLE
+	void copy_code (ulong);
+#endif
+
+	/* Pointer is writable since we allocated a register for it.
+	 */
+	gd = &gd_data;
+	/* compiler optimization barrier needed for GCC >= 3.4 */
+	__asm__ __volatile__("": : :"memory");
+
+	memset ((void *)gd, 0, sizeof (gd_t));
+
+	for (init_fnc_ptr = init_sequence; *init_fnc_ptr; ++init_fnc_ptr) {
+		if ((*init_fnc_ptr)() != 0) {
+			hang ();
+		}
+	}
+
+	/*
+	 * Now that we have DRAM mapped and working, we can
+	 * relocate the code and continue running from DRAM.
+	 */
+	addr = CFG_SDRAM_BASE + gd->ram_size;
+
+	/* We can reserve some RAM "on top" here.
+	 */
+
+	/* round down to next 4 kB limit.
+	 */
+	addr &= ~(4096 - 1);
+	debug ("Top of RAM usable for U-Boot at: %08lx\n", addr);
+
+	/* Reserve memory for U-Boot code, data & bss
+	 * round down to next 16 kB limit
+	 */
+	addr -= len;
+	addr &= ~(16 * 1024 - 1);
+
+	debug ("Reserving %ldk for U-Boot at: %08lx\n", len >> 10, addr);
+
+	 /* Reserve memory for malloc() arena.
+	 */
+	addr_sp = addr - TOTAL_MALLOC_LEN;
+	debug ("Reserving %dk for malloc() at: %08lx\n",
+			TOTAL_MALLOC_LEN >> 10, addr_sp);
+
+	/*
+	 * (permanently) allocate a Board Info struct
+	 * and a permanent copy of the "global" data
+	 */
+	addr_sp -= sizeof(bd_t);
+	bd = (bd_t *)addr_sp;
+	gd->bd = bd;
+	debug ("Reserving %d Bytes for Board Info at: %08lx\n",
+			sizeof(bd_t), addr_sp);
+
+	addr_sp -= sizeof(gd_t);
+	id = (gd_t *)addr_sp;
+	debug ("Reserving %d Bytes for Global Data at: %08lx\n",
+			sizeof (gd_t), addr_sp);
+
+ 	/* Reserve memory for boot params.
+	 */
+	addr_sp -= CFG_BOOTPARAMS_LEN;
+	bd->bi_boot_params = addr_sp;
+	debug ("Reserving %dk for boot params() at: %08lx\n",
+			CFG_BOOTPARAMS_LEN >> 10, addr_sp);
+
+	/*
+	 * Finally, we set up a new (bigger) stack.
+	 *
+	 * Leave some safety gap for SP, force alignment on 16 byte boundary
+	 * Clear initial stack frame
+	 */
+	addr_sp -= 16;
+	addr_sp &= ~0xF;
+	s = (ulong *)addr_sp;
+	*s-- = 0;
+	*s-- = 0;
+	addr_sp = (ulong)s;
+	debug ("Stack Pointer at: %08lx\n", addr_sp);
+
+	/*
+	 * Save local variables to board info struct
+	 */
+	bd->bi_memstart	= CFG_SDRAM_BASE;	/* start of  DRAM memory */
+	bd->bi_memsize	= gd->ram_size;		/* size  of  DRAM memory in bytes */
+	bd->bi_baudrate	= gd->baudrate;		/* Console Baudrate */
+
+	memcpy (id, (void *)gd, sizeof (gd_t));
+
+	/* On the purple board we copy the code in a special way
+	 * in order to solve flash problems
+	 */
+#ifdef CONFIG_PURPLE
+	copy_code(addr);
+#endif
+
+	lzmaImageaddr = (ulong)&uboot_end_data_bootstrap;
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	printf ("\n relocating to address %08x ", addr);
+#endif
+
+	bootstrap_relocate_code (addr_sp, id, addr);
+
+	/* NOTREACHED - relocate_code() does not return */
+}
+/************************************************************************
+ *
+ * This is the next part if the initialization sequence: we are now
+ * running from RAM and have a "normal" C environment, i. e. global
+ * data can be written, BSS has been cleared, the stack size in not
+ * that critical any more, etc.
+ *
+ ************************************************************************
+ */
+#define CONFIG_LZMA 
+
+void bootstrap_board_init_r (gd_t *id, ulong dest_addr)
+{
+	int i;
+
+	ulong	addr;
+	ulong	data, len, checksum;
+	ulong  *len_ptr;
+	image_header_t header;
+	image_header_t *hdr = &header;
+	unsigned int destLen;
+	int (*fn)();
+
+#if 1
+#endif
+
+
+
+	/* initialize malloc() area */
+	mem_malloc_init(dest_addr);
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	printf("\n Compressed Image at %08x \n ", (BOOTSTRAP_CFG_MONITOR_BASE + ((ulong)&uboot_end_data_bootstrap - dest_addr)));
+#endif
+	
+	addr = (char *)(BOOTSTRAP_CFG_MONITOR_BASE + ((ulong)&uboot_end_data_bootstrap - dest_addr));
+	memmove (&header, (char *)addr, sizeof(image_header_t));
+
+	if (ntohl(hdr->ih_magic) != IH_MAGIC) {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+		printf ("Bad Magic Number at address 0x%08lx\n",addr);
+#endif
+		return;
+	}
+
+	data = (ulong)&header;
+	len  = sizeof(image_header_t);
+
+	checksum = ntohl(hdr->ih_hcrc);
+	hdr->ih_hcrc = 0;
+	if (crc32 (0, (char *)data, len) != checksum) {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+		printf ("Bad Header Checksum\n");
+#endif
+		return;
+	}
+	
+	data = addr + sizeof(image_header_t);
+	len  = ntohl(hdr->ih_size);
+
+	len_ptr = (ulong *)data;
+
+    
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	printf ("Disabling all the interrupts\n");
+#endif
+	disable_interrupts();
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	printf ("   Uncompressing UBoot Image ... \n" );
+#endif
+
+	/*
+	 * If we've got less than 4 MB of malloc() space,
+	 * use slower decompression algorithm which requires
+	 * at most 2300 KB of memory.
+	 */
+	destLen = 0x0;
+
+#ifdef CONFIG_BZIP2
+	i = BZ2_bzBuffToBuffDecompress ((char*)ntohl(hdr->ih_load),
+					0x400000, (char *)data, len,
+					CFG_MALLOC_LEN < (4096 * 1024), 0);
+	if (i != BZ_OK) {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+			printf ("BUNZIP2 ERROR %d - must RESET board to recover\n", i);
+#endif
+			return;
+	}
+#endif /* CONFIG_BZIP2 */
+	
+#ifdef CONFIG_MICROBZIP2 
+	i = micro_bzBuffToBuffDecompress ((char*)ntohl(hdr->ih_load),
+					&destLen, (char *)data, len,
+					CFG_MALLOC_LEN < (4096 * 1024), 0);
+	if (i != RETVAL_OK) {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+		printf ("MICRO_BUNZIP2 ERROR %d - must RESET board to recover\n", i);
+#endif
+		//do_reset (cmdtp, flag, argc, argv);
+		return;
+	}
+#endif
+	
+#ifdef CONFIG_LZMA 
+#if 0
+	i = lzmaBuffToBuffDecompress ((char*)ntohl(hdr->ih_load),
+					&destLen, (char *)data, len);
+#endif
+
+	i = lzma_inflate ((unsigned char *)data, len, (unsigned char*)ntohl(hdr->ih_load), &destLen);
+	if (i != LZMA_RESULT_OK) {
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+		printf ("LZMA ERROR %d - must RESET board to recover\n", i);
+#endif
+		//do_reset (cmdtp, flag, argc, argv);
+		return;
+	}
+#endif
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	printf ("   Uncompression completed successfully with destLen %d\n ",destLen );
+#endif
+
+    fn = ntohl(hdr->ih_load);
+
+	(*fn)();
+
+	hang ();
+
+}
+
+void hang (void)
+{
+
+#ifdef DEBUG_ENABLE_BOOTSTRAP_PRINTF
+	puts ("### ERROR ### Please RESET the board ###\n");
+#endif
+	for (;;);
+}
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/console.c b/package/uboot-ifxmips/files/lib_bootstrap/console.c
new file mode 100644
index 0000000..a8fcd2a
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/console.c
@@ -0,0 +1,573 @@
+/*
+ * (C) Copyright 2000
+ * Paolo Scaffardi, AIRVENT SAM s.p.a - RIMINI(ITALY), arsenio@tin.it
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+#include <stdarg.h>
+#include <malloc.h>
+#include <console.h>
+#include <exports.h>
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#ifdef CONFIG_AMIGAONEG3SE
+int console_changed = 0;
+#endif
+
+#ifdef CFG_CONSOLE_IS_IN_ENV
+/*
+ * if overwrite_console returns 1, the stdin, stderr and stdout
+ * are switched to the serial port, else the settings in the
+ * environment are used
+ */
+#ifdef CFG_CONSOLE_OVERWRITE_ROUTINE
+extern int overwrite_console (void);
+#define OVERWRITE_CONSOLE overwrite_console ()
+#else
+#define OVERWRITE_CONSOLE 0
+#endif /* CFG_CONSOLE_OVERWRITE_ROUTINE */
+
+#endif /* CFG_CONSOLE_IS_IN_ENV */
+
+static int console_setfile (int file, device_t * dev)
+{
+	int error = 0;
+
+	if (dev == NULL)
+		return -1;
+
+	switch (file) {
+	case stdin:
+	case stdout:
+	case stderr:
+		/* Start new device */
+		if (dev->start) {
+			error = dev->start ();
+			/* If it's not started dont use it */
+			if (error < 0)
+				break;
+		}
+
+		/* Assign the new device (leaving the existing one started) */
+		stdio_devices[file] = dev;
+
+		/*
+		 * Update monitor functions
+		 * (to use the console stuff by other applications)
+		 */
+		switch (file) {
+		case stdin:
+			gd->jt[XF_getc] = dev->getc;
+			gd->jt[XF_tstc] = dev->tstc;
+			break;
+		case stdout:
+			gd->jt[XF_putc] = dev->putc;
+			gd->jt[XF_puts] = dev->puts;
+			gd->jt[XF_printf] = printf;
+			break;
+		}
+		break;
+
+	default:		/* Invalid file ID */
+		error = -1;
+	}
+	return error;
+}
+
+/** U-Boot INITIAL CONSOLE-NOT COMPATIBLE FUNCTIONS *************************/
+
+void serial_printf (const char *fmt, ...)
+{
+	va_list args;
+	uint i;
+	char printbuffer[CFG_PBSIZE];
+
+	va_start (args, fmt);
+
+	/* For this to work, printbuffer must be larger than
+	 * anything we ever want to print.
+	 */
+	i = vsprintf (printbuffer, fmt, args);
+	va_end (args);
+
+	serial_puts (printbuffer);
+}
+
+int fgetc (int file)
+{
+	if (file < MAX_FILES)
+		return stdio_devices[file]->getc ();
+
+	return -1;
+}
+
+int ftstc (int file)
+{
+	if (file < MAX_FILES)
+		return stdio_devices[file]->tstc ();
+
+	return -1;
+}
+
+void fputc (int file, const char c)
+{
+	if (file < MAX_FILES)
+		stdio_devices[file]->putc (c);
+}
+
+void fputs (int file, const char *s)
+{
+	if (file < MAX_FILES)
+		stdio_devices[file]->puts (s);
+}
+
+void fprintf (int file, const char *fmt, ...)
+{
+	va_list args;
+	uint i;
+	char printbuffer[CFG_PBSIZE];
+
+	va_start (args, fmt);
+
+	/* For this to work, printbuffer must be larger than
+	 * anything we ever want to print.
+	 */
+	i = vsprintf (printbuffer, fmt, args);
+	va_end (args);
+
+	/* Send to desired file */
+	fputs (file, printbuffer);
+}
+
+/** U-Boot INITIAL CONSOLE-COMPATIBLE FUNCTION *****************************/
+
+int getc (void)
+{
+	if (gd->flags & GD_FLG_DEVINIT) {
+		/* Get from the standard input */
+		return fgetc (stdin);
+	}
+
+	/* Send directly to the handler */
+	return serial_getc ();
+}
+
+int tstc (void)
+{
+	if (gd->flags & GD_FLG_DEVINIT) {
+		/* Test the standard input */
+		return ftstc (stdin);
+	}
+
+	/* Send directly to the handler */
+	return serial_tstc ();
+}
+
+void putc (const char c)
+{
+#ifdef CONFIG_SILENT_CONSOLE
+	if (gd->flags & GD_FLG_SILENT)
+		return;
+#endif
+
+	if (gd->flags & GD_FLG_DEVINIT) {
+		/* Send to the standard output */
+		fputc (stdout, c);
+	} else {
+		/* Send directly to the handler */
+		serial_putc (c);
+	}
+}
+
+void puts (const char *s)
+{
+#ifdef CONFIG_SILENT_CONSOLE
+	if (gd->flags & GD_FLG_SILENT)
+		return;
+#endif
+
+	if (gd->flags & GD_FLG_DEVINIT) {
+		/* Send to the standard output */
+		fputs (stdout, s);
+	} else {
+		/* Send directly to the handler */
+		serial_puts (s);
+	}
+}
+
+void printf (const char *fmt, ...)
+{
+	va_list args;
+	uint i;
+	char printbuffer[CFG_PBSIZE];
+
+	va_start (args, fmt);
+
+	/* For this to work, printbuffer must be larger than
+	 * anything we ever want to print.
+	 */
+	i = vsprintf (printbuffer, fmt, args);
+	va_end (args);
+
+	/* Print the string */
+	puts (printbuffer);
+}
+
+void vprintf (const char *fmt, va_list args)
+{
+	uint i;
+	char printbuffer[CFG_PBSIZE];
+
+	/* For this to work, printbuffer must be larger than
+	 * anything we ever want to print.
+	 */
+	i = vsprintf (printbuffer, fmt, args);
+
+	/* Print the string */
+	puts (printbuffer);
+}
+
+/* test if ctrl-c was pressed */
+static int ctrlc_disabled = 0;	/* see disable_ctrl() */
+static int ctrlc_was_pressed = 0;
+int ctrlc (void)
+{
+	if (!ctrlc_disabled && gd->have_console) {
+		if (tstc ()) {
+			switch (getc ()) {
+			case 0x03:		/* ^C - Control C */
+				ctrlc_was_pressed = 1;
+				return 1;
+			default:
+				break;
+			}
+		}
+	}
+	return 0;
+}
+
+/* pass 1 to disable ctrlc() checking, 0 to enable.
+ * returns previous state
+ */
+int disable_ctrlc (int disable)
+{
+	int prev = ctrlc_disabled;	/* save previous state */
+
+	ctrlc_disabled = disable;
+	return prev;
+}
+
+int had_ctrlc (void)
+{
+	return ctrlc_was_pressed;
+}
+
+void clear_ctrlc (void)
+{
+	ctrlc_was_pressed = 0;
+}
+
+#ifdef CONFIG_MODEM_SUPPORT_DEBUG
+char	screen[1024];
+char *cursor = screen;
+int once = 0;
+inline void dbg(const char *fmt, ...)
+{
+	va_list	args;
+	uint	i;
+	char	printbuffer[CFG_PBSIZE];
+
+	if (!once) {
+		memset(screen, 0, sizeof(screen));
+		once++;
+	}
+
+	va_start(args, fmt);
+
+	/* For this to work, printbuffer must be larger than
+	 * anything we ever want to print.
+	 */
+	i = vsprintf(printbuffer, fmt, args);
+	va_end(args);
+
+	if ((screen + sizeof(screen) - 1 - cursor) < strlen(printbuffer)+1) {
+		memset(screen, 0, sizeof(screen));
+		cursor = screen;
+	}
+	sprintf(cursor, printbuffer);
+	cursor += strlen(printbuffer);
+
+}
+#else
+inline void dbg(const char *fmt, ...)
+{
+}
+#endif
+
+/** U-Boot INIT FUNCTIONS *************************************************/
+
+int console_assign (int file, char *devname)
+{
+	int flag, i;
+
+	/* Check for valid file */
+	switch (file) {
+	case stdin:
+		flag = DEV_FLAGS_INPUT;
+		break;
+	case stdout:
+	case stderr:
+		flag = DEV_FLAGS_OUTPUT;
+		break;
+	default:
+		return -1;
+	}
+
+	/* Check for valid device name */
+
+	for (i = 1; i <= ListNumItems (devlist); i++) {
+		device_t *dev = ListGetPtrToItem (devlist, i);
+
+		if (strcmp (devname, dev->name) == 0) {
+			if (dev->flags & flag)
+				return console_setfile (file, dev);
+
+			return -1;
+		}
+	}
+
+	return -1;
+}
+
+/* Called before relocation - use serial functions */
+int console_init_f (void)
+{
+	gd->have_console = 1;
+
+#ifdef CONFIG_SILENT_CONSOLE
+	if (getenv("silent") != NULL)
+		gd->flags |= GD_FLG_SILENT;
+#endif
+
+	return (0);
+}
+
+#if defined(CFG_CONSOLE_IS_IN_ENV) || defined(CONFIG_SPLASH_SCREEN) || defined(CONFIG_SILENT_CONSOLE)
+/* search a device */
+device_t *search_device (int flags, char *name)
+{
+	int i, items;
+	device_t *dev = NULL;
+
+	items = ListNumItems (devlist);
+	if (name == NULL)
+		return dev;
+
+	for (i = 1; i <= items; i++) {
+		dev = ListGetPtrToItem (devlist, i);
+		if ((dev->flags & flags) && (strcmp (name, dev->name) == 0)) {
+			break;
+		}
+	}
+	return dev;
+}
+#endif /* CFG_CONSOLE_IS_IN_ENV || CONFIG_SPLASH_SCREEN */
+
+#ifdef CFG_CONSOLE_IS_IN_ENV
+/* Called after the relocation - use desired console functions */
+int console_init_r (void)
+{
+	char *stdinname, *stdoutname, *stderrname;
+	device_t *inputdev = NULL, *outputdev = NULL, *errdev = NULL;
+#ifdef CFG_CONSOLE_ENV_OVERWRITE
+	int i;
+#endif /* CFG_CONSOLE_ENV_OVERWRITE */
+
+	/* set default handlers at first */
+	gd->jt[XF_getc] = serial_getc;
+	gd->jt[XF_tstc] = serial_tstc;
+	gd->jt[XF_putc] = serial_putc;
+	gd->jt[XF_puts] = serial_puts;
+	gd->jt[XF_printf] = serial_printf;
+
+	/* stdin stdout and stderr are in environment */
+	/* scan for it */
+	stdinname  = getenv ("stdin");
+	stdoutname = getenv ("stdout");
+	stderrname = getenv ("stderr");
+
+	if (OVERWRITE_CONSOLE == 0) { 	/* if not overwritten by config switch */
+		inputdev  = search_device (DEV_FLAGS_INPUT,  stdinname);
+		outputdev = search_device (DEV_FLAGS_OUTPUT, stdoutname);
+		errdev    = search_device (DEV_FLAGS_OUTPUT, stderrname);
+	}
+	/* if the devices are overwritten or not found, use default device */
+	if (inputdev == NULL) {
+		inputdev  = search_device (DEV_FLAGS_INPUT,  "serial");
+	}
+	if (outputdev == NULL) {
+		outputdev = search_device (DEV_FLAGS_OUTPUT, "serial");
+	}
+	if (errdev == NULL) {
+		errdev    = search_device (DEV_FLAGS_OUTPUT, "serial");
+	}
+	/* Initializes output console first */
+	if (outputdev != NULL) {
+		console_setfile (stdout, outputdev);
+	}
+	if (errdev != NULL) {
+		console_setfile (stderr, errdev);
+	}
+	if (inputdev != NULL) {
+		console_setfile (stdin, inputdev);
+	}
+
+	gd->flags |= GD_FLG_DEVINIT;	/* device initialization completed */
+
+#ifndef CFG_CONSOLE_INFO_QUIET
+	/* Print information */
+	puts ("In:    ");
+	if (stdio_devices[stdin] == NULL) {
+		puts ("No input devices available!\n");
+	} else {
+		printf ("%s\n", stdio_devices[stdin]->name);
+	}
+
+	puts ("Out:   ");
+	if (stdio_devices[stdout] == NULL) {
+		puts ("No output devices available!\n");
+	} else {
+		printf ("%s\n", stdio_devices[stdout]->name);
+	}
+
+	puts ("Err:   ");
+	if (stdio_devices[stderr] == NULL) {
+		puts ("No error devices available!\n");
+	} else {
+		printf ("%s\n", stdio_devices[stderr]->name);
+	}
+#endif /* CFG_CONSOLE_INFO_QUIET */
+
+#ifdef CFG_CONSOLE_ENV_OVERWRITE
+	/* set the environment variables (will overwrite previous env settings) */
+	for (i = 0; i < 3; i++) {
+		setenv (stdio_names[i], stdio_devices[i]->name);
+	}
+#endif /* CFG_CONSOLE_ENV_OVERWRITE */
+
+#if 0
+	/* If nothing usable installed, use only the initial console */
+	if ((stdio_devices[stdin] == NULL) && (stdio_devices[stdout] == NULL))
+		return (0);
+#endif
+	return (0);
+}
+
+#else /* CFG_CONSOLE_IS_IN_ENV */
+#if 0
+/* Called after the relocation - use desired console functions */
+int console_init_r (void)
+{
+	device_t *inputdev = NULL, *outputdev = NULL;
+	int i, items = ListNumItems (devlist);
+
+#ifdef CONFIG_SPLASH_SCREEN
+	/* suppress all output if splash screen is enabled and we have
+	   a bmp to display                                            */
+	if (getenv("splashimage") != NULL)
+		outputdev = search_device (DEV_FLAGS_OUTPUT, "nulldev");
+#endif
+
+#ifdef CONFIG_SILENT_CONSOLE
+	/* Suppress all output if "silent" mode requested		*/
+	if (gd->flags & GD_FLG_SILENT)
+		outputdev = search_device (DEV_FLAGS_OUTPUT, "nulldev");
+#endif
+
+	/* Scan devices looking for input and output devices */
+	for (i = 1;
+	     (i <= items) && ((inputdev == NULL) || (outputdev == NULL));
+	     i++
+	    ) {
+		device_t *dev = ListGetPtrToItem (devlist, i);
+
+		if ((dev->flags & DEV_FLAGS_INPUT) && (inputdev == NULL)) {
+			inputdev = dev;
+		}
+		if ((dev->flags & DEV_FLAGS_OUTPUT) && (outputdev == NULL)) {
+			outputdev = dev;
+		}
+	}
+
+	/* Initializes output console first */
+	if (outputdev != NULL) {
+		console_setfile (stdout, outputdev);
+		console_setfile (stderr, outputdev);
+	}
+
+	/* Initializes input console */
+	if (inputdev != NULL) {
+		console_setfile (stdin, inputdev);
+	}
+
+	gd->flags |= GD_FLG_DEVINIT;	/* device initialization completed */
+
+#ifndef CFG_CONSOLE_INFO_QUIET
+	/* Print information */
+	puts ("In:    ");
+	if (stdio_devices[stdin] == NULL) {
+		puts ("No input devices available!\n");
+	} else {
+		printf ("%s\n", stdio_devices[stdin]->name);
+	}
+
+	puts ("Out:   ");
+	if (stdio_devices[stdout] == NULL) {
+		puts ("No output devices available!\n");
+	} else {
+		printf ("%s\n", stdio_devices[stdout]->name);
+	}
+
+	puts ("Err:   ");
+	if (stdio_devices[stderr] == NULL) {
+		puts ("No error devices available!\n");
+	} else {
+		printf ("%s\n", stdio_devices[stderr]->name);
+	}
+#endif /* CFG_CONSOLE_INFO_QUIET */
+
+	/* Setting environment variables */
+	for (i = 0; i < 3; i++) {
+		setenv (stdio_names[i], stdio_devices[i]->name);
+	}
+
+#if 0
+	/* If nothing usable installed, use only the initial console */
+	if ((stdio_devices[stdin] == NULL) && (stdio_devices[stdout] == NULL))
+		return (0);
+#endif
+
+	return (0);
+}
+#endif
+
+#endif /* CFG_CONSOLE_IS_IN_ENV */
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/crc32.c b/package/uboot-ifxmips/files/lib_bootstrap/crc32.c
new file mode 100644
index 0000000..50ca4ff
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/crc32.c
@@ -0,0 +1,197 @@
+/*
+ * This file is derived from crc32.c from the zlib-1.1.3 distribution
+ * by Jean-loup Gailly and Mark Adler.
+ */
+
+/* crc32.c -- compute the CRC-32 of a data stream
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#ifndef USE_HOSTCC	/* Shut down "ANSI does not permit..." warnings */
+#include <common.h>	/* to get command definitions like CFG_CMD_JFFS2 */
+#endif
+
+#include "zlib.h"
+
+#define local static
+#define ZEXPORT	/* empty */
+unsigned long crc32 (unsigned long, const unsigned char *, unsigned int);
+
+#ifdef DYNAMIC_CRC_TABLE
+
+local int crc_table_empty = 1;
+local uLongf crc_table[256];
+local void make_crc_table OF((void));
+
+/*
+  Generate a table for a byte-wise 32-bit CRC calculation on the polynomial:
+  x^32+x^26+x^23+x^22+x^16+x^12+x^11+x^10+x^8+x^7+x^5+x^4+x^2+x+1.
+
+  Polynomials over GF(2) are represented in binary, one bit per coefficient,
+  with the lowest powers in the most significant bit.  Then adding polynomials
+  is just exclusive-or, and multiplying a polynomial by x is a right shift by
+  one.  If we call the above polynomial p, and represent a byte as the
+  polynomial q, also with the lowest power in the most significant bit (so the
+  byte 0xb1 is the polynomial x^7+x^3+x+1), then the CRC is (q*x^32) mod p,
+  where a mod b means the remainder after dividing a by b.
+
+  This calculation is done using the shift-register method of multiplying and
+  taking the remainder.  The register is initialized to zero, and for each
+  incoming bit, x^32 is added mod p to the register if the bit is a one (where
+  x^32 mod p is p+x^32 = x^26+...+1), and the register is multiplied mod p by
+  x (which is shifting right by one and adding x^32 mod p if the bit shifted
+  out is a one).  We start with the highest power (least significant bit) of
+  q and repeat for all eight bits of q.
+
+  The table is simply the CRC of all possible eight bit values.  This is all
+  the information needed to generate CRC's on data a byte at a time for all
+  combinations of CRC register values and incoming bytes.
+*/
+local void make_crc_table()
+{
+  uLong c;
+  int n, k;
+  uLong poly;            /* polynomial exclusive-or pattern */
+  /* terms of polynomial defining this crc (except x^32): */
+  static const Byte p[] = {0,1,2,4,5,7,8,10,11,12,16,22,23,26};
+
+  /* make exclusive-or pattern from polynomial (0xedb88320L) */
+  poly = 0L;
+  for (n = 0; n < sizeof(p)/sizeof(Byte); n++)
+    poly |= 1L << (31 - p[n]);
+
+  for (n = 0; n < 256; n++)
+  {
+    c = (uLong)n;
+    for (k = 0; k < 8; k++)
+      c = c & 1 ? poly ^ (c >> 1) : c >> 1;
+    crc_table[n] = c;
+  }
+  crc_table_empty = 0;
+}
+#else
+/* ========================================================================
+ * Table of CRC-32's of all single-byte values (made by make_crc_table)
+ */
+local const uLongf crc_table[256] = {
+  0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L,
+  0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L,
+  0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L,
+  0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL,
+  0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L,
+  0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L,
+  0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L,
+  0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL,
+  0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L,
+  0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL,
+  0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L,
+  0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L,
+  0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L,
+  0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL,
+  0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL,
+  0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L,
+  0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL,
+  0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L,
+  0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L,
+  0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L,
+  0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL,
+  0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L,
+  0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L,
+  0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL,
+  0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L,
+  0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L,
+  0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L,
+  0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L,
+  0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L,
+  0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL,
+  0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL,
+  0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L,
+  0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L,
+  0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL,
+  0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL,
+  0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L,
+  0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL,
+  0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L,
+  0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL,
+  0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L,
+  0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL,
+  0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L,
+  0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L,
+  0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL,
+  0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L,
+  0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L,
+  0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L,
+  0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L,
+  0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L,
+  0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L,
+  0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL,
+  0x2d02ef8dL
+};
+#endif
+
+#if 0
+/* =========================================================================
+ * This function can be used by asm versions of crc32()
+ */
+const uLongf * ZEXPORT get_crc_table()
+{
+#ifdef DYNAMIC_CRC_TABLE
+  if (crc_table_empty) make_crc_table();
+#endif
+  return (const uLongf *)crc_table;
+}
+#endif
+
+/* ========================================================================= */
+#define DO1(buf) crc = crc_table[((int)crc ^ (*buf++)) & 0xff] ^ (crc >> 8);
+#define DO2(buf)  DO1(buf); DO1(buf);
+#define DO4(buf)  DO2(buf); DO2(buf);
+#define DO8(buf)  DO4(buf); DO4(buf);
+
+/* ========================================================================= */
+uLong ZEXPORT crc32(crc, buf, len)
+    uLong crc;
+    const Bytef *buf;
+    uInt len;
+{
+#ifdef DYNAMIC_CRC_TABLE
+    if (crc_table_empty)
+      make_crc_table();
+#endif
+    crc = crc ^ 0xffffffffL;
+    while (len >= 8)
+    {
+      DO8(buf);
+      len -= 8;
+    }
+    if (len) do {
+      DO1(buf);
+    } while (--len);
+    return crc ^ 0xffffffffL;
+}
+
+#if (CONFIG_COMMANDS & CFG_CMD_JFFS2)
+
+/* No ones complement version. JFFS2 (and other things ?)
+ * don't use ones compliment in their CRC calculations.
+ */
+uLong ZEXPORT crc32_no_comp(uLong crc, const Bytef *buf, uInt len)
+{
+#ifdef DYNAMIC_CRC_TABLE
+    if (crc_table_empty)
+      make_crc_table();
+#endif
+    while (len >= 8)
+    {
+      DO8(buf);
+      len -= 8;
+    }
+    if (len) do {
+      DO1(buf);
+    } while (--len);
+
+    return crc;
+}
+
+#endif	/* CFG_CMD_JFFS2 */
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/ctype.c b/package/uboot-ifxmips/files/lib_bootstrap/ctype.c
new file mode 100644
index 0000000..6ed0468
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/ctype.c
@@ -0,0 +1,56 @@
+/*
+ * (C) Copyright 2000
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+/*
+ *  linux/lib/ctype.c
+ *
+ *  Copyright (C) 1991, 1992  Linus Torvalds
+ */
+
+#include <linux/ctype.h>
+
+unsigned char _ctype[] = {
+_C,_C,_C,_C,_C,_C,_C,_C,			/* 0-7 */
+_C,_C|_S,_C|_S,_C|_S,_C|_S,_C|_S,_C,_C,		/* 8-15 */
+_C,_C,_C,_C,_C,_C,_C,_C,			/* 16-23 */
+_C,_C,_C,_C,_C,_C,_C,_C,			/* 24-31 */
+_S|_SP,_P,_P,_P,_P,_P,_P,_P,			/* 32-39 */
+_P,_P,_P,_P,_P,_P,_P,_P,			/* 40-47 */
+_D,_D,_D,_D,_D,_D,_D,_D,			/* 48-55 */
+_D,_D,_P,_P,_P,_P,_P,_P,			/* 56-63 */
+_P,_U|_X,_U|_X,_U|_X,_U|_X,_U|_X,_U|_X,_U,	/* 64-71 */
+_U,_U,_U,_U,_U,_U,_U,_U,			/* 72-79 */
+_U,_U,_U,_U,_U,_U,_U,_U,			/* 80-87 */
+_U,_U,_U,_P,_P,_P,_P,_P,			/* 88-95 */
+_P,_L|_X,_L|_X,_L|_X,_L|_X,_L|_X,_L|_X,_L,	/* 96-103 */
+_L,_L,_L,_L,_L,_L,_L,_L,			/* 104-111 */
+_L,_L,_L,_L,_L,_L,_L,_L,			/* 112-119 */
+_L,_L,_L,_P,_P,_P,_P,_C,			/* 120-127 */
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,		/* 128-143 */
+0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,0,		/* 144-159 */
+_S|_SP,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,   /* 160-175 */
+_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,_P,       /* 176-191 */
+_U,_U,_U,_U,_U,_U,_U,_U,_U,_U,_U,_U,_U,_U,_U,_U,       /* 192-207 */
+_U,_U,_U,_U,_U,_U,_U,_P,_U,_U,_U,_U,_U,_U,_U,_L,       /* 208-223 */
+_L,_L,_L,_L,_L,_L,_L,_L,_L,_L,_L,_L,_L,_L,_L,_L,       /* 224-239 */
+_L,_L,_L,_L,_L,_L,_L,_P,_L,_L,_L,_L,_L,_L,_L,_L};      /* 240-255 */
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/devices.c b/package/uboot-ifxmips/files/lib_bootstrap/devices.c
new file mode 100644
index 0000000..ddf8f8e
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/devices.c
@@ -0,0 +1,216 @@
+/*
+ * (C) Copyright 2000
+ * Paolo Scaffardi, AIRVENT SAM s.p.a - RIMINI(ITALY), arsenio@tin.it
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <config.h>
+#include <common.h>
+#include <stdarg.h>
+#include <malloc.h>
+#include <devices.h>
+#include <serial.h>
+#ifdef CONFIG_LOGBUFFER
+#include <logbuff.h>
+#endif
+#if defined(CONFIG_HARD_I2C) || defined(CONFIG_SOFT_I2C)
+#include <i2c.h>
+#endif
+
+DECLARE_GLOBAL_DATA_PTR;
+
+list_t devlist = 0;
+device_t *stdio_devices[] = { NULL, NULL, NULL };
+char *stdio_names[MAX_FILES] = { "stdin", "stdout", "stderr" };
+
+#if defined(CONFIG_SPLASH_SCREEN) && !defined(CFG_DEVICE_NULLDEV)
+#define	CFG_DEVICE_NULLDEV	1
+#endif
+
+
+#ifdef CFG_DEVICE_NULLDEV
+void nulldev_putc(const char c)
+{
+  /* nulldev is empty! */
+}
+
+void nulldev_puts(const char *s)
+{
+  /* nulldev is empty! */
+}
+
+int nulldev_input(void)
+{
+  /* nulldev is empty! */
+  return 0;
+}
+#endif
+
+/**************************************************************************
+ * SYSTEM DRIVERS
+ **************************************************************************
+ */
+
+static void drv_system_init (void)
+{
+	device_t dev;
+
+	memset (&dev, 0, sizeof (dev));
+
+	strcpy (dev.name, "serial");
+	dev.flags = DEV_FLAGS_OUTPUT | DEV_FLAGS_INPUT | DEV_FLAGS_SYSTEM;
+#ifdef CONFIG_SERIAL_SOFTWARE_FIFO
+	dev.putc = serial_buffered_putc;
+	dev.puts = serial_buffered_puts;
+	dev.getc = serial_buffered_getc;
+	dev.tstc = serial_buffered_tstc;
+#else
+	dev.putc = serial_putc;
+	dev.puts = serial_puts;
+	dev.getc = serial_getc;
+	dev.tstc = serial_tstc;
+#endif
+
+	device_register (&dev);
+
+#ifdef CFG_DEVICE_NULLDEV
+	memset (&dev, 0, sizeof (dev));
+
+	strcpy (dev.name, "nulldev");
+	dev.flags = DEV_FLAGS_OUTPUT | DEV_FLAGS_INPUT | DEV_FLAGS_SYSTEM;
+	dev.putc = nulldev_putc;
+	dev.puts = nulldev_puts;
+	dev.getc = nulldev_input;
+	dev.tstc = nulldev_input;
+
+	device_register (&dev);
+#endif
+}
+
+/**************************************************************************
+ * DEVICES
+ **************************************************************************
+ */
+
+int device_register (device_t * dev)
+{
+	ListInsertItem (devlist, dev, LIST_END);
+	return 0;
+}
+
+/* deregister the device "devname".
+ * returns 0 if success, -1 if device is assigned and 1 if devname not found
+ */
+#ifdef	CFG_DEVICE_DEREGISTER
+int device_deregister(char *devname)
+{
+	int i,l,dev_index;
+	device_t *dev = NULL;
+	char temp_names[3][8];
+
+	dev_index=-1;
+	for (i=1; i<=ListNumItems(devlist); i++) {
+		dev = ListGetPtrToItem (devlist, i);
+		if(strcmp(dev->name,devname)==0) {
+			dev_index=i;
+			break;
+		}
+	}
+	if(dev_index<0) /* device not found */
+		return 0;
+	/* get stdio devices (ListRemoveItem changes the dev list) */
+	for (l=0 ; l< MAX_FILES; l++) {
+		if (stdio_devices[l] == dev) {
+			/* Device is assigned -> report error */
+			return -1;
+		}
+		memcpy (&temp_names[l][0],
+			stdio_devices[l]->name,
+			sizeof(stdio_devices[l]->name));
+	}
+	ListRemoveItem(devlist,NULL,dev_index);
+	/* reassign Device list */
+	for (i=1; i<=ListNumItems(devlist); i++) {
+		dev = ListGetPtrToItem (devlist, i);
+		for (l=0 ; l< MAX_FILES; l++) {
+			if(strcmp(dev->name,temp_names[l])==0) {
+				stdio_devices[l] = dev;
+			}
+		}
+	}
+	return 0;
+}
+#endif	/* CFG_DEVICE_DEREGISTER */
+
+int devices_init (void)
+{
+#ifndef CONFIG_ARM     /* already relocated for current ARM implementation */
+	ulong relocation_offset = gd->reloc_off;
+	int i;
+
+	/* relocate device name pointers */
+	for (i = 0; i < (sizeof (stdio_names) / sizeof (char *)); ++i) {
+		stdio_names[i] = (char *) (((ulong) stdio_names[i]) +
+						relocation_offset);
+	}
+#endif
+
+	/* Initialize the list */
+	devlist = ListCreate (sizeof (device_t));
+
+	if (devlist == NULL) {
+		eputs ("Cannot initialize the list of devices!\n");
+		return -1;
+	}
+#if defined(CONFIG_HARD_I2C) || defined(CONFIG_SOFT_I2C)
+	i2c_init (CFG_I2C_SPEED, CFG_I2C_SLAVE);
+#endif
+#ifdef CONFIG_LCD
+	drv_lcd_init ();
+#endif
+#if defined(CONFIG_VIDEO) || defined(CONFIG_CFB_CONSOLE)
+	drv_video_init ();
+#endif
+#ifdef CONFIG_KEYBOARD
+	drv_keyboard_init ();
+#endif
+#ifdef CONFIG_LOGBUFFER
+	drv_logbuff_init ();
+#endif
+	drv_system_init ();
+#ifdef CONFIG_SERIAL_MULTI
+	serial_devices_init ();
+#endif
+#ifdef CONFIG_USB_TTY
+	drv_usbtty_init ();
+#endif
+#ifdef CONFIG_NETCONSOLE
+	drv_nc_init ();
+#endif
+
+	return (0);
+}
+
+int devices_done (void)
+{
+	ListDispose (devlist);
+
+	return 0;
+}
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/display_options.c b/package/uboot-ifxmips/files/lib_bootstrap/display_options.c
new file mode 100644
index 0000000..512e898
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/display_options.c
@@ -0,0 +1,67 @@
+/*
+ * (C) Copyright 2000-2002
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+
+int display_options (void)
+{
+	extern char version_string[];
+
+#if defined(BUILD_TAG)
+	printf ("\n\n%s, Build: %s\n\n", version_string, BUILD_TAG);
+#else
+	printf ("\n\n%s\n\n", version_string);
+#endif
+	return 0;
+}
+
+/*
+ * print sizes as "xxx kB", "xxx.y kB", "xxx MB" or "xxx.y MB" as needed;
+ * allow for optional trailing string (like "\n")
+ */
+void print_size (ulong size, const char *s)
+{
+	ulong m, n;
+	ulong d = 1 << 20;		/* 1 MB */
+	char  c = 'M';
+
+	if (size < d) {			/* print in kB */
+		c = 'k';
+		d = 1 << 10;
+	}
+
+	n = size / d;
+
+	m = (10 * (size - (n * d)) + (d / 2) ) / d;
+
+	if (m >= 10) {
+		m -= 10;
+		n += 1;
+	}
+
+	printf ("%2ld", n);
+	if (m) {
+		printf (".%ld", m);
+	}
+	printf (" %cB%s", c, s);
+}
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/lists.c b/package/uboot-ifxmips/files/lib_bootstrap/lists.c
new file mode 100644
index 0000000..3f117b5
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/lists.c
@@ -0,0 +1,734 @@
+#include <common.h>
+#include <malloc.h>
+#include <lists.h>
+
+#define MAX(a,b) 	(((a)>(b)) ? (a) : (b))
+#define MIN(a,b) 	(((a)<(b)) ? (a) : (b))
+#define CAT4CHARS(a,b,c,d)	((a<<24) | (b<<16) | (c<<8) | d)
+
+/* increase list size by 10% every time it is full */
+#define kDefaultAllocationPercentIncrease	10
+
+/* always increase list size by 4 items when it is full */
+#define kDefaultAllocationminNumItemsIncrease	4
+
+/*
+ * how many items to expand the list by when it becomes full
+ * = current listSize (in items) + (hiword percent of list size) + loword
+ */
+#define NUMITEMSPERALLOC(list)	MAX(((*list)->listSize * \
+				    ((*list)->percentIncrease + 100)) / 100, \
+				    (*list)->minNumItemsIncrease )
+
+#define ITEMPTR(list,item)	&(((char *)&(*list)->itemList)[(*(list))->itemSize * (item)])
+
+#define LIST_SIGNATURE		CAT4CHARS('L', 'I', 'S', 'T');
+
+#define calloc(size,num)	malloc(size*num)
+
+/********************************************************************/
+
+Handle NewHandle (unsigned int numBytes)
+{
+	void *memPtr;
+	HandleRecord *hanPtr;
+
+	memPtr = calloc (numBytes, 1);
+	hanPtr = (HandleRecord *) calloc (sizeof (HandleRecord), 1);
+	if (hanPtr && (memPtr || numBytes == 0)) {
+		hanPtr->ptr = memPtr;
+		hanPtr->size = numBytes;
+		return (Handle) hanPtr;
+	} else {
+		free (memPtr);
+		free (hanPtr);
+		return NULL;
+	}
+}
+/********************************************************************/
+
+void DisposeHandle (Handle handle)
+{
+	if (handle) {
+		free (*handle);
+		free ((void *) handle);
+	}
+}
+/********************************************************************/
+
+unsigned int GetHandleSize (Handle handle)
+{
+	return ((HandleRecord *) handle)->size;
+}
+/********************************************************************/
+
+int SetHandleSize (Handle handle, unsigned int newSize)
+{
+	HandleRecord *hanRecPtr = (HandleRecord *) handle;
+	void *newPtr, *oldPtr;
+	unsigned int oldSize;
+
+
+	oldPtr = hanRecPtr->ptr;
+	oldSize = hanRecPtr->size;
+
+	if (oldSize == newSize)
+		return 1;
+
+	if (oldPtr == NULL) {
+		newPtr = malloc (newSize);
+	} else {
+		newPtr = realloc (oldPtr, newSize);
+	}
+	if (newPtr || (newSize == 0)) {
+		hanRecPtr->ptr = newPtr;
+		hanRecPtr->size = newSize;
+		if (newSize > oldSize)
+			memset ((char *) newPtr + oldSize, 0, newSize - oldSize);
+		return 1;
+	} else
+		return 0;
+}
+
+#ifdef	CFG_ALL_LIST_FUNCTIONS
+
+/*  Used to compare list elements by their raw data contents */
+static int ListMemBlockCmp (void *a, void *b, int size)
+{
+	return memcmp (a, b, size);
+}
+
+/***************************************************************************/
+
+/*
+ * Binary search numElements of size elementSize in array for a match
+ * to the. item. Return the index of the element that matches
+ * (0 - numElements - 1). If no match is found return the -i-1 where
+ * i is the index (0 - numElements) where the item should be placed.
+ * (*theCmp)(a,b) should return <0 if a<b, 0 if a==b, >0 if a>b.
+ *
+ * This function is like the C-Library function bsearch() except that
+ * this function returns the index where the item should be placed if
+ * it is not found.
+ */
+int BinSearch ( void *array, int numElements, int elementSize,
+		void *itemPtr, CompareFunction compareFunction)
+{
+	int low, high, mid, cmp;
+	void *arrayItemPtr;
+
+	for (low = 0, high = numElements - 1, mid = 0, cmp = -1; low <= high;) {
+		mid = (low + high) >> 1;
+
+		arrayItemPtr = (void *) (((char *) array) + (mid * elementSize));
+		cmp = compareFunction
+			? compareFunction (itemPtr, arrayItemPtr)
+			: ListMemBlockCmp (itemPtr, arrayItemPtr, elementSize);
+		if (cmp == 0) {
+			return mid;
+		} else if (cmp < 0) {
+			high = mid - 1;
+		} else {
+			low = mid + 1;
+		}
+	}
+	if (cmp > 0)
+		mid++;
+
+	return -mid - 1;
+}
+
+#endif	/* CFG_ALL_LIST_FUNCTIONS */
+
+/*******************************************************************************/
+
+/*
+ * If numNewItems == 0 then expand the list by the number of items
+ * indicated by its allocation policy.
+ * If numNewItems > 0 then expand the list by exactly the number of
+ * items indicated.
+ * If numNewItems < 0 then expand the list by the absolute value of
+ * numNewItems plus the number of items indicated by its allocation
+ * policy.
+ * Returns 1 for success, 0 if out of memory
+*/
+static int ExpandListSpace (list_t list, int numNewItems)
+{
+	if (numNewItems == 0) {
+		numNewItems = NUMITEMSPERALLOC (list);
+	} else if (numNewItems < 0) {
+		numNewItems = (-numNewItems) + NUMITEMSPERALLOC (list);
+	}
+
+	if (SetHandleSize ((Handle) list,
+			   sizeof (ListStruct) +
+			   ((*list)->listSize +
+			   numNewItems) * (*list)->itemSize)) {
+		(*list)->listSize += numNewItems;
+		return 1;
+	} else {
+		return 0;
+	}
+}
+
+/*******************************/
+
+#ifdef	CFG_ALL_LIST_FUNCTIONS
+
+/*
+ * This function reallocate the list, minus any currently unused
+ * portion of its allotted memory.
+ */
+void ListCompact (list_t list)
+{
+
+	if (!SetHandleSize ((Handle) list,
+			    sizeof (ListStruct) +
+			    (*list)->numItems * (*list)->itemSize)) {
+		return;
+	}
+
+	(*list)->listSize = (*list)->numItems;
+}
+
+#endif	/* CFG_ALL_LIST_FUNCTIONS */
+
+/*******************************/
+
+list_t ListCreate (int elementSize)
+{
+	list_t list;
+
+	list = (list_t) (NewHandle (sizeof (ListStruct)));  /* create empty list */
+	if (list) {
+		(*list)->signature = LIST_SIGNATURE;
+		(*list)->numItems = 0;
+		(*list)->listSize = 0;
+		(*list)->itemSize = elementSize;
+		(*list)->percentIncrease = kDefaultAllocationPercentIncrease;
+		(*list)->minNumItemsIncrease =
+				kDefaultAllocationminNumItemsIncrease;
+	}
+
+	return list;
+}
+
+/*******************************/
+
+void ListSetAllocationPolicy (list_t list, int minItemsPerAlloc,
+			      int percentIncreasePerAlloc)
+{
+	(*list)->percentIncrease = percentIncreasePerAlloc;
+	(*list)->minNumItemsIncrease = minItemsPerAlloc;
+}
+
+/*******************************/
+
+void ListDispose (list_t list)
+{
+	DisposeHandle ((Handle) list);
+}
+/*******************************/
+
+#ifdef	CFG_ALL_LIST_FUNCTIONS
+
+void ListDisposePtrList (list_t list)
+{
+	int index;
+	int numItems;
+
+	if (list) {
+		numItems = ListNumItems (list);
+
+		for (index = 1; index <= numItems; index++)
+			free (*(void **) ListGetPtrToItem (list, index));
+
+		ListDispose (list);
+	}
+}
+
+/*******************************/
+
+/*
+ * keeps memory, resets the number of items to 0
+ */
+void ListClear (list_t list)
+{
+	if (!list)
+		return;
+	(*list)->numItems = 0;
+}
+
+/*******************************/
+
+/*
+ * copy is only as large as necessary
+ */
+list_t ListCopy (list_t originalList)
+{
+	list_t tempList = NULL;
+	int numItems;
+
+	if (!originalList)
+		return NULL;
+
+	tempList = ListCreate ((*originalList)->itemSize);
+	if (tempList) {
+		numItems = ListNumItems (originalList);
+
+		if (!SetHandleSize ((Handle) tempList,
+				    sizeof (ListStruct) +
+				    numItems * (*tempList)->itemSize)) {
+			ListDispose (tempList);
+			return NULL;
+		}
+
+		(*tempList)->numItems = (*originalList)->numItems;
+		(*tempList)->listSize = (*originalList)->numItems;
+		(*tempList)->itemSize = (*originalList)->itemSize;
+		(*tempList)->percentIncrease = (*originalList)->percentIncrease;
+		(*tempList)->minNumItemsIncrease =
+				(*originalList)->minNumItemsIncrease;
+
+		memcpy (ITEMPTR (tempList, 0), ITEMPTR (originalList, 0),
+				numItems * (*tempList)->itemSize);
+	}
+
+	return tempList;
+}
+
+/********************************/
+
+/*
+ * list1 = list1 + list2
+ */
+int ListAppend (list_t list1, list_t list2)
+{
+	int numItemsL1, numItemsL2;
+
+	if (!list2)
+		return 1;
+
+	if (!list1)
+		return 0;
+	if ((*list1)->itemSize != (*list2)->itemSize)
+		return 0;
+
+	numItemsL1 = ListNumItems (list1);
+	numItemsL2 = ListNumItems (list2);
+
+	if (numItemsL2 == 0)
+		return 1;
+
+	if (!SetHandleSize ((Handle) list1,
+			    sizeof (ListStruct) + (numItemsL1 + numItemsL2) *
+					(*list1)->itemSize)) {
+		return 0;
+	}
+
+	(*list1)->numItems = numItemsL1 + numItemsL2;
+	(*list1)->listSize = numItemsL1 + numItemsL2;
+
+	memmove (ITEMPTR (list1, numItemsL1),
+		 ITEMPTR (list2, 0),
+		 numItemsL2 * (*list2)->itemSize);
+
+	return 1;
+}
+
+#endif	/* CFG_ALL_LIST_FUNCTIONS */
+
+/*******************************/
+
+/*
+ * returns 1 if the item is inserted, returns 0 if out of memory or
+ * bad arguments were passed.
+ */
+int ListInsertItem (list_t list, void *ptrToItem, int itemPosition)
+{
+	return ListInsertItems (list, ptrToItem, itemPosition, 1);
+}
+
+/*******************************/
+
+int ListInsertItems (list_t list, void *ptrToItems, int firstItemPosition,
+		     int numItemsToInsert)
+{
+	int numItems = (*list)->numItems;
+
+	if (firstItemPosition == numItems + 1)
+		firstItemPosition = LIST_END;
+	else if (firstItemPosition > numItems)
+		return 0;
+
+	if ((*list)->numItems >= (*list)->listSize) {
+		if (!ExpandListSpace (list, -numItemsToInsert))
+			return 0;
+	}
+
+	if (firstItemPosition == LIST_START) {
+		if (numItems == 0) {
+			/* special case for empty list */
+			firstItemPosition = LIST_END;
+		} else {
+			firstItemPosition = 1;
+		}
+	}
+
+	if (firstItemPosition == LIST_END) {	/* add at the end of the list */
+		if (ptrToItems)
+			memcpy (ITEMPTR (list, numItems), ptrToItems,
+					(*list)->itemSize * numItemsToInsert);
+		else
+			memset (ITEMPTR (list, numItems), 0,
+					(*list)->itemSize * numItemsToInsert);
+
+		(*list)->numItems += numItemsToInsert;
+	} else {					/* move part of list up to make room for new item */
+		memmove (ITEMPTR (list, firstItemPosition - 1 + numItemsToInsert),
+			 ITEMPTR (list, firstItemPosition - 1),
+			 (numItems + 1 - firstItemPosition) * (*list)->itemSize);
+
+		if (ptrToItems)
+			memmove (ITEMPTR (list, firstItemPosition - 1), ptrToItems,
+					 (*list)->itemSize * numItemsToInsert);
+		else
+			memset (ITEMPTR (list, firstItemPosition - 1), 0,
+					(*list)->itemSize * numItemsToInsert);
+
+		(*list)->numItems += numItemsToInsert;
+	}
+
+	return 1;
+}
+
+#ifdef CFG_ALL_LIST_FUNCTIONS
+
+/*******************************/
+
+int ListEqual (list_t list1, list_t list2)
+{
+	if (list1 == list2)
+		return 1;
+
+	if (list1 == NULL || list2 == NULL)
+		return 0;
+
+	if ((*list1)->itemSize == (*list1)->itemSize) {
+	    if ((*list1)->numItems == (*list2)->numItems) {
+		return (memcmp (ITEMPTR (list1, 0), ITEMPTR (list2, 0),
+				(*list1)->itemSize * (*list1)->numItems) == 0);
+	    }
+	}
+
+	return 0;
+}
+
+/*******************************/
+
+/*
+ * The item pointed to by ptrToItem is copied over the current item
+ * at itemPosition
+ */
+void ListReplaceItem (list_t list, void *ptrToItem, int itemPosition)
+{
+	ListReplaceItems (list, ptrToItem, itemPosition, 1);
+}
+
+/*******************************/
+
+/*
+ * The item pointed to by ptrToItems is copied over the current item
+ * at itemPosition
+ */
+void ListReplaceItems ( list_t list, void *ptrToItems,
+			int firstItemPosition, int numItemsToReplace)
+{
+
+	if (firstItemPosition == LIST_END)
+		firstItemPosition = (*list)->numItems;
+	else if (firstItemPosition == LIST_START)
+		firstItemPosition = 1;
+
+	memmove (ITEMPTR (list, firstItemPosition - 1), ptrToItems,
+			 (*list)->itemSize * numItemsToReplace);
+}
+
+/*******************************/
+
+void ListGetItem (list_t list, void *itemDestination, int itemPosition)
+{
+	ListGetItems (list, itemDestination, itemPosition, 1);
+}
+
+#endif	/* CFG_ALL_LIST_FUNCTIONS */
+
+/*******************************/
+
+#if defined(CFG_ALL_LIST_FUNCTIONS) || defined(CFG_DEVICE_DEREGISTER)
+
+void ListRemoveItem (list_t list, void *itemDestination, int itemPosition)
+{
+	ListRemoveItems (list, itemDestination, itemPosition, 1);
+}
+
+/*******************************/
+
+void ListRemoveItems (list_t list, void *itemsDestination,
+		      int firstItemPosition, int numItemsToRemove)
+{
+	int firstItemAfterChunk, numToMove;
+
+	if (firstItemPosition == LIST_START)
+		firstItemPosition = 1;
+	else if (firstItemPosition == LIST_END)
+		firstItemPosition = (*list)->numItems;
+
+	if (itemsDestination != NULL)
+		memcpy (itemsDestination, ITEMPTR (list, firstItemPosition - 1),
+				(*list)->itemSize * numItemsToRemove);
+
+	firstItemAfterChunk = firstItemPosition + numItemsToRemove;
+	numToMove = (*list)->numItems - (firstItemAfterChunk - 1);
+
+	if (numToMove > 0) {
+		/*
+		 * move part of list down to cover hole left by removed item
+		 */
+		memmove (ITEMPTR (list, firstItemPosition - 1),
+				 ITEMPTR (list, firstItemAfterChunk - 1),
+				 (*list)->itemSize * numToMove);
+	}
+
+	(*list)->numItems -= numItemsToRemove;
+}
+#endif	/* CFG_ALL_LIST_FUNCTIONS || CFG_DEVICE_DEREGISTER */
+
+/*******************************/
+
+void ListGetItems (list_t list, void *itemsDestination,
+		   int firstItemPosition, int numItemsToGet)
+{
+
+	if (firstItemPosition == LIST_START)
+		firstItemPosition = 1;
+	else if (firstItemPosition == LIST_END)
+		firstItemPosition = (*list)->numItems;
+
+	memcpy (itemsDestination,
+		ITEMPTR (list, firstItemPosition - 1),
+		(*list)->itemSize * numItemsToGet);
+}
+
+/*******************************/
+
+/*
+ * Returns a pointer to the item at itemPosition. returns null if an
+ * errors occurred.
+ */
+void *ListGetPtrToItem (list_t list, int itemPosition)
+{
+	if (itemPosition == LIST_START)
+		itemPosition = 1;
+	else if (itemPosition == LIST_END)
+		itemPosition = (*list)->numItems;
+
+	return ITEMPTR (list, itemPosition - 1);
+}
+
+/*******************************/
+
+/*
+ * returns a pointer the lists data (abstraction violation for
+ * optimization)
+ */
+void *ListGetDataPtr (list_t list)
+{
+	return &((*list)->itemList[0]);
+}
+
+/********************************/
+
+#ifdef	CFG_ALL_LIST_FUNCTIONS
+
+int ListApplyToEach (list_t list, int ascending,
+		     ListApplicationFunc funcToApply,
+		     void *callbackData)
+{
+	int result = 0, index;
+
+	if (!list || !funcToApply)
+		goto Error;
+
+	if (ascending) {
+		for (index = 1; index <= ListNumItems (list); index++) {
+			result = funcToApply (index,
+					      ListGetPtrToItem (list, index),
+					      callbackData);
+			if (result < 0)
+				goto Error;
+		}
+	} else {
+		for (index = ListNumItems (list);
+		     index > 0 && index <= ListNumItems (list);
+		     index--) {
+			result = funcToApply (index,
+					      ListGetPtrToItem (list, index),
+					      callbackData);
+			if (result < 0)
+				goto Error;
+		}
+	}
+
+Error:
+	return result;
+}
+
+#endif /* CFG_ALL_LIST_FUNCTIONS */
+
+/********************************/
+
+int ListGetItemSize (list_t list)
+{
+	return (*list)->itemSize;
+}
+
+/********************************/
+
+int ListNumItems (list_t list)
+{
+	return (*list)->numItems;
+}
+
+/*******************************/
+
+#ifdef	CFG_ALL_LIST_FUNCTIONS
+
+void ListRemoveDuplicates (list_t list, CompareFunction compareFunction)
+{
+	int numItems, index, startIndexForFind, duplicatesIndex;
+
+	numItems = ListNumItems (list);
+
+	for (index = 1; index < numItems; index++) {
+		startIndexForFind = index + 1;
+		while (startIndexForFind <= numItems) {
+			duplicatesIndex =
+				ListFindItem (list,
+					      ListGetPtrToItem (list, index),
+					      startIndexForFind,
+					      compareFunction);
+			if (duplicatesIndex > 0) {
+				ListRemoveItem (list, NULL, duplicatesIndex);
+				numItems--;
+				startIndexForFind = duplicatesIndex;
+			} else {
+				break;
+			}
+		}
+	}
+}
+
+/*******************************/
+
+
+/*******************************/
+
+int ListFindItem (list_t list, void *ptrToItem, int startingPosition,
+		  CompareFunction compareFunction)
+{
+	int numItems, size, index, cmp;
+	void *listItemPtr;
+
+	if ((numItems = (*list)->numItems) == 0)
+		return 0;
+
+	size = (*list)->itemSize;
+
+	if (startingPosition == LIST_START)
+		startingPosition = 1;
+	else if (startingPosition == LIST_END)
+		startingPosition = numItems;
+
+	for (index = startingPosition; index <= numItems; index++) {
+		listItemPtr = ITEMPTR (list, index - 1);
+		cmp = compareFunction
+			? compareFunction (ptrToItem, listItemPtr)
+			: ListMemBlockCmp (ptrToItem, listItemPtr, size);
+		if (cmp == 0)
+			return index;
+	}
+
+	return 0;
+}
+
+/*******************************/
+
+int ShortCompare (void *a, void *b)
+{
+	if (*(short *) a < *(short *) b)
+		return -1;
+	if (*(short *) a > *(short *) b)
+		return 1;
+	return 0;
+}
+
+/*******************************/
+
+int IntCompare (void *a, void *b)
+{
+	if (*(int *) a < *(int *) b)
+		return -1;
+	if (*(int *) a > *(int *) b)
+		return 1;
+	return 0;
+}
+
+/*******************************/
+
+int CStringCompare (void *a, void *b)
+{
+	return strcmp (*(char **) a, *(char **) b);
+}
+
+/*******************************/
+
+
+int ListBinSearch (list_t list, void *ptrToItem,
+		   CompareFunction compareFunction)
+{
+	int index;
+
+	index = BinSearch (ITEMPTR (list, 0),
+			   (int) (*list)->numItems,
+			   (int) (*list)->itemSize, ptrToItem,
+			   compareFunction);
+
+	if (index >= 0)
+		index++;			/* lists start from 1 */
+	else
+		index = 0;			/* item not found */
+
+	return index;
+}
+
+/**************************************************************************/
+
+/*
+ * Reserves memory for numItems in the list. If it succeeds then
+ * numItems items can be inserted without possibility of an out of
+ * memory error (useful to simplify error recovery in complex
+ * functions). Returns 1 if success, 0 if out of memory.
+ */
+int ListPreAllocate (list_t list, int numItems)
+{
+	if ((*list)->listSize - (*list)->numItems < numItems) {
+		return ExpandListSpace (list,
+					numItems - ((*list)->listSize -
+						(*list)->numItems));
+	} else {
+		return 1;	/* enough items are already pre-allocated */
+	}
+}
+
+#endif /* CFG_ALL_LIST_FUNCTIONS */
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/string.c b/package/uboot-ifxmips/files/lib_bootstrap/string.c
new file mode 100644
index 0000000..e0b793a
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/string.c
@@ -0,0 +1,578 @@
+/*
+ *  linux/lib/string.c
+ *
+ *  Copyright (C) 1991, 1992  Linus Torvalds
+ */
+
+/*
+ * stupid library routines.. The optimized versions should generally be found
+ * as inline code in <asm-xx/string.h>
+ *
+ * These are buggy as well..
+ *
+ * * Fri Jun 25 1999, Ingo Oeser <ioe@informatik.tu-chemnitz.de>
+ * -  Added strsep() which will replace strtok() soon (because strsep() is
+ *    reentrant and should be faster). Use only strsep() in new code, please.
+ */
+
+#include <linux/types.h>
+#include <linux/string.h>
+#include <linux/ctype.h>
+#include <malloc.h>
+
+
+#if 0 /* not used - was: #ifndef __HAVE_ARCH_STRNICMP */
+/**
+ * strnicmp - Case insensitive, length-limited string comparison
+ * @s1: One string
+ * @s2: The other string
+ * @len: the maximum number of characters to compare
+ */
+int strnicmp(const char *s1, const char *s2, size_t len)
+{
+	/* Yes, Virginia, it had better be unsigned */
+	unsigned char c1, c2;
+
+	c1 = 0;	c2 = 0;
+	if (len) {
+		do {
+			c1 = *s1; c2 = *s2;
+			s1++; s2++;
+			if (!c1)
+				break;
+			if (!c2)
+				break;
+			if (c1 == c2)
+				continue;
+			c1 = tolower(c1);
+			c2 = tolower(c2);
+			if (c1 != c2)
+				break;
+		} while (--len);
+	}
+	return (int)c1 - (int)c2;
+}
+#endif
+
+char * ___strtok;
+
+#ifndef __HAVE_ARCH_STRCPY
+/**
+ * strcpy - Copy a %NUL terminated string
+ * @dest: Where to copy the string to
+ * @src: Where to copy the string from
+ */
+char * strcpy(char * dest,const char *src)
+{
+	char *tmp = dest;
+
+	while ((*dest++ = *src++) != '\0')
+		/* nothing */;
+	return tmp;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRNCPY
+/**
+ * strncpy - Copy a length-limited, %NUL-terminated string
+ * @dest: Where to copy the string to
+ * @src: Where to copy the string from
+ * @count: The maximum number of bytes to copy
+ *
+ * Note that unlike userspace strncpy, this does not %NUL-pad the buffer.
+ * However, the result is not %NUL-terminated if the source exceeds
+ * @count bytes.
+ */
+char * strncpy(char * dest,const char *src,size_t count)
+{
+	char *tmp = dest;
+
+	while (count-- && (*dest++ = *src++) != '\0')
+		/* nothing */;
+
+	return tmp;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRCAT
+/**
+ * strcat - Append one %NUL-terminated string to another
+ * @dest: The string to be appended to
+ * @src: The string to append to it
+ */
+char * strcat(char * dest, const char * src)
+{
+	char *tmp = dest;
+
+	while (*dest)
+		dest++;
+	while ((*dest++ = *src++) != '\0')
+		;
+
+	return tmp;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRNCAT
+/**
+ * strncat - Append a length-limited, %NUL-terminated string to another
+ * @dest: The string to be appended to
+ * @src: The string to append to it
+ * @count: The maximum numbers of bytes to copy
+ *
+ * Note that in contrast to strncpy, strncat ensures the result is
+ * terminated.
+ */
+char * strncat(char *dest, const char *src, size_t count)
+{
+	char *tmp = dest;
+
+	if (count) {
+		while (*dest)
+			dest++;
+		while ((*dest++ = *src++)) {
+			if (--count == 0) {
+				*dest = '\0';
+				break;
+			}
+		}
+	}
+
+	return tmp;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRCMP
+/**
+ * strcmp - Compare two strings
+ * @cs: One string
+ * @ct: Another string
+ */
+int strcmp(const char * cs,const char * ct)
+{
+	register signed char __res;
+
+	while (1) {
+		if ((__res = *cs - *ct++) != 0 || !*cs++)
+			break;
+	}
+
+	return __res;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRNCMP
+/**
+ * strncmp - Compare two length-limited strings
+ * @cs: One string
+ * @ct: Another string
+ * @count: The maximum number of bytes to compare
+ */
+int strncmp(const char * cs,const char * ct,size_t count)
+{
+	register signed char __res = 0;
+
+	while (count) {
+		if ((__res = *cs - *ct++) != 0 || !*cs++)
+			break;
+		count--;
+	}
+
+	return __res;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRCHR
+/**
+ * strchr - Find the first occurrence of a character in a string
+ * @s: The string to be searched
+ * @c: The character to search for
+ */
+char * strchr(const char * s, int c)
+{
+	for(; *s != (char) c; ++s)
+		if (*s == '\0')
+			return NULL;
+	return (char *) s;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRRCHR
+/**
+ * strrchr - Find the last occurrence of a character in a string
+ * @s: The string to be searched
+ * @c: The character to search for
+ */
+char * strrchr(const char * s, int c)
+{
+       const char *p = s + strlen(s);
+       do {
+	   if (*p == (char)c)
+	       return (char *)p;
+       } while (--p >= s);
+       return NULL;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRLEN
+/**
+ * strlen - Find the length of a string
+ * @s: The string to be sized
+ */
+size_t strlen(const char * s)
+{
+	const char *sc;
+
+	for (sc = s; *sc != '\0'; ++sc)
+		/* nothing */;
+	return sc - s;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRNLEN
+/**
+ * strnlen - Find the length of a length-limited string
+ * @s: The string to be sized
+ * @count: The maximum number of bytes to search
+ */
+size_t strnlen(const char * s, size_t count)
+{
+	const char *sc;
+
+	for (sc = s; count-- && *sc != '\0'; ++sc)
+		/* nothing */;
+	return sc - s;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRDUP
+char * strdup(const char *s)
+{
+	char *new;
+
+	if ((s == NULL)	||
+	    ((new = malloc (strlen(s) + 1)) == NULL) ) {
+		return NULL;
+	}
+
+	strcpy (new, s);
+	return new;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRSPN
+/**
+ * strspn - Calculate the length of the initial substring of @s which only
+ * 	contain letters in @accept
+ * @s: The string to be searched
+ * @accept: The string to search for
+ */
+size_t strspn(const char *s, const char *accept)
+{
+	const char *p;
+	const char *a;
+	size_t count = 0;
+
+	for (p = s; *p != '\0'; ++p) {
+		for (a = accept; *a != '\0'; ++a) {
+			if (*p == *a)
+				break;
+		}
+		if (*a == '\0')
+			return count;
+		++count;
+	}
+
+	return count;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRPBRK
+/**
+ * strpbrk - Find the first occurrence of a set of characters
+ * @cs: The string to be searched
+ * @ct: The characters to search for
+ */
+char * strpbrk(const char * cs,const char * ct)
+{
+	const char *sc1,*sc2;
+
+	for( sc1 = cs; *sc1 != '\0'; ++sc1) {
+		for( sc2 = ct; *sc2 != '\0'; ++sc2) {
+			if (*sc1 == *sc2)
+				return (char *) sc1;
+		}
+	}
+	return NULL;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRTOK
+/**
+ * strtok - Split a string into tokens
+ * @s: The string to be searched
+ * @ct: The characters to search for
+ *
+ * WARNING: strtok is deprecated, use strsep instead.
+ */
+char * strtok(char * s,const char * ct)
+{
+	char *sbegin, *send;
+
+	sbegin  = s ? s : ___strtok;
+	if (!sbegin) {
+		return NULL;
+	}
+	sbegin += strspn(sbegin,ct);
+	if (*sbegin == '\0') {
+		___strtok = NULL;
+		return( NULL );
+	}
+	send = strpbrk( sbegin, ct);
+	if (send && *send != '\0')
+		*send++ = '\0';
+	___strtok = send;
+	return (sbegin);
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRSEP
+/**
+ * strsep - Split a string into tokens
+ * @s: The string to be searched
+ * @ct: The characters to search for
+ *
+ * strsep() updates @s to point after the token, ready for the next call.
+ *
+ * It returns empty tokens, too, behaving exactly like the libc function
+ * of that name. In fact, it was stolen from glibc2 and de-fancy-fied.
+ * Same semantics, slimmer shape. ;)
+ */
+char * strsep(char **s, const char *ct)
+{
+	char *sbegin = *s, *end;
+
+	if (sbegin == NULL)
+		return NULL;
+
+	end = strpbrk(sbegin, ct);
+	if (end)
+		*end++ = '\0';
+	*s = end;
+
+	return sbegin;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRSWAB
+/**
+ * strswab - swap adjacent even and odd bytes in %NUL-terminated string
+ * s: address of the string
+ *
+ * returns the address of the swapped string or NULL on error. If
+ * string length is odd, last byte is untouched.
+ */
+char *strswab(const char *s)
+{
+	char *p, *q;
+
+	if ((NULL == s) || ('\0' == *s)) {
+		return (NULL);
+	}
+
+	for (p=(char *)s, q=p+1; (*p != '\0') && (*q != '\0'); p+=2, q+=2) {
+		char  tmp;
+
+		tmp = *p;
+		*p  = *q;
+		*q  = tmp;
+	}
+
+	return (char *) s;
+}
+#endif
+
+#ifndef __HAVE_ARCH_MEMSET
+/**
+ * memset - Fill a region of memory with the given value
+ * @s: Pointer to the start of the area.
+ * @c: The byte to fill the area with
+ * @count: The size of the area.
+ *
+ * Do not use memset() to access IO space, use memset_io() instead.
+ */
+void * memset(void * s,int c,size_t count)
+{
+	char *xs = (char *) s;
+
+	while (count--)
+		*xs++ = c;
+
+	return s;
+}
+#endif
+
+#ifndef __HAVE_ARCH_BCOPY
+/**
+ * bcopy - Copy one area of memory to another
+ * @src: Where to copy from
+ * @dest: Where to copy to
+ * @count: The size of the area.
+ *
+ * Note that this is the same as memcpy(), with the arguments reversed.
+ * memcpy() is the standard, bcopy() is a legacy BSD function.
+ *
+ * You should not use this function to access IO space, use memcpy_toio()
+ * or memcpy_fromio() instead.
+ */
+char * bcopy(const char * src, char * dest, int count)
+{
+	char *tmp = dest;
+
+	while (count--)
+		*tmp++ = *src++;
+
+	return dest;
+}
+#endif
+
+#ifndef __HAVE_ARCH_MEMCPY
+/**
+ * memcpy - Copy one area of memory to another
+ * @dest: Where to copy to
+ * @src: Where to copy from
+ * @count: The size of the area.
+ *
+ * You should not use this function to access IO space, use memcpy_toio()
+ * or memcpy_fromio() instead.
+ */
+void * memcpy(void * dest,const void *src,size_t count)
+{
+	char *tmp = (char *) dest, *s = (char *) src;
+
+	while (count--)
+		*tmp++ = *s++;
+
+	return dest;
+}
+#endif
+
+#ifndef __HAVE_ARCH_MEMMOVE
+/**
+ * memmove - Copy one area of memory to another
+ * @dest: Where to copy to
+ * @src: Where to copy from
+ * @count: The size of the area.
+ *
+ * Unlike memcpy(), memmove() copes with overlapping areas.
+ */
+void * memmove(void * dest,const void *src,size_t count)
+{
+	char *tmp, *s;
+
+	if (dest <= src) {
+		tmp = (char *) dest;
+		s = (char *) src;
+		while (count--)
+			*tmp++ = *s++;
+		}
+	else {
+		tmp = (char *) dest + count;
+		s = (char *) src + count;
+		while (count--)
+			*--tmp = *--s;
+		}
+
+	return dest;
+}
+#endif
+
+#ifndef __HAVE_ARCH_MEMCMP
+/**
+ * memcmp - Compare two areas of memory
+ * @cs: One area of memory
+ * @ct: Another area of memory
+ * @count: The size of the area.
+ */
+int memcmp(const void * cs,const void * ct,size_t count)
+{
+	const unsigned char *su1, *su2;
+	int res = 0;
+
+	for( su1 = cs, su2 = ct; 0 < count; ++su1, ++su2, count--)
+		if ((res = *su1 - *su2) != 0)
+			break;
+	return res;
+}
+#endif
+
+#ifndef __HAVE_ARCH_MEMSCAN
+/**
+ * memscan - Find a character in an area of memory.
+ * @addr: The memory area
+ * @c: The byte to search for
+ * @size: The size of the area.
+ *
+ * returns the address of the first occurrence of @c, or 1 byte past
+ * the area if @c is not found
+ */
+void * memscan(void * addr, int c, size_t size)
+{
+	unsigned char * p = (unsigned char *) addr;
+
+	while (size) {
+		if (*p == c)
+			return (void *) p;
+		p++;
+		size--;
+	}
+	return (void *) p;
+}
+#endif
+
+#ifndef __HAVE_ARCH_STRSTR
+/**
+ * strstr - Find the first substring in a %NUL terminated string
+ * @s1: The string to be searched
+ * @s2: The string to search for
+ */
+char * strstr(const char * s1,const char * s2)
+{
+	int l1, l2;
+
+	l2 = strlen(s2);
+	if (!l2)
+		return (char *) s1;
+	l1 = strlen(s1);
+	while (l1 >= l2) {
+		l1--;
+		if (!memcmp(s1,s2,l2))
+			return (char *) s1;
+		s1++;
+	}
+	return NULL;
+}
+#endif
+
+#ifndef __HAVE_ARCH_MEMCHR
+/**
+ * memchr - Find a character in an area of memory.
+ * @s: The memory area
+ * @c: The byte to search for
+ * @n: The size of the area.
+ *
+ * returns the address of the first occurrence of @c, or %NULL
+ * if @c is not found
+ */
+void *memchr(const void *s, int c, size_t n)
+{
+	const unsigned char *p = s;
+	while (n-- != 0) {
+		if ((unsigned char)c == *p++) {
+			return (void *)(p-1);
+		}
+	}
+	return NULL;
+}
+
+#endif
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/time.c b/package/uboot-ifxmips/files/lib_bootstrap/time.c
new file mode 100644
index 0000000..cd8dc72
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/time.c
@@ -0,0 +1,99 @@
+/*
+ * (C) Copyright 2003
+ * Wolfgang Denk, DENX Software Engineering, wd@denx.de.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.  See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#include <common.h>
+
+
+static inline void mips_compare_set(u32 v)
+{
+	asm volatile ("mtc0 %0, $11" : : "r" (v));
+}
+
+static inline void mips_count_set(u32 v)
+{
+	asm volatile ("mtc0 %0, $9" : : "r" (v));
+}
+
+
+static inline u32 mips_count_get(void)
+{
+	u32 count;
+
+	asm volatile ("mfc0 %0, $9" : "=r" (count) :);
+	return count;
+}
+
+/*
+ * timer without interrupts
+ */
+
+int timer_init(void)
+{
+	mips_compare_set(0);
+	mips_count_set(0);
+
+	return 0;
+}
+
+void reset_timer(void)
+{
+	mips_count_set(0);
+}
+
+ulong get_timer(ulong base)
+{
+	return mips_count_get() - base;
+}
+
+void set_timer(ulong t)
+{
+	mips_count_set(t);
+}
+
+void udelay (unsigned long usec)
+{
+	ulong tmo;
+	ulong start = get_timer(0);
+
+	tmo = usec * (CFG_HZ / 1000000);
+	while ((ulong)((mips_count_get() - start)) < tmo)
+		/*NOP*/;
+}
+
+/*
+ * This function is derived from PowerPC code (read timebase as long long).
+ * On MIPS it just returns the timer value.
+ */
+unsigned long long get_ticks(void)
+{
+	return mips_count_get();
+}
+
+/*
+ * This function is derived from PowerPC code (timebase clock frequency).
+ * On MIPS it returns the number of timer ticks per second.
+ */
+ulong get_tbclk(void)
+{
+	return CFG_HZ;
+}
diff --git a/package/uboot-ifxmips/files/lib_bootstrap/vsprintf.c b/package/uboot-ifxmips/files/lib_bootstrap/vsprintf.c
new file mode 100644
index 0000000..2740f2e
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_bootstrap/vsprintf.c
@@ -0,0 +1,385 @@
+/*
+ *  linux/lib/vsprintf.c
+ *
+ *  Copyright (C) 1991, 1992  Linus Torvalds
+ */
+
+/* vsprintf.c -- Lars Wirzenius & Linus Torvalds. */
+/*
+ * Wirzenius wrote this portably, Torvalds fucked it up :-)
+ */
+
+#include <stdarg.h>
+#include <linux/types.h>
+#include <linux/string.h>
+#include <linux/ctype.h>
+
+#include <common.h>
+#if !defined (CONFIG_PANIC_HANG)
+#include <command.h>
+/*cmd_boot.c*/
+extern int do_reset (cmd_tbl_t *cmdtp, int flag, int argc, char *argv[]);
+#endif
+
+unsigned long simple_strtoul(const char *cp,char **endp,unsigned int base)
+{
+	unsigned long result = 0,value;
+
+	if (*cp == '0') {
+		cp++;
+		if ((*cp == 'x') && isxdigit(cp[1])) {
+			base = 16;
+			cp++;
+		}
+		if (!base) {
+			base = 8;
+		}
+	}
+	if (!base) {
+		base = 10;
+	}
+	while (isxdigit(*cp) && (value = isdigit(*cp) ? *cp-'0' : (islower(*cp)
+	    ? toupper(*cp) : *cp)-'A'+10) < base) {
+		result = result*base + value;
+		cp++;
+	}
+	if (endp)
+		*endp = (char *)cp;
+	return result;
+}
+
+long simple_strtol(const char *cp,char **endp,unsigned int base)
+{
+	if(*cp=='-')
+		return -simple_strtoul(cp+1,endp,base);
+	return simple_strtoul(cp,endp,base);
+}
+
+#ifdef CFG_64BIT_STRTOUL
+unsigned long long simple_strtoull (const char *cp, char **endp, unsigned int base)
+{
+	unsigned long long result = 0, value;
+
+	if (*cp == '0') {
+		cp++;
+		if ((*cp == 'x') && isxdigit (cp[1])) {
+			base = 16;
+			cp++;
+		}
+		if (!base) {
+			base = 8;
+		}
+	}
+	if (!base) {
+		base = 10;
+	}
+	while (isxdigit (*cp) && (value = isdigit (*cp)
+				? *cp - '0'
+				: (islower (*cp) ? toupper (*cp) : *cp) - 'A' + 10) < base) {
+		result = result * base + value;
+		cp++;
+	}
+	if (endp)
+		*endp = (char *) cp;
+	return result;
+}
+#endif /* CFG_64BIT_STRTOUL */
+
+/* we use this so that we can do without the ctype library */
+#define is_digit(c)	((c) >= '0' && (c) <= '9')
+
+static int skip_atoi(const char **s)
+{
+	int i=0;
+
+	while (is_digit(**s))
+		i = i*10 + *((*s)++) - '0';
+	return i;
+}
+
+#define ZEROPAD	1		/* pad with zero */
+#define SIGN	2		/* unsigned/signed long */
+#define PLUS	4		/* show plus */
+#define SPACE	8		/* space if plus */
+#define LEFT	16		/* left justified */
+#define SPECIAL	32		/* 0x */
+#define LARGE	64		/* use 'ABCDEF' instead of 'abcdef' */
+
+#define do_div(n,base) ({ \
+	int __res; \
+	__res = ((unsigned long) n) % (unsigned) base; \
+	n = ((unsigned long) n) / (unsigned) base; \
+	__res; \
+})
+
+#ifdef CFG_64BIT_VSPRINTF
+static char * number(char * str, long long num, int base, int size, int precision ,int type)
+#else
+static char * number(char * str, long num, int base, int size, int precision ,int type)
+#endif
+{
+	char c,sign,tmp[66];
+	const char *digits="0123456789abcdefghijklmnopqrstuvwxyz";
+	int i;
+
+	if (type & LARGE)
+		digits = "0123456789ABCDEFGHIJKLMNOPQRSTUVWXYZ";
+	if (type & LEFT)
+		type &= ~ZEROPAD;
+	if (base < 2 || base > 36)
+		return 0;
+	c = (type & ZEROPAD) ? '0' : ' ';
+	sign = 0;
+	if (type & SIGN) {
+		if (num < 0) {
+			sign = '-';
+			num = -num;
+			size--;
+		} else if (type & PLUS) {
+			sign = '+';
+			size--;
+		} else if (type & SPACE) {
+			sign = ' ';
+			size--;
+		}
+	}
+	if (type & SPECIAL) {
+		if (base == 16)
+			size -= 2;
+		else if (base == 8)
+			size--;
+	}
+	i = 0;
+	if (num == 0)
+		tmp[i++]='0';
+	else while (num != 0)
+		tmp[i++] = digits[do_div(num,base)];
+	if (i > precision)
+		precision = i;
+	size -= precision;
+	if (!(type&(ZEROPAD+LEFT)))
+		while(size-->0)
+			*str++ = ' ';
+	if (sign)
+		*str++ = sign;
+	if (type & SPECIAL) {
+		if (base==8)
+			*str++ = '0';
+		else if (base==16) {
+			*str++ = '0';
+			*str++ = digits[33];
+		}
+	}
+	if (!(type & LEFT))
+		while (size-- > 0)
+			*str++ = c;
+	while (i < precision--)
+		*str++ = '0';
+	while (i-- > 0)
+		*str++ = tmp[i];
+	while (size-- > 0)
+		*str++ = ' ';
+	return str;
+}
+
+/* Forward decl. needed for IP address printing stuff... */
+int sprintf(char * buf, const char *fmt, ...);
+
+int vsprintf(char *buf, const char *fmt, va_list args)
+{
+	int len;
+#ifdef CFG_64BIT_VSPRINTF
+	unsigned long long num;
+#else
+	unsigned long num;
+#endif
+	int i, base;
+	char * str;
+	const char *s;
+
+	int flags;		/* flags to number() */
+
+	int field_width;	/* width of output field */
+	int precision;		/* min. # of digits for integers; max
+				   number of chars for from string */
+	int qualifier;		/* 'h', 'l', or 'q' for integer fields */
+
+	for (str=buf ; *fmt ; ++fmt) {
+		if (*fmt != '%') {
+			*str++ = *fmt;
+			continue;
+		}
+
+		/* process flags */
+		flags = 0;
+		repeat:
+			++fmt;		/* this also skips first '%' */
+			switch (*fmt) {
+				case '-': flags |= LEFT; goto repeat;
+				case '+': flags |= PLUS; goto repeat;
+				case ' ': flags |= SPACE; goto repeat;
+				case '#': flags |= SPECIAL; goto repeat;
+				case '0': flags |= ZEROPAD; goto repeat;
+				}
+
+		/* get field width */
+		field_width = -1;
+		if (is_digit(*fmt))
+			field_width = skip_atoi(&fmt);
+		else if (*fmt == '*') {
+			++fmt;
+			/* it's the next argument */
+			field_width = va_arg(args, int);
+			if (field_width < 0) {
+				field_width = -field_width;
+				flags |= LEFT;
+			}
+		}
+
+		/* get the precision */
+		precision = -1;
+		if (*fmt == '.') {
+			++fmt;
+			if (is_digit(*fmt))
+				precision = skip_atoi(&fmt);
+			else if (*fmt == '*') {
+				++fmt;
+				/* it's the next argument */
+				precision = va_arg(args, int);
+			}
+			if (precision < 0)
+				precision = 0;
+		}
+
+		/* get the conversion qualifier */
+		qualifier = -1;
+		if (*fmt == 'h' || *fmt == 'l' || *fmt == 'q') {
+			qualifier = *fmt;
+			++fmt;
+		}
+
+		/* default base */
+		base = 10;
+
+		switch (*fmt) {
+		case 'c':
+			if (!(flags & LEFT))
+				while (--field_width > 0)
+					*str++ = ' ';
+			*str++ = (unsigned char) va_arg(args, int);
+			while (--field_width > 0)
+				*str++ = ' ';
+			continue;
+
+		case 's':
+			s = va_arg(args, char *);
+			if (!s)
+				s = "<NULL>";
+
+			len = strnlen(s, precision);
+
+			if (!(flags & LEFT))
+				while (len < field_width--)
+					*str++ = ' ';
+			for (i = 0; i < len; ++i)
+				*str++ = *s++;
+			while (len < field_width--)
+				*str++ = ' ';
+			continue;
+
+		case 'p':
+			if (field_width == -1) {
+				field_width = 2*sizeof(void *);
+				flags |= ZEROPAD;
+			}
+			str = number(str,
+				(unsigned long) va_arg(args, void *), 16,
+				field_width, precision, flags);
+			continue;
+
+
+		case 'n':
+			if (qualifier == 'l') {
+				long * ip = va_arg(args, long *);
+				*ip = (str - buf);
+			} else {
+				int * ip = va_arg(args, int *);
+				*ip = (str - buf);
+			}
+			continue;
+
+		case '%':
+			*str++ = '%';
+			continue;
+
+		/* integer number formats - set up the flags and "break" */
+		case 'o':
+			base = 8;
+			break;
+
+		case 'X':
+			flags |= LARGE;
+		case 'x':
+			base = 16;
+			break;
+
+		case 'd':
+		case 'i':
+			flags |= SIGN;
+		case 'u':
+			break;
+
+		default:
+			*str++ = '%';
+			if (*fmt)
+				*str++ = *fmt;
+			else
+				--fmt;
+			continue;
+		}
+#ifdef CFG_64BIT_VSPRINTF
+		if (qualifier == 'q')  /* "quad" for 64 bit variables */
+			num = va_arg(args, unsigned long long);
+		else
+#endif
+		if (qualifier == 'l')
+			num = va_arg(args, unsigned long);
+		else if (qualifier == 'h') {
+			num = (unsigned short) va_arg(args, int);
+			if (flags & SIGN)
+				num = (short) num;
+		} else if (flags & SIGN)
+			num = va_arg(args, int);
+		else
+			num = va_arg(args, unsigned int);
+		str = number(str, num, base, field_width, precision, flags);
+	}
+	*str = '\0';
+	return str-buf;
+}
+
+int sprintf(char * buf, const char *fmt, ...)
+{
+	va_list args;
+	int i;
+
+	va_start(args, fmt);
+	i=vsprintf(buf,fmt,args);
+	va_end(args);
+	return i;
+}
+
+void panic(const char *fmt, ...)
+{
+	va_list	args;
+	va_start(args, fmt);
+	vprintf(fmt, args);
+	putc('\n');
+	va_end(args);
+#if defined (CONFIG_PANIC_HANG)
+	hang();
+#else
+	udelay (100000);	/* allow messages to go out */
+	do_reset (NULL, 0, 0, NULL);
+#endif
+}
diff --git a/package/uboot-ifxmips/files/lib_generic/LzmaDecode.c b/package/uboot-ifxmips/files/lib_generic/LzmaDecode.c
new file mode 100644
index 0000000..99d1117
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_generic/LzmaDecode.c
@@ -0,0 +1,600 @@
+/*
+  LzmaDecode.c
+  LZMA Decoder (optimized for Speed version)
+  
+  LZMA SDK 4.40 Copyright (c) 1999-2006 Igor Pavlov (2006-05-01)
+  http://www.7-zip.org/
+
+  LZMA SDK is licensed under two licenses:
+  1) GNU Lesser General Public License (GNU LGPL)
+  2) Common Public License (CPL)
+  It means that you can select one of these two licenses and 
+  follow rules of that license.
+
+  SPECIAL EXCEPTION:
+  Igor Pavlov, as the author of this Code, expressly permits you to 
+  statically or dynamically link your Code (or bind by name) to the 
+  interfaces of this file without subjecting your linked Code to the 
+  terms of the CPL or GNU LGPL. Any modifications or additions 
+  to this file, however, are subject to the LGPL or CPL terms.
+*/
+
+#ifdef CONFIG_LZMA
+
+#include "LzmaDecode.h"
+
+#define kNumTopBits 24
+#define kTopValue ((UInt32)1 << kNumTopBits)
+
+#define kNumBitModelTotalBits 11
+#define kBitModelTotal (1 << kNumBitModelTotalBits)
+#define kNumMoveBits 5
+
+#define RC_READ_BYTE (*Buffer++)
+
+#define RC_INIT2 Code = 0; Range = 0xFFFFFFFF; \
+  { int i; for(i = 0; i < 5; i++) { RC_TEST; Code = (Code << 8) | RC_READ_BYTE; }}
+
+#ifdef _LZMA_IN_CB
+
+#define RC_TEST { if (Buffer == BufferLim) \
+  { SizeT size; int result = InCallback->Read(InCallback, &Buffer, &size); if (result != LZMA_RESULT_OK) { printf("ERROR, %s, %d\n", __FILE__, __LINE__); return result; } \
+  BufferLim = Buffer + size; if (size == 0) { printf("ERROR, %s, %d\n", __FILE__, __LINE__); return LZMA_RESULT_DATA_ERROR; } }}
+
+#define RC_INIT Buffer = BufferLim = 0; RC_INIT2
+
+#else
+
+#define RC_TEST { if (Buffer == BufferLim) { printf("ERROR, %s, %d\n", __FILE__, __LINE__); return LZMA_RESULT_DATA_ERROR; } }
+
+#define RC_INIT(buffer, bufferSize) Buffer = buffer; BufferLim = buffer + bufferSize; RC_INIT2
+ 
+#endif
+
+#define RC_NORMALIZE if (Range < kTopValue) { RC_TEST; Range <<= 8; Code = (Code << 8) | RC_READ_BYTE; }
+
+#define IfBit0(p) RC_NORMALIZE; bound = (Range >> kNumBitModelTotalBits) * *(p); if (Code < bound)
+#define UpdateBit0(p) Range = bound; *(p) += (kBitModelTotal - *(p)) >> kNumMoveBits;
+#define UpdateBit1(p) Range -= bound; Code -= bound; *(p) -= (*(p)) >> kNumMoveBits;
+
+#define RC_GET_BIT2(p, mi, A0, A1) IfBit0(p) \
+  { UpdateBit0(p); mi <<= 1; A0; } else \
+  { UpdateBit1(p); mi = (mi + mi) + 1; A1; } 
+  
+#define RC_GET_BIT(p, mi) RC_GET_BIT2(p, mi, ; , ;)               
+
+#define RangeDecoderBitTreeDecode(probs, numLevels, res) \
+  { int i = numLevels; res = 1; \
+  do { CProb *p = probs + res; RC_GET_BIT(p, res) } while(--i != 0); \
+  res -= (1 << numLevels); }
+
+
+#define kNumPosBitsMax 4
+#define kNumPosStatesMax (1 << kNumPosBitsMax)
+
+#define kLenNumLowBits 3
+#define kLenNumLowSymbols (1 << kLenNumLowBits)
+#define kLenNumMidBits 3
+#define kLenNumMidSymbols (1 << kLenNumMidBits)
+#define kLenNumHighBits 8
+#define kLenNumHighSymbols (1 << kLenNumHighBits)
+
+#define LenChoice 0
+#define LenChoice2 (LenChoice + 1)
+#define LenLow (LenChoice2 + 1)
+#define LenMid (LenLow + (kNumPosStatesMax << kLenNumLowBits))
+#define LenHigh (LenMid + (kNumPosStatesMax << kLenNumMidBits))
+#define kNumLenProbs (LenHigh + kLenNumHighSymbols) 
+
+
+#define kNumStates 12
+#define kNumLitStates 7
+
+#define kStartPosModelIndex 4
+#define kEndPosModelIndex 14
+#define kNumFullDistances (1 << (kEndPosModelIndex >> 1))
+
+#define kNumPosSlotBits 6
+#define kNumLenToPosStates 4
+
+#define kNumAlignBits 4
+#define kAlignTableSize (1 << kNumAlignBits)
+
+#define kMatchMinLen 2
+
+#define IsMatch 0
+#define IsRep (IsMatch + (kNumStates << kNumPosBitsMax))
+#define IsRepG0 (IsRep + kNumStates)
+#define IsRepG1 (IsRepG0 + kNumStates)
+#define IsRepG2 (IsRepG1 + kNumStates)
+#define IsRep0Long (IsRepG2 + kNumStates)
+#define PosSlot (IsRep0Long + (kNumStates << kNumPosBitsMax))
+#define SpecPos (PosSlot + (kNumLenToPosStates << kNumPosSlotBits))
+#define Align (SpecPos + kNumFullDistances - kEndPosModelIndex)
+#define LenCoder (Align + kAlignTableSize)
+#define RepLenCoder (LenCoder + kNumLenProbs)
+#define Literal (RepLenCoder + kNumLenProbs)
+
+#if Literal != LZMA_BASE_SIZE
+StopCompilingDueBUG
+#endif
+
+int LzmaDecodeProperties(CLzmaProperties *propsRes, const unsigned char *propsData, int size)
+{
+  unsigned char prop0;
+  if (size < LZMA_PROPERTIES_SIZE)
+  {
+    printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+    return LZMA_RESULT_DATA_ERROR;
+  }
+  prop0 = propsData[0];
+  if (prop0 >= (9 * 5 * 5))
+  {
+    printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+    return LZMA_RESULT_DATA_ERROR;
+  }
+  {
+    for (propsRes->pb = 0; prop0 >= (9 * 5); propsRes->pb++, prop0 -= (9 * 5));
+    for (propsRes->lp = 0; prop0 >= 9; propsRes->lp++, prop0 -= 9);
+    propsRes->lc = prop0;
+    /*
+    unsigned char remainder = (unsigned char)(prop0 / 9);
+    propsRes->lc = prop0 % 9;
+    propsRes->pb = remainder / 5;
+    propsRes->lp = remainder % 5;
+    */
+  }
+
+  #ifdef _LZMA_OUT_READ
+  {
+    int i;
+    propsRes->DictionarySize = 0;
+    for (i = 0; i < 4; i++)
+      propsRes->DictionarySize += (UInt32)(propsData[1 + i]) << (i * 8);
+    if (propsRes->DictionarySize == 0)
+      propsRes->DictionarySize = 1;
+  }
+  #endif
+  return LZMA_RESULT_OK;
+}
+
+#define kLzmaStreamWasFinishedId (-1)
+
+int LzmaDecode(CLzmaDecoderState *vs,
+    #ifdef _LZMA_IN_CB
+    ILzmaInCallback *InCallback,
+    #else
+    const unsigned char *inStream, SizeT inSize, SizeT *inSizeProcessed,
+    #endif
+    unsigned char *outStream, SizeT outSize, SizeT *outSizeProcessed)
+{
+  CProb *p = vs->Probs;
+  SizeT nowPos = 0;
+  Byte previousByte = 0;
+  UInt32 posStateMask = (1 << (vs->Properties.pb)) - 1;
+  UInt32 literalPosMask = (1 << (vs->Properties.lp)) - 1;
+  int lc = vs->Properties.lc;
+
+  #ifdef _LZMA_OUT_READ
+  
+  UInt32 Range = vs->Range;
+  UInt32 Code = vs->Code;
+  #ifdef _LZMA_IN_CB
+  const Byte *Buffer = vs->Buffer;
+  const Byte *BufferLim = vs->BufferLim;
+  #else
+  const Byte *Buffer = inStream;
+  const Byte *BufferLim = inStream + inSize;
+  #endif
+  int state = vs->State;
+  UInt32 rep0 = vs->Reps[0], rep1 = vs->Reps[1], rep2 = vs->Reps[2], rep3 = vs->Reps[3];
+  int len = vs->RemainLen;
+  UInt32 globalPos = vs->GlobalPos;
+  UInt32 distanceLimit = vs->DistanceLimit;
+
+  Byte *dictionary = vs->Dictionary;
+  UInt32 dictionarySize = vs->Properties.DictionarySize;
+  UInt32 dictionaryPos = vs->DictionaryPos;
+
+  Byte tempDictionary[4];
+
+  #ifndef _LZMA_IN_CB
+  *inSizeProcessed = 0;
+  #endif
+  *outSizeProcessed = 0;
+  if (len == kLzmaStreamWasFinishedId)
+    return LZMA_RESULT_OK;
+
+  if (dictionarySize == 0)
+  {
+    dictionary = tempDictionary;
+    dictionarySize = 1;
+    tempDictionary[0] = vs->TempDictionary[0];
+  }
+
+  if (len == kLzmaNeedInitId)
+  {
+    {
+      UInt32 numProbs = Literal + ((UInt32)LZMA_LIT_SIZE << (lc + vs->Properties.lp));
+      UInt32 i;
+      for (i = 0; i < numProbs; i++)
+        p[i] = kBitModelTotal >> 1; 
+      rep0 = rep1 = rep2 = rep3 = 1;
+      state = 0;
+      globalPos = 0;
+      distanceLimit = 0;
+      dictionaryPos = 0;
+      dictionary[dictionarySize - 1] = 0;
+      #ifdef _LZMA_IN_CB
+      RC_INIT;
+      #else
+      RC_INIT(inStream, inSize);
+      #endif
+    }
+    len = 0;
+  }
+  while(len != 0 && nowPos < outSize)
+  {
+    UInt32 pos = dictionaryPos - rep0;
+    if (pos >= dictionarySize)
+      pos += dictionarySize;
+    outStream[nowPos++] = dictionary[dictionaryPos] = dictionary[pos];
+    if (++dictionaryPos == dictionarySize)
+      dictionaryPos = 0;
+    len--;
+  }
+  if (dictionaryPos == 0)
+    previousByte = dictionary[dictionarySize - 1];
+  else
+    previousByte = dictionary[dictionaryPos - 1];
+
+  #else /* if !_LZMA_OUT_READ */
+
+  int state = 0;
+  UInt32 rep0 = 1, rep1 = 1, rep2 = 1, rep3 = 1;
+  int len = 0;
+  const Byte *Buffer;
+  const Byte *BufferLim;
+  UInt32 Range;
+  UInt32 Code;
+
+  #ifndef _LZMA_IN_CB
+  *inSizeProcessed = 0;
+  #endif
+  *outSizeProcessed = 0;
+
+  {
+    UInt32 i;
+    UInt32 numProbs = Literal + ((UInt32)LZMA_LIT_SIZE << (lc + vs->Properties.lp));
+    for (i = 0; i < numProbs; i++)
+      p[i] = kBitModelTotal >> 1;
+  }
+  
+  #ifdef _LZMA_IN_CB
+  RC_INIT;
+  #else
+  RC_INIT(inStream, inSize);
+  #endif
+
+  #endif /* _LZMA_OUT_READ */
+
+  while(nowPos < outSize)
+  {
+    CProb *prob;
+    UInt32 bound;
+    int posState = (int)(
+        (nowPos 
+        #ifdef _LZMA_OUT_READ
+        + globalPos
+        #endif
+        )
+        & posStateMask);
+
+    prob = p + IsMatch + (state << kNumPosBitsMax) + posState;
+    IfBit0(prob)
+    {
+      int symbol = 1;
+      UpdateBit0(prob)
+      prob = p + Literal + (LZMA_LIT_SIZE * 
+        (((
+        (nowPos 
+        #ifdef _LZMA_OUT_READ
+        + globalPos
+        #endif
+        )
+        & literalPosMask) << lc) + (previousByte >> (8 - lc))));
+
+      if (state >= kNumLitStates)
+      {
+        int matchByte;
+        #ifdef _LZMA_OUT_READ
+        UInt32 pos = dictionaryPos - rep0;
+        if (pos >= dictionarySize)
+          pos += dictionarySize;
+        matchByte = dictionary[pos];
+        #else
+        matchByte = outStream[nowPos - rep0];
+        #endif
+        do
+        {
+          int bit;
+          CProb *probLit;
+          matchByte <<= 1;
+          bit = (matchByte & 0x100);
+          probLit = prob + 0x100 + bit + symbol;
+          RC_GET_BIT2(probLit, symbol, if (bit != 0) break, if (bit == 0) break)
+        }
+        while (symbol < 0x100);
+      }
+      while (symbol < 0x100)
+      {
+        CProb *probLit = prob + symbol;
+        RC_GET_BIT(probLit, symbol)
+      }
+      previousByte = (Byte)symbol;
+
+      outStream[nowPos++] = previousByte;
+      #ifdef _LZMA_OUT_READ
+      if (distanceLimit < dictionarySize)
+        distanceLimit++;
+
+      dictionary[dictionaryPos] = previousByte;
+      if (++dictionaryPos == dictionarySize)
+        dictionaryPos = 0;
+      #endif
+      if (state < 4) state = 0;
+      else if (state < 10) state -= 3;
+      else state -= 6;
+    }
+    else             
+    {
+      UpdateBit1(prob);
+      prob = p + IsRep + state;
+      IfBit0(prob)
+      {
+        UpdateBit0(prob);
+        rep3 = rep2;
+        rep2 = rep1;
+        rep1 = rep0;
+        state = state < kNumLitStates ? 0 : 3;
+        prob = p + LenCoder;
+      }
+      else
+      {
+        UpdateBit1(prob);
+        prob = p + IsRepG0 + state;
+        IfBit0(prob)
+        {
+          UpdateBit0(prob);
+          prob = p + IsRep0Long + (state << kNumPosBitsMax) + posState;
+          IfBit0(prob)
+          {
+            #ifdef _LZMA_OUT_READ
+            UInt32 pos;
+            #endif
+            UpdateBit0(prob);
+            
+            #ifdef _LZMA_OUT_READ
+            if (distanceLimit == 0)
+            #else
+            if (nowPos == 0)
+            #endif
+            {
+              printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+              return LZMA_RESULT_DATA_ERROR;
+            }
+            
+            state = state < kNumLitStates ? 9 : 11;
+            #ifdef _LZMA_OUT_READ
+            pos = dictionaryPos - rep0;
+            if (pos >= dictionarySize)
+              pos += dictionarySize;
+            previousByte = dictionary[pos];
+            dictionary[dictionaryPos] = previousByte;
+            if (++dictionaryPos == dictionarySize)
+              dictionaryPos = 0;
+            #else
+            previousByte = outStream[nowPos - rep0];
+            #endif
+            outStream[nowPos++] = previousByte;
+            #ifdef _LZMA_OUT_READ
+            if (distanceLimit < dictionarySize)
+              distanceLimit++;
+            #endif
+
+            continue;
+          }
+          else
+          {
+            UpdateBit1(prob);
+          }
+        }
+        else
+        {
+          UInt32 distance;
+          UpdateBit1(prob);
+          prob = p + IsRepG1 + state;
+          IfBit0(prob)
+          {
+            UpdateBit0(prob);
+            distance = rep1;
+          }
+          else 
+          {
+            UpdateBit1(prob);
+            prob = p + IsRepG2 + state;
+            IfBit0(prob)
+            {
+              UpdateBit0(prob);
+              distance = rep2;
+            }
+            else
+            {
+              UpdateBit1(prob);
+              distance = rep3;
+              rep3 = rep2;
+            }
+            rep2 = rep1;
+          }
+          rep1 = rep0;
+          rep0 = distance;
+        }
+        state = state < kNumLitStates ? 8 : 11;
+        prob = p + RepLenCoder;
+      }
+      {
+        int numBits, offset;
+        CProb *probLen = prob + LenChoice;
+        IfBit0(probLen)
+        {
+          UpdateBit0(probLen);
+          probLen = prob + LenLow + (posState << kLenNumLowBits);
+          offset = 0;
+          numBits = kLenNumLowBits;
+        }
+        else
+        {
+          UpdateBit1(probLen);
+          probLen = prob + LenChoice2;
+          IfBit0(probLen)
+          {
+            UpdateBit0(probLen);
+            probLen = prob + LenMid + (posState << kLenNumMidBits);
+            offset = kLenNumLowSymbols;
+            numBits = kLenNumMidBits;
+          }
+          else
+          {
+            UpdateBit1(probLen);
+            probLen = prob + LenHigh;
+            offset = kLenNumLowSymbols + kLenNumMidSymbols;
+            numBits = kLenNumHighBits;
+          }
+        }
+        RangeDecoderBitTreeDecode(probLen, numBits, len);
+        len += offset;
+      }
+
+      if (state < 4)
+      {
+        int posSlot;
+        state += kNumLitStates;
+        prob = p + PosSlot +
+            ((len < kNumLenToPosStates ? len : kNumLenToPosStates - 1) << 
+            kNumPosSlotBits);
+        RangeDecoderBitTreeDecode(prob, kNumPosSlotBits, posSlot);
+        if (posSlot >= kStartPosModelIndex)
+        {
+          int numDirectBits = ((posSlot >> 1) - 1);
+          rep0 = (2 | ((UInt32)posSlot & 1));
+          if (posSlot < kEndPosModelIndex)
+          {
+            rep0 <<= numDirectBits;
+            prob = p + SpecPos + rep0 - posSlot - 1;
+          }
+          else
+          {
+            numDirectBits -= kNumAlignBits;
+            do
+            {
+              RC_NORMALIZE
+              Range >>= 1;
+              rep0 <<= 1;
+              if (Code >= Range)
+              {
+                Code -= Range;
+                rep0 |= 1;
+              }
+            }
+            while (--numDirectBits != 0);
+            prob = p + Align;
+            rep0 <<= kNumAlignBits;
+            numDirectBits = kNumAlignBits;
+          }
+          {
+            int i = 1;
+            int mi = 1;
+            do
+            {
+              CProb *prob3 = prob + mi;
+              RC_GET_BIT2(prob3, mi, ; , rep0 |= i);
+              i <<= 1;
+            }
+            while(--numDirectBits != 0);
+          }
+        }
+        else
+          rep0 = posSlot;
+        if (++rep0 == (UInt32)(0))
+        {
+          /* it's for stream version */
+          len = kLzmaStreamWasFinishedId;
+          break;
+        }
+      }
+
+      len += kMatchMinLen;
+      #ifdef _LZMA_OUT_READ
+      if (rep0 > distanceLimit) 
+      #else
+      if (rep0 > nowPos)
+      #endif
+      {
+        printf("ERROR: %s, %d\n", __FILE__, __LINE__);
+        return LZMA_RESULT_DATA_ERROR;
+      }
+
+      #ifdef _LZMA_OUT_READ
+      if (dictionarySize - distanceLimit > (UInt32)len)
+        distanceLimit += len;
+      else
+        distanceLimit = dictionarySize;
+      #endif
+
+      do
+      {
+        #ifdef _LZMA_OUT_READ
+        UInt32 pos = dictionaryPos - rep0;
+        if (pos >= dictionarySize)
+          pos += dictionarySize;
+        previousByte = dictionary[pos];
+        dictionary[dictionaryPos] = previousByte;
+        if (++dictionaryPos == dictionarySize)
+          dictionaryPos = 0;
+        #else
+        previousByte = outStream[nowPos - rep0];
+        #endif
+        len--;
+        outStream[nowPos++] = previousByte;
+      }
+      while(len != 0 && nowPos < outSize);
+    }
+  }
+  RC_NORMALIZE;
+
+  #ifdef _LZMA_OUT_READ
+  vs->Range = Range;
+  vs->Code = Code;
+  vs->DictionaryPos = dictionaryPos;
+  vs->GlobalPos = globalPos + (UInt32)nowPos;
+  vs->DistanceLimit = distanceLimit;
+  vs->Reps[0] = rep0;
+  vs->Reps[1] = rep1;
+  vs->Reps[2] = rep2;
+  vs->Reps[3] = rep3;
+  vs->State = state;
+  vs->RemainLen = len;
+  vs->TempDictionary[0] = tempDictionary[0];
+  #endif
+
+  #ifdef _LZMA_IN_CB
+  vs->Buffer = Buffer;
+  vs->BufferLim = BufferLim;
+  #else
+  *inSizeProcessed = (SizeT)(Buffer - inStream);
+  #endif
+  *outSizeProcessed = nowPos;
+  return LZMA_RESULT_OK;
+}
+
+#endif /* CONFIG_LZMA */
diff --git a/package/uboot-ifxmips/files/lib_generic/LzmaDecode.h b/package/uboot-ifxmips/files/lib_generic/LzmaDecode.h
new file mode 100644
index 0000000..2870eeb
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_generic/LzmaDecode.h
@@ -0,0 +1,113 @@
+/* 
+  LzmaDecode.h
+  LZMA Decoder interface
+
+  LZMA SDK 4.40 Copyright (c) 1999-2006 Igor Pavlov (2006-05-01)
+  http://www.7-zip.org/
+
+  LZMA SDK is licensed under two licenses:
+  1) GNU Lesser General Public License (GNU LGPL)
+  2) Common Public License (CPL)
+  It means that you can select one of these two licenses and 
+  follow rules of that license.
+
+  SPECIAL EXCEPTION:
+  Igor Pavlov, as the author of this code, expressly permits you to 
+  statically or dynamically link your code (or bind by name) to the 
+  interfaces of this file without subjecting your linked code to the 
+  terms of the CPL or GNU LGPL. Any modifications or additions 
+  to this file, however, are subject to the LGPL or CPL terms.
+*/
+
+#ifndef __LZMADECODE_H
+#define __LZMADECODE_H
+
+#include "LzmaTypes.h"
+
+/* #define _LZMA_IN_CB */
+/* Use callback for input data */
+
+/* #define _LZMA_OUT_READ */
+/* Use read function for output data */
+
+/* #define _LZMA_PROB32 */
+/* It can increase speed on some 32-bit CPUs, 
+   but memory usage will be doubled in that case */
+
+/* #define _LZMA_LOC_OPT */
+/* Enable local speed optimizations inside code */
+
+#ifdef _LZMA_PROB32
+#define CProb UInt32
+#else
+#define CProb UInt16
+#endif
+
+#define LZMA_RESULT_OK 0
+#define LZMA_RESULT_DATA_ERROR 1
+
+#ifdef _LZMA_IN_CB
+typedef struct _ILzmaInCallback
+{
+  int (*Read)(void *object, const unsigned char **buffer, SizeT *bufferSize);
+} ILzmaInCallback;
+#endif
+
+#define LZMA_BASE_SIZE 1846
+#define LZMA_LIT_SIZE 768
+
+#define LZMA_PROPERTIES_SIZE 5
+
+typedef struct _CLzmaProperties
+{
+  int lc;
+  int lp;
+  int pb;
+  #ifdef _LZMA_OUT_READ
+  UInt32 DictionarySize;
+  #endif
+}CLzmaProperties;
+
+int LzmaDecodeProperties(CLzmaProperties *propsRes, const unsigned char *propsData, int size);
+
+#define LzmaGetNumProbs(Properties) (LZMA_BASE_SIZE + (LZMA_LIT_SIZE << ((Properties)->lc + (Properties)->lp)))
+
+#define kLzmaNeedInitId (-2)
+
+typedef struct _CLzmaDecoderState
+{
+  CLzmaProperties Properties;
+  CProb *Probs;
+
+  #ifdef _LZMA_IN_CB
+  const unsigned char *Buffer;
+  const unsigned char *BufferLim;
+  #endif
+
+  #ifdef _LZMA_OUT_READ
+  unsigned char *Dictionary;
+  UInt32 Range;
+  UInt32 Code;
+  UInt32 DictionaryPos;
+  UInt32 GlobalPos;
+  UInt32 DistanceLimit;
+  UInt32 Reps[4];
+  int State;
+  int RemainLen;
+  unsigned char TempDictionary[4];
+  #endif
+} CLzmaDecoderState;
+
+#ifdef _LZMA_OUT_READ
+#define LzmaDecoderInit(vs) { (vs)->RemainLen = kLzmaNeedInitId; }
+#endif
+
+int LzmaDecode(CLzmaDecoderState *vs,
+    #ifdef _LZMA_IN_CB
+    ILzmaInCallback *inCallback,
+    #else
+    const unsigned char *inStream, SizeT inSize, SizeT *inSizeProcessed,
+    #endif
+    unsigned char *outStream, SizeT outSize, SizeT *outSizeProcessed);
+
+#endif
diff --git a/package/uboot-ifxmips/files/lib_generic/LzmaTypes.h b/package/uboot-ifxmips/files/lib_generic/LzmaTypes.h
new file mode 100644
index 0000000..288c5e4
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_generic/LzmaTypes.h
@@ -0,0 +1,45 @@
+/* 
+LzmaTypes.h 
+
+Types for LZMA Decoder
+
+This file written and distributed to public domain by Igor Pavlov.
+This file is part of LZMA SDK 4.40 (2006-05-01)
+*/
+
+#ifndef __LZMATYPES_H
+#define __LZMATYPES_H
+
+#ifndef _7ZIP_BYTE_DEFINED
+#define _7ZIP_BYTE_DEFINED
+typedef unsigned char Byte;
+#endif 
+
+#ifndef _7ZIP_UINT16_DEFINED
+#define _7ZIP_UINT16_DEFINED
+typedef unsigned short UInt16;
+#endif 
+
+#ifndef _7ZIP_UINT32_DEFINED
+#define _7ZIP_UINT32_DEFINED
+#ifdef _LZMA_UINT32_IS_ULONG
+typedef unsigned long UInt32;
+#else
+typedef unsigned int UInt32;
+#endif
+#endif 
+
+/* #define _LZMA_SYSTEM_SIZE_T */
+/* Use system's size_t. You can use it to enable 64-bit sizes supporting */
+
+#ifndef _7ZIP_SIZET_DEFINED
+#define _7ZIP_SIZET_DEFINED
+#ifdef _LZMA_SYSTEM_SIZE_T
+#include <stddef.h>
+typedef size_t SizeT;
+#else
+typedef UInt32 SizeT;
+#endif
+#endif
+
+#endif
diff --git a/package/uboot-ifxmips/files/lib_generic/LzmaWrapper.c b/package/uboot-ifxmips/files/lib_generic/LzmaWrapper.c
new file mode 100644
index 0000000..6c3d702
--- /dev/null
+++ b/package/uboot-ifxmips/files/lib_generic/LzmaWrapper.c
@@ -0,0 +1,197 @@
+/******************************************************************************
+**
+** FILE NAME    : LzmaWrapper.c
+** PROJECT      : bootloader
+** MODULES      : U-boot
+**
+** DATE         : 2 Nov 2006
+** AUTHOR       : Lin Mars
+** DESCRIPTION  : LZMA decoder support for U-boot 1.1.5
+** COPYRIGHT    :       Copyright (c) 2006
+**                      Infineon Technologies AG
+**                      Am Campeon 1-12, 85579 Neubiberg, Germany
+**
+**    This program is free software; you can redistribute it and/or modify
+**    it under the terms of the GNU General Public License as published by
+**    the Free Software Foundation; either version 2 of the License, or
+**    (at your option) any later version.
+**
+** HISTORY
+** $Date        $Author         $Comment
+** 2 Nov 2006   Lin Mars        init version which derived from LzmaTest.c from
+**                              LZMA v4.43 SDK
+*******************************************************************************/
+#define LZMA_NO_STDIO
+#ifndef LZMA_NO_STDIO
+#include <stdio.h>
+#include <stdlib.h>
+#include <string.h>
+#endif
+
+#include <config.h>
+#include <common.h>
+#include <linux/types.h>
+#include <linux/string.h>
+#include <linux/ctype.h>
+#include <malloc.h>
+
+#ifdef CONFIG_LZMA
+
+#include "LzmaDecode.h"
+#include "LzmaWrapper.h"
+
+static const char *kCantReadMessage = "Can not read from source buffer";
+static const char *kCantAllocateMessage = "Not enough buffer for decompression";
+
+static size_t rpos=0, dpos=0;
+
+static int MyReadFileAndCheck(unsigned char *src, void *dest, size_t size)
+{
+  if (size == 0)
+    return 0;
+  memcpy(dest, src + rpos, size);
+  rpos += size;
+  return 1;
+}
+
+int lzma_inflate(unsigned char *source, int s_len, unsigned char *dest, int *d_len)
+{
+  /* We use two 32-bit integers to construct 64-bit integer for file size.
+     You can remove outSizeHigh, if you don't need >= 4GB supporting,
+     or you can use UInt64 outSize, if your compiler supports 64-bit integers*/
+  UInt32 outSize = 0;
+  UInt32 outSizeHigh = 0;
+  SizeT outSizeFull;
+  unsigned char *outStream;
+  
+  int waitEOS = 1; 
+  /* waitEOS = 1, if there is no uncompressed size in headers, 
+   so decoder will wait EOS (End of Stream Marker) in compressed stream */
+
+  SizeT compressedSize;
+  unsigned char *inStream;
+
+  CLzmaDecoderState state;  /* it's about 24-80 bytes structure, if int is 32-bit */
+  unsigned char properties[LZMA_PROPERTIES_SIZE];
+
+  int res;
+
+  if (sizeof(UInt32) < 4)
+  {
+    printf("LZMA decoder needs correct UInt32\n");
+    return LZMA_RESULT_DATA_ERROR;
+  }
+
+  {
+    long length=s_len;
+    if ((long)(SizeT)length != length)
+    {
+      printf("Too big compressed stream\n");
+      return LZMA_RESULT_DATA_ERROR;
+    }
+    compressedSize = (SizeT)(length - (LZMA_PROPERTIES_SIZE + 8));
+  }
+
+  /* Read LZMA properties for compressed stream */
+
+  if (!MyReadFileAndCheck(source, properties, sizeof(properties)))
+  {
+    printf("%s\n", kCantReadMessage);
+    return LZMA_RESULT_DATA_ERROR;
+  }
+
+  /* Read uncompressed size */
+  {
+    int i;
+    for (i = 0; i < 8; i++)
+    {
+      unsigned char b;
+      if (!MyReadFileAndCheck(source, &b, 1))
+      {
+        printf("%s\n", kCantReadMessage);
+        return LZMA_RESULT_DATA_ERROR;
+      }
+      if (b != 0xFF)
+        waitEOS = 0;
+      if (i < 4)
+        outSize += (UInt32)(b) << (i * 8);
+      else
+        outSizeHigh += (UInt32)(b) << ((i - 4) * 8);
+    }
+    
+    if (waitEOS)
+    {
+      printf("Stream with EOS marker is not supported");
+      return LZMA_RESULT_DATA_ERROR;
+    }
+    outSizeFull = (SizeT)outSize;
+    if (sizeof(SizeT) >= 8)
+      outSizeFull |= (((SizeT)outSizeHigh << 16) << 16);
+    else if (outSizeHigh != 0 || (UInt32)(SizeT)outSize != outSize)
+    {
+      printf("Too big uncompressed stream");
+      return LZMA_RESULT_DATA_ERROR;
+    }
+  }
+
+  /* Decode LZMA properties and allocate memory */
+  if (LzmaDecodeProperties(&state.Properties, properties, LZMA_PROPERTIES_SIZE) != LZMA_RESULT_OK)
+  {
+    printf("Incorrect stream properties");
+    return LZMA_RESULT_DATA_ERROR;
+  }
+  state.Probs = (CProb *)malloc(LzmaGetNumProbs(&state.Properties) * sizeof(CProb));
+
+  if (outSizeFull == 0)
+    outStream = 0;
+  else
+  {
+    if (outSizeFull > d_len)
+      outStream = 0;
+    else
+      outStream = dest;
+  }
+
+  if (compressedSize == 0)
+    inStream = 0;
+  else
+  {
+    if ((compressedSize+rpos) > s_len )
+      inStream = 0;
+    else
+      inStream = source + rpos;
+  }
+
+  if (state.Probs == 0 
+    || (outStream == 0 && outSizeFull != 0)
+    || (inStream == 0 && compressedSize != 0)
+    )
+  {
+    free(state.Probs);
+    printf("%s\n", kCantAllocateMessage);
+    return LZMA_RESULT_DATA_ERROR;
+  }
+
+  /* Decompress */
+  {
+    SizeT inProcessed;
+    SizeT outProcessed;
+    res = LzmaDecode(&state,
+      inStream, compressedSize, &inProcessed,
+      outStream, outSizeFull, &outProcessed);
+    if (res != 0)
+    {
+      printf("\nDecoding error = %d\n", res);
+      res = 1;
+    }
+    else
+    {
+      *d_len = outProcessed;
+    }
+  }
+
+  free(state.Probs);
+  return res;
+}
+
+#endif /* CONFIG_LZMA */
diff --git a/package/uboot-ifxmips/files/net/ifx_eth.c b/package/uboot-ifxmips/files/net/ifx_eth.c
new file mode 100644
index 0000000..02e72ae
--- /dev/null
+++ b/package/uboot-ifxmips/files/net/ifx_eth.c
@@ -0,0 +1,4 @@
+
+#define IFX_ETH_INITIALIZE_EXTERN	extern int danube_switch_initialize(bd_t *);
+#define IFX_ETH_INITIALIZE(bd_t)	danube_switch_initialize(bd_t);
+
diff --git a/package/uboot-ifxmips/files/net/net_danube.c b/package/uboot-ifxmips/files/net/net_danube.c
new file mode 100644
index 0000000..1d1c98f
--- /dev/null
+++ b/package/uboot-ifxmips/files/net/net_danube.c
@@ -0,0 +1,1754 @@
+/*
+ *	Copied from Linux Monitor (LiMon) - Networking.
+ *
+ *	Copyright 1994 - 2000 Neil Russell.
+ *	(See License)
+ *	Copyright 2000 Roland Borde
+ *	Copyright 2000 Paolo Scaffardi
+ *	Copyright 2000-2002 Wolfgang Denk, wd@denx.de
+ */
+
+/*
+ * General Desription:
+ *
+ * The user interface supports commands for BOOTP, RARP, and TFTP.
+ * Also, we support ARP internally. Depending on available data,
+ * these interact as follows:
+ *
+ * BOOTP:
+ *
+ *	Prerequisites:	- own ethernet address
+ *	We want:	- own IP address
+ *			- TFTP server IP address
+ *			- name of bootfile
+ *	Next step:	ARP
+ *
+ * RARP:
+ *
+ *	Prerequisites:	- own ethernet address
+ *	We want:	- own IP address
+ *			- TFTP server IP address
+ *	Next step:	ARP
+ *
+ * ARP:
+ *
+ *	Prerequisites:	- own ethernet address
+ *			- own IP address
+ *			- TFTP server IP address
+ *	We want:	- TFTP server ethernet address
+ *	Next step:	TFTP
+ *
+ * DHCP:
+ *
+ *     Prerequisites:	- own ethernet address
+ *     We want:		- IP, Netmask, ServerIP, Gateway IP
+ *			- bootfilename, lease time
+ *     Next step:	- TFTP
+ *
+ * TFTP:
+ *
+ *	Prerequisites:	- own ethernet address
+ *			- own IP address
+ *			- TFTP server IP address
+ *			- TFTP server ethernet address
+ *			- name of bootfile (if unknown, we use a default name
+ *			  derived from our own IP address)
+ *	We want:	- load the boot file
+ *	Next step:	none
+ *
+ * NFS:
+ *
+ *	Prerequisites:	- own ethernet address
+ *			- own IP address
+ *			- name of bootfile (if unknown, we use a default name
+ *			  derived from our own IP address)
+ *	We want:	- load the boot file
+ *	Next step:	none
+ *
+ * SNTP:
+ *
+ *	Prerequisites:	- own ethernet address
+ *			- own IP address
+ *	We want:	- network time
+ *	Next step:	none
+ */
+
+
+#include <common.h>
+#include <watchdog.h>
+#include <command.h>
+#include <net.h>
+#include "bootp.h"
+#include "tftp.h"
+#include "rarp.h"
+#include "nfs.h"
+#ifdef CONFIG_STATUS_LED
+#include <status_led.h>
+#include <miiphy.h>
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_SNTP)
+#include "sntp.h"
+#endif
+
+#if (CONFIG_COMMANDS & CFG_CMD_NET)
+
+DECLARE_GLOBAL_DATA_PTR;
+
+#define ARP_TIMEOUT		5		/* Seconds before trying ARP again */
+#ifndef	CONFIG_NET_RETRY_COUNT
+# define ARP_TIMEOUT_COUNT	5		/* # of timeouts before giving up  */
+#else
+# define ARP_TIMEOUT_COUNT  (CONFIG_NET_RETRY_COUNT)
+#endif
+
+#if 0
+#define ET_DEBUG
+#endif
+
+/** BOOTP EXTENTIONS **/
+
+IPaddr_t	NetOurSubnetMask=0;		/* Our subnet mask (0=unknown)	*/
+IPaddr_t	NetOurGatewayIP=0;		/* Our gateways IP address	*/
+IPaddr_t	NetOurDNSIP=0;			/* Our DNS IP address		*/
+#if (CONFIG_BOOTP_MASK & CONFIG_BOOTP_DNS2)
+IPaddr_t	NetOurDNS2IP=0;			/* Our 2nd DNS IP address	*/
+#endif
+char		NetOurNISDomain[32]={0,};	/* Our NIS domain		*/
+char		NetOurHostName[32]={0,};	/* Our hostname			*/
+char		NetOurRootPath[64]={0,};	/* Our bootpath			*/
+ushort		NetBootFileSize=0;		/* Our bootfile size in blocks	*/
+
+/** END OF BOOTP EXTENTIONS **/
+
+ulong		NetBootFileXferSize;	/* The actual transferred size of the bootfile (in bytes) */
+uchar		NetOurEther[6];		/* Our ethernet address			*/
+uchar		NetServerEther[6] =	/* Boot server enet address		*/
+			{ 0, 0, 0, 0, 0, 0 };
+IPaddr_t	NetOurIP;		/* Our IP addr (0 = unknown)		*/
+IPaddr_t	NetServerIP;		/* Our IP addr (0 = unknown)		*/
+volatile uchar *NetRxPkt;		/* Current receive packet		*/
+int		NetRxPktLen;		/* Current rx packet length		*/
+unsigned	NetIPID;		/* IP packet ID				*/
+uchar		NetBcastAddr[6] =	/* Ethernet bcast address		*/
+			{ 0xff, 0xff, 0xff, 0xff, 0xff, 0xff };
+uchar		NetEtherNullAddr[6] =
+			{ 0, 0, 0, 0, 0, 0 };
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+uchar		NetCDPAddr[6] =		/* Ethernet bcast address		*/
+			{ 0x01, 0x00, 0x0c, 0xcc, 0xcc, 0xcc };
+#endif
+int		NetState;		/* Network loop state			*/
+#ifdef CONFIG_NET_MULTI
+int		NetRestartWrap = 0;	/* Tried all network devices		*/
+static int	NetRestarted = 0;	/* Network loop restarted		*/
+static int	NetDevExists = 0;	/* At least one device configured	*/
+#endif
+
+/* XXX in both little & big endian machines 0xFFFF == ntohs(-1) */
+ushort		NetOurVLAN = 0xFFFF;		/* default is without VLAN	*/
+ushort		NetOurNativeVLAN = 0xFFFF;	/* ditto			*/
+
+char		BootFile[128];		/* Boot File name			*/
+
+#if (CONFIG_COMMANDS & CFG_CMD_PING)
+IPaddr_t	NetPingIP;		/* the ip address to ping 		*/
+
+static void PingStart(void);
+#endif
+
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+static void CDPStart(void);
+#endif
+
+#if (CONFIG_COMMANDS & CFG_CMD_SNTP)
+IPaddr_t	NetNtpServerIP;		/* NTP server IP address		*/
+int		NetTimeOffset=0;	/* offset time from UTC			*/
+#endif
+
+#ifdef CONFIG_NETCONSOLE
+void NcStart(void);
+int nc_input_packet(uchar *pkt, unsigned dest, unsigned src, unsigned len);
+#endif
+
+volatile uchar	PktBuf[(PKTBUFSRX+1) * PKTSIZE_ALIGN + PKTALIGN];
+
+volatile uchar *NetRxPackets[PKTBUFSRX]; /* Receive packets			*/
+
+static rxhand_f *packetHandler;		/* Current RX packet handler		*/
+static thand_f *timeHandler;		/* Current timeout handler		*/
+static ulong	timeStart;		/* Time base value			*/
+static ulong	timeDelta;		/* Current timeout value		*/
+volatile uchar *NetTxPacket = 0;	/* THE transmit packet			*/
+
+static int net_check_prereq (proto_t protocol);
+
+/**********************************************************************/
+
+IPaddr_t	NetArpWaitPacketIP;
+IPaddr_t	NetArpWaitReplyIP;
+uchar	       *NetArpWaitPacketMAC;	/* MAC address of waiting packet's destination	*/
+uchar	       *NetArpWaitTxPacket;	/* THE transmit packet			*/
+int		NetArpWaitTxPacketSize;
+uchar 		NetArpWaitPacketBuf[PKTSIZE_ALIGN + PKTALIGN];
+ulong		NetArpWaitTimerStart;
+int		NetArpWaitTry;
+
+void ArpRequest (void)
+{
+	int i;
+	volatile uchar *pkt;
+	ARP_t *arp;
+
+#ifdef ET_DEBUG
+	printf ("ARP broadcast %d\n", NetArpWaitTry);
+#endif
+	pkt = NetTxPacket;
+
+	pkt += NetSetEther (pkt, NetBcastAddr, PROT_ARP);
+
+	arp = (ARP_t *) pkt;
+
+	arp->ar_hrd = htons (ARP_ETHER);
+	arp->ar_pro = htons (PROT_IP);
+	arp->ar_hln = 6;
+	arp->ar_pln = 4;
+	arp->ar_op = htons (ARPOP_REQUEST);
+
+	memcpy (&arp->ar_data[0], NetOurEther, 6);		/* source ET addr	*/
+	NetWriteIP ((uchar *) & arp->ar_data[6], NetOurIP);	/* source IP addr	*/
+	for (i = 10; i < 16; ++i) {
+		arp->ar_data[i] = 0;				/* dest ET addr = 0     */
+	}
+
+	if ((NetArpWaitPacketIP & NetOurSubnetMask) !=
+	    (NetOurIP & NetOurSubnetMask)) {
+		if (NetOurGatewayIP == 0) {
+			puts ("## Warning: gatewayip needed but not set\n");
+			NetArpWaitReplyIP = NetArpWaitPacketIP;
+		} else {
+			NetArpWaitReplyIP = NetOurGatewayIP;
+		}
+	} else {
+		NetArpWaitReplyIP = NetArpWaitPacketIP;
+	}
+
+	NetWriteIP ((uchar *) & arp->ar_data[16], NetArpWaitReplyIP);
+	(void) eth_send (NetTxPacket, (pkt - NetTxPacket) + ARP_HDR_SIZE);
+}
+
+void ArpTimeoutCheck(void)
+{
+	ulong t;
+
+	if (!NetArpWaitPacketIP)
+		return;
+
+	t = get_timer(0);
+
+	/* check for arp timeout */
+	if ((t - NetArpWaitTimerStart) > ARP_TIMEOUT * CFG_HZ) {
+		NetArpWaitTry++;
+
+		if (NetArpWaitTry >= ARP_TIMEOUT_COUNT) {
+			puts ("\nARP Retry count exceeded; starting again\n");
+			NetArpWaitTry = 0;
+			NetStartAgain();
+		} else {
+			NetArpWaitTimerStart = t;
+			ArpRequest();
+		}
+	}
+}
+
+/**********************************************************************/
+/*
+ *	Main network processing loop.
+ */
+
+int
+NetLoop(proto_t protocol)
+{
+	bd_t *bd = gd->bd;
+
+#ifdef CONFIG_NET_MULTI
+	NetRestarted = 0;
+	NetDevExists = 0;
+#endif
+
+	/* XXX problem with bss workaround */
+	NetArpWaitPacketMAC = NULL;
+	NetArpWaitTxPacket = NULL;
+	NetArpWaitPacketIP = 0;
+	NetArpWaitReplyIP = 0;
+	NetArpWaitTxPacket = NULL;
+	NetTxPacket = NULL;
+
+	if (!NetTxPacket) {
+		int	i;
+		/*
+		 *	Setup packet buffers, aligned correctly.
+		 */
+		NetTxPacket = &PktBuf[0] + (PKTALIGN - 1);
+		NetTxPacket -= (ulong)NetTxPacket % PKTALIGN;
+		for (i = 0; i < PKTBUFSRX; i++) {
+			NetRxPackets[i] = NetTxPacket + (i+1)*PKTSIZE_ALIGN;
+		}
+	}
+
+	if (!NetArpWaitTxPacket) {
+		NetArpWaitTxPacket = &NetArpWaitPacketBuf[0] + (PKTALIGN - 1);
+		NetArpWaitTxPacket -= (ulong)NetArpWaitTxPacket % PKTALIGN;
+		NetArpWaitTxPacketSize = 0;
+	}
+
+	eth_halt();
+#ifdef CONFIG_NET_MULTI
+	eth_set_current();
+#endif
+	if (eth_init(bd) < 0) {
+		eth_halt();
+		return(-1);
+	}
+
+restart:
+#ifdef CONFIG_NET_MULTI
+	memcpy (NetOurEther, eth_get_dev()->enetaddr, 6);
+#else
+	memcpy (NetOurEther, bd->bi_enetaddr, 6);
+#endif
+
+	NetState = NETLOOP_CONTINUE;
+
+	/*
+	 *	Start the ball rolling with the given start function.  From
+	 *	here on, this code is a state machine driven by received
+	 *	packets and timer events.
+	 */
+
+	switch (protocol) {
+#if (CONFIG_COMMANDS & CFG_CMD_NFS)
+	case NFS:
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_PING)
+	case PING:
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_SNTP)
+	case SNTP:
+#endif
+	case NETCONS:
+	case TFTP:
+		NetCopyIP(&NetOurIP, &bd->bi_ip_addr);
+		NetOurGatewayIP = getenv_IPaddr ("gatewayip");
+		NetOurSubnetMask= getenv_IPaddr ("netmask");
+		NetOurVLAN = getenv_VLAN("vlan");
+		NetOurNativeVLAN = getenv_VLAN("nvlan");
+
+		switch (protocol) {
+#if (CONFIG_COMMANDS & CFG_CMD_NFS)
+		case NFS:
+#endif
+		case NETCONS:
+		case TFTP:
+			NetServerIP = getenv_IPaddr ("serverip");
+			break;
+#if (CONFIG_COMMANDS & CFG_CMD_PING)
+		case PING:
+			/* nothing */
+			break;
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_SNTP)
+		case SNTP:
+			/* nothing */
+			break;
+#endif
+		default:
+			break;
+		}
+
+		break;
+	case BOOTP:
+	case RARP:
+		/*
+		 * initialize our IP addr to 0 in order to accept ANY
+		 * IP addr assigned to us by the BOOTP / RARP server
+		 */
+		NetOurIP = 0;
+		NetServerIP = getenv_IPaddr ("serverip");
+		NetOurVLAN = getenv_VLAN("vlan");	/* VLANs must be read */
+		NetOurNativeVLAN = getenv_VLAN("nvlan");
+	case CDP:
+		NetOurVLAN = getenv_VLAN("vlan");	/* VLANs must be read */
+		NetOurNativeVLAN = getenv_VLAN("nvlan");
+		break;
+	default:
+		break;
+	}
+
+	switch (net_check_prereq (protocol)) {
+	case 1:
+		/* network not configured */
+		eth_halt();
+		return (-1);
+
+#ifdef CONFIG_NET_MULTI
+	case 2:
+		/* network device not configured */
+		break;
+#endif /* CONFIG_NET_MULTI */
+
+	case 0:
+#ifdef CONFIG_NET_MULTI
+		NetDevExists = 1;
+#endif
+		switch (protocol) {
+		case TFTP:
+			/* always use ARP to get server ethernet address */
+			TftpStart();
+			break;
+
+#if (CONFIG_COMMANDS & CFG_CMD_DHCP)
+		case DHCP:
+			/* Start with a clean slate... */
+			BootpTry = 0;
+			NetOurIP = 0;
+			NetServerIP = getenv_IPaddr ("serverip");
+			DhcpRequest();		/* Basically same as BOOTP */
+			break;
+#endif /* CFG_CMD_DHCP */
+
+		case BOOTP:
+			BootpTry = 0;
+			BootpRequest ();
+			break;
+
+		case RARP:
+			RarpTry = 0;
+			RarpRequest ();
+			break;
+#if (CONFIG_COMMANDS & CFG_CMD_PING)
+		case PING:
+			PingStart();
+			break;
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_NFS)
+		case NFS:
+			NfsStart();
+			break;
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+		case CDP:
+			CDPStart();
+			break;
+#endif
+#ifdef CONFIG_NETCONSOLE
+		case NETCONS:
+			NcStart();
+			break;
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_SNTP)
+		case SNTP:
+			SntpStart();
+			break;
+#endif
+		default:
+			break;
+		}
+
+		NetBootFileXferSize = 0;
+		break;
+	}
+
+#if defined(CONFIG_MII) || (CONFIG_COMMANDS & CFG_CMD_MII)
+#if defined(CFG_FAULT_ECHO_LINK_DOWN) && defined(CONFIG_STATUS_LED) && defined(STATUS_LED_RED)
+	/*
+	 * Echo the inverted link state to the fault LED.
+	 */
+	if(miiphy_link(eth_get_dev()->name, CFG_FAULT_MII_ADDR)) {
+		status_led_set (STATUS_LED_RED, STATUS_LED_OFF);
+	} else {
+		status_led_set (STATUS_LED_RED, STATUS_LED_ON);
+	}
+#endif /* CFG_FAULT_ECHO_LINK_DOWN, ... */
+#endif /* CONFIG_MII, ... */
+
+	/*
+	 *	Main packet reception loop.  Loop receiving packets until
+	 *	someone sets `NetState' to a state that terminates.
+	 */
+	for (;;) {
+		WATCHDOG_RESET();
+#ifdef CONFIG_SHOW_ACTIVITY
+		{
+			extern void show_activity(int arg);
+			show_activity(1);
+		}
+#endif
+		/*
+		 *	Check the ethernet for a new packet.  The ethernet
+		 *	receive routine will process it.
+		 */
+			eth_rx();
+
+		/*
+		 *	Abort if ctrl-c was pressed.
+		 */
+		if (ctrlc()) {
+			eth_halt();
+			puts ("\nAbort\n");
+			return (-1);
+		}
+
+		ArpTimeoutCheck();
+
+		/*
+		 *	Check for a timeout, and run the timeout handler
+		 *	if we have one.
+		 */
+		if (timeHandler && ((get_timer(0) - timeStart) > timeDelta)) {
+			thand_f *x;
+
+#if defined(CONFIG_MII) || (CONFIG_COMMANDS & CFG_CMD_MII)
+#  if defined(CFG_FAULT_ECHO_LINK_DOWN) && \
+      defined(CONFIG_STATUS_LED) &&	   \
+      defined(STATUS_LED_RED)
+			/*
+			 * Echo the inverted link state to the fault LED.
+			 */
+			if(miiphy_link(eth_get_dev()->name, CFG_FAULT_MII_ADDR)) {
+				status_led_set (STATUS_LED_RED, STATUS_LED_OFF);
+			} else {
+				status_led_set (STATUS_LED_RED, STATUS_LED_ON);
+			}
+#  endif /* CFG_FAULT_ECHO_LINK_DOWN, ... */
+#endif /* CONFIG_MII, ... */
+			x = timeHandler;
+			timeHandler = (thand_f *)0;
+			(*x)();
+		}
+
+
+		switch (NetState) {
+
+		case NETLOOP_RESTART:
+#ifdef CONFIG_NET_MULTI
+			NetRestarted = 1;
+#endif
+			goto restart;
+
+		case NETLOOP_SUCCESS:
+			if (NetBootFileXferSize > 0) {
+				char buf[10];
+				printf("Bytes transferred = %ld (%lx hex)\n",
+					NetBootFileXferSize,
+					NetBootFileXferSize);
+				sprintf(buf, "%lx", NetBootFileXferSize);
+				setenv("filesize", buf);
+
+				sprintf(buf, "%lX", (unsigned long)load_addr);
+				setenv("fileaddr", buf);
+			}
+			eth_halt();
+			return NetBootFileXferSize;
+
+		case NETLOOP_FAIL:
+			return (-1);
+		}
+	}
+}
+
+/**********************************************************************/
+
+static void
+startAgainTimeout(void)
+{
+	NetState = NETLOOP_RESTART;
+}
+
+static void
+startAgainHandler(uchar * pkt, unsigned dest, unsigned src, unsigned len)
+{
+	/* Totally ignore the packet */
+}
+
+void NetStartAgain (void)
+{
+	char *nretry;
+	int noretry = 0, once = 0;
+
+	if ((nretry = getenv ("netretry")) != NULL) {
+		noretry = (strcmp (nretry, "no") == 0);
+		once = (strcmp (nretry, "once") == 0);
+	}
+	if (noretry) {
+		eth_halt ();
+		NetState = NETLOOP_FAIL;
+		return;
+	}
+#ifndef CONFIG_NET_MULTI
+	NetSetTimeout (10 * CFG_HZ, startAgainTimeout);
+	NetSetHandler (startAgainHandler);
+#else	/* !CONFIG_NET_MULTI*/
+	eth_halt ();
+	eth_try_another (!NetRestarted);
+	eth_init (gd->bd);
+	if (NetRestartWrap) {
+		NetRestartWrap = 0;
+		if (NetDevExists && !once) {
+			NetSetTimeout (10 * CFG_HZ, startAgainTimeout);
+			NetSetHandler (startAgainHandler);
+		} else {
+			NetState = NETLOOP_FAIL;
+		}
+	} else {
+		NetState = NETLOOP_RESTART;
+	}
+#endif	/* CONFIG_NET_MULTI */
+}
+
+/**********************************************************************/
+/*
+ *	Miscelaneous bits.
+ */
+
+void
+NetSetHandler(rxhand_f * f)
+{
+	packetHandler = f;
+}
+
+
+void
+NetSetTimeout(ulong iv, thand_f * f)
+{
+	if (iv == 0) {
+		timeHandler = (thand_f *)0;
+	} else {
+		timeHandler = f;
+		timeStart = get_timer(0);
+		timeDelta = iv;
+	}
+}
+
+
+void
+NetSendPacket(volatile uchar * pkt, int len)
+{
+	(void) eth_send(pkt, len);
+}
+
+int
+NetSendUDPPacket(uchar *ether, IPaddr_t dest, int dport, int sport, int len)
+{
+	uchar *pkt;
+
+	/* convert to new style broadcast */
+	if (dest == 0)
+		dest = 0xFFFFFFFF;
+
+	/* if broadcast, make the ether address a broadcast and don't do ARP */
+	if (dest == 0xFFFFFFFF)
+		ether = NetBcastAddr;
+
+	/* if MAC address was not discovered yet, save the packet and do an ARP request */
+	if (memcmp(ether, NetEtherNullAddr, 6) == 0) {
+
+#ifdef ET_DEBUG
+		printf("sending ARP for %08lx\n", dest);
+#endif
+		NetArpWaitPacketIP = dest;
+		NetArpWaitPacketMAC = ether;
+
+		pkt = NetArpWaitTxPacket;
+		pkt += NetSetEther (pkt, NetArpWaitPacketMAC, PROT_IP);
+
+		NetSetIP (pkt, dest, dport, sport, len);
+		memcpy(pkt + IP_HDR_SIZE, (uchar *)NetTxPacket + (pkt - (uchar *)NetArpWaitTxPacket) + IP_HDR_SIZE, len);
+
+		/* size of the waiting packet */
+		NetArpWaitTxPacketSize = (pkt - NetArpWaitTxPacket) + IP_HDR_SIZE + len;
+
+		/* and do the ARP request */
+		NetArpWaitTry = 1;
+		NetArpWaitTimerStart = get_timer(0);
+		ArpRequest();
+		return 1;	/* waiting */
+	}
+
+#ifdef ET_DEBUG
+	printf("sending UDP to %08lx/%02x:%02x:%02x:%02x:%02x:%02x\n",
+		dest, ether[0], ether[1], ether[2], ether[3], ether[4], ether[5]);
+#endif
+
+	pkt = (uchar *)NetTxPacket;
+	pkt += NetSetEther (pkt, ether, PROT_IP);
+	NetSetIP (pkt, dest, dport, sport, len);
+	(void) eth_send(NetTxPacket, (pkt - NetTxPacket) + IP_HDR_SIZE + len);
+
+	return 0;	/* transmitted */
+}
+
+#if (CONFIG_COMMANDS & CFG_CMD_PING)
+static ushort PingSeqNo;
+
+int PingSend(void)
+{
+	static uchar mac[6];
+	volatile IP_t *ip;
+	volatile ushort *s;
+	uchar *pkt;
+
+	/* XXX always send arp request */
+
+	memcpy(mac, NetEtherNullAddr, 6);
+
+#ifdef ET_DEBUG
+	printf("sending ARP for %08lx\n", NetPingIP);
+#endif
+
+	NetArpWaitPacketIP = NetPingIP;
+	NetArpWaitPacketMAC = mac;
+
+	pkt = NetArpWaitTxPacket;
+	pkt += NetSetEther(pkt, mac, PROT_IP);
+
+	ip = (volatile IP_t *)pkt;
+
+	/*
+	 *	Construct an IP and ICMP header.  (need to set no fragment bit - XXX)
+	 */
+	ip->ip_hl_v  = 0x45;		/* IP_HDR_SIZE / 4 (not including UDP) */
+	ip->ip_tos   = 0;
+	ip->ip_len   = htons(IP_HDR_SIZE_NO_UDP + 8);
+	ip->ip_id    = htons(NetIPID++);
+	ip->ip_off   = htons(0x4000);	/* No fragmentation */
+	ip->ip_ttl   = 255;
+	ip->ip_p     = 0x01;		/* ICMP */
+	ip->ip_sum   = 0;
+	NetCopyIP((void*)&ip->ip_src, &NetOurIP); /* already in network byte order */
+	NetCopyIP((void*)&ip->ip_dst, &NetPingIP);	   /* - "" - */
+	ip->ip_sum   = ~NetCksum((uchar *)ip, IP_HDR_SIZE_NO_UDP / 2);
+
+	s = &ip->udp_src;		/* XXX ICMP starts here */
+	s[0] = htons(0x0800);		/* echo-request, code */
+	s[1] = 0;			/* checksum */
+	s[2] = 0; 			/* identifier */
+	s[3] = htons(PingSeqNo++);	/* sequence number */
+	s[1] = ~NetCksum((uchar *)s, 8/2);
+
+	/* size of the waiting packet */
+	NetArpWaitTxPacketSize = (pkt - NetArpWaitTxPacket) + IP_HDR_SIZE_NO_UDP + 8;
+
+	/* and do the ARP request */
+	NetArpWaitTry = 1;
+	NetArpWaitTimerStart = get_timer(0);
+	ArpRequest();
+	return 1;	/* waiting */
+}
+
+static void
+PingTimeout (void)
+{
+	eth_halt();
+	NetState = NETLOOP_FAIL;	/* we did not get the reply */
+}
+
+static void
+PingHandler (uchar * pkt, unsigned dest, unsigned src, unsigned len)
+{
+	IPaddr_t tmp;
+	volatile IP_t *ip = (volatile IP_t *)pkt;
+
+	tmp = NetReadIP((void *)&ip->ip_src);
+	if (tmp != NetPingIP)
+		return;
+
+	NetState = NETLOOP_SUCCESS;
+}
+
+static void PingStart(void)
+{
+#if defined(CONFIG_NET_MULTI)
+	printf ("Using %s device\n", eth_get_name());
+#endif	/* CONFIG_NET_MULTI */
+	NetSetTimeout (10 * CFG_HZ, PingTimeout);
+	NetSetHandler (PingHandler);
+
+	PingSend();
+}
+#endif	/* CFG_CMD_PING */
+
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+
+#define CDP_DEVICE_ID_TLV		0x0001
+#define CDP_ADDRESS_TLV			0x0002
+#define CDP_PORT_ID_TLV			0x0003
+#define CDP_CAPABILITIES_TLV		0x0004
+#define CDP_VERSION_TLV			0x0005
+#define CDP_PLATFORM_TLV		0x0006
+#define CDP_NATIVE_VLAN_TLV		0x000a
+#define CDP_APPLIANCE_VLAN_TLV		0x000e
+#define CDP_TRIGGER_TLV			0x000f
+#define CDP_POWER_CONSUMPTION_TLV	0x0010
+#define CDP_SYSNAME_TLV			0x0014
+#define CDP_SYSOBJECT_TLV		0x0015
+#define CDP_MANAGEMENT_ADDRESS_TLV	0x0016
+
+#define CDP_TIMEOUT			(CFG_HZ/4)	/* one packet every 250ms */
+
+static int CDPSeq;
+static int CDPOK;
+
+ushort CDPNativeVLAN;
+ushort CDPApplianceVLAN;
+
+static const uchar CDP_SNAP_hdr[8] = { 0xAA, 0xAA, 0x03, 0x00, 0x00, 0x0C, 0x20, 0x00 };
+
+static ushort CDP_compute_csum(const uchar *buff, ushort len)
+{
+	ushort csum;
+	int     odd;
+	ulong   result = 0;
+	ushort  leftover;
+	ushort *p;
+
+	if (len > 0) {
+		odd = 1 & (ulong)buff;
+		if (odd) {
+			result = *buff << 8;
+			len--;
+			buff++;
+		}
+		while (len > 1) {
+			p = (ushort *)buff;
+			result += *p++;
+			buff = (uchar *)p;
+			if (result & 0x80000000)
+				result = (result & 0xFFFF) + (result >> 16);
+			len -= 2;
+		}
+		if (len) {
+			leftover = (signed short)(*(const signed char *)buff);
+			/* CISCO SUCKS big time! (and blows too):
+			 * CDP uses the IP checksum algorithm with a twist;
+			 * for the last byte it *sign* extends and sums.
+			 */
+			result = (result & 0xffff0000) | ((result + leftover) & 0x0000ffff);
+		}
+		while (result >> 16)
+			result = (result & 0xFFFF) + (result >> 16);
+
+		if (odd)
+			result = ((result >> 8) & 0xff) | ((result & 0xff) << 8);
+	}
+
+	/* add up 16-bit and 17-bit words for 17+c bits */
+	result = (result & 0xffff) + (result >> 16);
+	/* add up 16-bit and 2-bit for 16+c bit */
+	result = (result & 0xffff) + (result >> 16);
+	/* add up carry.. */
+	result = (result & 0xffff) + (result >> 16);
+
+	/* negate */
+	csum = ~(ushort)result;
+
+	/* run time endian detection */
+	if (csum != htons(csum))	/* little endian */
+		csum = htons(csum);
+
+	return csum;
+}
+
+int CDPSendTrigger(void)
+{
+	volatile uchar *pkt;
+	volatile ushort *s;
+	volatile ushort *cp;
+	Ethernet_t *et;
+	int len;
+	ushort chksum;
+#if defined(CONFIG_CDP_DEVICE_ID) || defined(CONFIG_CDP_PORT_ID)   || \
+    defined(CONFIG_CDP_VERSION)   || defined(CONFIG_CDP_PLATFORM)
+	char buf[32];
+#endif
+
+	pkt = NetTxPacket;
+	et = (Ethernet_t *)pkt;
+
+	/* NOTE: trigger sent not on any VLAN */
+
+	/* form ethernet header */
+	memcpy(et->et_dest, NetCDPAddr, 6);
+	memcpy(et->et_src, NetOurEther, 6);
+
+	pkt += ETHER_HDR_SIZE;
+
+	/* SNAP header */
+	memcpy((uchar *)pkt, CDP_SNAP_hdr, sizeof(CDP_SNAP_hdr));
+	pkt += sizeof(CDP_SNAP_hdr);
+
+	/* CDP header */
+	*pkt++ = 0x02;				/* CDP version 2 */
+	*pkt++ = 180;				/* TTL */
+	s = (volatile ushort *)pkt;
+	cp = s;
+	*s++ = htons(0);			/* checksum (0 for later calculation) */
+
+	/* CDP fields */
+#ifdef CONFIG_CDP_DEVICE_ID
+	*s++ = htons(CDP_DEVICE_ID_TLV);
+	*s++ = htons(CONFIG_CDP_DEVICE_ID);
+	memset(buf, 0, sizeof(buf));
+	sprintf(buf, CONFIG_CDP_DEVICE_ID_PREFIX "%02X%02X%02X%02X%02X%02X",
+		NetOurEther[0] & 0xff, NetOurEther[1] & 0xff,
+		NetOurEther[2] & 0xff, NetOurEther[3] & 0xff,
+		NetOurEther[4] & 0xff, NetOurEther[5] & 0xff);
+	memcpy((uchar *)s, buf, 16);
+	s += 16 / 2;
+#endif
+
+#ifdef CONFIG_CDP_PORT_ID
+	*s++ = htons(CDP_PORT_ID_TLV);
+	memset(buf, 0, sizeof(buf));
+	sprintf(buf, CONFIG_CDP_PORT_ID, eth_get_dev_index());
+	len = strlen(buf);
+	if (len & 1)	/* make it even */
+		len++;
+	*s++ = htons(len + 4);
+	memcpy((uchar *)s, buf, len);
+	s += len / 2;
+#endif
+
+#ifdef CONFIG_CDP_CAPABILITIES
+	*s++ = htons(CDP_CAPABILITIES_TLV);
+	*s++ = htons(8);
+	*(ulong *)s = htonl(CONFIG_CDP_CAPABILITIES);
+	s += 2;
+#endif
+
+#ifdef CONFIG_CDP_VERSION
+	*s++ = htons(CDP_VERSION_TLV);
+	memset(buf, 0, sizeof(buf));
+	strcpy(buf, CONFIG_CDP_VERSION);
+	len = strlen(buf);
+	if (len & 1)	/* make it even */
+		len++;
+	*s++ = htons(len + 4);
+	memcpy((uchar *)s, buf, len);
+	s += len / 2;
+#endif
+
+#ifdef CONFIG_CDP_PLATFORM
+	*s++ = htons(CDP_PLATFORM_TLV);
+	memset(buf, 0, sizeof(buf));
+	strcpy(buf, CONFIG_CDP_PLATFORM);
+	len = strlen(buf);
+	if (len & 1)	/* make it even */
+		len++;
+	*s++ = htons(len + 4);
+	memcpy((uchar *)s, buf, len);
+	s += len / 2;
+#endif
+
+#ifdef CONFIG_CDP_TRIGGER
+	*s++ = htons(CDP_TRIGGER_TLV);
+	*s++ = htons(8);
+	*(ulong *)s = htonl(CONFIG_CDP_TRIGGER);
+	s += 2;
+#endif
+
+#ifdef CONFIG_CDP_POWER_CONSUMPTION
+	*s++ = htons(CDP_POWER_CONSUMPTION_TLV);
+	*s++ = htons(6);
+	*s++ = htons(CONFIG_CDP_POWER_CONSUMPTION);
+#endif
+
+	/* length of ethernet packet */
+	len = (uchar *)s - ((uchar *)NetTxPacket + ETHER_HDR_SIZE);
+	et->et_protlen = htons(len);
+
+	len = ETHER_HDR_SIZE + sizeof(CDP_SNAP_hdr);
+	chksum = CDP_compute_csum((uchar *)NetTxPacket + len, (uchar *)s - (NetTxPacket + len));
+	if (chksum == 0)
+		chksum = 0xFFFF;
+	*cp = htons(chksum);
+
+	(void) eth_send(NetTxPacket, (uchar *)s - NetTxPacket);
+	return 0;
+}
+
+static void
+CDPTimeout (void)
+{
+	CDPSeq++;
+
+	if (CDPSeq < 3) {
+		NetSetTimeout (CDP_TIMEOUT, CDPTimeout);
+		CDPSendTrigger();
+		return;
+	}
+
+	/* if not OK try again */
+	if (!CDPOK)
+		NetStartAgain();
+	else
+		NetState = NETLOOP_SUCCESS;
+}
+
+static void
+CDPDummyHandler (uchar * pkt, unsigned dest, unsigned src, unsigned len)
+{
+	/* nothing */
+}
+
+static void
+CDPHandler(const uchar * pkt, unsigned len)
+{
+	const uchar *t;
+	const ushort *ss;
+	ushort type, tlen;
+	uchar applid;
+	ushort vlan, nvlan;
+
+	/* minimum size? */
+	if (len < sizeof(CDP_SNAP_hdr) + 4)
+		goto pkt_short;
+
+	/* check for valid CDP SNAP header */
+	if (memcmp(pkt, CDP_SNAP_hdr, sizeof(CDP_SNAP_hdr)) != 0)
+		return;
+
+	pkt += sizeof(CDP_SNAP_hdr);
+	len -= sizeof(CDP_SNAP_hdr);
+
+	/* Version of CDP protocol must be >= 2 and TTL != 0 */
+	if (pkt[0] < 0x02 || pkt[1] == 0)
+		return;
+
+	/* if version is greater than 0x02 maybe we'll have a problem; output a warning */
+	if (pkt[0] != 0x02)
+		printf("** WARNING: CDP packet received with a protocol version %d > 2\n",
+				pkt[0] & 0xff);
+
+	if (CDP_compute_csum(pkt, len) != 0)
+		return;
+
+	pkt += 4;
+	len -= 4;
+
+	vlan = htons(-1);
+	nvlan = htons(-1);
+	while (len > 0) {
+		if (len < 4)
+			goto pkt_short;
+
+		ss = (const ushort *)pkt;
+		type = ntohs(ss[0]);
+		tlen = ntohs(ss[1]);
+		if (tlen > len) {
+			goto pkt_short;
+		}
+
+		pkt += tlen;
+		len -= tlen;
+
+		ss += 2;	/* point ss to the data of the TLV */
+		tlen -= 4;
+
+		switch (type) {
+			case CDP_DEVICE_ID_TLV:
+				break;
+			case CDP_ADDRESS_TLV:
+				break;
+			case CDP_PORT_ID_TLV:
+				break;
+			case CDP_CAPABILITIES_TLV:
+				break;
+			case CDP_VERSION_TLV:
+				break;
+			case CDP_PLATFORM_TLV:
+				break;
+			case CDP_NATIVE_VLAN_TLV:
+				nvlan = *ss;
+				break;
+			case CDP_APPLIANCE_VLAN_TLV:
+				t = (const uchar *)ss;
+				while (tlen > 0) {
+					if (tlen < 3)
+						goto pkt_short;
+
+					applid = t[0];
+					ss = (const ushort *)(t + 1);
+
+#ifdef CONFIG_CDP_APPLIANCE_VLAN_TYPE
+					if (applid == CONFIG_CDP_APPLIANCE_VLAN_TYPE)
+						vlan = *ss;
+#else
+					vlan = ntohs(*ss);	/* XXX will this work; dunno */
+#endif
+					t += 3; tlen -= 3;
+				}
+				break;
+			case CDP_TRIGGER_TLV:
+				break;
+			case CDP_POWER_CONSUMPTION_TLV:
+				break;
+			case CDP_SYSNAME_TLV:
+				break;
+			case CDP_SYSOBJECT_TLV:
+				break;
+			case CDP_MANAGEMENT_ADDRESS_TLV:
+				break;
+		}
+	}
+
+	CDPApplianceVLAN = vlan;
+	CDPNativeVLAN = nvlan;
+
+	CDPOK = 1;
+	return;
+
+ pkt_short:
+	printf("** CDP packet is too short\n");
+	return;
+}
+
+static void CDPStart(void)
+{
+#if defined(CONFIG_NET_MULTI)
+	printf ("Using %s device\n", eth_get_name());
+#endif
+	CDPSeq = 0;
+	CDPOK = 0;
+
+	CDPNativeVLAN = htons(-1);
+	CDPApplianceVLAN = htons(-1);
+
+	NetSetTimeout (CDP_TIMEOUT, CDPTimeout);
+	NetSetHandler (CDPDummyHandler);
+
+	CDPSendTrigger();
+}
+#endif	/* CFG_CMD_CDP */
+
+
+void
+NetReceive(volatile uchar * inpkt, int len)
+{
+	Ethernet_t *et;
+	IP_t	*ip;
+	ARP_t	*arp;
+	IPaddr_t tmp;
+	int	x;
+	uchar *pkt;
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+	int iscdp;
+#endif
+	ushort cti = 0, vlanid = VLAN_NONE, myvlanid, mynvlanid;
+
+#ifdef ET_DEBUG
+	printf("packet received\n");
+#endif
+
+	NetRxPkt = inpkt;
+	NetRxPktLen = len;
+	et = (Ethernet_t *)inpkt;
+
+	/* too small packet? */
+	if (len < ETHER_HDR_SIZE)
+		return;
+
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+	/* keep track if packet is CDP */
+	iscdp = memcmp(et->et_dest, NetCDPAddr, 6) == 0;
+#endif
+
+	myvlanid = ntohs(NetOurVLAN);
+	if (myvlanid == (ushort)-1)
+		myvlanid = VLAN_NONE;
+	mynvlanid = ntohs(NetOurNativeVLAN);
+	if (mynvlanid == (ushort)-1)
+		mynvlanid = VLAN_NONE;
+
+	x = ntohs(et->et_protlen);
+
+#ifdef ET_DEBUG
+	printf("packet received\n");
+#endif
+
+	if (x < 1514) {
+		/*
+		 *	Got a 802 packet.  Check the other protocol field.
+		 */
+		x = ntohs(et->et_prot);
+
+		ip = (IP_t *)(inpkt + E802_HDR_SIZE);
+		len -= E802_HDR_SIZE;
+
+	} else if (x != PROT_VLAN) {	/* normal packet */
+		ip = (IP_t *)(inpkt + ETHER_HDR_SIZE);
+		len -= ETHER_HDR_SIZE;
+
+	} else {			/* VLAN packet */
+		VLAN_Ethernet_t *vet = (VLAN_Ethernet_t *)et;
+
+#ifdef ET_DEBUG
+		printf("VLAN packet received\n");
+#endif
+		/* too small packet? */
+		if (len < VLAN_ETHER_HDR_SIZE)
+			return;
+
+		/* if no VLAN active */
+		if ((ntohs(NetOurVLAN) & VLAN_IDMASK) == VLAN_NONE
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+				&& iscdp == 0
+#endif
+				)
+			return;
+
+		cti = ntohs(vet->vet_tag);
+		vlanid = cti & VLAN_IDMASK;
+		x = ntohs(vet->vet_type);
+
+		ip = (IP_t *)(inpkt + VLAN_ETHER_HDR_SIZE);
+		len -= VLAN_ETHER_HDR_SIZE;
+	}
+
+#ifdef ET_DEBUG
+	printf("Receive from protocol 0x%x\n", x);
+#endif
+
+#if (CONFIG_COMMANDS & CFG_CMD_CDP)
+	if (iscdp) {
+		CDPHandler((uchar *)ip, len);
+		return;
+	}
+#endif
+
+	if ((myvlanid & VLAN_IDMASK) != VLAN_NONE) {
+		if (vlanid == VLAN_NONE)
+			vlanid = (mynvlanid & VLAN_IDMASK);
+		/* not matched? */
+		if (vlanid != (myvlanid & VLAN_IDMASK))
+			return;
+	}
+
+	switch (x) {
+
+	case PROT_ARP:
+		/*
+		 * We have to deal with two types of ARP packets:
+		 * - REQUEST packets will be answered by sending  our
+		 *   IP address - if we know it.
+		 * - REPLY packates are expected only after we asked
+		 *   for the TFTP server's or the gateway's ethernet
+		 *   address; so if we receive such a packet, we set
+		 *   the server ethernet address
+		 */
+#ifdef ET_DEBUG
+		puts ("Got ARP\n");
+#endif
+		arp = (ARP_t *)ip;
+		if (len < ARP_HDR_SIZE) {
+			printf("bad length %d < %d\n", len, ARP_HDR_SIZE);
+			return;
+		}
+		if (ntohs(arp->ar_hrd) != ARP_ETHER) {
+			return;
+		}
+		if (ntohs(arp->ar_pro) != PROT_IP) {
+			return;
+		}
+		if (arp->ar_hln != 6) {
+			return;
+		}
+		if (arp->ar_pln != 4) {
+			return;
+		}
+
+		if (NetOurIP == 0) {
+			return;
+		}
+
+		if (NetReadIP(&arp->ar_data[16]) != NetOurIP) {
+			return;
+		}
+
+		switch (ntohs(arp->ar_op)) {
+		case ARPOP_REQUEST:		/* reply with our IP address	*/
+#ifdef ET_DEBUG
+			puts ("Got ARP REQUEST, return our IP\n");
+#endif
+			pkt = (uchar *)et;
+			pkt += NetSetEther(pkt, et->et_src, PROT_ARP);
+			arp->ar_op = htons(ARPOP_REPLY);
+			memcpy   (&arp->ar_data[10], &arp->ar_data[0], 6);
+			NetCopyIP(&arp->ar_data[16], &arp->ar_data[6]);
+			memcpy   (&arp->ar_data[ 0], NetOurEther, 6);
+			NetCopyIP(&arp->ar_data[ 6], &NetOurIP);
+			(void) eth_send((uchar *)et, (pkt - (uchar *)et) + ARP_HDR_SIZE);
+			return;
+
+		case ARPOP_REPLY:		/* arp reply */
+			/* are we waiting for a reply */
+			if (!NetArpWaitPacketIP || !NetArpWaitPacketMAC)
+				break;
+#ifdef ET_DEBUG
+			printf("Got ARP REPLY, set server/gtwy eth addr (%02x:%02x:%02x:%02x:%02x:%02x)\n",
+				arp->ar_data[0], arp->ar_data[1],
+				arp->ar_data[2], arp->ar_data[3],
+				arp->ar_data[4], arp->ar_data[5]);
+#endif
+
+			tmp = NetReadIP(&arp->ar_data[6]);
+
+			/* matched waiting packet's address */
+			if (tmp == NetArpWaitReplyIP) {
+#ifdef ET_DEBUG
+				puts ("Got it\n");
+#endif
+				/* save address for later use */
+				memcpy(NetArpWaitPacketMAC, &arp->ar_data[0], 6);
+
+#ifdef CONFIG_NETCONSOLE
+				(*packetHandler)(0,0,0,0);
+#endif
+				/* modify header, and transmit it */
+				memcpy(((Ethernet_t *)NetArpWaitTxPacket)->et_dest, NetArpWaitPacketMAC, 6);
+				(void) eth_send(NetArpWaitTxPacket, NetArpWaitTxPacketSize);
+
+				/* no arp request pending now */
+				NetArpWaitPacketIP = 0;
+				NetArpWaitTxPacketSize = 0;
+				NetArpWaitPacketMAC = NULL;
+
+			}
+			return;
+		default:
+#ifdef ET_DEBUG
+			printf("Unexpected ARP opcode 0x%x\n", ntohs(arp->ar_op));
+#endif
+			return;
+		}
+		break;
+
+	case PROT_RARP:
+#ifdef ET_DEBUG
+		puts ("Got RARP\n");
+#endif
+		arp = (ARP_t *)ip;
+		if (len < ARP_HDR_SIZE) {
+			printf("bad length %d < %d\n", len, ARP_HDR_SIZE);
+			return;
+		}
+
+		if ((ntohs(arp->ar_op) != RARPOP_REPLY) ||
+			(ntohs(arp->ar_hrd) != ARP_ETHER)   ||
+			(ntohs(arp->ar_pro) != PROT_IP)     ||
+			(arp->ar_hln != 6) || (arp->ar_pln != 4)) {
+
+			puts ("invalid RARP header\n");
+		} else {
+			NetCopyIP(&NetOurIP,    &arp->ar_data[16]);
+			if (NetServerIP == 0)
+				NetCopyIP(&NetServerIP, &arp->ar_data[ 6]);
+			memcpy (NetServerEther, &arp->ar_data[ 0], 6);
+
+			(*packetHandler)(0,0,0,0);
+		}
+		break;
+
+	case PROT_IP:
+#ifdef ET_DEBUG
+		puts ("Got IP\n");
+#endif
+		if (len < IP_HDR_SIZE) {
+			debug ("len bad %d < %d\n", len, IP_HDR_SIZE);
+			return;
+		}
+		if (len < ntohs(ip->ip_len)) {
+			printf("len bad %d < %d\n", len, ntohs(ip->ip_len));
+			return;
+		}
+		len = ntohs(ip->ip_len);
+#ifdef ET_DEBUG
+		printf("len=%d, v=%02x\n", len, ip->ip_hl_v & 0xff);
+#endif
+		if ((ip->ip_hl_v & 0xf0) != 0x40) {
+			return;
+		}
+		if (ip->ip_off & htons(0x1fff)) { /* Can't deal w/ fragments */
+			return;
+		}
+		if (!NetCksumOk((uchar *)ip, IP_HDR_SIZE_NO_UDP / 2)) {
+			puts ("checksum bad\n");
+			return;
+		}
+		tmp = NetReadIP(&ip->ip_dst);
+		if (NetOurIP && tmp != NetOurIP && tmp != 0xFFFFFFFF) {
+			return;
+		}
+		/*
+		 * watch for ICMP host redirects
+		 *
+		 * There is no real handler code (yet). We just watch
+		 * for ICMP host redirect messages. In case anybody
+		 * sees these messages: please contact me
+		 * (wd@denx.de), or - even better - send me the
+		 * necessary fixes :-)
+		 *
+		 * Note: in all cases where I have seen this so far
+		 * it was a problem with the router configuration,
+		 * for instance when a router was configured in the
+		 * BOOTP reply, but the TFTP server was on the same
+		 * subnet. So this is probably a warning that your
+		 * configuration might be wrong. But I'm not really
+		 * sure if there aren't any other situations.
+		 */
+		if (ip->ip_p == IPPROTO_ICMP) {
+			ICMP_t *icmph = (ICMP_t *)&(ip->udp_src);
+
+			switch (icmph->type) {
+			case ICMP_REDIRECT:
+				if (icmph->code != ICMP_REDIR_HOST)
+					return;
+				puts (" ICMP Host Redirect to ");
+				print_IPaddr(icmph->un.gateway);
+				putc(' ');
+				return;
+#if (CONFIG_COMMANDS & CFG_CMD_PING)
+			case ICMP_ECHO_REPLY:
+				/*
+				 *	IP header OK.  Pass the packet to the current handler.
+				 */
+				/* XXX point to ip packet */
+				(*packetHandler)((uchar *)ip, 0, 0, 0);
+				return;
+#endif
+			default:
+				return;
+			}
+		} else if (ip->ip_p != IPPROTO_UDP) {	/* Only UDP packets */
+			return;
+		}
+
+#ifdef CONFIG_UDP_CHECKSUM
+		if (ip->udp_xsum != 0) {
+			ulong   xsum;
+			ushort *sumptr;
+			ushort  sumlen;
+
+			xsum  = ip->ip_p;
+			xsum += (ntohs(ip->udp_len));
+			xsum += (ntohl(ip->ip_src) >> 16) & 0x0000ffff;
+			xsum += (ntohl(ip->ip_src) >>  0) & 0x0000ffff;
+			xsum += (ntohl(ip->ip_dst) >> 16) & 0x0000ffff;
+			xsum += (ntohl(ip->ip_dst) >>  0) & 0x0000ffff;
+
+			sumlen = ntohs(ip->udp_len);
+			sumptr = (ushort *) &(ip->udp_src);
+
+			while (sumlen > 1) {
+				ushort sumdata;
+
+				sumdata = *sumptr++;
+				xsum += ntohs(sumdata);
+				sumlen -= 2;
+			}
+			if (sumlen > 0) {
+				ushort sumdata;
+
+				sumdata = *(unsigned char *) sumptr;
+				sumdata = (sumdata << 8) & 0xff00;
+				xsum += sumdata;
+			}
+			while ((xsum >> 16) != 0) {
+				xsum = (xsum & 0x0000ffff) + ((xsum >> 16) & 0x0000ffff);
+			}
+			if ((xsum != 0x00000000) && (xsum != 0x0000ffff)) {
+				printf(" UDP wrong checksum %08x %08x\n", xsum, ntohs(ip->udp_xsum));
+				return;
+			}
+		}
+#endif
+
+#ifdef CONFIG_NETCONSOLE
+		nc_input_packet((uchar *)ip +IP_HDR_SIZE,
+						ntohs(ip->udp_dst),
+						ntohs(ip->udp_src),
+						ntohs(ip->udp_len) - 8);
+#endif
+		/*
+		 *	IP header OK.  Pass the packet to the current handler.
+		 */
+		(*packetHandler)((uchar *)ip +IP_HDR_SIZE,
+						ntohs(ip->udp_dst),
+						ntohs(ip->udp_src),
+						ntohs(ip->udp_len) - 8);
+		break;
+	}
+}
+
+
+/**********************************************************************/
+
+static int net_check_prereq (proto_t protocol)
+{
+	switch (protocol) {
+		/* Fall through */
+#if (CONFIG_COMMANDS & CFG_CMD_PING)
+	case PING:
+		if (NetPingIP == 0) {
+			puts ("*** ERROR: ping address not given\n");
+			return (1);
+		}
+		goto common;
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_SNTP)
+	case SNTP:
+		if (NetNtpServerIP == 0) {
+			puts ("*** ERROR: NTP server address not given\n");
+			return (1);
+		}
+		goto common;
+#endif
+#if (CONFIG_COMMANDS & CFG_CMD_NFS)
+	case NFS:
+#endif
+	case NETCONS:
+	case TFTP:
+		if (NetServerIP == 0) {
+			puts ("*** ERROR: `serverip' not set\n");
+			return (1);
+		}
+#if (CONFIG_COMMANDS & (CFG_CMD_PING | CFG_CMD_SNTP))
+    common:
+#endif
+
+		if (NetOurIP == 0) {
+			puts ("*** ERROR: `ipaddr' not set\n");
+			return (1);
+		}
+		/* Fall through */
+
+	case DHCP:
+	case RARP:
+	case BOOTP:
+	case CDP:
+		if (memcmp (NetOurEther, "\0\0\0\0\0\0", 6) == 0) {
+#ifdef CONFIG_NET_MULTI
+			extern int eth_get_dev_index (void);
+			int num = eth_get_dev_index ();
+
+			switch (num) {
+			case -1:
+				puts ("*** ERROR: No ethernet found.\n");
+				return (1);
+			case 0:
+				puts ("*** ERROR: `ethaddr' not set\n");
+				break;
+			default:
+				printf ("*** ERROR: `eth%daddr' not set\n",
+					num);
+				break;
+			}
+
+			NetStartAgain ();
+			return (2);
+#else
+			puts ("*** ERROR: `ethaddr' not set\n");
+			return (1);
+#endif
+		}
+		/* Fall through */
+	default:
+		return (0);
+	}
+	return (0);		/* OK */
+}
+/**********************************************************************/
+
+int
+NetCksumOk(uchar * ptr, int len)
+{
+	return !((NetCksum(ptr, len) + 1) & 0xfffe);
+}
+
+
+unsigned
+NetCksum(uchar * ptr, int len)
+{
+	ulong	xsum;
+	ushort *p = (ushort *)ptr;
+
+	xsum = 0;
+	while (len-- > 0)
+		xsum += *p++;
+	xsum = (xsum & 0xffff) + (xsum >> 16);
+	xsum = (xsum & 0xffff) + (xsum >> 16);
+	return (xsum & 0xffff);
+}
+
+int
+NetEthHdrSize(void)
+{
+	ushort myvlanid;
+
+	myvlanid = ntohs(NetOurVLAN);
+	if (myvlanid == (ushort)-1)
+		myvlanid = VLAN_NONE;
+
+	return ((myvlanid & VLAN_IDMASK) == VLAN_NONE) ? ETHER_HDR_SIZE : VLAN_ETHER_HDR_SIZE;
+}
+
+int
+NetSetEther(volatile uchar * xet, uchar * addr, uint prot)
+{
+	Ethernet_t *et = (Ethernet_t *)xet;
+	ushort myvlanid;
+
+	myvlanid = ntohs(NetOurVLAN);
+	if (myvlanid == (ushort)-1)
+		myvlanid = VLAN_NONE;
+
+	memcpy (et->et_dest, addr, 6);
+	memcpy (et->et_src, NetOurEther, 6);
+	if ((myvlanid & VLAN_IDMASK) == VLAN_NONE) {
+	et->et_protlen = htons(prot);
+		return ETHER_HDR_SIZE;
+	} else {
+		VLAN_Ethernet_t *vet = (VLAN_Ethernet_t *)xet;
+
+		vet->vet_vlan_type = htons(PROT_VLAN);
+		vet->vet_tag = htons((0 << 5) | (myvlanid & VLAN_IDMASK));
+		vet->vet_type = htons(prot);
+		return VLAN_ETHER_HDR_SIZE;
+	}
+}
+
+void
+NetSetIP(volatile uchar * xip, IPaddr_t dest, int dport, int sport, int len)
+{
+	volatile IP_t *ip = (IP_t *)xip;
+
+	/*
+	 *	If the data is an odd number of bytes, zero the
+	 *	byte after the last byte so that the checksum
+	 *	will work.
+	 */
+	if (len & 1)
+		xip[IP_HDR_SIZE + len] = 0;
+
+	/*
+	 *	Construct an IP and UDP header.
+	 *	(need to set no fragment bit - XXX)
+	 */
+	ip->ip_hl_v  = 0x45;		/* IP_HDR_SIZE / 4 (not including UDP) */
+	ip->ip_tos   = 0;
+	ip->ip_len   = htons(IP_HDR_SIZE + len);
+	ip->ip_id    = htons(NetIPID++);
+	ip->ip_off   = htons(0x4000);	/* No fragmentation */
+	ip->ip_ttl   = 255;
+	ip->ip_p     = 17;		/* UDP */
+	ip->ip_sum   = 0;
+	NetCopyIP((void*)&ip->ip_src, &NetOurIP); /* already in network byte order */
+	NetCopyIP((void*)&ip->ip_dst, &dest);	   /* - "" - */
+	ip->udp_src  = htons(sport);
+	ip->udp_dst  = htons(dport);
+	ip->udp_len  = htons(8 + len);
+	ip->udp_xsum = 0;
+	ip->ip_sum   = ~NetCksum((uchar *)ip, IP_HDR_SIZE_NO_UDP / 2);
+}
+
+void copy_filename (char *dst, char *src, int size)
+{
+	if (*src && (*src == '"')) {
+		++src;
+		--size;
+	}
+
+	while ((--size > 0) && *src && (*src != '"')) {
+		*dst++ = *src++;
+	}
+	*dst = '\0';
+}
+
+#endif /* CFG_CMD_NET */
+
+void ip_to_string (IPaddr_t x, char *s)
+{
+	x = ntohl (x);
+	sprintf (s, "%d.%d.%d.%d",
+		 (int) ((x >> 24) & 0xff),
+		 (int) ((x >> 16) & 0xff),
+		 (int) ((x >> 8) & 0xff), (int) ((x >> 0) & 0xff)
+	);
+}
+
+IPaddr_t string_to_ip(char *s)
+{
+	IPaddr_t addr;
+	char *e;
+	int i;
+
+	if (s == NULL)
+		return(0);
+
+	for (addr=0, i=0; i<4; ++i) {
+		ulong val = s ? simple_strtoul(s, &e, 10) : 0;
+		addr <<= 8;
+		addr |= (val & 0xFF);
+		if (s) {
+			s = (*e) ? e+1 : e;
+		}
+	}
+
+	return (htonl(addr));
+}
+
+void VLAN_to_string(ushort x, char *s)
+{
+	x = ntohs(x);
+
+	if (x == (ushort)-1)
+		x = VLAN_NONE;
+
+	if (x == VLAN_NONE)
+		strcpy(s, "none");
+	else
+		sprintf(s, "%d", x & VLAN_IDMASK);
+}
+
+ushort string_to_VLAN(char *s)
+{
+	ushort id;
+
+	if (s == NULL)
+		return htons(VLAN_NONE);
+
+	if (*s < '0' || *s > '9')
+		id = VLAN_NONE;
+	else
+		id = (ushort)simple_strtoul(s, NULL, 10);
+
+	return htons(id);
+}
+
+void print_IPaddr (IPaddr_t x)
+{
+	char tmp[16];
+
+	ip_to_string (x, tmp);
+
+	puts (tmp);
+}
+
+IPaddr_t getenv_IPaddr (char *var)
+{
+	return (string_to_ip(getenv(var)));
+}
+
+ushort getenv_VLAN(char *var)
+{
+	return (string_to_VLAN(getenv(var)));
+}
diff --git a/package/uboot-ifxmips/files/net/nfs_danube.c b/package/uboot-ifxmips/files/net/nfs_danube.c
new file mode 100644
index 0000000..de789e1
--- /dev/null
+++ b/package/uboot-ifxmips/files/net/nfs_danube.c
@@ -0,0 +1,778 @@
+/*
+ * NFS support driver - based on etherboot and U-BOOT's tftp.c
+ *
+ * Masami Komiya <mkomiya@sonare.it> 2004
+ *
+ */
+
+/* NOTE: the NFS code is heavily inspired by the NetBSD netboot code (read:
+ * large portions are copied verbatim) as distributed in OSKit 0.97.  A few
+ * changes were necessary to adapt the code to Etherboot and to fix several
+ * inconsistencies.  Also the RPC message preparation is done "by hand" to
+ * avoid adding netsprintf() which I find hard to understand and use.  */
+
+/* NOTE 2: Etherboot does not care about things beyond the kernel image, so
+ * it loads the kernel image off the boot server (ARP_SERVER) and does not
+ * access the client root disk (root-path in dhcpd.conf), which would use
+ * ARP_ROOTSERVER.  The root disk is something the operating system we are
+ * about to load needs to use.	This is different from the OSKit 0.97 logic.  */
+
+/* NOTE 3: Symlink handling introduced by Anselm M Hoffmeister, 2003-July-14
+ * If a symlink is encountered, it is followed as far as possible (recursion
+ * possible, maximum 16 steps). There is no clearing of ".."'s inside the
+ * path, so please DON'T DO THAT. thx. */
+
+#include <common.h>
+#include <command.h>
+#include <net.h>
+#include <malloc.h>
+#include "nfs.h"
+#include "bootp.h"
+
+/*#define NFS_DEBUG*/
+
+#if ((CONFIG_COMMANDS & CFG_CMD_NET) && (CONFIG_COMMANDS & CFG_CMD_NFS))
+
+#define HASHES_PER_LINE 65	/* Number of "loading" hashes per line	*/
+#define NFS_TIMEOUT 60
+
+static int fs_mounted = 0;
+static unsigned long rpc_id = 0;
+static int nfs_offset = -1;
+static int nfs_len;
+
+static char dirfh[NFS_FHSIZE];	/* file handle of directory */
+static char filefh[NFS_FHSIZE]; /* file handle of kernel image */
+
+static int	NfsDownloadState;
+static IPaddr_t NfsServerIP;
+static int	NfsSrvMountPort;
+static int	NfsSrvNfsPort;
+static int	NfsOurPort;
+static int	NfsTimeoutCount;
+static int	NfsState;
+#define STATE_PRCLOOKUP_PROG_MOUNT_REQ	1
+#define STATE_PRCLOOKUP_PROG_NFS_REQ	2
+#define STATE_MOUNT_REQ			3
+#define STATE_UMOUNT_REQ		4
+#define STATE_LOOKUP_REQ		5
+#define STATE_READ_REQ			6
+#define STATE_READLINK_REQ		7
+
+static char default_filename[64];
+static char *nfs_filename;
+static char *nfs_path;
+static char nfs_path_buff[2048];
+
+static __inline__ int
+store_block (uchar * src, unsigned offset, unsigned len)
+{
+	ulong newsize = offset + len;
+#ifdef CFG_DIRECT_FLASH_NFS
+	int i, rc = 0;
+
+	for (i=0; i<CFG_MAX_FLASH_BANKS; i++) {
+		/* start address in flash? */
+		if (load_addr + offset >= flash_info[i].start[0]) {
+			rc = 1;
+			break;
+		}
+	}
+
+	if (rc) { /* Flash is destination for this packet */
+		rc = flash_write ((uchar *)src, (ulong)(load_addr+offset), len);
+		if (rc) {
+			flash_perror (rc);
+			return -1;
+		}
+	} else
+#endif /* CFG_DIRECT_FLASH_NFS */
+	{
+		(void)memcpy ((void *)(load_addr + offset), src, len);
+	}
+
+	if (NetBootFileXferSize < (offset+len))
+		NetBootFileXferSize = newsize;
+	return 0;
+}
+
+static char*
+basename (char *path)
+{
+	char *fname;
+
+	fname = path + strlen(path) - 1;
+	while (fname >= path) {
+		if (*fname == '/') {
+			fname++;
+			break;
+		}
+		fname--;
+	}
+	return fname;
+}
+
+static char*
+dirname (char *path)
+{
+	char *fname;
+
+	fname = basename (path);
+	--fname;
+	*fname = '\0';
+	return path;
+}
+
+/**************************************************************************
+RPC_ADD_CREDENTIALS - Add RPC authentication/verifier entries
+**************************************************************************/
+static long *rpc_add_credentials (long *p)
+{
+	int hl;
+	int hostnamelen;
+	char hostname[256];
+
+	strcpy (hostname, "");
+	hostnamelen=strlen (hostname);
+
+	/* Here's the executive summary on authentication requirements of the
+	 * various NFS server implementations:	Linux accepts both AUTH_NONE
+	 * and AUTH_UNIX authentication (also accepts an empty hostname field
+	 * in the AUTH_UNIX scheme).  *BSD refuses AUTH_NONE, but accepts
+	 * AUTH_UNIX (also accepts an empty hostname field in the AUTH_UNIX
+	 * scheme).  To be safe, use AUTH_UNIX and pass the hostname if we have
+	 * it (if the BOOTP/DHCP reply didn't give one, just use an empty
+	 * hostname).  */
+
+	hl = (hostnamelen + 3) & ~3;
+
+	/* Provide an AUTH_UNIX credential.  */
+	*p++ = htonl(1);		/* AUTH_UNIX */
+	*p++ = htonl(hl+20);		/* auth length */
+	*p++ = htonl(0);		/* stamp */
+	*p++ = htonl(hostnamelen);	/* hostname string */
+	if (hostnamelen & 3) {
+		*(p + hostnamelen / 4) = 0; /* add zero padding */
+	}
+	memcpy (p, hostname, hostnamelen);
+	p += hl / 4;
+	*p++ = 0;			/* uid */
+	*p++ = 0;			/* gid */
+	*p++ = 0;			/* auxiliary gid list */
+
+	/* Provide an AUTH_NONE verifier.  */
+	*p++ = 0;			/* AUTH_NONE */
+	*p++ = 0;			/* auth length */
+
+	return p;
+}
+
+/**************************************************************************
+RPC_LOOKUP - Lookup RPC Port numbers
+**************************************************************************/
+static void
+rpc_req (int rpc_prog, int rpc_proc, uint32_t *data, int datalen)
+{
+	struct rpc_t pkt;
+	unsigned long id;
+	uint32_t *p;
+	int pktlen;
+	int sport;
+
+	id = ++rpc_id;
+	pkt.u.call.id = htonl(id);
+	pkt.u.call.type = htonl(MSG_CALL);
+	pkt.u.call.rpcvers = htonl(2);	/* use RPC version 2 */
+	pkt.u.call.prog = htonl(rpc_prog);
+	pkt.u.call.vers = htonl(2);	/* portmapper is version 2 */
+	pkt.u.call.proc = htonl(rpc_proc);
+	p = (uint32_t *)&(pkt.u.call.data);
+
+	if (datalen)
+		memcpy ((char *)p, (char *)data, datalen*sizeof(uint32_t));
+
+	pktlen = (char *)p + datalen*sizeof(uint32_t) - (char *)&pkt;
+
+	memcpy ((char *)NetTxPacket + NetEthHdrSize() + IP_HDR_SIZE, (char *)&pkt, pktlen);
+
+	if (rpc_prog == PROG_PORTMAP)
+		sport = SUNRPC_PORT;
+	else if (rpc_prog == PROG_MOUNT)
+		sport = NfsSrvMountPort;
+	else
+		sport = NfsSrvNfsPort;
+
+	NetSendUDPPacket (NetServerEther, NfsServerIP, sport, NfsOurPort, pktlen);
+}
+
+/**************************************************************************
+RPC_LOOKUP - Lookup RPC Port numbers
+**************************************************************************/
+static void
+rpc_lookup_req (int prog, int ver)
+{
+	uint32_t data[16];
+
+	data[0] = 0; data[1] = 0;	/* auth credential */
+	data[2] = 0; data[3] = 0;	/* auth verifier */
+	data[4] = htonl(prog);
+	data[5] = htonl(ver);
+	data[6] = htonl(17);	/* IP_UDP */
+	data[7] = 0;
+
+	rpc_req (PROG_PORTMAP, PORTMAP_GETPORT, data, 8);
+}
+
+/**************************************************************************
+NFS_MOUNT - Mount an NFS Filesystem
+**************************************************************************/
+static void
+nfs_mount_req (char *path)
+{
+	uint32_t data[1024];
+	uint32_t *p;
+	int len;
+	int pathlen;
+
+	pathlen = strlen (path);
+
+	p = &(data[0]);
+	p = (uint32_t *)rpc_add_credentials((long *)p);
+
+	*p++ = htonl(pathlen);
+	if (pathlen & 3) *(p + pathlen / 4) = 0;
+	memcpy (p, path, pathlen);
+	p += (pathlen + 3) / 4;
+
+	len = (uint32_t *)p - (uint32_t *)&(data[0]);
+
+	rpc_req (PROG_MOUNT, MOUNT_ADDENTRY, data, len);
+}
+
+/**************************************************************************
+NFS_UMOUNTALL - Unmount all our NFS Filesystems on the Server
+**************************************************************************/
+static void
+nfs_umountall_req (void)
+{
+	uint32_t data[1024];
+	uint32_t *p;
+	int len;
+
+	if ((NfsSrvMountPort == -1) || (!fs_mounted)) {
+		/* Nothing mounted, nothing to umount */
+		return;
+	}
+
+	p = &(data[0]);
+	p = (uint32_t *)rpc_add_credentials ((long *)p);
+
+	len = (uint32_t *)p - (uint32_t *)&(data[0]);
+
+	rpc_req (PROG_MOUNT, MOUNT_UMOUNTALL, data, len);
+}
+
+/***************************************************************************
+ * NFS_READLINK (AH 2003-07-14)
+ * This procedure is called when read of the first block fails -
+ * this probably happens when it's a directory or a symlink
+ * In case of successful readlink(), the dirname is manipulated,
+ * so that inside the nfs() function a recursion can be done.
+ **************************************************************************/
+static void
+nfs_readlink_req (void)
+{
+	uint32_t data[1024];
+	uint32_t *p;
+	int len;
+
+	p = &(data[0]);
+	p = (uint32_t *)rpc_add_credentials ((long *)p);
+
+	memcpy (p, filefh, NFS_FHSIZE);
+	p += (NFS_FHSIZE / 4);
+
+	len = (uint32_t *)p - (uint32_t *)&(data[0]);
+
+	rpc_req (PROG_NFS, NFS_READLINK, data, len);
+}
+
+/**************************************************************************
+NFS_LOOKUP - Lookup Pathname
+**************************************************************************/
+static void
+nfs_lookup_req (char *fname)
+{
+	uint32_t data[1024];
+	uint32_t *p;
+	int len;
+	int fnamelen;
+
+	fnamelen = strlen (fname);
+
+	p = &(data[0]);
+	p = (uint32_t *)rpc_add_credentials ((long *)p);
+
+	memcpy (p, dirfh, NFS_FHSIZE);
+	p += (NFS_FHSIZE / 4);
+	*p++ = htonl(fnamelen);
+	if (fnamelen & 3) *(p + fnamelen / 4) = 0;
+	memcpy (p, fname, fnamelen);
+	p += (fnamelen + 3) / 4;
+
+	len = (uint32_t *)p - (uint32_t *)&(data[0]);
+
+	rpc_req (PROG_NFS, NFS_LOOKUP, data, len);
+}
+
+/**************************************************************************
+NFS_READ - Read File on NFS Server
+**************************************************************************/
+static void
+nfs_read_req (int offset, int readlen)
+{
+	uint32_t data[1024];
+	uint32_t *p;
+	int len;
+
+	p = &(data[0]);
+	p = (uint32_t *)rpc_add_credentials ((long *)p);
+
+	memcpy (p, filefh, NFS_FHSIZE);
+	p += (NFS_FHSIZE / 4);
+	*p++ = htonl(offset);
+	*p++ = htonl(readlen);
+	*p++ = 0;
+
+	len = (uint32_t *)p - (uint32_t *)&(data[0]);
+
+	rpc_req (PROG_NFS, NFS_READ, data, len);
+}
+
+/**************************************************************************
+RPC request dispatcher
+**************************************************************************/
+
+static void
+NfsSend (void)
+{
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	switch (NfsState) {
+	case STATE_PRCLOOKUP_PROG_MOUNT_REQ:
+		rpc_lookup_req (PROG_MOUNT, 1);
+		break;
+	case STATE_PRCLOOKUP_PROG_NFS_REQ:
+		rpc_lookup_req (PROG_NFS, 2);
+		break;
+	case STATE_MOUNT_REQ:
+		nfs_mount_req (nfs_path);
+		break;
+	case STATE_UMOUNT_REQ:
+		nfs_umountall_req ();
+		break;
+	case STATE_LOOKUP_REQ:
+		nfs_lookup_req (nfs_filename);
+		break;
+	case STATE_READ_REQ:
+		nfs_read_req (nfs_offset, nfs_len);
+		break;
+	case STATE_READLINK_REQ:
+		nfs_readlink_req ();
+		break;
+	}
+}
+
+/**************************************************************************
+Handlers for the reply from server
+**************************************************************************/
+
+static int
+rpc_lookup_reply (int prog, uchar *pkt, unsigned len)
+{
+	struct rpc_t rpc_pkt;
+
+	memcpy ((unsigned char *)&rpc_pkt, pkt, len);
+
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	if (ntohl(rpc_pkt.u.reply.id) != rpc_id)
+		return -1;
+
+	if (rpc_pkt.u.reply.rstatus  ||
+	    rpc_pkt.u.reply.verifier ||
+	    rpc_pkt.u.reply.astatus  ||
+	    rpc_pkt.u.reply.astatus) {
+		return -1;
+	}
+
+	switch (prog) {
+	case PROG_MOUNT:
+		NfsSrvMountPort = ntohl(rpc_pkt.u.reply.data[0]);
+		break;
+	case PROG_NFS:
+		NfsSrvNfsPort = ntohl(rpc_pkt.u.reply.data[0]);
+		break;
+	}
+
+	return 0;
+}
+
+static int
+nfs_mount_reply (uchar *pkt, unsigned len)
+{
+	struct rpc_t rpc_pkt;
+
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	memcpy ((unsigned char *)&rpc_pkt, pkt, len);
+
+	if (ntohl(rpc_pkt.u.reply.id) != rpc_id)
+		return -1;
+
+	if (rpc_pkt.u.reply.rstatus  ||
+	    rpc_pkt.u.reply.verifier ||
+	    rpc_pkt.u.reply.astatus  ||
+	    rpc_pkt.u.reply.data[0]) {
+		return -1;
+	}
+
+	fs_mounted = 1;
+	memcpy (dirfh, rpc_pkt.u.reply.data + 1, NFS_FHSIZE);
+
+	return 0;
+}
+
+static int
+nfs_umountall_reply (uchar *pkt, unsigned len)
+{
+	struct rpc_t rpc_pkt;
+
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	memcpy ((unsigned char *)&rpc_pkt, pkt, len);
+
+	if (ntohl(rpc_pkt.u.reply.id) != rpc_id)
+		return -1;
+
+	if (rpc_pkt.u.reply.rstatus  ||
+	    rpc_pkt.u.reply.verifier ||
+	    rpc_pkt.u.reply.astatus) {
+		return -1;
+	}
+
+	fs_mounted = 0;
+	memset (dirfh, 0, sizeof(dirfh));
+
+	return 0;
+}
+
+static int
+nfs_lookup_reply (uchar *pkt, unsigned len)
+{
+	struct rpc_t rpc_pkt;
+
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	memcpy ((unsigned char *)&rpc_pkt, pkt, len);
+
+	if (ntohl(rpc_pkt.u.reply.id) != rpc_id)
+		return -1;
+
+	if (rpc_pkt.u.reply.rstatus  ||
+	    rpc_pkt.u.reply.verifier ||
+	    rpc_pkt.u.reply.astatus  ||
+	    rpc_pkt.u.reply.data[0]) {
+		return -1;
+	}
+
+	memcpy (filefh, rpc_pkt.u.reply.data + 1, NFS_FHSIZE);
+
+	return 0;
+}
+
+static int
+nfs_readlink_reply (uchar *pkt, unsigned len)
+{
+	struct rpc_t rpc_pkt;
+	int rlen;
+
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	memcpy ((unsigned char *)&rpc_pkt, pkt, len);
+
+	if (ntohl(rpc_pkt.u.reply.id) != rpc_id)
+		return -1;
+
+	if (rpc_pkt.u.reply.rstatus  ||
+	    rpc_pkt.u.reply.verifier ||
+	    rpc_pkt.u.reply.astatus  ||
+	    rpc_pkt.u.reply.data[0]) {
+		return -1;
+	}
+
+	rlen = ntohl (rpc_pkt.u.reply.data[1]); /* new path length */
+
+	if (*((char *)&(rpc_pkt.u.reply.data[2])) != '/') {
+		int pathlen;
+		strcat (nfs_path, "/");
+		pathlen = strlen(nfs_path);
+		memcpy (nfs_path+pathlen, (uchar *)&(rpc_pkt.u.reply.data[2]), rlen);
+		nfs_path[pathlen+rlen+1] = 0;
+	} else {
+		memcpy (nfs_path, (uchar *)&(rpc_pkt.u.reply.data[2]), rlen);
+		nfs_path[rlen] = 0;
+	}
+	return 0;
+}
+
+static int
+nfs_read_reply (uchar *pkt, unsigned len)
+{
+	struct rpc_t rpc_pkt;
+	int rlen;
+
+#ifdef NFS_DEBUG_nop
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	memcpy ((uchar *)&rpc_pkt, pkt, sizeof(rpc_pkt.u.reply));
+
+	if (ntohl(rpc_pkt.u.reply.id) != rpc_id)
+		return -1;
+
+	if (rpc_pkt.u.reply.rstatus  ||
+	    rpc_pkt.u.reply.verifier ||
+	    rpc_pkt.u.reply.astatus  ||
+	    rpc_pkt.u.reply.data[0]) {
+		if (rpc_pkt.u.reply.rstatus) {
+			return -9999;
+		}
+		if (rpc_pkt.u.reply.astatus) {
+			return -9999;
+		}
+		return -ntohl(rpc_pkt.u.reply.data[0]);;
+	}
+
+	if ((nfs_offset!=0) && !((nfs_offset) % (NFS_READ_SIZE/2*10*HASHES_PER_LINE))) {
+		puts ("\n\t ");
+	}
+	if (!(nfs_offset % ((NFS_READ_SIZE/2)*10))) {
+		putc ('#');
+	}
+
+	rlen = ntohl(rpc_pkt.u.reply.data[18]);
+	if ( store_block ((uchar *)pkt+sizeof(rpc_pkt.u.reply), nfs_offset, rlen) )
+		return -9999;
+
+	return rlen;
+}
+
+/**************************************************************************
+Interfaces of U-BOOT
+**************************************************************************/
+
+static void
+NfsTimeout (void)
+{
+	puts ("Timeout\n");
+	NetState = NETLOOP_FAIL;
+	return;
+}
+
+static void
+NfsHandler (uchar *pkt, unsigned dest, unsigned src, unsigned len)
+{
+	int rlen;
+
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+
+	if (dest != NfsOurPort) return;
+
+	switch (NfsState) {
+	case STATE_PRCLOOKUP_PROG_MOUNT_REQ:
+		rpc_lookup_reply (PROG_MOUNT, pkt, len);
+		NfsState = STATE_PRCLOOKUP_PROG_NFS_REQ;
+		NfsSend ();
+		break;
+
+	case STATE_PRCLOOKUP_PROG_NFS_REQ:
+		rpc_lookup_reply (PROG_NFS, pkt, len);
+		NfsState = STATE_MOUNT_REQ;
+		NfsSend ();
+		break;
+
+	case STATE_MOUNT_REQ:
+		if (nfs_mount_reply(pkt, len)) {
+			puts ("*** ERROR: Cannot mount\n");
+			/* just to be sure... */
+			NfsState = STATE_UMOUNT_REQ;
+			NfsSend ();
+		} else {
+			NfsState = STATE_LOOKUP_REQ;
+			NfsSend ();
+		}
+		break;
+
+	case STATE_UMOUNT_REQ:
+		if (nfs_umountall_reply(pkt, len)) {
+			puts ("*** ERROR: Cannot umount\n");
+			NetState = NETLOOP_FAIL;
+		} else {
+			puts ("\ndone\n");
+			NetState = NfsDownloadState;
+		}
+		break;
+
+	case STATE_LOOKUP_REQ:
+		if (nfs_lookup_reply(pkt, len)) {
+			puts ("*** ERROR: File lookup fail\n");
+			NfsState = STATE_UMOUNT_REQ;
+			NfsSend ();
+		} else {
+			NfsState = STATE_READ_REQ;
+			nfs_offset = 0;
+			nfs_len = NFS_READ_SIZE;
+			NfsSend ();
+		}
+		break;
+
+	case STATE_READLINK_REQ:
+		if (nfs_readlink_reply(pkt, len)) {
+			puts ("*** ERROR: Symlink fail\n");
+			NfsState = STATE_UMOUNT_REQ;
+			NfsSend ();
+		} else {
+#ifdef NFS_DEBUG
+			printf ("Symlink --> %s\n", nfs_path);
+#endif
+			nfs_filename = basename (nfs_path);
+			nfs_path     = dirname (nfs_path);
+
+			NfsState = STATE_MOUNT_REQ;
+			NfsSend ();
+		}
+		break;
+
+	case STATE_READ_REQ:
+		rlen = nfs_read_reply (pkt, len);
+		NetSetTimeout (NFS_TIMEOUT * CFG_HZ, NfsTimeout);
+		if (rlen > 0) {
+			nfs_offset += rlen;
+			NfsSend ();
+		}
+		else if ((rlen == -NFSERR_ISDIR)||(rlen == -NFSERR_INVAL)) {
+			/* symbolic link */
+			NfsState = STATE_READLINK_REQ;
+			NfsSend ();
+		} else {
+			if ( ! rlen ) NfsDownloadState = NETLOOP_SUCCESS;
+			NfsState = STATE_UMOUNT_REQ;
+			NfsSend ();
+		}
+		break;
+	}
+}
+
+
+void
+NfsStart (void)
+{
+#ifdef NFS_DEBUG
+	printf ("%s\n", __FUNCTION__);
+#endif
+	NfsDownloadState = NETLOOP_FAIL;
+
+	NfsServerIP = NetServerIP;
+	nfs_path = (char *)nfs_path_buff;
+
+	if (nfs_path == NULL) {
+		NetState = NETLOOP_FAIL;
+		puts ("*** ERROR: Fail allocate memory\n");
+		return;
+	}
+
+	if (BootFile[0] == '\0') {
+		sprintf (default_filename, "/nfsroot/%02lX%02lX%02lX%02lX.img",
+			NetOurIP & 0xFF,
+			(NetOurIP >>  8) & 0xFF,
+			(NetOurIP >> 16) & 0xFF,
+			(NetOurIP >> 24) & 0xFF	);
+		strcpy (nfs_path, default_filename);
+
+		printf ("*** Warning: no boot file name; using '%s'\n",
+			nfs_path);
+	} else {
+		char *p=BootFile;
+
+		p = strchr (p, ':');
+
+		if (p != NULL) {
+			NfsServerIP = string_to_ip (BootFile);
+			++p;
+			strcpy (nfs_path, p);
+		} else {
+			strcpy (nfs_path, BootFile);
+		}
+	}
+
+	nfs_filename = basename (nfs_path);
+	nfs_path     = dirname (nfs_path);
+
+#if defined(CONFIG_NET_MULTI)
+	printf ("Using %s device\n", eth_get_name());
+#endif
+
+	puts ("File transfer via NFS from server "); print_IPaddr (NfsServerIP);
+	puts ("; our IP address is ");		    print_IPaddr (NetOurIP);
+
+	/* Check if we need to send across this subnet */
+	if (NetOurGatewayIP && NetOurSubnetMask) {
+		IPaddr_t OurNet	    = NetOurIP	  & NetOurSubnetMask;
+		IPaddr_t ServerNet  = NetServerIP & NetOurSubnetMask;
+
+		if (OurNet != ServerNet) {
+			puts ("; sending through gateway ");
+			print_IPaddr (NetOurGatewayIP) ;
+		}
+	}
+	printf ("\nFilename '%s/%s'.", nfs_path, nfs_filename);
+
+	if (NetBootFileSize) {
+		printf (" Size is 0x%x Bytes = ", NetBootFileSize<<9);
+		print_size (NetBootFileSize<<9, "");
+	}
+	printf ("\nLoad address: 0x%lx\n"
+		"Loading: *\b", load_addr);
+
+	NetSetTimeout (NFS_TIMEOUT * CFG_HZ, NfsTimeout);
+	NetSetHandler (NfsHandler);
+
+	NfsTimeoutCount = 0;
+	NfsState = STATE_PRCLOOKUP_PROG_MOUNT_REQ;
+
+	/*NfsOurPort = 4096 + (get_ticks() % 3072);*/
+	/*FIX ME !!!*/
+	NfsOurPort = 1000;
+
+	/* zero out server ether in case the server ip has changed */
+	memset (NetServerEther, 0, 6);
+
+	NfsSend ();
+}
+
+#endif /* CONFIG_COMMANDS & CFG_CMD_NFS */
diff --git a/package/uboot-ifxmips/files/net/tftp_danube.c b/package/uboot-ifxmips/files/net/tftp_danube.c
new file mode 100644
index 0000000..f3a5471
--- /dev/null
+++ b/package/uboot-ifxmips/files/net/tftp_danube.c
@@ -0,0 +1,389 @@
+/*
+ *	Copyright 1994, 1995, 2000 Neil Russell.
+ *	(See License)
+ *	Copyright 2000, 2001 DENX Software Engineering, Wolfgang Denk, wd@denx.de
+ */
+
+#include <common.h>
+#include <command.h>
+#include <net.h>
+#include "tftp.h"
+#include "bootp.h"
+
+#undef	ET_DEBUG
+
+#if (CONFIG_COMMANDS & CFG_CMD_NET)
+
+#define WELL_KNOWN_PORT	69		/* Well known TFTP port #		*/
+#define TIMEOUT		5		/* Seconds to timeout for a lost pkt	*/
+#ifndef	CONFIG_NET_RETRY_COUNT
+# define TIMEOUT_COUNT	10		/* # of timeouts before giving up  */
+#else
+# define TIMEOUT_COUNT  (CONFIG_NET_RETRY_COUNT * 2)
+#endif
+					/* (for checking the image size)	*/
+#define HASHES_PER_LINE	65		/* Number of "loading" hashes per line	*/
+
+/*
+ *	TFTP operations.
+ */
+#define TFTP_RRQ	1
+#define TFTP_WRQ	2
+#define TFTP_DATA	3
+#define TFTP_ACK	4
+#define TFTP_ERROR	5
+#define TFTP_OACK	6
+
+
+static int	TftpServerPort;		/* The UDP port at their end		*/
+static int	TftpOurPort;		/* The UDP port at our end		*/
+static int	TftpTimeoutCount;
+static ulong	TftpBlock;		/* packet sequence number		*/
+static ulong	TftpLastBlock;		/* last packet sequence number received */
+static ulong	TftpBlockWrap;		/* count of sequence number wraparounds */
+static ulong	TftpBlockWrapOffset;	/* memory offset due to wrapping	*/
+static int	TftpState;
+
+#define STATE_RRQ	1
+#define STATE_DATA	2
+#define STATE_TOO_LARGE	3
+#define STATE_BAD_MAGIC	4
+#define STATE_OACK	5
+
+#define TFTP_BLOCK_SIZE		512		    /* default TFTP block size	*/
+#define TFTP_SEQUENCE_SIZE	((ulong)(1<<16))    /* sequence number is 16 bit */
+
+#define DEFAULT_NAME_LEN	(8 + 4 + 1)
+static char default_filename[DEFAULT_NAME_LEN];
+static char *tftp_filename;
+
+#ifdef CFG_DIRECT_FLASH_TFTP
+extern flash_info_t flash_info[];
+#endif
+
+static __inline__ void
+store_block (unsigned block, uchar * src, unsigned len)
+{
+	ulong offset = block * TFTP_BLOCK_SIZE + TftpBlockWrapOffset;
+	ulong newsize = offset + len;
+#ifdef CFG_DIRECT_FLASH_TFTP
+	int i, rc = 0;
+
+	for (i=0; i<CFG_MAX_FLASH_BANKS; i++) {
+		/* start address in flash? */
+		if (load_addr + offset >= flash_info[i].start[0]) {
+			rc = 1;
+			break;
+		}
+	}
+
+	if (rc) { /* Flash is destination for this packet */
+		rc = flash_write ((char *)src, (ulong)(load_addr+offset), len);
+		if (rc) {
+			flash_perror (rc);
+			NetState = NETLOOP_FAIL;
+			return;
+		}
+	}
+	else
+#endif /* CFG_DIRECT_FLASH_TFTP */
+	{
+		(void)memcpy((void *)(load_addr + offset), src, len);
+	}
+
+	if (NetBootFileXferSize < newsize)
+		NetBootFileXferSize = newsize;
+}
+
+static void TftpSend (void);
+static void TftpTimeout (void);
+
+/**********************************************************************/
+
+static void
+TftpSend (void)
+{
+	volatile uchar *	pkt;
+	volatile uchar *	xp;
+	int			len = 0;
+	volatile ushort *s;
+
+	/*
+	 *	We will always be sending some sort of packet, so
+	 *	cobble together the packet headers now.
+	 */
+	pkt = NetTxPacket + NetEthHdrSize() + IP_HDR_SIZE;
+
+	switch (TftpState) {
+
+	case STATE_RRQ:
+		xp = pkt;
+		s = (ushort *)pkt;
+		*s++ = htons(TFTP_RRQ);
+		pkt = (uchar *)s;
+		strcpy ((char *)pkt, tftp_filename);
+		pkt += strlen(tftp_filename) + 1;
+		strcpy ((char *)pkt, "octet");
+		pkt += 5 /*strlen("octet")*/ + 1;
+		strcpy ((char *)pkt, "timeout");
+		pkt += 7 /*strlen("timeout")*/ + 1;
+		sprintf((char *)pkt, "%d", TIMEOUT);
+#ifdef ET_DEBUG
+		printf("send option \"timeout %s\"\n", (char *)pkt);
+#endif
+		pkt += strlen((char *)pkt) + 1;
+		len = pkt - xp;
+		break;
+
+	case STATE_DATA:
+	case STATE_OACK:
+		xp = pkt;
+		s = (ushort *)pkt;
+		*s++ = htons(TFTP_ACK);
+		*s++ = htons(TftpBlock);
+		pkt = (uchar *)s;
+		len = pkt - xp;
+		break;
+
+	case STATE_TOO_LARGE:
+		xp = pkt;
+		s = (ushort *)pkt;
+		*s++ = htons(TFTP_ERROR);
+		*s++ = htons(3);
+		pkt = (uchar *)s;
+		strcpy ((char *)pkt, "File too large");
+		pkt += 14 /*strlen("File too large")*/ + 1;
+		len = pkt - xp;
+		break;
+
+	case STATE_BAD_MAGIC:
+		xp = pkt;
+		s = (ushort *)pkt;
+		*s++ = htons(TFTP_ERROR);
+		*s++ = htons(2);
+		pkt = (uchar *)s;
+		strcpy ((char *)pkt, "File has bad magic");
+		pkt += 18 /*strlen("File has bad magic")*/ + 1;
+		len = pkt - xp;
+		break;
+	}
+
+	NetSendUDPPacket(NetServerEther, NetServerIP, TftpServerPort, TftpOurPort, len);
+}
+
+
+static void
+TftpHandler (uchar * pkt, unsigned dest, unsigned src, unsigned len)
+{
+	ushort proto;
+	ushort *s;
+
+	if (dest != TftpOurPort) {
+		return;
+	}
+	if (TftpState != STATE_RRQ && src != TftpServerPort) {
+		return;
+	}
+
+	if (len < 2) {
+		return;
+	}
+	len -= 2;
+	/* warning: don't use increment (++) in ntohs() macros!! */
+	s = (ushort *)pkt;
+	proto = *s++;
+	pkt = (uchar *)s;
+	switch (ntohs(proto)) {
+
+	case TFTP_RRQ:
+	case TFTP_WRQ:
+	case TFTP_ACK:
+		break;
+	default:
+		break;
+
+	case TFTP_OACK:
+#ifdef ET_DEBUG
+		printf("Got OACK: %s %s\n", pkt, pkt+strlen(pkt)+1);
+#endif
+		TftpState = STATE_OACK;
+		TftpServerPort = src;
+		TftpSend (); /* Send ACK */
+		break;
+	case TFTP_DATA:
+		if (len < 2)
+			return;
+		len -= 2;
+		TftpBlock = ntohs(*(ushort *)pkt);
+
+		/*
+		 * RFC1350 specifies that the first data packet will
+		 * have sequence number 1. If we receive a sequence
+		 * number of 0 this means that there was a wrap
+		 * around of the (16 bit) counter.
+		 */
+		if (TftpBlock == 0) {
+			TftpBlockWrap++;
+			TftpBlockWrapOffset += TFTP_BLOCK_SIZE * TFTP_SEQUENCE_SIZE;
+			printf ("\n\t %lu MB received\n\t ", TftpBlockWrapOffset>>20);
+		} else {
+			if (((TftpBlock - 1) % 10) == 0) {
+				putc ('#');
+			} else if ((TftpBlock % (10 * HASHES_PER_LINE)) == 0) {
+				puts ("\n\t ");
+			}
+		}
+
+#ifdef ET_DEBUG
+		if (TftpState == STATE_RRQ) {
+			puts ("Server did not acknowledge timeout option!\n");
+		}
+#endif
+
+		if (TftpState == STATE_RRQ || TftpState == STATE_OACK) {
+			/* first block received */
+			TftpState = STATE_DATA;
+			TftpServerPort = src;
+			TftpLastBlock = 0;
+			TftpBlockWrap = 0;
+			TftpBlockWrapOffset = 0;
+
+			if (TftpBlock != 1) {	/* Assertion */
+				printf ("\nTFTP error: "
+					"First block is not block 1 (%ld)\n"
+					"Starting again\n\n",
+					TftpBlock);
+				NetStartAgain ();
+				break;
+			}
+		}
+
+		if (TftpBlock == TftpLastBlock) {
+			/*
+			 *	Same block again; ignore it.
+			 */
+			break;
+		}
+
+		TftpLastBlock = TftpBlock;
+		NetSetTimeout (TIMEOUT * CFG_HZ, TftpTimeout);
+
+		store_block (TftpBlock - 1, pkt + 2, len);
+
+		/*
+		 *	Acknoledge the block just received, which will prompt
+		 *	the server for the next one.
+		 */
+		TftpSend ();
+
+		if (len < TFTP_BLOCK_SIZE) {
+			/*
+			 *	We received the whole thing.  Try to
+			 *	run it.
+			 */
+			puts ("\ndone\n");
+			NetState = NETLOOP_SUCCESS;
+		}
+		break;
+
+	case TFTP_ERROR:
+		printf ("\nTFTP error: '%s' (%d)\n",
+					pkt + 2, ntohs(*(ushort *)pkt));
+		puts ("Starting again\n\n");
+		NetStartAgain ();
+		break;
+	}
+}
+
+
+static void
+TftpTimeout (void)
+{
+	if (++TftpTimeoutCount > TIMEOUT_COUNT) {
+		puts ("\nRetry count exceeded; starting again\n");
+		NetStartAgain ();
+	} else {
+		puts ("T ");
+		NetSetTimeout (TIMEOUT * CFG_HZ, TftpTimeout);
+		TftpSend ();
+	}
+}
+
+
+void
+TftpStart (void)
+{
+#ifdef CONFIG_TFTP_PORT
+	char *ep;             /* Environment pointer */
+#endif
+
+	if (BootFile[0] == '\0') {
+		sprintf(default_filename, "%02lX%02lX%02lX%02lX.img",
+			NetOurIP & 0xFF,
+			(NetOurIP >>  8) & 0xFF,
+			(NetOurIP >> 16) & 0xFF,
+			(NetOurIP >> 24) & 0xFF	);
+		tftp_filename = default_filename;
+
+		printf ("*** Warning: no boot file name; using '%s'\n",
+			tftp_filename);
+	} else {
+		tftp_filename = BootFile;
+	}
+
+#if defined(CONFIG_NET_MULTI)
+	printf ("Using %s device\n", eth_get_name());
+#endif
+	puts ("TFTP from server ");	print_IPaddr (NetServerIP);
+	puts ("; our IP address is ");	print_IPaddr (NetOurIP);
+
+	/* Check if we need to send across this subnet */
+	if (NetOurGatewayIP && NetOurSubnetMask) {
+	    IPaddr_t OurNet 	= NetOurIP    & NetOurSubnetMask;
+	    IPaddr_t ServerNet 	= NetServerIP & NetOurSubnetMask;
+
+	    if (OurNet != ServerNet) {
+		puts ("; sending through gateway ");
+		print_IPaddr (NetOurGatewayIP) ;
+	    }
+	}
+	putc ('\n');
+
+	printf ("Filename '%s'.", tftp_filename);
+
+	if (NetBootFileSize) {
+		printf (" Size is 0x%x Bytes = ", NetBootFileSize<<9);
+		print_size (NetBootFileSize<<9, "");
+	}
+
+	putc ('\n');
+
+	printf ("Load address: 0x%lx\n", load_addr);
+
+	puts ("Loading: *\b");
+
+	NetSetTimeout (TIMEOUT * CFG_HZ, TftpTimeout);
+	NetSetHandler (TftpHandler);
+
+	TftpServerPort = WELL_KNOWN_PORT;
+	TftpTimeoutCount = 0;
+	TftpState = STATE_RRQ;
+	/* Use a pseudo-random port unless a specific port is set */
+	TftpOurPort = 1024 + (get_timer(0) % 3072);
+#ifdef CONFIG_TFTP_PORT
+	if ((ep = getenv("tftpdstp")) != NULL) {
+		TftpServerPort = simple_strtol(ep, NULL, 10);
+	}
+	if ((ep = getenv("tftpsrcp")) != NULL) {
+		TftpOurPort= simple_strtol(ep, NULL, 10);
+	}
+#endif
+	TftpBlock = 0;
+
+	/* zero out server ether in case the server ip has changed */
+	memset(NetServerEther, 0, 6);
+
+	TftpSend ();
+}
+
+#endif /* CFG_CMD_NET */
diff --git a/package/uboot-ifxmips/files/tools/crc32_danube.c b/package/uboot-ifxmips/files/tools/crc32_danube.c
new file mode 100644
index 0000000..3d99b69
--- /dev/null
+++ b/package/uboot-ifxmips/files/tools/crc32_danube.c
@@ -0,0 +1,198 @@
+/*
+ * This file is derived from crc32.c from the zlib-1.1.3 distribution
+ * by Jean-loup Gailly and Mark Adler.
+ */
+
+/* crc32.c -- compute the CRC-32 of a data stream
+ * Copyright (C) 1995-1998 Mark Adler
+ * For conditions of distribution and use, see copyright notice in zlib.h
+ */
+
+#ifndef USE_HOSTCC	/* Shut down "ANSI does not permit..." warnings */
+#include <common.h>	/* to get command definitions like CFG_CMD_JFFS2 */
+#endif
+
+#include "zlib.h"
+
+#define local static
+#define ZEXPORT	/* empty */
+unsigned long crc32 (unsigned long, const unsigned char *, unsigned int);
+
+#ifdef DYNAMIC_CRC_TABLE
+
+local int crc_table_empty = 1;
+local uLongf crc_table[256];
+local void make_crc_table OF((void));
+
+/*
+  Generate a table for a byte-wise 32-bit CRC calculation on the polynomial:
+  x^32+x^26+x^23+x^22+x^16+x^12+x^11+x^10+x^8+x^7+x^5+x^4+x^2+x+1.
+
+  Polynomials over GF(2) are represented in binary, one bit per coefficient,
+  with the lowest powers in the most significant bit.  Then adding polynomials
+  is just exclusive-or, and multiplying a polynomial by x is a right shift by
+  one.  If we call the above polynomial p, and represent a byte as the
+  polynomial q, also with the lowest power in the most significant bit (so the
+  byte 0xb1 is the polynomial x^7+x^3+x+1), then the CRC is (q*x^32) mod p,
+  where a mod b means the remainder after dividing a by b.
+
+  This calculation is done using the shift-register method of multiplying and
+  taking the remainder.  The register is initialized to zero, and for each
+  incoming bit, x^32 is added mod p to the register if the bit is a one (where
+  x^32 mod p is p+x^32 = x^26+...+1), and the register is multiplied mod p by
+  x (which is shifting right by one and adding x^32 mod p if the bit shifted
+  out is a one).  We start with the highest power (least significant bit) of
+  q and repeat for all eight bits of q.
+
+  The table is simply the CRC of all possible eight bit values.  This is all
+  the information needed to generate CRC's on data a byte at a time for all
+  combinations of CRC register values and incoming bytes.
+*/
+local void make_crc_table()
+{
+  uLong c;
+  int n, k;
+  uLong poly;            /* polynomial exclusive-or pattern */
+  /* terms of polynomial defining this crc (except x^32): */
+  static const Byte p[] = {0,1,2,4,5,7,8,10,11,12,16,22,23,26};
+
+  /* make exclusive-or pattern from polynomial (0xedb88320L) */
+  poly = 0L;
+  for (n = 0; n < sizeof(p)/sizeof(Byte); n++)
+    poly |= 1L << (31 - p[n]);
+
+  for (n = 0; n < 256; n++)
+  {
+    c = (uLong)n;
+    for (k = 0; k < 8; k++)
+      c = c & 1 ? poly ^ (c >> 1) : c >> 1;
+    crc_table[n] = c;
+  }
+  crc_table_empty = 0;
+}
+#else
+/* ========================================================================
+ * Table of CRC-32's of all single-byte values (made by make_crc_table)
+ */
+local const uLongf crc_table[256] = {
+  0x00000000L, 0x77073096L, 0xee0e612cL, 0x990951baL, 0x076dc419L,
+  0x706af48fL, 0xe963a535L, 0x9e6495a3L, 0x0edb8832L, 0x79dcb8a4L,
+  0xe0d5e91eL, 0x97d2d988L, 0x09b64c2bL, 0x7eb17cbdL, 0xe7b82d07L,
+  0x90bf1d91L, 0x1db71064L, 0x6ab020f2L, 0xf3b97148L, 0x84be41deL,
+  0x1adad47dL, 0x6ddde4ebL, 0xf4d4b551L, 0x83d385c7L, 0x136c9856L,
+  0x646ba8c0L, 0xfd62f97aL, 0x8a65c9ecL, 0x14015c4fL, 0x63066cd9L,
+  0xfa0f3d63L, 0x8d080df5L, 0x3b6e20c8L, 0x4c69105eL, 0xd56041e4L,
+  0xa2677172L, 0x3c03e4d1L, 0x4b04d447L, 0xd20d85fdL, 0xa50ab56bL,
+  0x35b5a8faL, 0x42b2986cL, 0xdbbbc9d6L, 0xacbcf940L, 0x32d86ce3L,
+  0x45df5c75L, 0xdcd60dcfL, 0xabd13d59L, 0x26d930acL, 0x51de003aL,
+  0xc8d75180L, 0xbfd06116L, 0x21b4f4b5L, 0x56b3c423L, 0xcfba9599L,
+  0xb8bda50fL, 0x2802b89eL, 0x5f058808L, 0xc60cd9b2L, 0xb10be924L,
+  0x2f6f7c87L, 0x58684c11L, 0xc1611dabL, 0xb6662d3dL, 0x76dc4190L,
+  0x01db7106L, 0x98d220bcL, 0xefd5102aL, 0x71b18589L, 0x06b6b51fL,
+  0x9fbfe4a5L, 0xe8b8d433L, 0x7807c9a2L, 0x0f00f934L, 0x9609a88eL,
+  0xe10e9818L, 0x7f6a0dbbL, 0x086d3d2dL, 0x91646c97L, 0xe6635c01L,
+  0x6b6b51f4L, 0x1c6c6162L, 0x856530d8L, 0xf262004eL, 0x6c0695edL,
+  0x1b01a57bL, 0x8208f4c1L, 0xf50fc457L, 0x65b0d9c6L, 0x12b7e950L,
+  0x8bbeb8eaL, 0xfcb9887cL, 0x62dd1ddfL, 0x15da2d49L, 0x8cd37cf3L,
+  0xfbd44c65L, 0x4db26158L, 0x3ab551ceL, 0xa3bc0074L, 0xd4bb30e2L,
+  0x4adfa541L, 0x3dd895d7L, 0xa4d1c46dL, 0xd3d6f4fbL, 0x4369e96aL,
+  0x346ed9fcL, 0xad678846L, 0xda60b8d0L, 0x44042d73L, 0x33031de5L,
+  0xaa0a4c5fL, 0xdd0d7cc9L, 0x5005713cL, 0x270241aaL, 0xbe0b1010L,
+  0xc90c2086L, 0x5768b525L, 0x206f85b3L, 0xb966d409L, 0xce61e49fL,
+  0x5edef90eL, 0x29d9c998L, 0xb0d09822L, 0xc7d7a8b4L, 0x59b33d17L,
+  0x2eb40d81L, 0xb7bd5c3bL, 0xc0ba6cadL, 0xedb88320L, 0x9abfb3b6L,
+  0x03b6e20cL, 0x74b1d29aL, 0xead54739L, 0x9dd277afL, 0x04db2615L,
+  0x73dc1683L, 0xe3630b12L, 0x94643b84L, 0x0d6d6a3eL, 0x7a6a5aa8L,
+  0xe40ecf0bL, 0x9309ff9dL, 0x0a00ae27L, 0x7d079eb1L, 0xf00f9344L,
+  0x8708a3d2L, 0x1e01f268L, 0x6906c2feL, 0xf762575dL, 0x806567cbL,
+  0x196c3671L, 0x6e6b06e7L, 0xfed41b76L, 0x89d32be0L, 0x10da7a5aL,
+  0x67dd4accL, 0xf9b9df6fL, 0x8ebeeff9L, 0x17b7be43L, 0x60b08ed5L,
+  0xd6d6a3e8L, 0xa1d1937eL, 0x38d8c2c4L, 0x4fdff252L, 0xd1bb67f1L,
+  0xa6bc5767L, 0x3fb506ddL, 0x48b2364bL, 0xd80d2bdaL, 0xaf0a1b4cL,
+  0x36034af6L, 0x41047a60L, 0xdf60efc3L, 0xa867df55L, 0x316e8eefL,
+  0x4669be79L, 0xcb61b38cL, 0xbc66831aL, 0x256fd2a0L, 0x5268e236L,
+  0xcc0c7795L, 0xbb0b4703L, 0x220216b9L, 0x5505262fL, 0xc5ba3bbeL,
+  0xb2bd0b28L, 0x2bb45a92L, 0x5cb36a04L, 0xc2d7ffa7L, 0xb5d0cf31L,
+  0x2cd99e8bL, 0x5bdeae1dL, 0x9b64c2b0L, 0xec63f226L, 0x756aa39cL,
+  0x026d930aL, 0x9c0906a9L, 0xeb0e363fL, 0x72076785L, 0x05005713L,
+  0x95bf4a82L, 0xe2b87a14L, 0x7bb12baeL, 0x0cb61b38L, 0x92d28e9bL,
+  0xe5d5be0dL, 0x7cdcefb7L, 0x0bdbdf21L, 0x86d3d2d4L, 0xf1d4e242L,
+  0x68ddb3f8L, 0x1fda836eL, 0x81be16cdL, 0xf6b9265bL, 0x6fb077e1L,
+  0x18b74777L, 0x88085ae6L, 0xff0f6a70L, 0x66063bcaL, 0x11010b5cL,
+  0x8f659effL, 0xf862ae69L, 0x616bffd3L, 0x166ccf45L, 0xa00ae278L,
+  0xd70dd2eeL, 0x4e048354L, 0x3903b3c2L, 0xa7672661L, 0xd06016f7L,
+  0x4969474dL, 0x3e6e77dbL, 0xaed16a4aL, 0xd9d65adcL, 0x40df0b66L,
+  0x37d83bf0L, 0xa9bcae53L, 0xdebb9ec5L, 0x47b2cf7fL, 0x30b5ffe9L,
+  0xbdbdf21cL, 0xcabac28aL, 0x53b39330L, 0x24b4a3a6L, 0xbad03605L,
+  0xcdd70693L, 0x54de5729L, 0x23d967bfL, 0xb3667a2eL, 0xc4614ab8L,
+  0x5d681b02L, 0x2a6f2b94L, 0xb40bbe37L, 0xc30c8ea1L, 0x5a05df1bL,
+  0x2d02ef8dL
+};
+#endif
+
+#if 0
+/* =========================================================================
+ * This function can be used by asm versions of crc32()
+ */
+const uLongf * ZEXPORT get_crc_table()
+{
+#ifdef DYNAMIC_CRC_TABLE
+  if (crc_table_empty) make_crc_table();
+#endif
+  return (const uLongf *)crc_table;
+}
+#endif
+
+/* ========================================================================= */
+#define DO1(buf) crc = crc_table[((int)crc ^ (*buf++)) & 0xff] ^ (crc >> 8);
+#define DO2(buf)  DO1(buf); DO1(buf);
+#define DO4(buf)  DO2(buf); DO2(buf);
+#define DO8(buf)  DO4(buf); DO4(buf);
+
+/* ========================================================================= */
+uLong ZEXPORT crc32(crc, buf, len)
+    uLong crc;
+    const Bytef *buf;
+    uInt len;
+{
+#ifdef DYNAMIC_CRC_TABLE
+    if (crc_table_empty)
+      make_crc_table();
+#endif
+    crc = crc ^ 0xffffffffL;
+    while (len >= 8)
+    {
+      DO8(buf);
+      len -= 8;
+    }
+    if (len) do {
+      DO1(buf);
+    } while (--len);
+    return crc ^ 0xffffffffL;
+}
+
+#if (CONFIG_COMMANDS & CFG_CMD_JFFS2) || \
+	((CONFIG_COMMANDS & CFG_CMD_NAND) && !defined(CFG_NAND_LEGACY))
+
+/* No ones complement version. JFFS2 (and other things ?)
+ * don't use ones compliment in their CRC calculations.
+ */
+uLong ZEXPORT crc32_no_comp(uLong crc, const Bytef *buf, uInt len)
+{
+#ifdef DYNAMIC_CRC_TABLE
+    if (crc_table_empty)
+      make_crc_table();
+#endif
+    while (len >= 8)
+    {
+      DO8(buf);
+      len -= 8;
+    }
+    if (len) do {
+      DO1(buf);
+    } while (--len);
+
+    return crc;
+}
+
+#endif	/* CFG_CMD_JFFS2 */
diff --git a/package/uboot-ifxmips/files/tools/environment_danube.c b/package/uboot-ifxmips/files/tools/environment_danube.c
new file mode 100644
index 0000000..19bdeb0
--- /dev/null
+++ b/package/uboot-ifxmips/files/tools/environment_danube.c
@@ -0,0 +1,213 @@
+/*
+ * (C) Copyright 2001
+ * Erik Theisen,  Wave 7 Optics, etheisen@mindspring.com.
+ *
+ * See file CREDITS for list of people who contributed to this
+ * project.
+ *
+ * This program is free software; you can redistribute it and/or
+ * modify it under the terms of the GNU General Public License as
+ * published by the Free Software Foundation; either version 2 of
+ * the License, or (at your option) any later version.
+ *
+ * This program is distributed in the hope that it will be useful,
+ * but WITHOUT ANY WARRANTY; without even the implied warranty of
+ * MERCHANTABILITY or FITNESS FOR A PARTICULAR PURPOSE.	 See the
+ * GNU General Public License for more details.
+ *
+ * You should have received a copy of the GNU General Public License
+ * along with this program; if not, write to the Free Software
+ * Foundation, Inc., 59 Temple Place, Suite 330, Boston,
+ * MA 02111-1307 USA
+ */
+
+#ifndef __ASSEMBLY__
+#define	__ASSEMBLY__			/* Dirty trick to get only #defines	*/
+#endif
+#define	__ASM_STUB_PROCESSOR_H__	/* don't include asm/processor.		*/
+#include <config.h>
+#undef	__ASSEMBLY__
+#include <environment.h>
+
+/*
+ * Handle HOSTS that have prepended
+ * crap on symbol names, not TARGETS.
+ */
+#if defined(__APPLE__)
+/* Leading underscore on symbols */
+#  define SYM_CHAR "_"
+#else /* No leading character on symbols */
+#  define SYM_CHAR
+#endif
+
+/*
+ * Generate embedded environment table
+ * inside U-Boot image, if needed.
+ */
+#if defined(ENV_IS_EMBEDDED)
+/*
+ * Only put the environment in it's own section when we are building
+ * U-Boot proper.  The host based program "tools/envcrc" does not need
+ * a seperate section.  Note that ENV_CRC is only defined when building
+ * U-Boot itself.
+ */
+#if (defined(CONFIG_CMI)	|| \
+     defined(CONFIG_FADS)	|| \
+     defined(CONFIG_HYMOD)	|| \
+     defined(CONFIG_ICU862)	|| \
+     defined(CONFIG_R360MPI)	|| \
+     defined(CONFIG_TQM8xxL)	|| \
+     defined(CONFIG_RRVISION)	|| \
+     defined(CONFIG_TRAB)   	|| \
+     defined(CONFIG_PPCHAMELEONEVB) || \
+     defined(CONFIG_M5271EVB)	|| \
+     defined(CONFIG_NAND_U_BOOT))	&& \
+     defined(ENV_CRC) /* Environment embedded in U-Boot .ppcenv section */
+/* XXX - This only works with GNU C */
+#  define __PPCENV__ __attribute__ ((section(".ppcenv")))
+#  define __PPCTEXT__ __attribute__ ((section(".text")))
+
+#elif defined(USE_HOSTCC) /* Native for 'tools/envcrc' */
+#  define __PPCENV__ /*XXX DO_NOT_DEL_THIS_COMMENT*/
+#  define __PPCTEXT__ /*XXX DO_NOT_DEL_THIS_COMMENT*/
+
+#else /* Environment is embedded in U-Boot's .text section */
+/* XXX - This only works with GNU C */
+#  define __PPCENV__ __attribute__ ((section(".text")))
+#  define __PPCTEXT__ __attribute__ ((section(".text")))
+#endif
+
+/*
+ * Macros to generate global absolutes.
+ */
+#define GEN_SYMNAME(str) SYM_CHAR #str
+#define GEN_VALUE(str) #str
+#define GEN_ABS(name, value) \
+		asm (".globl " GEN_SYMNAME(name)); \
+		asm (GEN_SYMNAME(name) " = " GEN_VALUE(value))
+
+/*
+ * Macros to transform values
+ * into environment strings.
+ */
+#define XMK_STR(x)	#x
+#define MK_STR(x)	XMK_STR(x)
+
+/*
+ * Check to see if we are building with a
+ * computed CRC.  Otherwise define it as ~0.
+ */
+#if !defined(ENV_CRC)
+#  define ENV_CRC	~0
+#endif
+
+env_t environment __PPCENV__ = {
+	ENV_CRC,	/* CRC Sum */
+#ifdef CFG_REDUNDAND_ENVIRONMENT
+	1,		/* Flags: valid */
+#endif
+	{
+#if defined(CONFIG_BOOTARGS)
+	"bootargs="	CONFIG_BOOTARGS			"\0"
+#endif
+#if defined(CONFIG_BOOTCOMMAND)
+	"bootcmd="	CONFIG_BOOTCOMMAND		"\0"
+#endif
+#if defined(CONFIG_RAMBOOTCOMMAND)
+	"ramboot="	CONFIG_RAMBOOTCOMMAND		"\0"
+#endif
+#if defined(CONFIG_NFSBOOTCOMMAND)
+	"nfsboot="	CONFIG_NFSBOOTCOMMAND		"\0"
+#endif
+#if defined(CONFIG_BOOTDELAY) && (CONFIG_BOOTDELAY >= 0)
+	"bootdelay="	MK_STR(CONFIG_BOOTDELAY)	"\0"
+#endif
+#if defined(CONFIG_BAUDRATE) && (CONFIG_BAUDRATE >= 0)
+	"baudrate="	MK_STR(CONFIG_BAUDRATE)		"\0"
+#endif
+#ifdef	CONFIG_LOADS_ECHO
+	"loads_echo="	MK_STR(CONFIG_LOADS_ECHO)	"\0"
+#endif
+#ifdef	CONFIG_ETHADDR
+	"ethaddr="	MK_STR(CONFIG_ETHADDR)		"\0"
+#endif
+#ifdef	CONFIG_ETH1ADDR
+	"eth1addr="	MK_STR(CONFIG_ETH1ADDR)		"\0"
+#endif
+#ifdef	CONFIG_ETH2ADDR
+	"eth2addr="	MK_STR(CONFIG_ETH2ADDR)		"\0"
+#endif
+#ifdef	CONFIG_ETH3ADDR
+	"eth3addr="	MK_STR(CONFIG_ETH3ADDR)		"\0"
+#endif
+#ifdef	CONFIG_ETHPRIME
+	"ethprime="	CONFIG_ETHPRIME			"\0"
+#endif
+#ifdef	CONFIG_IPADDR
+	"ipaddr="	MK_STR(CONFIG_IPADDR)		"\0"
+#endif
+#ifdef	CONFIG_SERVERIP
+	"serverip="	MK_STR(CONFIG_SERVERIP)		"\0"
+#endif
+#ifdef	CFG_AUTOLOAD
+	"autoload="	CFG_AUTOLOAD			"\0"
+#endif
+#ifdef	CONFIG_ROOTPATH
+	"rootpath="	MK_STR(CONFIG_ROOTPATH)		"\0"
+#endif
+#ifdef	CONFIG_GATEWAYIP
+	"gatewayip="	MK_STR(CONFIG_GATEWAYIP)	"\0"
+#endif
+#ifdef	CONFIG_NETMASK
+	"netmask="	MK_STR(CONFIG_NETMASK)		"\0"
+#endif
+#ifdef	CONFIG_HOSTNAME
+	"hostname="	MK_STR(CONFIG_HOSTNAME)		"\0"
+#endif
+#ifdef	CONFIG_BOOTFILE
+	"bootfile="	MK_STR(CONFIG_BOOTFILE)		"\0"
+#endif
+#ifdef	CONFIG_LOADADDR
+	"loadaddr="	MK_STR(CONFIG_LOADADDR)		"\0"
+#endif
+#ifdef	CONFIG_PREBOOT
+	"preboot="	CONFIG_PREBOOT			"\0"
+#endif
+#ifdef	CONFIG_CLOCKS_IN_MHZ
+	"clocks_in_mhz=" "1"				"\0"
+#endif
+#if defined(CONFIG_PCI_BOOTDELAY) && (CONFIG_PCI_BOOTDELAY > 0)
+	"pcidelay="	MK_STR(CONFIG_PCI_BOOTDELAY)	"\0"
+#endif
+#ifdef  CONFIG_EXTRA_ENV_SETTINGS
+	CONFIG_EXTRA_ENV_SETTINGS
+#endif
+	"\0"		/* Term. env_t.data with 2 NULs */
+	}
+};
+#ifdef CFG_ENV_ADDR_REDUND
+env_t redundand_environment __PPCENV__ = {
+	0,		/* CRC Sum: invalid */
+	0,		/* Flags:   invalid */
+	{
+	"\0"
+	}
+};
+#endif	/* CFG_ENV_ADDR_REDUND */
+
+/*
+ * These will end up in the .text section
+ * if the environment strings are embedded
+ * in the image.  When this is used for
+ * tools/envcrc, they are placed in the
+ * .data/.sdata section.
+ *
+ */
+unsigned long env_size __PPCTEXT__ = sizeof(env_t);
+
+/*
+ * Add in absolutes.
+ */
+GEN_ABS(env_offset, CFG_ENV_OFFSET);
+
+#endif /* ENV_IS_EMBEDDED */
diff --git a/package/uboot-ifxmips/patches/100-ifx.patch b/package/uboot-ifxmips/patches/100-ifx.patch
new file mode 100644
index 0000000..ff1b511
--- /dev/null
+++ b/package/uboot-ifxmips/patches/100-ifx.patch
@@ -0,0 +1,1830 @@
+diff -urN u-boot-1.1.5.a/Makefile u-boot/Makefile
+--- u-boot-1.1.5.a/Makefile	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/Makefile	2008-05-11 14:14:55.000000000 +0100
+@@ -24,7 +24,7 @@
+ VERSION = 1
+ PATCHLEVEL = 1
+ SUBLEVEL = 5
+-EXTRAVERSION =
++EXTRAVERSION = -IFX-LXDB
+ U_BOOT_VERSION = $(VERSION).$(PATCHLEVEL).$(SUBLEVEL)$(EXTRAVERSION)
+ VERSION_FILE = $(obj)include/version_autogenerated.h
+ 
+@@ -44,6 +44,25 @@
+ # Deal with colliding definitions from tcsh etc.
+ VENDOR=
+ 
++# Default algorithm form compressing u-boot.bin
++ifndef COMPRESS
++COMPRESS=none
++COMPRESS_FILE=$(obj)u-boot.img
++else
++ifeq ($(COMPRESS),lzma)
++COMPRESS_FILE=$(obj)u-boot.limg
++endif
++ifeq ($(COMPRESS),bz2)
++COMPRESS_FILE=$(obj)u-boot.bzimg
++endif
++ifeq ($(COMPRESS),gzip)
++COMPRESS_FILE=$(obj)u-boot.zimg
++endif
++ifeq ($(COMPRESS),none)
++COMPRESS_FILE=$(obj)u-boot.img
++endif
++endif
++
+ #########################################################################
+ #
+ # U-boot build supports producing a object files to the separate external
+@@ -155,6 +174,11 @@
+ endif
+ endif
+ 
++
++
++
++
++
+ export	CROSS_COMPILE
+ 
+ # load other configuration
+@@ -163,7 +187,9 @@
+ #########################################################################
+ # U-Boot objects....order is important (i.e. start must be first)
+ 
+-OBJS  = cpu/$(CPU)/start.o
++OBJS  = cpu/$(CPU)/$(BOARDDIR)/start.o
++OBJS_BOOTSTRAP  = cpu/$(CPU)/$(BOARDDIR)/start_bootstrap.o
++
+ ifeq ($(CPU),i386)
+ OBJS += cpu/$(CPU)/start16.o
+ OBJS += cpu/$(CPU)/reset.o
+@@ -186,11 +212,11 @@
+ 
+ LIBS  = lib_generic/libgeneric.a
+ LIBS += board/$(BOARDDIR)/lib$(BOARD).a
+-LIBS += cpu/$(CPU)/lib$(CPU).a
++LIBS += cpu/$(CPU)/$(BOARDDIR)/lib$(CPU).a
+ ifdef SOC
+ LIBS += cpu/$(CPU)/$(SOC)/lib$(SOC).a
+ endif
+-LIBS += lib_$(ARCH)/lib$(ARCH).a
++LIBS += lib_$(ARCH)/$(BOARDIR)/lib$(ARCH).a
+ LIBS += fs/cramfs/libcramfs.a fs/fat/libfat.a fs/fdos/libfdos.a fs/jffs2/libjffs2.a \
+ 	fs/reiserfs/libreiserfs.a fs/ext2/libext2fs.a
+ LIBS += net/libnet.a
+@@ -198,27 +224,54 @@
+ LIBS += rtc/librtc.a
+ LIBS += dtt/libdtt.a
+ LIBS += drivers/libdrivers.a
+-LIBS += drivers/nand/libnand.a
+-LIBS += drivers/nand_legacy/libnand_legacy.a
++#LIBS += drivers/nand_$(BOARDDIR)/libnand.a
++#LIBS += drivers/nand_legacy/libnand_legacy.a
+ LIBS += drivers/sk98lin/libsk98lin.a
+ LIBS += post/libpost.a post/cpu/libcpu.a
+ LIBS += common/libcommon.a
+ LIBS += $(BOARDLIBS)
+ 
+ LIBS := $(addprefix $(obj),$(LIBS))
++
++
++LIBS_BOOTSTRAP  = lib_bootstrap/libbootstrap.a 
++LIBS_BOOTSTRAP+= board/$(BOARDDIR)/lib$(BOARD).a 
++#LIBS_BOOTSTRAP+= board/ifx/libifx.a 
++LIBS_BOOTSTRAP+= cpu/$(CPU)/$(BOARDDIR)/lib$(CPU).a
++
++#HEAD_OBJS = cpu/$(CPU)/$(BOARDDIR)/start.o lib_$(ARCH)/board.o
++
++#HEAD_LIBS  = board/$(BOARDDIR)/lib$(BOARD).a
++#HEAD_LIBS += cpu/$(CPU)/$(BOARDDIR)/lib$(CPU).a
++#HEAD_LIBS += lib_$(ARCH)/lib$(ARCH).a
++#HEAD_LIBS += lib_generic/libgeneric.a
++#HEAD_LIBS += common/console.o
++#HEAD_LIBS += common/devices.o
++#HEAD_LIBS += common/cmd_bootm.o
++
++#.PHONY : $(LIBS) $(HEAD_LIBS)
+ .PHONY : $(LIBS)
++.PHONY : $(LIBS_BOOTSTRAP)
+ 
+ # Add GCC lib
+ PLATFORM_LIBS += -L $(shell dirname `$(CC) $(CFLAGS) -print-libgcc-file-name`) -lgcc
+ 
+ # The "tools" are needed early, so put this first
+ # Don't include stuff already done in $(LIBS)
++	  #examples 
+ SUBDIRS	= tools \
+-	  examples \
+ 	  post \
+ 	  post/cpu
+ .PHONY : $(SUBDIRS)
+ 
++# HEAD_SUBDIRS = tools
++#HEAD_SUBDIRS = lib_generic \
++#	  cpu/$(CPU) \
++#	  board/$(BOARDDIR) \
++#	  common \
++#	  lib_$(ARCH)
++#.PHONY : $(HEAD_SUBDIRS)
++
+ ifeq ($(CONFIG_NAND_U_BOOT),y)
+ NAND_SPL = nand_spl
+ U_BOOT_NAND = $(obj)u-boot-nand.bin
+@@ -227,13 +280,76 @@
+ __OBJS := $(subst $(obj),,$(OBJS))
+ __LIBS := $(subst $(obj),,$(LIBS))
+ 
++#__HEAD_OBJS := $(subst $(obj),,$(HEAD_OBJS))
++#__HEAD_LIBS := $(subst $(obj),,$(HEAD_LIBS))
++
+ #########################################################################
+ #########################################################################
+ 
+ ALL = $(obj)u-boot.srec $(obj)u-boot.bin $(obj)System.map $(U_BOOT_NAND)
++#IFX_ALL = $(obj)u-boot.ifx $(obj)head.srec $(obj)head.bin $(obj)head $(obj)head.map $(COMPRESS_FILE) $(obj)u-boot.srec
++IFX_ALL = $(obj)u-boot.srec $(obj)u-boot.ifx $(obj)u-boot.lzimg $(obj)System.map $(obj)bootstrap.bin
+ 
+ all:		$(ALL)
+ 
++ifx_all:	$(IFX_ALL)
++
++
++$(obj)u-boot.ifx: $(obj)System.map $(obj)bootstrap.bin $(obj)u-boot.lzimg	
++		@cat $(obj)bootstrap.bin > $(obj)u-boot.ifx
++		@cat $(obj)u-boot.lzimg >> $(obj)u-boot.ifx
++
++$(obj)u-boot.lzimg: $(obj)u-boot.bin System.map
++#		@lzma -f -z --best -v $(obj)u-boot.bin
++		@lzma e $(obj)u-boot.bin $(obj)u-boot.bin.lzma
++		@./tools/mkimage -A mips -T firmware -C lzma \
++		-a 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-e 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-n 'u-boot image' -d $(obj)u-boot.bin.lzma $@
++
++$(obj)ld_uboot.img: $(obj)u-boot.ifx $(obj)u-boot.lzimg $(obj)System.map $(obj)bootstrap.bin	
++		@  cp -f $(obj)u-boot.ifx $(obj)u-boot.bin
++		@ ./mkbootimg.incaip2 $(obj)ld_uboot.img < ld_uboot.conf
++
++
++
++
++$(obj)u-boot.zimg:	$(obj)u-boot.bin $(obj)System.map
++		gzip $(obj)u-boot.bin
++		./tools/mkimage -A $(ARCH) -T firmware -C gzip \
++                -a 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-e 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-n $(shell sed -n -e 's/.*U_BOOT_VERSION//p' $(VERSION_FILE) | \
++			 sed -e 's/"[     ]*$$/ for $(BOARD) board"/') \
++		-d u-boot.gz $@
++
++$(obj)u-boot.bzimg:	$(obj)u-boot.bin $(obj)System.map
++		bzip $(obj)u-boot.bin
++		./tools/mkimage -A $(ARCH) -T firmware -C bzip2 \
++		-a 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-e 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-n $(shell sed -n -e 's/.*U_BOOT_VERSION//p' $(VERSION_FILE) | \
++			sed -e 's/"[     ]*$$/ for $(BOARD) board"/') \
++		-d u-boot.bz2 $@
++
++$(obj)u-boot.limg:	$(obj)u-boot.bin $(obj)System.map
++#		@lzma -f -z --best -v $(obj)u-boot.bin
++		@lzma e $(obj)u-boot.bin $(obj)u-boot.bin.lzma
++		./tools/mkimage -A $(ARCH) -T firmware -C lzma \
++		-a 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-e 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-n $(shell sed -n -e 's/.*U_BOOT_VERSION//p' $(VERSION_FILE) | \
++			sed -e 's/"[     ]*$$/ for $(BOARD) board"/') \
++		-d u-boot.bin.lzma $@
++
++$(obj)u-boot.img:	$(obj)u-boot.bin $(obj)System.map
++		./tools/mkimage -A $(ARCH) -T firmware -C none \
++		-a 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-e 0x$(shell grep "T _start" $(TOPDIR)/System.map | awk '{ printf "%s", $$1 }') \
++		-n $(shell sed -n -e 's/.*U_BOOT_VERSION//p' $(VERSION_FILE) | \
++			sed -e 's/"[     ]*$$/ for $(BOARD) board"/') \
++		-d u-boot.bin $@
++
+ $(obj)u-boot.hex:	$(obj)u-boot
+ 		$(OBJCOPY) ${OBJCFLAGS} -O ihex $< $@
+ 
+@@ -243,28 +359,36 @@
+ $(obj)u-boot.bin:	$(obj)u-boot
+ 		$(OBJCOPY) ${OBJCFLAGS} -O binary $< $@
+ 
+-$(obj)u-boot.img:	$(obj)u-boot.bin
+-		./tools/mkimage -A $(ARCH) -T firmware -C none \
+-		-a $(TEXT_BASE) -e 0 \
+-		-n $(shell sed -n -e 's/.*U_BOOT_VERSION//p' $(VERSION_FILE) | \
+-			sed -e 's/"[	 ]*$$/ for $(BOARD) board"/') \
+-		-d $< $@
+-
+ $(obj)u-boot.dis:	$(obj)u-boot
+ 		$(OBJDUMP) -d $< > $@
+ 
+-$(obj)u-boot:		depend version $(SUBDIRS) $(OBJS) $(LIBS) $(LDSCRIPT)
++$(obj)u-boot:	depend version $(SUBDIRS) $(OBJS) $(LIBS) $(LDSCRIPT)
+ 		UNDEF_SYM=`$(OBJDUMP) -x $(LIBS) |sed  -n -e 's/.*\(__u_boot_cmd_.*\)/-u\1/p'|sort|uniq`;\
+ 		cd $(LNDIR) && $(LD) $(LDFLAGS) $$UNDEF_SYM $(__OBJS) \
+ 			--start-group $(__LIBS) --end-group $(PLATFORM_LIBS) \
+ 			-Map u-boot.map -o u-boot
+ 
++
++
++$(obj)bootstrap.bin:	$(obj)bootstrap
++		$(OBJCOPY) ${OBJCFLAGS} -O binary $< $@
++
++$(obj)bootstrap :		depend version $(SUBDIRS) $(OBJS_BOOTSTRAP) $(LIBS_BOOTSTRAP) $(LDSCRIPT_BOOTSTRAP)
++		UNDEF_SYM=`$(OBJDUMP) -x $(LIBS_BOOTSTRAP) |sed  -n -e 's/.*\(__u_boot_cmd_.*\)/-u\1/p'|sort|uniq`;\
++		$(LD) $(LDFLAGS_BOOTSTRAP) $$UNDEF_SYM $(OBJS_BOOTSTRAP) \
++			--start-group $(LIBS_BOOTSTRAP) --end-group $(PLATFORM_LIBS) \
++			-Map bootstrap.map -o bootstrap
++
+ $(OBJS):
+-		$(MAKE) -C cpu/$(CPU) $(if $(REMOTE_BUILD),$@,$(notdir $@))
++		$(MAKE) -C cpu/$(CPU)/$(BOARDDIR) $(if $(REMOTE_BUILD),$@,$(notdir $@))
+ 
+ $(LIBS):
+ 		$(MAKE) -C $(dir $(subst $(obj),,$@))
+ 
++
++$(LIBS_BOOTSTRAP):
++		$(MAKE) -C `dirname $@`
++
+ $(SUBDIRS):
+ 		$(MAKE) -C $@ all
+ 
+@@ -295,14 +419,14 @@
+ 
+ tags ctags:
+ 		ctags -w -o $(OBJTREE)/ctags `find $(SUBDIRS) include \
+-				lib_generic board/$(BOARDDIR) cpu/$(CPU) lib_$(ARCH) \
++				lib_generic board/$(BOARDDIR) cpu/$(CPU)/$(BOARDDIR) lib_$(ARCH) \
+ 				fs/cramfs fs/fat fs/fdos fs/jffs2 \
+ 				net disk rtc dtt drivers drivers/sk98lin common \
+ 			\( -name CVS -prune \) -o \( -name '*.[ch]' -print \)`
+ 
+ etags:
+ 		etags -a -o $(OBJTREE)/etags `find $(SUBDIRS) include \
+-				lib_generic board/$(BOARDDIR) cpu/$(CPU) lib_$(ARCH) \
++				lib_generic board/$(BOARDDIR) cpu/$(CPU)/$(BOARDDIR) lib_$(ARCH) \
+ 				fs/cramfs fs/fat fs/fdos fs/jffs2 \
+ 				net disk rtc dtt drivers drivers/sk98lin common \
+ 			\( -name CVS -prune \) -o \( -name '*.[ch]' -print \)`
+@@ -2032,7 +2156,20 @@
+ # MIPS
+ #========================================================================
+ #########################################################################
+-## MIPS32 4Kc
++## Infineon MIPS generic u-boot config 
++#########################################################################
++danube_config:	unconfig
++	@$(MKCONFIG) $(@:_config=) mips mips danube
++
++amazon_config:	unconfig
++	@$(MKCONFIG) $(@:_config=) mips mips amazon
++
++
++incaip2_config:	unconfig
++	@$(MKCONFIG) $(@:_config=) mips mips incaip2
++
++#########################################################################
++## MIPS32 4kc
+ #########################################################################
+ 
+ xtract_incaip = $(subst _100MHz,,$(subst _133MHz,,$(subst _150MHz,,$(subst _config,,$1))))
+@@ -2246,6 +2383,8 @@
+ 	rm -f $(obj)include/bmp_logo.h
+ 	find nand_spl -lname "*" -print | xargs rm -f
+ 	rm -f nand_spl/u-boot-spl nand_spl/u-boot-spl.map
++	rm -f lib_bootstrap/*.o
++	rm -f lib_bootstrap/*.a
+ 
+ clobber:	clean
+ 	find $(OBJTREE) -type f \( -name .depend \
+@@ -2254,7 +2393,7 @@
+ 		| xargs -0 rm -f
+ 	rm -f $(OBJS) $(obj)*.bak $(obj)ctags $(obj)etags $(obj)TAGS $(obj)include/version_autogenerated.h
+ 	rm -fr $(obj)*.*~
+-	rm -f $(obj)u-boot $(obj)u-boot.map $(obj)u-boot.hex $(ALL)
++	rm -f $(obj)u-boot $(obj)u-boot.map $(obj)u-boot.hex $(ALL) $(IFX_ALL)
+ 	rm -f $(obj)tools/crc32.c $(obj)tools/environment.c $(obj)tools/env/crc32.c
+ 	rm -f $(obj)tools/inca-swap-bytes $(obj)cpu/mpc824x/bedbug_603e.c
+ 	rm -f $(obj)include/asm/proc $(obj)include/asm/arch $(obj)include/asm
+Binary files u-boot-1.1.5.a/bootstrap and u-boot/bootstrap differ
+diff -urN u-boot-1.1.5.a/build_danube.sh u-boot/build_danube.sh
+--- u-boot-1.1.5.a/build_danube.sh	1970-01-01 01:00:00.000000000 +0100
++++ u-boot/build_danube.sh	2008-05-11 14:02:24.000000000 +0100
+@@ -0,0 +1,28 @@
++#!/bin/sh
++IFX_CONFIG_FLASH_SIZE=8
++IFX_CONFIG_MEMORY_SIZE=30
++CONFIG_RAM_TEXT_BASE=0xA0400000
++
++#prepare_headers()
++#{
++#	cp -f include/flash_$1.h \
++#	include/flash.h
++#	cp -f include/net_$1.h \
++#	include/net.h
++#	cp -f include/asm-mips/cacheops_$1.h \
++#	include/asm-mips/cacheops.h
++#	cp -f include/asm-mips/mipsregs_$1.h \
++#	include/asm-mips/mipsregs.h
++#}
++#prepare_headers "danube"
++UBOOT_COMPRESS=lzma
++UBOOT_CFLAGS="-DCONFIG_IFX_MIPS -DCONFIG_LZMA -DIFX_CONFIG_MEMORY_SIZE=${IFX_CONFIG_MEMORY_SIZE} -DIFX_CONFIG_FLASH_SIZE=${IFX_CONFIG_FLASH_SIZE}"
++
++rm -f .config_ok
++
++make CROSS_COMPILE="mips-linux-uclibc-" CROSS_COMPILE_UCLIBC=1 COMPRESS=${UBOOT_COMPRESS} PLATFORM_CPU=mips32r2 IFX_CFLAGS="${UBOOT_CFLAGS}" UBOOT_RAM_TEXT_BASE=${CONFIG_RAM_TEXT_BASE} CPU_TYPE=${IFX_CONFIG_CPU} danube_config distclean
++
++CROSS_COMPILE="mips-linux-uclibc-" CROSS_COMPILE_UCLIBC=1 COMPRESS=${UBOOT_COMPRESS} PLATFORM_CPU=mips32r2 IFX_CFLAGS="${UBOOT_CFLAGS}" make UBOOT_RAM_TEXT_BASE=${CONFIG_RAM_TEXT_BASE} CPU_TYPE=${IFX_CONFIG_CPU} danube_config
++       echo -n > .config_ok
++
++CROSS_COMPILE="mips-linux-uclibc-" CROSS_COMPILE_UCLIBC=1 COMPRESS=${UBOOT_COMPRESS} PLATFORM_CPU=mips32r2 IFX_CFLAGS="${UBOOT_CFLAGS}" make UBOOT_RAM_TEXT_BASE=${CONFIG_RAM_TEXT_BASE} BOOTSTRAP_PRINTF_STATUS=$2 CPU_TYPE=${IFX_CONFIG_CPU} ifx_all
+diff -urN u-boot-1.1.5.a/common/Makefile u-boot/common/Makefile
+--- u-boot-1.1.5.a/common/Makefile	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/Makefile	2008-05-11 14:53:59.000000000 +0100
+@@ -46,7 +46,7 @@
+ 	  env_nand.o env_dataflash.o env_flash.o env_eeprom.o \
+ 	  env_nvram.o env_nowhere.o \
+ 	  exports.o \
+-	  flash.o fpga.o ft_build.o \
++	  flash_$(BOARD).o fpga.o ft_build.o \
+ 	  hush.o kgdb.o lcd.o lists.o lynxkdi.o \
+ 	  memsize.o miiphybb.o miiphyutil.o \
+ 	  s_record.o serial.o soft_i2c.o soft_spi.o spartan2.o spartan3.o \
+@@ -60,7 +60,7 @@
+ 
+ all:	$(LIB) $(AOBJS)
+ 
+-$(LIB): $(obj).depend $(OBJS)
++$(LIB): $(OBJS)
+ 	$(AR) $(ARFLAGS) $@ $(OBJS)
+ 
+ $(obj)environment.o: $(src)environment.c $(obj)../tools/envcrc
+diff -urN u-boot-1.1.5.a/common/cmd_bootm.c u-boot/common/cmd_bootm.c
+--- u-boot-1.1.5.a/common/cmd_bootm.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/cmd_bootm.c	2007-03-09 09:47:46.000000000 +0000
+@@ -31,6 +31,7 @@
+ #include <malloc.h>
+ #include <zlib.h>
+ #include <bzlib.h>
++#include <LzmaWrapper.h>
+ #include <environment.h>
+ #include <asm/byteorder.h>
+ 
+@@ -79,6 +80,8 @@
+ # define CHUNKSZ (64 * 1024)
+ #endif
+ 
++#ifndef CFG_HEAD_CODE
++
+ int  gunzip (void *, int, unsigned char *, unsigned long *);
+ 
+ static void *zalloc(void *, unsigned, unsigned);
+@@ -341,6 +344,7 @@
+ #endif	/* CONFIG_HW_WATCHDOG || CONFIG_WATCHDOG */
+ 		}
+ 		break;
++#ifndef CONFIG_REMOVE_GZIP
+ 	case IH_COMP_GZIP:
+ 		printf ("   Uncompressing %s ... ", name);
+ 		if (gunzip ((void *)ntohl(hdr->ih_load), unc_len,
+@@ -350,6 +354,7 @@
+ 			do_reset (cmdtp, flag, argc, argv);
+ 		}
+ 		break;
++#endif /* CONFIG_REMOVE_GZIP */
+ #ifdef CONFIG_BZIP2
+ 	case IH_COMP_BZIP2:
+ 		printf ("   Uncompressing %s ... ", name);
+@@ -369,6 +374,18 @@
+ 		}
+ 		break;
+ #endif /* CONFIG_BZIP2 */
++#ifdef CONFIG_LZMA
++	case IH_COMP_LZMA:
++		printf ("   Uncompressing %s ... ", name);
++		i = lzma_inflate ((unsigned char *)data, len, (unsigned char*)ntohl(hdr->ih_load), &unc_len);
++		if (i != LZMA_RESULT_OK) {
++			printf ("LZMA ERROR %d - must RESET board to recover\n", i);
++			SHOW_BOOT_PROGRESS (-6);
++			udelay(100000);
++			do_reset (cmdtp, flag, argc, argv);
++		}
++		break;
++#endif /* CONFIG_LZMA */
+ 	default:
+ 		if (iflag)
+ 			enable_interrupts();
+@@ -1176,6 +1193,8 @@
+ );
+ #endif	/* CFG_CMD_IMLS */
+ 
++#endif	/* ! CFG_HEAD_CODE */
++
+ void
+ print_image_hdr (image_header_t *hdr)
+ {
+@@ -1270,12 +1289,15 @@
+ 	case IH_COMP_NONE:	comp = "uncompressed";		break;
+ 	case IH_COMP_GZIP:	comp = "gzip compressed";	break;
+ 	case IH_COMP_BZIP2:	comp = "bzip2 compressed";	break;
++	case IH_COMP_LZMA:      comp = "lzma compressed";       break;	
+ 	default:		comp = "unknown compression";	break;
+ 	}
+ 
+ 	printf ("%s %s %s (%s)", arch, os, type, comp);
+ }
+ 
++#ifndef CFG_HEAD_CODE
++
+ #define	ZALLOC_ALIGNMENT	16
+ 
+ static void *zalloc(void *x, unsigned items, unsigned size)
+@@ -1427,3 +1449,5 @@
+ }
+ 
+ #endif /* CONFIG_LYNXKDI */
++
++#endif /* ! CFG_HEAD_CODE */
+diff -urN u-boot-1.1.5.a/common/cmd_flash.c u-boot/common/cmd_flash.c
+--- u-boot-1.1.5.a/common/cmd_flash.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/cmd_flash.c	2007-03-09 09:47:46.000000000 +0000
+@@ -196,9 +196,17 @@
+ }
+ 
+ static int
+-flash_fill_sect_ranges (ulong addr_first, ulong addr_last,
+-			int *s_first, int *s_last,
+-			int *s_count )
++flash_fill_sect_ranges(
++	ulong *addr_first_sect_start,
++	ulong addr_first,
++	ulong *addr_last_sect_end,
++	ulong addr_last,
++	int *s_first,
++	int *s_last,
++	int *bPartialStart,
++	int *bPartialEnd,
++	int *s_count,
++	unsigned int bPartialErase)
+ {
+ 	flash_info_t *info;
+ 	ulong bank;
+@@ -211,9 +219,7 @@
+ 		s_last [bank] = -1;	/* last  sector to erase	*/
+ 	}
+ 
+-	for (bank=0,info=&flash_info[0];
+-	     (bank < CFG_MAX_FLASH_BANKS) && (addr_first <= addr_last);
+-	     ++bank, ++info) {
++	for (bank=0, info=&flash_info[0]; (bank < CFG_MAX_FLASH_BANKS) && (addr_first <= addr_last); ++bank, ++info) {
+ 		ulong b_end;
+ 		int sect;
+ 		short s_end;
+@@ -225,7 +231,6 @@
+ 		b_end = info->start[0] + info->size - 1;	/* bank end addr */
+ 		s_end = info->sector_count - 1;			/* last sector   */
+ 
+-
+ 		for (sect=0; sect < info->sector_count; ++sect) {
+ 			ulong end;	/* last address in current sect	*/
+ 
+@@ -238,11 +243,21 @@
+ 
+ 			if (addr_first == info->start[sect]) {
+ 				s_first[bank] = sect;
++			} else if (addr_first > info->start[sect] && addr_first <= end && bPartialErase) {
++				*addr_first_sect_start = info->start[sect];
++				s_first[bank] = sect;
++				*bPartialStart = 1;
+ 			}
++
+ 			if (addr_last  == end) {
+ 				s_last[bank]  = sect;
++			} else if (addr_last >= info->start[sect] && addr_last < end && bPartialErase) {
++				*addr_last_sect_end = end;
++				s_last[bank] = sect;
++				*bPartialEnd = 1;
+ 			}
+ 		}
++		
+ 		if (s_first[bank] >= 0) {
+ 			if (s_last[bank] < 0) {
+ 				if (addr_last > b_end) {
+@@ -316,6 +331,8 @@
+ 	struct part_info *part;
+ 	u8 dev_type, dev_num, pnum;
+ #endif
++	unsigned int bPartialErase = 0;
++
+ 	int rcode = 0;
+ 
+ 	if (argc < 2) {
+@@ -368,8 +385,8 @@
+ 		}
+ 	}
+ #endif
+-
+-	if (argc != 3) {
++	
++	if (argc != 4) {
+ 		printf ("Usage:\n%s\n", cmdtp->usage);
+ 		return 1;
+ 	}
+@@ -397,11 +414,117 @@
+ 		return 1;
+ 	}
+ 
+-	rcode = flash_sect_erase(addr_first, addr_last);
++	printf ("Erase Flash from 0x%08lx to 0x%08lx\n", addr_first, addr_last);
++	if(argc == 4) {
++		bPartialErase = simple_strtoul(argv[3], NULL, 10);
++	}
++
++	rcode = flash_sect_erase(addr_first, addr_last, bPartialErase);
+ 	return rcode;
+ }
+ 
+-int flash_sect_erase (ulong addr_first, ulong addr_last)
++int flerase_Partial(
++	ulong addr_first_sect_start,
++	ulong addr_first,
++	ulong addr_last_sect_end,
++	ulong addr_last,
++	flash_info_t *info,
++	int first_sect,
++	int last_sect,
++	int bFirstPartial,
++	int bLastPartial) {
++	unsigned int firstMemLen = 0;
++	unsigned int lastMemLen = 0;
++	unsigned int sectMemLen = 0;
++	uchar *pSavedFirstMem = NULL;
++	uchar *pSavedLastMem = NULL;
++	uchar *pSavedSectMem = NULL;
++	int bSectPartial = 0;
++	int rt_code = 0;
++
++	debug("%s ... 0x%08x, 0x%08x, 0x%08x, 0x%08x, 0x%p, %d, %d, %d, %d\n", __FUNCTION__, addr_first_sect_start, addr_first, addr_last_sect_end, addr_last, info, first_sect, last_sect, bFirstPartial, bLastPartial);
++
++	if (bFirstPartial && bLastPartial && (first_sect == last_sect))
++	{
++		ulong b_end = info->start[0] + info->size - 1;
++		ulong end = (first_sect == (info->sector_count - 1)) ? b_end : info->start[first_sect + 1] - 1;
++		sectMemLen = end - info->start[first_sect] + 1;
++		pSavedSectMem = (uchar *)calloc(sectMemLen, sizeof(char));
++		if (pSavedSectMem == NULL)
++		{
++			debug("calloc %u FAILED\n", sectMemLen);
++			rt_code = 1;
++			goto ret;
++		}
++		memset(pSavedSectMem, 0xff, sectMemLen);
++		bSectPartial = 1;
++		memcpy(pSavedSectMem, (uchar *)addr_first_sect_start, addr_first - addr_first_sect_start);
++		memcpy(pSavedSectMem + (addr_last - info->start[first_sect]) + 1, addr_last + 1, end - addr_last);
++	}
++	else
++	{
++		if (bFirstPartial){
++			firstMemLen = addr_first - addr_first_sect_start + 1;
++			pSavedFirstMem = (uchar *)calloc(firstMemLen,sizeof(char));
++			memcpy(pSavedFirstMem,(uchar *)addr_first_sect_start,firstMemLen - 1);
++		}
++		if (bLastPartial){
++			lastMemLen = addr_last_sect_end - addr_last + 1;
++			pSavedLastMem = (uchar *)calloc(lastMemLen,sizeof(char));
++			memcpy(pSavedLastMem,(uchar *)addr_last + 1,lastMemLen - 1);
++		}
++	}
++
++	if (bFirstPartial){
++		if(flash_erase (info, first_sect, first_sect)) {
++			printf("%s ... Couldn't erase sector %d\n", __FUNCTION__, first_sect);
++			rt_code = 1;
++			goto ret;
++		}
++		debug("%s ... erase sector %d done!\n", __FUNCTION__, first_sect);
++	}
++	
++	if (bLastPartial && first_sect != last_sect){
++		if(flash_erase (info, last_sect, last_sect)) {
++			printf("%s ... Couldn't erase sector %d\n", __FUNCTION__, last_sect);
++			rt_code = 1;
++			goto ret;
++		}
++		debug("%s ... erase sector %d done!\n", __FUNCTION__, last_sect);
++	}
++
++	if (bFirstPartial && bLastPartial && (first_sect == last_sect))
++	{
++		flash_write(pSavedSectMem, (uchar *)addr_first_sect_start, sectMemLen);
++		debug("flash_write from 0x%08x with len %u\n", addr_first_sect_start, sectMemLen);
++	}
++	else
++	{
++		if (bFirstPartial){
++			if(flash_write(pSavedFirstMem,(uchar *)addr_first_sect_start,firstMemLen - 1)) {
++				printf("%s ... Couldn't write at 0x%08lx length %d\n", __FUNCTION__, addr_first_sect_start,firstMemLen - 1);
++				rt_code = 1;
++				goto ret;
++			}
++		}
++		if (bLastPartial){
++			if(flash_write(pSavedLastMem,(uchar *)addr_last + 1,lastMemLen - 1)) {
++				printf("%s ... Couldn't write at 0x%08lx length %d\n", __FUNCTION__, addr_last, lastMemLen - 1);
++				rt_code = 1;
++			}
++		}
++	}
++ret:
++	if (bFirstPartial)
++		free(pSavedFirstMem);
++	if (bLastPartial)
++		free(pSavedLastMem);
++	if (bSectPartial)
++		free(pSavedSectMem);
++	return rt_code;
++}
++
++int flash_sect_erase (ulong addr_first, ulong addr_last, unsigned int bPartialErase)
+ {
+ 	flash_info_t *info;
+ 	ulong bank;
+@@ -413,27 +536,66 @@
+ 	int erased = 0;
+ 	int planned;
+ 	int rcode = 0;
+-
+-	rcode = flash_fill_sect_ranges (addr_first, addr_last,
+-					s_first, s_last, &planned );
++	int bPartialStart = 0;		// Start sector has to be erased partially
++	int bPartialEnd = 0;		// End sector has to be erased partially
++	ulong addr_first_sect_start = 0;// Sector start address of location addr_start
++	ulong addr_last_sect_end = 0;	// Sector end address of location addr_last
++
++	rcode = flash_fill_sect_ranges (
++			&addr_first_sect_start,
++			addr_first,
++			&addr_last_sect_end,
++			addr_last,
++			s_first,
++			s_last,
++			&bPartialStart,
++			&bPartialEnd,
++			&planned,
++			bPartialErase );
+ 
+ 	if (planned && (rcode == 0)) {
+-		for (bank=0,info=&flash_info[0];
+-		     (bank < CFG_MAX_FLASH_BANKS) && (rcode == 0);
+-		     ++bank, ++info) {
++		for (bank=0, info=&flash_info[0]; (bank < CFG_MAX_FLASH_BANKS) && (rcode == 0); ++bank, ++info) {
++			ulong b_end = info->start[0] + info->size - 1;	/* bank end addr */
+ 			if (s_first[bank]>=0) {
+-				erased += s_last[bank] - s_first[bank] + 1;
+-				debug ("Erase Flash from 0x%08lx to 0x%08lx "
+-					"in Bank # %ld ",
+-					info->start[s_first[bank]],
+-					(s_last[bank] == info->sector_count) ?
+-						info->start[0] + info->size - 1:
+-						info->start[s_last[bank]+1] - 1,
+-					bank+1);
+-				rcode = flash_erase (info, s_first[bank], s_last[bank]);
++				if(bPartialErase) {
++					rcode = flerase_Partial(
++							addr_first_sect_start,
++							addr_first,
++							addr_last_sect_end,
++							addr_last,
++							info,
++							s_first[bank],
++							s_last[bank],
++							bPartialStart,
++							bPartialEnd);
++				}			
++
++				//Erase full sectores
++				if (bPartialStart)
++					s_first[bank] += 1;
++				if (bPartialEnd)
++					s_last[bank] -= 1;
++				if (s_last[bank] >= s_first[bank]) {
++					erased += s_last[bank] - s_first[bank] + 1;
++					debug ("Erase Flash from 0x%08lx to 0x%08lx in Bank # %ld ",
++						info->start[s_first[bank]],
++						(s_last[bank] == info->sector_count) ?
++							info->start[0] + info->size - 1:
++							info->start[s_last[bank]+1] - 1,
++						bank + 1);
++					rcode = flash_erase (info, s_first[bank], s_last[bank]);
++				}
+ 			}
+ 		}
+-		printf ("Erased %d sectors\n", erased);
++		
++		if (erased && !bPartialErase) {
++			printf ("Erased %d sectors\n", erased);
++		} else if (bPartialErase){
++			printf ("Partial erased from 0x%08lx to 0x%08lx\n", addr_first, addr_last);
++		} else {
++			printf ("Error: start and/or end address not on sector boundary\n");
++			rcode = 1;
++		}
+ 	} else if (rcode == 0) {
+ 		puts ("Error: start and/or end address"
+ 			" not on sector boundary\n");
+@@ -629,8 +791,22 @@
+ 	int protected, i;
+ 	int planned;
+ 	int rcode;
+-
+-	rcode = flash_fill_sect_ranges( addr_first, addr_last, s_first, s_last, &planned );
++	int bPartialStart = 0;		// Start sector has to be erased partially
++	int bPartialEnd = 0;		// End sector has to be erased partially
++	ulong addr_first_sect_start = 0;// Sector start address of location addr_start
++	ulong addr_last_sect_end = 0;	// Sector end address of location addr_last
++
++	rcode = flash_fill_sect_ranges (
++			&addr_first_sect_start,
++			addr_first,
++			&addr_last_sect_end,
++			addr_last,
++			s_first,
++			s_last,
++			&bPartialStart,
++			&bPartialEnd,
++			&planned,
++			1 );
+ 
+ 	protected = 0;
+ 
+@@ -690,7 +866,7 @@
+ );
+ 
+ U_BOOT_CMD(
+-	erase,   3,   1,  do_flerase,
++	erase,   4,   1,  do_flerase,
+ 	"erase   - erase FLASH memory\n",
+ 	"start end\n"
+ 	"    - erase FLASH from addr 'start' to addr 'end'\n"
+diff -urN u-boot-1.1.5.a/common/cmd_nvedit.c u-boot/common/cmd_nvedit.c
+--- u-boot-1.1.5.a/common/cmd_nvedit.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/cmd_nvedit.c	2007-03-09 09:47:46.000000000 +0000
+@@ -540,8 +540,19 @@
+ 	extern char * env_name_spec;
+ 
+ 	printf ("Saving Environment to %s...\n", env_name_spec);
+-
++#if 1
++	if(saveenv() == 0) {
++#ifdef UBOOT_ENV_COPY
++		saveenv_copy();
++#else
++		;
++#endif //UBOOT_ENV_COPY
++	} else
++		return 1;
++	return 0;
++#else
+ 	return (saveenv() ? 1 : 0);
++#endif
+ }
+ 
+ 
+diff -urN u-boot-1.1.5.a/common/console.c u-boot/common/console.c
+--- u-boot-1.1.5.a/common/console.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/console.c	2007-03-09 09:47:46.000000000 +0000
+@@ -324,7 +324,7 @@
+ #endif
+ 
+ /** U-Boot INIT FUNCTIONS *************************************************/
+-
++#ifndef CFG_HEAD_CODE
+ int console_assign (int file, char *devname)
+ {
+ 	int flag, i;
+@@ -357,7 +357,7 @@
+ 
+ 	return -1;
+ }
+-
++#endif	//CFG_HEAD_CODE
+ /* Called before relocation - use serial functions */
+ int console_init_f (void)
+ {
+@@ -392,6 +392,7 @@
+ }
+ #endif /* CFG_CONSOLE_IS_IN_ENV || CONFIG_SPLASH_SCREEN */
+ 
++#ifndef CFG_HEAD_CODE
+ #ifdef CFG_CONSOLE_IS_IN_ENV
+ /* Called after the relocation - use desired console functions */
+ int console_init_r (void)
+@@ -570,3 +571,4 @@
+ }
+ 
+ #endif /* CFG_CONSOLE_IS_IN_ENV */
++#endif	//CFG_HEAD_CODE
+diff -urN u-boot-1.1.5.a/common/devices.c u-boot/common/devices.c
+--- u-boot-1.1.5.a/common/devices.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/devices.c	2007-03-09 09:47:46.000000000 +0000
+@@ -39,6 +39,7 @@
+ list_t devlist = 0;
+ device_t *stdio_devices[] = { NULL, NULL, NULL };
+ char *stdio_names[MAX_FILES] = { "stdin", "stdout", "stderr" };
++#ifndef CFG_HEAD_CODE
+ 
+ #if defined(CONFIG_SPLASH_SCREEN) && !defined(CFG_DEVICE_NULLDEV)
+ #define	CFG_DEVICE_NULLDEV	1
+@@ -214,3 +215,5 @@
+ 
+ 	return 0;
+ }
++#endif //CFG_HEAD_CODE
++
+diff -urN u-boot-1.1.5.a/common/env_common.c u-boot/common/env_common.c
+--- u-boot-1.1.5.a/common/env_common.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/env_common.c	2008-05-11 13:26:45.000000000 +0100
+@@ -219,7 +219,9 @@
+ 	 * We must allocate a buffer for the environment
+ 	 */
+ 	env_ptr = (env_t *)malloc (CFG_ENV_SIZE);
+-	DEBUGF ("%s[%d] malloced ENV at %p\n", __FUNCTION__,__LINE__,env_ptr);
++	if(!env_ptr)
++		DEBUGF ("malloc env_ptr error!!\n");
++	DEBUGF ("%s[%d] malloced ENV at %p\n", __FUNCTION__, __LINE__, env_ptr);
+ #endif
+ 
+ 	/*
+@@ -227,6 +229,10 @@
+ 	 */
+ 	env_get_char = env_get_char_memory;
+ 
++	//leejack
++	DEBUGF ("%s[%d] gd->env_valid=%d\n", __FUNCTION__, __LINE__, gd->env_valid);
++	DEBUGF ("%s[%d] CFG_ENV_SIZE=%d\n", __FUNCTION__, __LINE__, CFG_ENV_SIZE);
++
+ 	if (gd->env_valid == 0) {
+ #if defined(CONFIG_GTH)	|| defined(CFG_ENV_IS_NOWHERE)	/* Environment not changable */
+ 		puts ("Using default environment\n\n");
+@@ -242,18 +248,17 @@
+ 		}
+ 
+ 		memset (env_ptr, 0, sizeof(env_t));
+-		memcpy (env_ptr->data,
+-			default_environment,
+-			sizeof(default_environment));
++		memcpy (env_ptr->data, default_environment, sizeof(default_environment));
++
+ #ifdef CFG_REDUNDAND_ENVIRONMENT
+ 		env_ptr->flags = 0xFF;
+ #endif
+ 		env_crc_update ();
+ 		gd->env_valid = 1;
+-	}
+-	else {
++	} else {
+ 		env_relocate_spec ();
+ 	}
++
+ 	gd->env_addr = (ulong)&(env_ptr->data);
+ 
+ #ifdef CONFIG_AMIGAONEG3SE
+diff -urN u-boot-1.1.5.a/common/env_flash.c u-boot/common/env_flash.c
+--- u-boot-1.1.5.a/common/env_flash.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/env_flash.c	2008-05-11 14:55:45.000000000 +0100
+@@ -66,7 +66,6 @@
+ #endif
+ 
+ #else /* ! ENV_IS_EMBEDDED */
+-
+ env_t *env_ptr = (env_t *)CFG_ENV_ADDR;
+ #ifdef CMD_SAVEENV
+ static env_t *flash_addr = (env_t *)CFG_ENV_ADDR;
+@@ -201,6 +200,7 @@
+ 	debug (" %08lX ... %08lX ...",
+ 		(ulong)&(flash_addr_new->data),
+ 		sizeof(env_ptr->data)+(ulong)&(flash_addr_new->data));
++	
+ 	if ((rc = flash_write((char *)env_ptr->data,
+ 			(ulong)&(flash_addr_new->data),
+ 			sizeof(env_ptr->data))) ||
+@@ -256,7 +256,6 @@
+ #endif /* CMD_SAVEENV */
+ 
+ #else /* ! CFG_ENV_ADDR_REDUND */
+-
+ int  env_init(void)
+ {
+ #ifdef CONFIG_OMAP2420H4
+@@ -280,8 +279,55 @@
+ 
+ #ifdef CMD_SAVEENV
+ 
++#ifdef UBOOT_ENV_COPY
++int saveenv_copy(void) {
++	uchar *env_buffer = (char *)env_ptr;
++	char *kernel_addr;
++	char *rootfs_addr;
++	char *rootfs_size;
++	ulong start_addr,end_addr,rootfs_end_addr;
++	ulong flash_start;
++
++	kernel_addr = getenv("f_kernel_addr");
++	end_addr = simple_strtoul(kernel_addr,NULL,16) - 1;
++	start_addr = end_addr - CFG_ENV_SIZE - sizeof(UBOOTCONFIG_COPY_HEADER) + 1;
++
++	rootfs_addr = getenv("f_rootfs_addr");
++	rootfs_size = getenv("f_rootfs_size");
++	rootfs_end_addr = simple_strtoul(rootfs_addr,NULL,16) + simple_strtoul(rootfs_size,NULL,16);
++
++	if(rootfs_end_addr >= start_addr)
++	{
++		printf("Can not copy the environment at 0x%08lx as no space left.\nf_kernel_addr = 0x%08lx while rootfs_end_addr = 0x%08lx\n",start_addr,end_addr,rootfs_end_addr);
++		return 1;
++	}
++
++	debug ("Protect off %08lX ... %08lX\n", (ulong)rootfs_end_addr, end_addr);
++	if (flash_sect_protect (0, rootfs_end_addr, end_addr))
++		return 1;
++
++	//delete the old environment copy, if found
++	flash_start = rootfs_end_addr;
++	while(flash_start + sizeof(UBOOTCONFIG_COPY_HEADER) + ENV_SIZE < end_addr)
++	{
++		if(strncmp((char *)flash_start,UBOOTCONFIG_COPY_HEADER,sizeof(UBOOTCONFIG_COPY_HEADER)) == 0)
++		{
++			flash_sect_erase(flash_start,flash_start + sizeof(UBOOTCONFIG_COPY_HEADER),1);
++		}
++		flash_start += 1;
++	}
++	flash_sect_erase(start_addr,end_addr,1);
++	flash_write(UBOOTCONFIG_COPY_HEADER,start_addr,sizeof(UBOOTCONFIG_COPY_HEADER));
++	flash_write(env_buffer,start_addr + sizeof(UBOOTCONFIG_COPY_HEADER), CFG_ENV_SIZE);
++	flash_sect_protect (1, rootfs_end_addr, end_addr);
++	printf("saved copy of the env at 0x%08lx\n",start_addr);
++	return 0;
++}
++#endif	//UBOOT_ENV_COPY
++
+ int saveenv(void)
+ {
++#define debug printf
+ 	int	len, rc;
+ 	ulong	end_addr;
+ 	ulong	flash_sect_addr;
+@@ -331,7 +377,7 @@
+ 		return 1;
+ 
+ 	puts ("Erasing Flash...");
+-	if (flash_sect_erase (flash_sect_addr, end_addr))
++	if (flash_sect_erase (flash_sect_addr, end_addr, 1))
+ 		return 1;
+ 
+ 	puts ("Writing to Flash... ");
+diff -urN u-boot-1.1.5.a/common/hush.c u-boot/common/hush.c
+--- u-boot-1.1.5.a/common/hush.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/common/hush.c	2008-05-10 18:56:37.000000000 +0100
+@@ -3167,9 +3167,11 @@
+ 	int code = 0;
+ #endif
+ 	do {
++		printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 		ctx.type = flag;
+ 		initialize_context(&ctx);
+ 		update_ifs_map();
++		printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 		if (!(flag & FLAG_PARSE_SEMICOLON) || (flag & FLAG_REPARSING)) mapset((uchar *)";$&|", 0);
+ 		inp->promptmode=1;
+ 		rcode = parse_stream(&temp, &ctx, inp, '\n');
+@@ -3180,9 +3182,12 @@
+ 			syntax();
+ #ifdef __U_BOOT__
+ 			flag_repeat = 0;
++printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ #endif
++		printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 		}
+ 		if (rcode != 1 && ctx.old_flag == 0) {
++			printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 			done_word(&temp, &ctx);
+ 			done_pipe(&ctx,PIPE_SEQ);
+ #ifndef __U_BOOT__
+@@ -3202,6 +3207,7 @@
+ 			if (code == -1)
+ 			    flag_repeat = 0;
+ #endif
++		printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 		} else {
+ 			if (ctx.old_flag != 0) {
+ 				free(ctx.stack);
+@@ -3215,6 +3221,7 @@
+ 			temp.quote = 0;
+ 			inp->p = NULL;
+ 			free_pipe_list(ctx.list_head,0);
++		printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 		}
+ 		b_free(&temp);
+ 	} while (rcode != -1 && !(flag & FLAG_EXIT_FROM_LOOP));   /* loop on syntax errors, return on EOF */
+@@ -3235,9 +3242,12 @@
+ #ifdef __U_BOOT__
+ 	char *p = NULL;
+ 	int rcode;
++	printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 	if ( !s || !*s)
+ 		return 1;
++	printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 	if (!(p = strchr(s, '\n')) || *++p) {
++		printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 		p = xmalloc(strlen(s) + 2);
+ 		strcpy(p, s);
+ 		strcat(p, "\n");
+@@ -3247,6 +3257,7 @@
+ 		return rcode;
+ 	} else {
+ #endif
++	printf("%s:%s[%d]\n", __FILE__, __func__, __LINE__);
+ 	setup_string_in_str(&input, s);
+ 	return parse_stream_outer(&input, flag);
+ #ifdef __U_BOOT__
+diff -urN u-boot-1.1.5.a/config.mk u-boot/config.mk
+--- u-boot-1.1.5.a/config.mk	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/config.mk	2008-05-11 12:23:31.000000000 +0100
+@@ -77,7 +77,7 @@
+ sinclude $(TOPDIR)/$(ARCH)_config.mk	# include architecture dependend rules
+ endif
+ ifdef	CPU
+-sinclude $(TOPDIR)/cpu/$(CPU)/config.mk	# include  CPU	specific rules
++sinclude $(TOPDIR)/cpu/$(CPU)/$(BOARD)/config.mk	# include  CPU	specific rules
+ endif
+ ifdef	SOC
+ sinclude $(TOPDIR)/cpu/$(CPU)/$(SOC)/config.mk	# include  SoC	specific rules
+@@ -130,7 +130,8 @@
+ ARFLAGS = crv
+ RELFLAGS= $(PLATFORM_RELFLAGS)
+ DBGFLAGS= -g # -DDEBUG
+-OPTFLAGS= -Os #-fomit-frame-pointer
++OPTFLAGS= -Os 
++#-O2 #-fomit-frame-pointer
+ ifndef LDSCRIPT
+ #LDSCRIPT := $(TOPDIR)/board/$(BOARDDIR)/u-boot.lds.debug
+ ifeq ($(CONFIG_NAND_U_BOOT),y)
+@@ -139,12 +140,15 @@
+ LDSCRIPT := $(TOPDIR)/board/$(BOARDDIR)/u-boot.lds
+ endif
+ endif
++
++LDSCRIPT_BOOTSTRAP := $(TOPDIR)/board/$(BOARDDIR)/u-boot-bootstrap.lds
++
+ OBJCFLAGS += --gap-fill=0xff
+ 
+ gccincdir := $(shell $(CC) -print-file-name=include)
+ 
+ CPPFLAGS := $(DBGFLAGS) $(OPTFLAGS) $(RELFLAGS)		\
+-	-D__KERNEL__ -DTEXT_BASE=$(TEXT_BASE)		\
++	-D__KERNEL__ -DUBOOT_RAM_TEXT_BASE=$(UBOOT_RAM_TEXT_BASE)		\
+ 
+ ifneq ($(OBJTREE),$(SRCTREE))
+ CPPFLAGS += -I$(OBJTREE)/include2 -I$(OBJTREE)/include
+@@ -180,7 +184,10 @@
+ 
+ AFLAGS := $(AFLAGS_DEBUG) -D__ASSEMBLY__ $(CPPFLAGS)
+ 
+-LDFLAGS += -Bstatic -T $(LDSCRIPT) -Ttext $(TEXT_BASE) $(PLATFORM_LDFLAGS)
++LDFLAGS += -Bstatic -T $(LDSCRIPT) -Ttext $(UBOOT_RAM_TEXT_BASE) $(PLATFORM_LDFLAGS)
++LDFLAGS_BOOTSTRAP += -Bstatic -T $(LDSCRIPT_BOOTSTRAP) -Ttext $(BOOTSTRAP_TEXT_BASE) $(PLATFORM_LDFLAGS)
++
++#HEAD_LDFLAGS += -Bstatic -T $(LDSCRIPT) -Ttext $(HEAD_FLASH_TEXT_BASE) $(PLATFORM_LDFLAGS)
+ 
+ # Location of a usable BFD library, where we define "usable" as
+ # "built for ${HOST}, supports ${TARGET}".  Sensible values are
+@@ -211,10 +218,17 @@
+ 
+ #########################################################################
+ 
++AFLAGS := $(AFLAGS) $(IFX_CFLAGS)
++CFLAGS := $(CFLAGS) $(IFX_CFLAGS)
++CPPFLAGS := $(CPPFLAGS) $(IFX_CFLAGS)
++
++#########################################################################
++
+ export	CONFIG_SHELL HPATH HOSTCC HOSTCFLAGS CROSS_COMPILE \
+ 	AS LD CC CPP AR NM STRIP OBJCOPY OBJDUMP \
+ 	MAKE
+-export	TEXT_BASE PLATFORM_CPPFLAGS PLATFORM_RELFLAGS CPPFLAGS CFLAGS AFLAGS
++#export	UBOOT_RAM_TEXT_BASE PLATFORM_CPPFLAGS PLATFORM_RELFLAGS CPPFLAGS CFLAGS AFLAGS
++export	UBOOT_RAM_TEXT_BASE BOOTSTRAP_TEXT_BASE PLATFORM_CPPFLAGS PLATFORM_RELFLAGS CPPFLAGS CFLAGS AFLAGS
+ 
+ #########################################################################
+ 
+diff -urN u-boot-1.1.5.a/drivers/Makefile u-boot/drivers/Makefile
+--- u-boot-1.1.5.a/drivers/Makefile	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/drivers/Makefile	2008-05-11 14:54:11.000000000 +0100
+@@ -50,14 +50,14 @@
+ 	  videomodes.o w83c553f.o \
+ 	  ks8695eth.o \
+ 	  pxa_pcmcia.o mpc8xx_pcmcia.o tqm8xx_pcmcia.o	\
+-	  rpx_pcmcia.o
++	  rpx_pcmcia.o ifx_sw.o
+ 
+ SRCS	:= $(COBJS:.o=.c)
+ OBJS	:= $(addprefix $(obj),$(COBJS))
+ 
+ all:	$(LIB)
+ 
+-$(LIB): $(obj).depend $(OBJS)
++$(LIB):  $(OBJS)
+ 	$(AR) $(ARFLAGS) $@ $(OBJS)
+ 
+ #########################################################################
+diff -urN u-boot-1.1.5.a/include/asm-mips/mipsregs.h u-boot/include/asm-mips/mipsregs.h
+--- u-boot-1.1.5.a/include/asm-mips/mipsregs.h	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/include/asm-mips/mipsregs.h	2008-05-11 12:31:57.000000000 +0100
+@@ -48,6 +48,7 @@
+ #define CP0_CAUSE $13
+ #define CP0_EPC $14
+ #define CP0_PRID $15
++#define CP0_EBASE $15,1
+ #define CP0_CONFIG $16
+ #define CP0_LLADDR $17
+ #define CP0_WATCHLO $18
+@@ -330,11 +331,32 @@
+ #  define KSU_USER		0x00000010
+ #  define KSU_SUPERVISOR	0x00000008
+ #  define KSU_KERNEL		0x00000000
++#ifdef CONFIG_DANUBE	/* MIPS 24KE */
++/* bits 5 & 6 & 7: reserved */
++/* bits 8~15: IM0~7 */
++/* bits 16: reserved */
++#define ST0_CEE			0x00020000
++/* bits 18: always 0 */
++#define ST0_NMI			0x00080000
++#define ST0_SR			0x00100000
++#define ST0_TS			0x00200000
++#define ST0_BEV			0x00400000
++/* bits 23: reserved */
++#define ST0_MX			0x01000000
++#define ST0_RE			0x02000000
++#define ST0_FR			0x04000000
++#define ST0_RP			0x08000000
++#define ST0_CU0			0x10000000
++#define ST0_CU1			0x20000000
++#define ST0_CU2			0x40000000
++#define ST0_CU3			0x80000000
++#else
+ #define ST0_UX			0x00000020
+ #define ST0_SX			0x00000040
+ #define ST0_KX 			0x00000080
+ #define ST0_DE			0x00010000
+ #define ST0_CE			0x00020000
++#endif
+ 
+ /*
+  * Bitfields in the R[23]000 cp0 status register.
+@@ -471,6 +493,14 @@
+ #define  CAUSEF_BD		(1   << 31)
+ 
+ /*
++ * Bits in the coprocessor 0 EBase register 
++ */
++#define EBASEB_CPUNUM		0
++#define EBASEF_CPUNUM		(0x3ff << EBASEB_CPUNUM)
++#define EBASEB_EXPBASE		12
++#define EBASEF_EXPBASE		(0x3ffff << EBASEB_EXPBASE)
++
++/*
+  * Bits in the coprozessor 0 config register.
+  */
+ #define CONF_CM_CACHABLE_NO_WA		0
+@@ -544,4 +574,10 @@
+ #define CEB_KERNEL	2	/* Count events in kernel mode EXL = ERL = 0 */
+ #define CEB_EXL		1	/* Count events with EXL = 1, ERL = 0 */
+ 
++/*
++ * Bits in ErrCtl register
++ */
++#define ECCB_WST	29
++#define ECCF_WST	(0x1 << ECCB_WST)
++
+ #endif /* _ASM_MIPSREGS_H */
+diff -urN u-boot-1.1.5.a/include/cmd_confdefs.h u-boot/include/cmd_confdefs.h
+--- u-boot-1.1.5.a/include/cmd_confdefs.h	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/include/cmd_confdefs.h	2007-03-09 09:47:46.000000000 +0000
+@@ -94,6 +94,7 @@
+ #define CFG_CMD_EXT2	0x1000000000000000ULL	/* EXT2 Support			*/
+ #define CFG_CMD_SNTP	0x2000000000000000ULL	/* SNTP support			*/
+ #define CFG_CMD_DISPLAY	0x4000000000000000ULL	/* Display support		*/
++#define CFG_CMD_DHRYSTONE	0x8000000000000000ULL	/* Dhrystone benchmark support		*/
+ 
+ #define CFG_CMD_ALL	0xFFFFFFFFFFFFFFFFULL	/* ALL commands			*/
+ 
+@@ -141,6 +142,7 @@
+ 			CFG_CMD_SPI	| \
+ 			CFG_CMD_UNIVERSE | \
+ 			CFG_CMD_USB	| \
++			CFG_CMD_DHRYSTONE | \
+ 			CFG_CMD_VFD	)
+ 
+ /* Default configuration
+diff -urN u-boot-1.1.5.a/include/config.h u-boot/include/config.h
+--- u-boot-1.1.5.a/include/config.h	1970-01-01 01:00:00.000000000 +0100
++++ u-boot/include/config.h	2008-05-11 14:02:25.000000000 +0100
+@@ -0,0 +1,2 @@
++/* Automatically generated - do not edit */
++#include <configs/danube.h>
+diff -urN u-boot-1.1.5.a/include/config.mk u-boot/include/config.mk
+--- u-boot-1.1.5.a/include/config.mk	1970-01-01 01:00:00.000000000 +0100
++++ u-boot/include/config.mk	2008-05-11 14:02:25.000000000 +0100
+@@ -0,0 +1,3 @@
++ARCH   = mips
++CPU    = mips
++BOARD  = danube
+diff -urN u-boot-1.1.5.a/include/flash.h u-boot/include/flash.h
+--- u-boot-1.1.5.a/include/flash.h	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/include/flash.h	2008-05-11 12:31:57.000000000 +0100
+@@ -79,7 +79,7 @@
+ extern unsigned long flash_init (void);
+ extern void flash_print_info (flash_info_t *);
+ extern int flash_erase	(flash_info_t *, int, int);
+-extern int flash_sect_erase (ulong addr_first, ulong addr_last);
++extern int flash_sect_erase (ulong addr_first, ulong addr_last, unsigned int bPartialErase);
+ extern int flash_sect_protect (int flag, ulong addr_first, ulong addr_last);
+ 
+ /* common/flash.c */
+@@ -299,6 +299,10 @@
+ #define TOSH_ID_FVT160	0xC2		/* TC58FVT160 ID (16 M, top )		*/
+ #define TOSH_ID_FVB160	0x43		/* TC58FVT160 ID (16 M, bottom )	*/
+ 
++#define MX_ID_29LV320AB 0x22A822A8      /* MXIC  MX29LV320AB ID (32 M, bottom ) joelin       */
++#define MX_ID_29LV160BB 0x22492249      /* MXIC  MX29LV160BB ID (16 M, bottom ) joelin       */
++#define MX_ID_29LV640BB 0x22cb22cb      /* MXIC  MX29LV640BB ID (64 M, bottom ) joelin       */
++
+ /*-----------------------------------------------------------------------
+  * Internal FLASH identification codes
+  *
+@@ -422,6 +426,10 @@
+ #define FLASH_S29GL064M 0x00F0		/* Spansion S29GL064M-R6		*/
+ #define FLASH_S29GL128N 0x00F1		/* Spansion S29GL128N			*/
+ 
++#define FLASH_29LV320AB 0x00B0          /* MXIC MX29LV320AB( 32M = 4M x 16 ) joelin 10/07/2004*/
++#define FLASH_29LV160BB 0x00B1          /* MXIC MX29LV160BB( 16M = 2M x 16 ) joelin 11/22/2004*/
++#define FLASH_29LV640BB 0x00B2          /* MXIC MX29LV640BB( 64M = 8M x 16 ) liupeng*/
++
+ #define FLASH_UNKNOWN	0xFFFF		/* unknown flash type			*/
+ 
+ 
+diff -urN u-boot-1.1.5.a/include/image.h u-boot/include/image.h
+--- u-boot-1.1.5.a/include/image.h	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/include/image.h	2007-03-09 09:47:46.000000000 +0000
+@@ -132,6 +132,7 @@
+ #define IH_COMP_NONE		0	/*  No	 Compression Used	*/
+ #define IH_COMP_GZIP		1	/* gzip	 Compression Used	*/
+ #define IH_COMP_BZIP2		2	/* bzip2 Compression Used	*/
++#define IH_COMP_LZMA		3	/* lzma Compression Used	*/
+ 
+ #define IH_MAGIC	0x27051956	/* Image Magic Number		*/
+ #define IH_NMLEN		32	/* Image Name Length		*/
+diff -urN u-boot-1.1.5.a/include/syscall.h u-boot/include/syscall.h
+--- u-boot-1.1.5.a/include/syscall.h	1970-01-01 01:00:00.000000000 +0100
++++ u-boot/include/syscall.h	2007-03-09 09:47:46.000000000 +0000
+@@ -0,0 +1,42 @@
++#ifndef __MON_SYS_CALL_H__
++#define __MON_SYS_CALL_H__
++
++#ifndef __ASSEMBLY__
++
++#include <common.h>
++
++/* These are declarations of system calls available in C code */
++int  mon_getc(void);
++int  mon_tstc(void);
++void mon_putc(const char);
++void mon_puts(const char*);
++void mon_printf(const char* fmt, ...);
++void mon_install_hdlr(int, interrupt_handler_t*, void*);
++void mon_free_hdlr(int);
++void *mon_malloc(size_t);
++void mon_free(void*);
++void mon_udelay(unsigned long);
++unsigned long mon_get_timer(unsigned long);
++
++#endif    /* ifndef __ASSEMBLY__ */
++
++#define NR_SYSCALLS            11        /* number of syscalls */
++
++
++/*
++ * Make sure these functions are in the same order as they
++ * appear in the "examples/syscall.S" file !!!
++ */
++#define SYSCALL_GETC           0
++#define SYSCALL_TSTC           1
++#define SYSCALL_PUTC           2
++#define SYSCALL_PUTS           3
++#define SYSCALL_PRINTF         4
++#define SYSCALL_INSTALL_HDLR   5
++#define SYSCALL_FREE_HDLR      6
++#define SYSCALL_MALLOC         7
++#define SYSCALL_FREE           8
++#define SYSCALL_UDELAY         9
++#define SYSCALL_GET_TIMER     10
++
++#endif
+diff -urN u-boot-1.1.5.a/include/version_autogenerated.h u-boot/include/version_autogenerated.h
+--- u-boot-1.1.5.a/include/version_autogenerated.h	1970-01-01 01:00:00.000000000 +0100
++++ u-boot/include/version_autogenerated.h	2008-05-11 14:02:26.000000000 +0100
+@@ -0,0 +1 @@
++#define U_BOOT_VERSION "U-Boot 1.1.5-IFX-LXDB"
+diff -urN u-boot-1.1.5.a/ld_uboot.conf u-boot/ld_uboot.conf
+--- u-boot-1.1.5.a/ld_uboot.conf	1970-01-01 01:00:00.000000000 +0100
++++ u-boot/ld_uboot.conf	2006-11-04 15:03:01.000000000 +0000
+@@ -0,0 +1,8 @@
++TAG_DWNLD() 
++{ 
++   0xA0B00000 "u-boot.bin" /* Download u-boot image */ 
++};
++TAG_START()
++{
++   0xA0B00000
++}; /* Start u-boot image */
+diff -urN u-boot-1.1.5.a/lib_generic/Makefile u-boot/lib_generic/Makefile
+--- u-boot-1.1.5.a/lib_generic/Makefile	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/lib_generic/Makefile	2007-03-09 09:47:46.000000000 +0000
+@@ -28,7 +28,7 @@
+ COBJS	= bzlib.o bzlib_crctable.o bzlib_decompress.o \
+ 	  bzlib_randtable.o bzlib_huffman.o \
+ 	  crc32.o ctype.o display_options.o ldiv.o \
+-	  string.o vsprintf.o zlib.o
++	  string.o vsprintf.o zlib.o LzmaDecode.o LzmaWrapper.o
+ 
+ SRCS 	:= $(COBJS:.o=.c)
+ OBJS	:= $(addprefix $(obj),$(COBJS))
+diff -urN u-boot-1.1.5.a/lib_mips/board.c u-boot/lib_mips/board.c
+--- u-boot-1.1.5.a/lib_mips/board.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/lib_mips/board.c	2008-05-11 13:17:00.000000000 +0100
+@@ -29,6 +29,25 @@
+ #include <net.h>
+ #include <environment.h>
+ 
++#ifdef CFG_HEAD_CODE
++#undef CONFIG_MICROBZIP2
++
++#ifdef CONFIG_BZIP2
++#include <bzlib.h>
++#endif
++
++#ifdef CONFIG_MICROBZIP2
++#include <micro_bzlib.h>
++#endif
++
++#ifdef CONFIG_LZMA
++#include <LzmaWrapper.h>
++#endif
++
++#include <image.h>
++#include "head.h"
++#endif //CFG_HEAD_CODE
++
+ DECLARE_GLOBAL_DATA_PTR;
+ 
+ #if ( ((CFG_ENV_ADDR+CFG_ENV_SIZE) < CFG_MONITOR_BASE) || \
+@@ -39,8 +58,6 @@
+ #define	TOTAL_MALLOC_LEN	CFG_MALLOC_LEN
+ #endif
+ 
+-#undef DEBUG
+-
+ extern int timer_init(void);
+ 
+ extern int incaip_set_cpuclk(void);
+@@ -79,6 +96,25 @@
+ 		mem_malloc_end - mem_malloc_start);
+ }
+ 
++#ifdef CFG_HEAD_CODE
++void *malloc(unsigned int size) {
++	if(size < (mem_malloc_end - mem_malloc_start)) {
++		mem_malloc_start += size;
++		//printf("malloc : size required = 0x%08lx and pointer = 0x%08lx\n",size,mem_malloc_start - size);
++		return (void *)(mem_malloc_start - size);
++	}
++	return NULL;
++}
++
++void *realloc(void *src,unsigned int size) {
++	return NULL;
++}
++
++void free(void *src) {
++	return;
++}
++#endif //CFG_HEAD_CODE 
++
+ void *sbrk (ptrdiff_t increment)
+ {
+ 	ulong old = mem_malloc_brk;
+@@ -99,7 +135,11 @@
+ #else
+ 	int board_type = 0;	/* use dummy arg */
+ #endif
++#ifdef CONFIG_USE_DDR_RAM
++	puts ("DDR-DRAM:  ");
++#else
+ 	puts ("DRAM:  ");
++#endif
+ 
+ 	if ((gd->ram_size = initdram (board_type)) > 0) {
+ 		print_size (gd->ram_size, "\n");
+@@ -116,26 +156,29 @@
+ 	return (0);
+ }
+ 
++#ifndef CFG_HEAD_CODE
+ static void display_flash_config(ulong size)
+ {
+ 	puts ("Flash: ");
+ 	print_size (size, "\n");
+ }
+-
++#endif
+ 
+ static int init_baudrate (void)
+ {
++#ifndef CFG_HEAD_CODE
+ 	char tmp[64];	/* long enough for environment variables */
+ 	int i = getenv_r ("baudrate", tmp, sizeof (tmp));
+ 
+ 	gd->baudrate = (i > 0)
+ 			? (int) simple_strtoul (tmp, NULL, 10)
+ 			: CONFIG_BAUDRATE;
+-
++#else //CFG_HEAD_CODE
++	gd->baudrate = CONFIG_BAUDRATE; 
++#endif //CFG_HEAD_CODE
+ 	return (0);
+ }
+ 
+-
+ /*
+  * Breath some life into the board...
+  *
+@@ -160,7 +203,9 @@
+ 
+ init_fnc_t *init_sequence[] = {
+ 	timer_init,
++#ifndef CFG_HEAD_CODE
+ 	env_init,		/* initialize environment */
++#endif //CFG_HEAD_CODE
+ #ifdef CONFIG_INCA_IP
+ 	incaip_set_cpuclk,	/* set cpu clock according to environment variable */
+ #endif
+@@ -179,7 +224,11 @@
+ 	gd_t gd_data, *id;
+ 	bd_t *bd;
+ 	init_fnc_t **init_fnc_ptr;
++#ifdef CFG_HEAD_CODE
++	ulong addr, addr_sp, len = (ulong)&uboot_end - CFG_HEAD_BASE;
++#else //CFG_HEAD_CODE
+ 	ulong addr, addr_sp, len = (ulong)&uboot_end - CFG_MONITOR_BASE;
++#endif //CFG_HEAD_CODE
+ 	ulong *s;
+ #ifdef CONFIG_PURPLE
+ 	void copy_code (ulong);
+@@ -278,7 +327,8 @@
+ #ifdef CONFIG_PURPLE
+ 	copy_code(addr);
+ #endif
+-
++	
++	puts("\n relocate_code start");
+ 	relocate_code (addr_sp, id, addr);
+ 
+ 	/* NOTREACHED - relocate_code() does not return */
+@@ -292,7 +342,93 @@
+  *
+  ************************************************************************
+  */
++#ifdef CFG_HEAD_CODE
++
++extern void print_image_hdr (image_header_t *hdr);
++extern void jump_unconditional (ulong addr);
++
++void board_init_r (gd_t *id, ulong dest_addr) {
++	int i;
++	ulong	addr;
++	ulong	data, len, checksum;
++	ulong  *len_ptr;
++	image_header_t header;
++	image_header_t *hdr = &header;
++	unsigned int destLen;
+ 
++	puts("\n relocate code finish.\n");
++
++	/* initialize malloc() area */
++	mem_malloc_init();
++
++	addr = CFG_HEAD_BASE + CFG_UBOOT_OFFSET;
++	memmove (&header, (char *)addr, sizeof(image_header_t));
++
++	if (ntohl(hdr->ih_magic) != IH_MAGIC) {
++		printf ("Bad Magic Number at address 0x%08lx\n",addr);
++		return;
++	}
++
++	data = (ulong)&header;
++	len  = sizeof(image_header_t);
++
++	checksum = ntohl(hdr->ih_hcrc);
++	hdr->ih_hcrc = 0;
++	if (crc32 (0, (char *)data, len) != checksum) {
++		printf ("Bad Header Checksum\n");
++		return;
++	}
++
++	print_image_hdr (hdr);
++
++	data = addr + sizeof(image_header_t);
++	len  = ntohl(hdr->ih_size);
++	len_ptr = (ulong *)data;
++
++	debug ("Disabling all the interrupts\n");
++	disable_interrupts();
++
++	debug ("   Uncompressing UBoot Image ... \n" );
++	/*
++	 * If we've got less than 4 MB of malloc() space,
++	 * use slower decompression algorithm which requires
++	 * at most 2300 KB of memory.
++	 */
++	destLen = 0x0;
++
++#ifdef CONFIG_BZIP2
++	i = BZ2_bzBuffToBuffDecompress ((char*)ntohl(hdr->ih_load),
++					0x400000, (char *)data, len,
++					CFG_MALLOC_LEN < (4096 * 1024), 0);
++	if (i != BZ_OK) {
++			printf ("BUNZIP2 ERROR %d - must RESET board to recover\n", i);
++			return;
++	}
++#elif CONFIG_MICROBZIP2
++	i = micro_bzBuffToBuffDecompress ((char*)ntohl(hdr->ih_load),
++					&destLen, (char *)data, len,
++					CFG_MALLOC_LEN < (4096 * 1024), 0);
++	if (i != RETVAL_OK) {
++		printf ("MICRO_BUNZIP2 ERROR %d - must RESET board to recover\n", i);
++		return;
++	}
++#elif CONFIG_LZMA
++	i = lzma_inflate ((char *)data, len, (char*)ntohl(hdr->ih_load), &destLen);
++	if (i != LZMA_RESULT_OK) {
++		printf ("LZMA ERROR %d - must RESET board to recover\n", i);
++		return;
++	}
++#else
++	printf ("NONE Compressing u-boot body!!\n");
++	memmove ((void *)ntohl(hdr->ih_load), (uchar *)data, len);
++	destLen = len;
++#endif
++	debug ("   Uncompression completed successfully with destLen %d.\n ",destLen );
++	debug ("Head: Jumping to u-boot in the ram at 0x%08lx\n", CFG_MONITOR_BASE);
++
++	jump_unconditional(CFG_MONITOR_BASE);
++}
++#else //CFG_HEAD_CODE
+ void board_init_r (gd_t *id, ulong dest_addr)
+ {
+ 	cmd_tbl_t *cmdtp;
+@@ -305,6 +441,8 @@
+ 	bd_t *bd;
+ 	int i;
+ 
++	puts("\n relocate code finish.\n");
++
+ 	gd = id;
+ 	gd->flags |= GD_FLG_RELOC;	/* tell others: relocation done */
+ 
+@@ -321,10 +459,10 @@
+ 		ulong addr;
+ 
+ 		addr = (ulong) (cmdtp->cmd) + gd->reloc_off;
+-#if 0
+-		printf ("Command \"%s\": 0x%08lx => 0x%08lx\n",
++
++		debug ("Command \"%s\": 0x%08lx => 0x%08lx\n",
+ 				cmdtp->name, (ulong) (cmdtp->cmd), addr);
+-#endif
++
+ 		cmdtp->cmd =
+ 			(int (*)(struct cmd_tbl_s *, int, int, char *[]))addr;
+ 
+@@ -424,6 +562,7 @@
+ 
+ 	/* NOTREACHED - no way out of command loop except booting */
+ }
++#endif //CFG_HEAD_CODE
+ 
+ void hang (void)
+ {
+diff -urN u-boot-1.1.5.a/lib_mips/head.h u-boot/lib_mips/head.h
+--- u-boot-1.1.5.a/lib_mips/head.h	1970-01-01 01:00:00.000000000 +0100
++++ u-boot/lib_mips/head.h	2007-03-09 09:47:46.000000000 +0000
+@@ -0,0 +1,3 @@
++
++//#define CFG_HEAD_LEN		0x00006000
++#define CFG_UBOOT_OFFSET	CFG_HEAD_LEN
+diff -urN u-boot-1.1.5.a/lib_mips/time.c u-boot/lib_mips/time.c
+--- u-boot-1.1.5.a/lib_mips/time.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/lib_mips/time.c	2007-03-09 09:47:46.000000000 +0000
+@@ -80,6 +80,17 @@
+ 		/*NOP*/;
+ }
+ 
++void mdelay (unsigned long msec)
++{
++       int i,j;
++       for(i=0;i<msec;i++)
++       {
++          udelay(1000);
++
++       }
++
++}
++
+ /*
+  * This function is derived from PowerPC code (read timebase as long long).
+  * On MIPS it just returns the timer value.
+Binary files u-boot-1.1.5.a/mkbootimg.incaip2 and u-boot/mkbootimg.incaip2 differ
+diff -urN u-boot-1.1.5.a/net/eth.c u-boot/net/eth.c
+--- u-boot-1.1.5.a/net/eth.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/net/eth.c	2008-05-11 12:58:45.000000000 +0100
+@@ -25,6 +25,9 @@
+ #include <command.h>
+ #include <net.h>
+ #include <miiphy.h>
++#if defined(CONFIG_IFX_MIPS)
++#       include "ifx_eth.c"
++#endif
+ 
+ #if (CONFIG_COMMANDS & CFG_CMD_NET) && defined(CONFIG_NET_MULTI)
+ 
+@@ -54,6 +57,9 @@
+ extern int skge_initialize(bd_t*);
+ extern int tsec_initialize(bd_t*, int, char *);
+ extern int npe_initialize(bd_t *);
++#if defined(CONFIG_IFX_MIPS)
++	IFX_ETH_INITIALIZE_EXTERN
++#endif
+ 
+ static struct eth_device *eth_devices, *eth_current;
+ 
+@@ -235,7 +241,9 @@
+ #if defined(CONFIG_RTL8169)
+ 	rtl8169_initialize(bis);
+ #endif
+-
++#if defined(CONFIG_IFX_MIPS)
++	IFX_ETH_INITIALIZE(bis)
++#endif
+ 	if (!eth_devices) {
+ 		puts ("No ethernet found.\n");
+ 	} else {
+Binary files u-boot-1.1.5.a/post/cache.o and u-boot/post/cache.o differ
+Binary files u-boot-1.1.5.a/post/cache_8xx.o and u-boot/post/cache_8xx.o differ
+Binary files u-boot-1.1.5.a/post/codec.o and u-boot/post/codec.o differ
+Binary files u-boot-1.1.5.a/post/cpu/andi.o and u-boot/post/cpu/andi.o differ
+Binary files u-boot-1.1.5.a/post/cpu/asm.o and u-boot/post/cpu/asm.o differ
+Binary files u-boot-1.1.5.a/post/cpu/b.o and u-boot/post/cpu/b.o differ
+Binary files u-boot-1.1.5.a/post/cpu/cmp.o and u-boot/post/cpu/cmp.o differ
+Binary files u-boot-1.1.5.a/post/cpu/cmpi.o and u-boot/post/cpu/cmpi.o differ
+Binary files u-boot-1.1.5.a/post/cpu/complex.o and u-boot/post/cpu/complex.o differ
+Binary files u-boot-1.1.5.a/post/cpu/cr.o and u-boot/post/cpu/cr.o differ
+Binary files u-boot-1.1.5.a/post/cpu/libcpu.a and u-boot/post/cpu/libcpu.a differ
+Binary files u-boot-1.1.5.a/post/cpu/load.o and u-boot/post/cpu/load.o differ
+Binary files u-boot-1.1.5.a/post/cpu/multi.o and u-boot/post/cpu/multi.o differ
+Binary files u-boot-1.1.5.a/post/cpu/rlwimi.o and u-boot/post/cpu/rlwimi.o differ
+Binary files u-boot-1.1.5.a/post/cpu/rlwinm.o and u-boot/post/cpu/rlwinm.o differ
+Binary files u-boot-1.1.5.a/post/cpu/rlwnm.o and u-boot/post/cpu/rlwnm.o differ
+Binary files u-boot-1.1.5.a/post/cpu/srawi.o and u-boot/post/cpu/srawi.o differ
+Binary files u-boot-1.1.5.a/post/cpu/store.o and u-boot/post/cpu/store.o differ
+Binary files u-boot-1.1.5.a/post/cpu/string.o and u-boot/post/cpu/string.o differ
+Binary files u-boot-1.1.5.a/post/cpu/three.o and u-boot/post/cpu/three.o differ
+Binary files u-boot-1.1.5.a/post/cpu/threei.o and u-boot/post/cpu/threei.o differ
+Binary files u-boot-1.1.5.a/post/cpu/threex.o and u-boot/post/cpu/threex.o differ
+Binary files u-boot-1.1.5.a/post/cpu/two.o and u-boot/post/cpu/two.o differ
+Binary files u-boot-1.1.5.a/post/cpu/twox.o and u-boot/post/cpu/twox.o differ
+Binary files u-boot-1.1.5.a/post/cpu.o and u-boot/post/cpu.o differ
+Binary files u-boot-1.1.5.a/post/dsp.o and u-boot/post/dsp.o differ
+Binary files u-boot-1.1.5.a/post/ether.o and u-boot/post/ether.o differ
+Binary files u-boot-1.1.5.a/post/i2c.o and u-boot/post/i2c.o differ
+Binary files u-boot-1.1.5.a/post/libpost.a and u-boot/post/libpost.a differ
+Binary files u-boot-1.1.5.a/post/memory.o and u-boot/post/memory.o differ
+Binary files u-boot-1.1.5.a/post/post.o and u-boot/post/post.o differ
+Binary files u-boot-1.1.5.a/post/rtc.o and u-boot/post/rtc.o differ
+Binary files u-boot-1.1.5.a/post/spr.o and u-boot/post/spr.o differ
+Binary files u-boot-1.1.5.a/post/sysmon.o and u-boot/post/sysmon.o differ
+Binary files u-boot-1.1.5.a/post/tests.o and u-boot/post/tests.o differ
+Binary files u-boot-1.1.5.a/post/uart.o and u-boot/post/uart.o differ
+Binary files u-boot-1.1.5.a/post/usb.o and u-boot/post/usb.o differ
+Binary files u-boot-1.1.5.a/post/watchdog.o and u-boot/post/watchdog.o differ
+diff -urN u-boot-1.1.5.a/tools/Makefile u-boot/tools/Makefile
+--- u-boot-1.1.5.a/tools/Makefile	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/tools/Makefile	2007-03-09 09:47:46.000000000 +0000
+@@ -23,7 +23,7 @@
+ 
+ BIN_FILES	= img2srec$(SFX) mkimage$(SFX) envcrc$(SFX) gen_eth_addr$(SFX) bmp_logo$(SFX)
+ 
+-OBJ_LINKS	= environment.o crc32.o
++OBJ_LINKS	= environment_$(BOARDDIR).o crc32_$(BOARDDIR).o
+ OBJ_FILES	= img2srec.o mkimage.o envcrc.o gen_eth_addr.o bmp_logo.o
+ 
+ ifeq ($(ARCH),mips)
+@@ -117,7 +117,7 @@
+ CPPFLAGS   = -idirafter $(SRCTREE)/include \
+ 		-idirafter $(OBJTREE)/include2 \
+ 		-idirafter $(OBJTREE)/include \
+-		-DTEXT_BASE=$(TEXT_BASE) -DUSE_HOSTCC
++		-DTEXT_BASE=$(TEXT_BASE) -DUSE_HOSTCC $(IFX_CFLAGS)
+ CFLAGS     = $(HOST_CFLAGS) $(CPPFLAGS) -O
+ AFLAGS	   = -D__ASSEMBLY__ $(CPPFLAGS)
+ CC	   = $(HOSTCC)
+@@ -126,14 +126,14 @@
+ 
+ all:	$(obj).depend $(BINS) $(LOGO_H) subdirs
+ 
+-$(obj)envcrc$(SFX):	$(obj)envcrc.o $(obj)crc32.o $(obj)environment.o
++$(obj)envcrc$(SFX):	$(obj)envcrc.o $(obj)crc32_$(BOARDDIR).o $(obj)environment_$(BOARDDIR).o
+ 		$(CC) $(CFLAGS) -o $@ $^
+ 
+ $(obj)img2srec$(SFX):	$(obj)img2srec.o
+ 		$(CC) $(CFLAGS) $(HOST_LDFLAGS) -o $@ $^
+ 		$(STRIP) $@
+ 
+-$(obj)mkimage$(SFX):	$(obj)mkimage.o $(obj)crc32.o
++$(obj)mkimage$(SFX):	$(obj)mkimage.o $(obj)crc32_$(BOARDDIR).o
+ 		$(CC) $(CFLAGS) $(HOST_LDFLAGS) -o $@ $^
+ 		$(STRIP) $@
+ 
+@@ -160,7 +160,7 @@
+ $(obj)envcrc.o:	$(src)envcrc.c
+ 		$(CC) -g $(CFLAGS) -c -o $@ $<
+ 
+-$(obj)crc32.o:	$(obj)crc32.c
++$(obj)crc32_$(BOARDDIR).o:	$(obj)crc32_$(BOARDDIR).c
+ 		$(CC) -g $(CFLAGS) -c -o $@ $<
+ 
+ $(obj)mkimage.o:	$(src)mkimage.c
+@@ -192,16 +192,16 @@
+ 		done
+ endif
+ 
+-$(obj)environment.c:
+-		@rm -f $(obj)environment.c
+-		ln -s $(src)../common/environment.c $(obj)environment.c
++$(obj)environment_$(BOARDDIR).c:
++		@rm -f $(obj)environment_$(BOARDDIR).c
++		ln -s $(src)../common/environment_$(BOARDDIR).c $(obj)environment_$(BOARDDIR).c
+ 
+-$(obj)environment.o:	$(obj)environment.c
++$(obj)environment_$(BOARDDIR).o:	$(obj)environment_$(BOARDDIR).c
+ 		$(CC) -g $(HOST_ENVIRO_CFLAGS) $(CPPFLAGS) -c -o $@ $<
+ 
+-$(obj)crc32.c:
+-		@rm -f $(obj)crc32.c
+-		ln -s $(src)../lib_generic/crc32.c $(obj)crc32.c
++$(obj)crc32_$(BOARDDIR).c:
++		@rm -f $(obj)crc32_$(BOARDDIR).c
++		ln -s $(src)../lib_generic/crc32_$(BOARDDIR).c $(obj)crc32_$(BOARDDIR).c
+ 
+ $(LOGO_H):	$(obj)bmp_logo $(LOGO_BMP)
+ 		$(obj)./bmp_logo $(LOGO_BMP) >$@
+Binary files u-boot-1.1.5.a/tools/bmp_logo and u-boot/tools/bmp_logo differ
+Binary files u-boot-1.1.5.a/tools/bmp_logo.o and u-boot/tools/bmp_logo.o differ
+Binary files u-boot-1.1.5.a/tools/crc32_danube.o and u-boot/tools/crc32_danube.o differ
+Binary files u-boot-1.1.5.a/tools/envcrc and u-boot/tools/envcrc differ
+Binary files u-boot-1.1.5.a/tools/envcrc.o and u-boot/tools/envcrc.o differ
+Binary files u-boot-1.1.5.a/tools/environment_danube.o and u-boot/tools/environment_danube.o differ
+Binary files u-boot-1.1.5.a/tools/gen_eth_addr and u-boot/tools/gen_eth_addr differ
+Binary files u-boot-1.1.5.a/tools/gen_eth_addr.o and u-boot/tools/gen_eth_addr.o differ
+Binary files u-boot-1.1.5.a/tools/img2srec and u-boot/tools/img2srec differ
+Binary files u-boot-1.1.5.a/tools/img2srec.o and u-boot/tools/img2srec.o differ
+Binary files u-boot-1.1.5.a/tools/inca-swap-bytes and u-boot/tools/inca-swap-bytes differ
+Binary files u-boot-1.1.5.a/tools/inca-swap-bytes.o and u-boot/tools/inca-swap-bytes.o differ
+Binary files u-boot-1.1.5.a/tools/mkimage and u-boot/tools/mkimage differ
+diff -urN u-boot-1.1.5.a/tools/mkimage.c u-boot/tools/mkimage.c
+--- u-boot-1.1.5.a/tools/mkimage.c	2006-10-20 16:54:33.000000000 +0100
++++ u-boot/tools/mkimage.c	2007-03-09 09:47:46.000000000 +0000
+@@ -138,6 +138,7 @@
+     {	IH_COMP_NONE,	"none",		"uncompressed",		},
+     {	IH_COMP_BZIP2,	"bzip2",	"bzip2 compressed",	},
+     {	IH_COMP_GZIP,	"gzip",		"gzip compressed",	},
++    {	IH_COMP_LZMA,	"lzma",		"lzma compressed",	},
+     {	-1,		"",		"",			},
+ };
+ 
+Binary files u-boot-1.1.5.a/tools/mkimage.o and u-boot/tools/mkimage.o differ